diff options
author | 2022-04-03 16:34:10 -0700 | |
---|---|---|
committer | 2022-04-03 16:34:10 -0700 | |
commit | a87508008dfa1604baf2d4e39bf44704c00f261c (patch) | |
tree | 0be2ade96772037a02803b30e157c367d931e3d9 /src/deps/skia/include/core | |
parent | 4a19a3f07f1887903e5638a3be167f0c7b377ba3 (diff) | |
download | bun-jarred/canvas.tar.gz bun-jarred/canvas.tar.zst bun-jarred/canvas.zip |
skia WIPjarred/canvas
Diffstat (limited to 'src/deps/skia/include/core')
93 files changed, 27997 insertions, 0 deletions
diff --git a/src/deps/skia/include/core/BUILD.bazel b/src/deps/skia/include/core/BUILD.bazel new file mode 100644 index 000000000..9b32d5a6e --- /dev/null +++ b/src/deps/skia/include/core/BUILD.bazel @@ -0,0 +1,951 @@ +load("//bazel:macros.bzl", "generated_cc_atom") + +generated_cc_atom( + name = "SkAnnotation_hdr", + hdrs = ["SkAnnotation.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkBBHFactory_hdr", + hdrs = ["SkBBHFactory.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkRect_hdr", + ":SkRefCnt_hdr", + ":SkTypes_hdr", + ], +) + +generated_cc_atom( + name = "SkBitmap_hdr", + hdrs = ["SkBitmap.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkColor_hdr", + ":SkImageInfo_hdr", + ":SkMatrix_hdr", + ":SkPixmap_hdr", + ":SkPoint_hdr", + ":SkRefCnt_hdr", + ":SkShader_hdr", + ":SkTileMode_hdr", + ], +) + +generated_cc_atom( + name = "SkBlendMode_hdr", + hdrs = ["SkBlendMode.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkBlender_hdr", + hdrs = ["SkBlender.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkBlendMode_hdr", + ":SkFlattenable_hdr", + ], +) + +generated_cc_atom( + name = "SkBlurTypes_hdr", + hdrs = ["SkBlurTypes.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkCanvasVirtualEnforcer_hdr", + hdrs = ["SkCanvasVirtualEnforcer.h"], + visibility = ["//:__subpackages__"], + deps = [":SkCanvas_hdr"], +) + +generated_cc_atom( + name = "SkCanvas_hdr", + hdrs = ["SkCanvas.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkBlendMode_hdr", + ":SkClipOp_hdr", + ":SkColor_hdr", + ":SkFontTypes_hdr", + ":SkImageInfo_hdr", + ":SkM44_hdr", + ":SkMatrix_hdr", + ":SkPaint_hdr", + ":SkPoint_hdr", + ":SkRasterHandleAllocator_hdr", + ":SkRect_hdr", + ":SkRefCnt_hdr", + ":SkSamplingOptions_hdr", + ":SkScalar_hdr", + ":SkSize_hdr", + ":SkString_hdr", + ":SkSurfaceProps_hdr", + ":SkTypes_hdr", + "//include/private:SkDeque_hdr", + "//include/private:SkMacros_hdr", + ], +) + +generated_cc_atom( + name = "SkClipOp_hdr", + hdrs = ["SkClipOp.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkColorFilter_hdr", + hdrs = ["SkColorFilter.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkBlendMode_hdr", + ":SkColor_hdr", + ":SkFlattenable_hdr", + ], +) + +generated_cc_atom( + name = "SkColorPriv_hdr", + hdrs = ["SkColorPriv.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkColor_hdr", + ":SkMath_hdr", + "//include/private:SkTPin_hdr", + "//include/private:SkTo_hdr", + ], +) + +generated_cc_atom( + name = "SkColorSpace_hdr", + hdrs = ["SkColorSpace.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkRefCnt_hdr", + "//include/private:SkFixed_hdr", + "//include/private:SkOnce_hdr", + "//include/third_party/skcms:skcms_hdr", + ], +) + +generated_cc_atom( + name = "SkColor_hdr", + hdrs = ["SkColor.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkImageInfo_hdr", + ":SkScalar_hdr", + ":SkTypes_hdr", + ], +) + +generated_cc_atom( + name = "SkContourMeasure_hdr", + hdrs = ["SkContourMeasure.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkPath_hdr", + ":SkRefCnt_hdr", + "//include/private:SkTDArray_hdr", + ], +) + +generated_cc_atom( + name = "SkCoverageMode_hdr", + hdrs = ["SkCoverageMode.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkCubicMap_hdr", + hdrs = ["SkCubicMap.h"], + visibility = ["//:__subpackages__"], + deps = [":SkPoint_hdr"], +) + +generated_cc_atom( + name = "SkDataTable_hdr", + hdrs = ["SkDataTable.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkData_hdr", + "//include/private:SkTDArray_hdr", + ], +) + +generated_cc_atom( + name = "SkData_hdr", + hdrs = ["SkData.h"], + visibility = ["//:__subpackages__"], + deps = [":SkRefCnt_hdr"], +) + +generated_cc_atom( + name = "SkDeferredDisplayListRecorder_hdr", + hdrs = ["SkDeferredDisplayListRecorder.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkDeferredDisplayList_hdr", + ":SkImageInfo_hdr", + ":SkImage_hdr", + ":SkRefCnt_hdr", + ":SkSurfaceCharacterization_hdr", + ":SkTypes_hdr", + ], +) + +generated_cc_atom( + name = "SkDeferredDisplayList_hdr", + hdrs = ["SkDeferredDisplayList.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkRefCnt_hdr", + ":SkSurfaceCharacterization_hdr", + ":SkTypes_hdr", + "//include/gpu:GrRecordingContext_hdr", + "//include/private:SkTArray_hdr", + ], +) + +generated_cc_atom( + name = "SkDocument_hdr", + hdrs = ["SkDocument.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkRefCnt_hdr", + ":SkScalar_hdr", + ], +) + +generated_cc_atom( + name = "SkDrawLooper_hdr", + hdrs = ["SkDrawLooper.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkBlurTypes_hdr", + ":SkColor_hdr", + ":SkFlattenable_hdr", + ":SkPoint_hdr", + ], +) + +generated_cc_atom( + name = "SkDrawable_hdr", + hdrs = ["SkDrawable.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkFlattenable_hdr", + ":SkImageInfo_hdr", + ":SkScalar_hdr", + ], +) + +generated_cc_atom( + name = "SkEncodedImageFormat_hdr", + hdrs = ["SkEncodedImageFormat.h"], + visibility = ["//:__subpackages__"], +) + +generated_cc_atom( + name = "SkExecutor_hdr", + hdrs = ["SkExecutor.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkFlattenable_hdr", + hdrs = ["SkFlattenable.h"], + visibility = ["//:__subpackages__"], + deps = [":SkRefCnt_hdr"], +) + +generated_cc_atom( + name = "SkFontArguments_hdr", + hdrs = ["SkFontArguments.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkScalar_hdr", + ":SkTypes_hdr", + ], +) + +generated_cc_atom( + name = "SkFontMetrics_hdr", + hdrs = ["SkFontMetrics.h"], + visibility = ["//:__subpackages__"], + deps = [":SkScalar_hdr"], +) + +generated_cc_atom( + name = "SkFontMgr_hdr", + hdrs = ["SkFontMgr.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkFontArguments_hdr", + ":SkFontStyle_hdr", + ":SkRefCnt_hdr", + ":SkTypes_hdr", + ], +) + +generated_cc_atom( + name = "SkFontParameters_hdr", + hdrs = ["SkFontParameters.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkScalar_hdr", + ":SkTypes_hdr", + ], +) + +generated_cc_atom( + name = "SkFontStyle_hdr", + hdrs = ["SkFontStyle.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkTypes_hdr", + "//include/private:SkTPin_hdr", + ], +) + +generated_cc_atom( + name = "SkFontTypes_hdr", + hdrs = ["SkFontTypes.h"], + visibility = ["//:__subpackages__"], +) + +generated_cc_atom( + name = "SkFont_hdr", + hdrs = ["SkFont.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkFontTypes_hdr", + ":SkScalar_hdr", + ":SkTypeface_hdr", + ], +) + +generated_cc_atom( + name = "SkGraphics_hdr", + hdrs = ["SkGraphics.h"], + visibility = ["//:__subpackages__"], + deps = [":SkRefCnt_hdr"], +) + +generated_cc_atom( + name = "SkICC_hdr", + hdrs = ["SkICC.h"], + visibility = ["//:__subpackages__"], + deps = [":SkData_hdr"], +) + +generated_cc_atom( + name = "SkImageEncoder_hdr", + hdrs = ["SkImageEncoder.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkBitmap_hdr", + ":SkData_hdr", + ":SkEncodedImageFormat_hdr", + ":SkPixmap_hdr", + ":SkStream_hdr", + ], +) + +generated_cc_atom( + name = "SkImageFilter_hdr", + hdrs = ["SkImageFilter.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkFlattenable_hdr", + ":SkMatrix_hdr", + ":SkRect_hdr", + ], +) + +generated_cc_atom( + name = "SkImageGenerator_hdr", + hdrs = ["SkImageGenerator.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkBitmap_hdr", + ":SkColor_hdr", + ":SkImageInfo_hdr", + ":SkImage_hdr", + ":SkYUVAPixmaps_hdr", + "//include/private:SkTOptional_hdr", + ], +) + +generated_cc_atom( + name = "SkImageInfo_hdr", + hdrs = ["SkImageInfo.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkColorSpace_hdr", + ":SkMath_hdr", + ":SkRect_hdr", + ":SkSize_hdr", + "//include/private:SkTFitsIn_hdr", + "//include/private:SkTo_hdr", + ], +) + +generated_cc_atom( + name = "SkImage_hdr", + hdrs = ["SkImage.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkImageEncoder_hdr", + ":SkImageInfo_hdr", + ":SkRefCnt_hdr", + ":SkSamplingOptions_hdr", + ":SkScalar_hdr", + ":SkShader_hdr", + ":SkTileMode_hdr", + "//include/gpu:GrTypes_hdr", + "//include/private:SkTOptional_hdr", + ], +) + +generated_cc_atom( + name = "SkM44_hdr", + hdrs = ["SkM44.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkMatrix_hdr", + ":SkRect_hdr", + ":SkScalar_hdr", + ], +) + +generated_cc_atom( + name = "SkMallocPixelRef_hdr", + hdrs = ["SkMallocPixelRef.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkPixelRef_hdr", + ":SkRefCnt_hdr", + ":SkTypes_hdr", + ], +) + +generated_cc_atom( + name = "SkMaskFilter_hdr", + hdrs = ["SkMaskFilter.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkBlurTypes_hdr", + ":SkCoverageMode_hdr", + ":SkFlattenable_hdr", + ":SkScalar_hdr", + ], +) + +generated_cc_atom( + name = "SkMath_hdr", + hdrs = ["SkMath.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkMatrix_hdr", + hdrs = ["SkMatrix.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkRect_hdr", + "//include/private:SkMacros_hdr", + "//include/private:SkTo_hdr", + ], +) + +generated_cc_atom( + name = "SkMilestone_hdr", + hdrs = ["SkMilestone.h"], + visibility = ["//:__subpackages__"], +) + +generated_cc_atom( + name = "SkOverdrawCanvas_hdr", + hdrs = ["SkOverdrawCanvas.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkCanvasVirtualEnforcer_hdr", + "//include/utils:SkNWayCanvas_hdr", + ], +) + +generated_cc_atom( + name = "SkPaint_hdr", + hdrs = ["SkPaint.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkBlendMode_hdr", + ":SkColor_hdr", + ":SkRefCnt_hdr", + "//include/private:SkTOptional_hdr", + "//include/private:SkTo_hdr", + ], +) + +generated_cc_atom( + name = "SkPathBuilder_hdr", + hdrs = ["SkPathBuilder.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkMatrix_hdr", + ":SkPathTypes_hdr", + ":SkPath_hdr", + "//include/private:SkTDArray_hdr", + ], +) + +generated_cc_atom( + name = "SkPathEffect_hdr", + hdrs = ["SkPathEffect.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkFlattenable_hdr", + ":SkPath_hdr", + ":SkScalar_hdr", + ], +) + +generated_cc_atom( + name = "SkPathMeasure_hdr", + hdrs = ["SkPathMeasure.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkContourMeasure_hdr", + ":SkPath_hdr", + "//include/private:SkTDArray_hdr", + ], +) + +generated_cc_atom( + name = "SkPathTypes_hdr", + hdrs = ["SkPathTypes.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkPath_hdr", + hdrs = ["SkPath.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkMatrix_hdr", + ":SkPathTypes_hdr", + "//include/private:SkPathRef_hdr", + "//include/private:SkTo_hdr", + ], +) + +generated_cc_atom( + name = "SkPictureRecorder_hdr", + hdrs = ["SkPictureRecorder.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkBBHFactory_hdr", + ":SkPicture_hdr", + ":SkRefCnt_hdr", + ], +) + +generated_cc_atom( + name = "SkPicture_hdr", + hdrs = ["SkPicture.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkRect_hdr", + ":SkRefCnt_hdr", + ":SkSamplingOptions_hdr", + ":SkShader_hdr", + ":SkTileMode_hdr", + ":SkTypes_hdr", + ], +) + +generated_cc_atom( + name = "SkPixelRef_hdr", + hdrs = ["SkPixelRef.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkBitmap_hdr", + ":SkImageInfo_hdr", + ":SkPixmap_hdr", + ":SkRefCnt_hdr", + ":SkSize_hdr", + "//include/private:SkIDChangeListener_hdr", + "//include/private:SkMutex_hdr", + "//include/private:SkTDArray_hdr", + ], +) + +generated_cc_atom( + name = "SkPixmap_hdr", + hdrs = ["SkPixmap.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkColor_hdr", + ":SkImageInfo_hdr", + ":SkSamplingOptions_hdr", + ], +) + +generated_cc_atom( + name = "SkPngChunkReader_hdr", + hdrs = ["SkPngChunkReader.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkRefCnt_hdr", + ":SkTypes_hdr", + ], +) + +generated_cc_atom( + name = "SkPoint3_hdr", + hdrs = ["SkPoint3.h"], + visibility = ["//:__subpackages__"], + deps = [":SkPoint_hdr"], +) + +generated_cc_atom( + name = "SkPoint_hdr", + hdrs = ["SkPoint.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkMath_hdr", + ":SkScalar_hdr", + "//include/private:SkSafe32_hdr", + ], +) + +generated_cc_atom( + name = "SkPromiseImageTexture_hdr", + hdrs = ["SkPromiseImageTexture.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkRefCnt_hdr", + ":SkTypes_hdr", + "//include/gpu:GrBackendSurface_hdr", + ], +) + +generated_cc_atom( + name = "SkRRect_hdr", + hdrs = ["SkRRect.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkPoint_hdr", + ":SkRect_hdr", + ], +) + +generated_cc_atom( + name = "SkRSXform_hdr", + hdrs = ["SkRSXform.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkPoint_hdr", + ":SkSize_hdr", + ], +) + +generated_cc_atom( + name = "SkRasterHandleAllocator_hdr", + hdrs = ["SkRasterHandleAllocator.h"], + visibility = ["//:__subpackages__"], + deps = [":SkImageInfo_hdr"], +) + +generated_cc_atom( + name = "SkRect_hdr", + hdrs = ["SkRect.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkPoint_hdr", + ":SkSize_hdr", + "//include/private:SkSafe32_hdr", + "//include/private:SkTFitsIn_hdr", + ], +) + +generated_cc_atom( + name = "SkRefCnt_hdr", + hdrs = ["SkRefCnt.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkRegion_hdr", + hdrs = ["SkRegion.h"], + visibility = ["//:__subpackages__"], + deps = [":SkRect_hdr"], +) + +generated_cc_atom( + name = "SkSamplingOptions_hdr", + hdrs = ["SkSamplingOptions.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkScalar_hdr", + hdrs = ["SkScalar.h"], + visibility = ["//:__subpackages__"], + deps = ["//include/private:SkFloatingPoint_hdr"], +) + +generated_cc_atom( + name = "SkSerialProcs_hdr", + hdrs = ["SkSerialProcs.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkImage_hdr", + ":SkPicture_hdr", + ":SkTypeface_hdr", + ], +) + +generated_cc_atom( + name = "SkShader_hdr", + hdrs = ["SkShader.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkBlendMode_hdr", + ":SkColor_hdr", + ":SkFlattenable_hdr", + ":SkImageInfo_hdr", + ":SkMatrix_hdr", + ":SkTileMode_hdr", + ], +) + +generated_cc_atom( + name = "SkSize_hdr", + hdrs = ["SkSize.h"], + visibility = ["//:__subpackages__"], + deps = [":SkScalar_hdr"], +) + +generated_cc_atom( + name = "SkSpan_hdr", + hdrs = ["SkSpan.h"], + visibility = ["//:__subpackages__"], + deps = ["//include/private:SkTLogic_hdr"], +) + +generated_cc_atom( + name = "SkStream_hdr", + hdrs = ["SkStream.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkData_hdr", + ":SkRefCnt_hdr", + ":SkScalar_hdr", + "//include/private:SkTo_hdr", + ], +) + +generated_cc_atom( + name = "SkStringView_hdr", + hdrs = ["SkStringView.h"], + visibility = ["//:__subpackages__"], +) + +generated_cc_atom( + name = "SkString_hdr", + hdrs = ["SkString.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkRefCnt_hdr", + ":SkScalar_hdr", + ":SkTypes_hdr", + "//include/private:SkMalloc_hdr", + "//include/private:SkTArray_hdr", + "//include/private:SkTo_hdr", + ], +) + +generated_cc_atom( + name = "SkStrokeRec_hdr", + hdrs = ["SkStrokeRec.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkPaint_hdr", + "//include/private:SkMacros_hdr", + ], +) + +generated_cc_atom( + name = "SkSurfaceCharacterization_hdr", + hdrs = ["SkSurfaceCharacterization.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkColorSpace_hdr", + ":SkImageInfo_hdr", + ":SkRefCnt_hdr", + ":SkSurfaceProps_hdr", + "//include/gpu:GrBackendSurface_hdr", + "//include/gpu:GrContextThreadSafeProxy_hdr", + "//include/gpu:GrTypes_hdr", + ], +) + +generated_cc_atom( + name = "SkSurfaceProps_hdr", + hdrs = ["SkSurfaceProps.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkSurface_hdr", + hdrs = ["SkSurface.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkImage_hdr", + ":SkPixmap_hdr", + ":SkRefCnt_hdr", + ":SkSurfaceProps_hdr", + "//include/gpu:GrTypes_hdr", + "//include/gpu/mtl:GrMtlTypes_hdr", + ], +) + +generated_cc_atom( + name = "SkSwizzle_hdr", + hdrs = ["SkSwizzle.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkTextBlob_hdr", + hdrs = ["SkTextBlob.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkFont_hdr", + ":SkPaint_hdr", + ":SkRefCnt_hdr", + ":SkString_hdr", + "//include/private:SkTemplates_hdr", + ], +) + +generated_cc_atom( + name = "SkTileMode_hdr", + hdrs = ["SkTileMode.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkTime_hdr", + hdrs = ["SkTime.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkTypes_hdr", + "//include/private:SkMacros_hdr", + ], +) + +generated_cc_atom( + name = "SkTraceMemoryDump_hdr", + hdrs = ["SkTraceMemoryDump.h"], + visibility = ["//:__subpackages__"], + deps = [":SkTypes_hdr"], +) + +generated_cc_atom( + name = "SkTypeface_hdr", + hdrs = ["SkTypeface.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkFontArguments_hdr", + ":SkFontParameters_hdr", + ":SkFontStyle_hdr", + ":SkFontTypes_hdr", + ":SkRect_hdr", + ":SkString_hdr", + "//include/private:SkOnce_hdr", + "//include/private:SkWeakRefCnt_hdr", + ], +) + +generated_cc_atom( + name = "SkTypes_hdr", + hdrs = ["SkTypes.h"], + visibility = ["//:__subpackages__"], + deps = ["//include/config:SkUserConfig_hdr"], +) + +generated_cc_atom( + name = "SkUnPreMultiply_hdr", + hdrs = ["SkUnPreMultiply.h"], + visibility = ["//:__subpackages__"], + deps = [":SkColor_hdr"], +) + +generated_cc_atom( + name = "SkVertices_hdr", + hdrs = ["SkVertices.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkColor_hdr", + ":SkRect_hdr", + ":SkRefCnt_hdr", + ], +) + +generated_cc_atom( + name = "SkYUVAInfo_hdr", + hdrs = ["SkYUVAInfo.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkImageInfo_hdr", + ":SkSize_hdr", + "//include/codec:SkEncodedOrigin_hdr", + ], +) + +generated_cc_atom( + name = "SkYUVAPixmaps_hdr", + hdrs = ["SkYUVAPixmaps.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkData_hdr", + ":SkImageInfo_hdr", + ":SkPixmap_hdr", + ":SkYUVAInfo_hdr", + "//include/private:SkTo_hdr", + ], +) + +generated_cc_atom( + name = "SkCustomMesh_hdr", + hdrs = ["SkCustomMesh.h"], + visibility = ["//:__subpackages__"], + deps = [ + ":SkColorSpace_hdr", + ":SkImageInfo_hdr", + ":SkRect_hdr", + ":SkRefCnt_hdr", + ":SkSpan_hdr", + ":SkString_hdr", + ":SkTypes_hdr", + ], +) diff --git a/src/deps/skia/include/core/SkAnnotation.h b/src/deps/skia/include/core/SkAnnotation.h new file mode 100644 index 000000000..9048bb6b6 --- /dev/null +++ b/src/deps/skia/include/core/SkAnnotation.h @@ -0,0 +1,50 @@ +/* + * Copyright 2012 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkAnnotation_DEFINED +#define SkAnnotation_DEFINED + +#include "include/core/SkTypes.h" + +class SkData; +struct SkPoint; +struct SkRect; +class SkCanvas; + +/** + * Annotate the canvas by associating the specified URL with the + * specified rectangle (in local coordinates, just like drawRect). + * + * If the backend of this canvas does not support annotations, this call is + * safely ignored. + * + * The caller is responsible for managing its ownership of the SkData. + */ +SK_API void SkAnnotateRectWithURL(SkCanvas*, const SkRect&, SkData*); + +/** + * Annotate the canvas by associating a name with the specified point. + * + * If the backend of this canvas does not support annotations, this call is + * safely ignored. + * + * The caller is responsible for managing its ownership of the SkData. + */ +SK_API void SkAnnotateNamedDestination(SkCanvas*, const SkPoint&, SkData*); + +/** + * Annotate the canvas by making the specified rectangle link to a named + * destination. + * + * If the backend of this canvas does not support annotations, this call is + * safely ignored. + * + * The caller is responsible for managing its ownership of the SkData. + */ +SK_API void SkAnnotateLinkToDestination(SkCanvas*, const SkRect&, SkData*); + +#endif diff --git a/src/deps/skia/include/core/SkBBHFactory.h b/src/deps/skia/include/core/SkBBHFactory.h new file mode 100644 index 000000000..2507d0f15 --- /dev/null +++ b/src/deps/skia/include/core/SkBBHFactory.h @@ -0,0 +1,63 @@ +/* + * Copyright 2014 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkBBHFactory_DEFINED +#define SkBBHFactory_DEFINED + +#include "include/core/SkRect.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkTypes.h" +#include <vector> + +class SkBBoxHierarchy : public SkRefCnt { +public: + struct Metadata { + bool isDraw; // The corresponding SkRect bounds a draw command, not a pure state change. + }; + + /** + * Insert N bounding boxes into the hierarchy. + */ + virtual void insert(const SkRect[], int N) = 0; + virtual void insert(const SkRect[], const Metadata[], int N); + + /** + * Populate results with the indices of bounding boxes intersecting that query. + */ + virtual void search(const SkRect& query, std::vector<int>* results) const = 0; + + /** + * Return approximate size in memory of *this. + */ + virtual size_t bytesUsed() const = 0; + +protected: + SkBBoxHierarchy() = default; + SkBBoxHierarchy(const SkBBoxHierarchy&) = delete; + SkBBoxHierarchy& operator=(const SkBBoxHierarchy&) = delete; +}; + +class SK_API SkBBHFactory { +public: + /** + * Allocate a new SkBBoxHierarchy. Return NULL on failure. + */ + virtual sk_sp<SkBBoxHierarchy> operator()() const = 0; + virtual ~SkBBHFactory() {} + +protected: + SkBBHFactory() = default; + SkBBHFactory(const SkBBHFactory&) = delete; + SkBBHFactory& operator=(const SkBBHFactory&) = delete; +}; + +class SK_API SkRTreeFactory : public SkBBHFactory { +public: + sk_sp<SkBBoxHierarchy> operator()() const override; +}; + +#endif diff --git a/src/deps/skia/include/core/SkBitmap.h b/src/deps/skia/include/core/SkBitmap.h new file mode 100644 index 000000000..088280fbe --- /dev/null +++ b/src/deps/skia/include/core/SkBitmap.h @@ -0,0 +1,1212 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkBitmap_DEFINED +#define SkBitmap_DEFINED + +#include "include/core/SkColor.h" +#include "include/core/SkImageInfo.h" +#include "include/core/SkMatrix.h" +#include "include/core/SkPixmap.h" +#include "include/core/SkPoint.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkShader.h" +#include "include/core/SkTileMode.h" + +class SkBitmap; +struct SkMask; +class SkMipmap; +struct SkIRect; +struct SkRect; +class SkPaint; +class SkPixelRef; +class SkShader; + +/** \class SkBitmap + SkBitmap describes a two-dimensional raster pixel array. SkBitmap is built on + SkImageInfo, containing integer width and height, SkColorType and SkAlphaType + describing the pixel format, and SkColorSpace describing the range of colors. + SkBitmap points to SkPixelRef, which describes the physical array of pixels. + SkImageInfo bounds may be located anywhere fully inside SkPixelRef bounds. + + SkBitmap can be drawn using SkCanvas. SkBitmap can be a drawing destination for SkCanvas + draw member functions. SkBitmap flexibility as a pixel container limits some + optimizations available to the target platform. + + If pixel array is primarily read-only, use SkImage for better performance. + If pixel array is primarily written to, use SkSurface for better performance. + + Declaring SkBitmap const prevents altering SkImageInfo: the SkBitmap height, width, + and so on cannot change. It does not affect SkPixelRef: a caller may write its + pixels. Declaring SkBitmap const affects SkBitmap configuration, not its contents. + + SkBitmap is not thread safe. Each thread must have its own copy of SkBitmap fields, + although threads may share the underlying pixel array. +*/ +class SK_API SkBitmap { +public: + class SK_API Allocator; + + /** Creates an empty SkBitmap without pixels, with kUnknown_SkColorType, + kUnknown_SkAlphaType, and with a width and height of zero. SkPixelRef origin is + set to (0, 0). + + Use setInfo() to associate SkColorType, SkAlphaType, width, and height + after SkBitmap has been created. + + @return empty SkBitmap + + example: https://fiddle.skia.org/c/@Bitmap_empty_constructor + */ + SkBitmap(); + + /** Copies settings from src to returned SkBitmap. Shares pixels if src has pixels + allocated, so both bitmaps reference the same pixels. + + @param src SkBitmap to copy SkImageInfo, and share SkPixelRef + @return copy of src + + example: https://fiddle.skia.org/c/@Bitmap_copy_const_SkBitmap + */ + SkBitmap(const SkBitmap& src); + + /** Copies settings from src to returned SkBitmap. Moves ownership of src pixels to + SkBitmap. + + @param src SkBitmap to copy SkImageInfo, and reassign SkPixelRef + @return copy of src + + example: https://fiddle.skia.org/c/@Bitmap_move_SkBitmap + */ + SkBitmap(SkBitmap&& src); + + /** Decrements SkPixelRef reference count, if SkPixelRef is not nullptr. + */ + ~SkBitmap(); + + /** Copies settings from src to returned SkBitmap. Shares pixels if src has pixels + allocated, so both bitmaps reference the same pixels. + + @param src SkBitmap to copy SkImageInfo, and share SkPixelRef + @return copy of src + + example: https://fiddle.skia.org/c/@Bitmap_copy_operator + */ + SkBitmap& operator=(const SkBitmap& src); + + /** Copies settings from src to returned SkBitmap. Moves ownership of src pixels to + SkBitmap. + + @param src SkBitmap to copy SkImageInfo, and reassign SkPixelRef + @return copy of src + + example: https://fiddle.skia.org/c/@Bitmap_move_operator + */ + SkBitmap& operator=(SkBitmap&& src); + + /** Swaps the fields of the two bitmaps. + + @param other SkBitmap exchanged with original + + example: https://fiddle.skia.org/c/@Bitmap_swap + */ + void swap(SkBitmap& other); + + /** Returns a constant reference to the SkPixmap holding the SkBitmap pixel + address, row bytes, and SkImageInfo. + + @return reference to SkPixmap describing this SkBitmap + */ + const SkPixmap& pixmap() const { return fPixmap; } + + /** Returns width, height, SkAlphaType, SkColorType, and SkColorSpace. + + @return reference to SkImageInfo + */ + const SkImageInfo& info() const { return fPixmap.info(); } + + /** Returns pixel count in each row. Should be equal or less than + rowBytes() / info().bytesPerPixel(). + + May be less than pixelRef().width(). Will not exceed pixelRef().width() less + pixelRefOrigin().fX. + + @return pixel width in SkImageInfo + */ + int width() const { return fPixmap.width(); } + + /** Returns pixel row count. + + Maybe be less than pixelRef().height(). Will not exceed pixelRef().height() less + pixelRefOrigin().fY. + + @return pixel height in SkImageInfo + */ + int height() const { return fPixmap.height(); } + + SkColorType colorType() const { return fPixmap.colorType(); } + + SkAlphaType alphaType() const { return fPixmap.alphaType(); } + + /** Returns SkColorSpace, the range of colors, associated with SkImageInfo. The + reference count of SkColorSpace is unchanged. The returned SkColorSpace is + immutable. + + @return SkColorSpace in SkImageInfo, or nullptr + */ + SkColorSpace* colorSpace() const { return fPixmap.colorSpace(); } + + /** Returns smart pointer to SkColorSpace, the range of colors, associated with + SkImageInfo. The smart pointer tracks the number of objects sharing this + SkColorSpace reference so the memory is released when the owners destruct. + + The returned SkColorSpace is immutable. + + @return SkColorSpace in SkImageInfo wrapped in a smart pointer + */ + sk_sp<SkColorSpace> refColorSpace() const { return fPixmap.info().refColorSpace(); } + + /** Returns number of bytes per pixel required by SkColorType. + Returns zero if colorType( is kUnknown_SkColorType. + + @return bytes in pixel + */ + int bytesPerPixel() const { return fPixmap.info().bytesPerPixel(); } + + /** Returns number of pixels that fit on row. Should be greater than or equal to + width(). + + @return maximum pixels per row + */ + int rowBytesAsPixels() const { return fPixmap.rowBytesAsPixels(); } + + /** Returns bit shift converting row bytes to row pixels. + Returns zero for kUnknown_SkColorType. + + @return one of: 0, 1, 2, 3; left shift to convert pixels to bytes + */ + int shiftPerPixel() const { return fPixmap.shiftPerPixel(); } + + /** Returns true if either width() or height() are zero. + + Does not check if SkPixelRef is nullptr; call drawsNothing() to check width(), + height(), and SkPixelRef. + + @return true if dimensions do not enclose area + */ + bool empty() const { return fPixmap.info().isEmpty(); } + + /** Returns true if SkPixelRef is nullptr. + + Does not check if width() or height() are zero; call drawsNothing() to check + width(), height(), and SkPixelRef. + + @return true if no SkPixelRef is associated + */ + bool isNull() const { return nullptr == fPixelRef; } + + /** Returns true if width() or height() are zero, or if SkPixelRef is nullptr. + If true, SkBitmap has no effect when drawn or drawn into. + + @return true if drawing has no effect + */ + bool drawsNothing() const { + return this->empty() || this->isNull(); + } + + /** Returns row bytes, the interval from one pixel row to the next. Row bytes + is at least as large as: width() * info().bytesPerPixel(). + + Returns zero if colorType() is kUnknown_SkColorType, or if row bytes supplied to + setInfo() is not large enough to hold a row of pixels. + + @return byte length of pixel row + */ + size_t rowBytes() const { return fPixmap.rowBytes(); } + + /** Sets SkAlphaType, if alphaType is compatible with SkColorType. + Returns true unless alphaType is kUnknown_SkAlphaType and current SkAlphaType + is not kUnknown_SkAlphaType. + + Returns true if SkColorType is kUnknown_SkColorType. alphaType is ignored, and + SkAlphaType remains kUnknown_SkAlphaType. + + Returns true if SkColorType is kRGB_565_SkColorType or kGray_8_SkColorType. + alphaType is ignored, and SkAlphaType remains kOpaque_SkAlphaType. + + If SkColorType is kARGB_4444_SkColorType, kRGBA_8888_SkColorType, + kBGRA_8888_SkColorType, or kRGBA_F16_SkColorType: returns true unless + alphaType is kUnknown_SkAlphaType and SkAlphaType is not kUnknown_SkAlphaType. + If SkAlphaType is kUnknown_SkAlphaType, alphaType is ignored. + + If SkColorType is kAlpha_8_SkColorType, returns true unless + alphaType is kUnknown_SkAlphaType and SkAlphaType is not kUnknown_SkAlphaType. + If SkAlphaType is kUnknown_SkAlphaType, alphaType is ignored. If alphaType is + kUnpremul_SkAlphaType, it is treated as kPremul_SkAlphaType. + + This changes SkAlphaType in SkPixelRef; all bitmaps sharing SkPixelRef + are affected. + + @return true if SkAlphaType is set + + example: https://fiddle.skia.org/c/@Bitmap_setAlphaType + */ + bool setAlphaType(SkAlphaType alphaType); + + /** Returns pixel address, the base address corresponding to the pixel origin. + + @return pixel address + */ + void* getPixels() const { return fPixmap.writable_addr(); } + + /** Returns minimum memory required for pixel storage. + Does not include unused memory on last row when rowBytesAsPixels() exceeds width(). + Returns SIZE_MAX if result does not fit in size_t. + Returns zero if height() or width() is 0. + Returns height() times rowBytes() if colorType() is kUnknown_SkColorType. + + @return size in bytes of image buffer + */ + size_t computeByteSize() const { return fPixmap.computeByteSize(); } + + /** Returns true if pixels can not change. + + Most immutable SkBitmap checks trigger an assert only on debug builds. + + @return true if pixels are immutable + + example: https://fiddle.skia.org/c/@Bitmap_isImmutable + */ + bool isImmutable() const; + + /** Sets internal flag to mark SkBitmap as immutable. Once set, pixels can not change. + Any other bitmap sharing the same SkPixelRef are also marked as immutable. + Once SkPixelRef is marked immutable, the setting cannot be cleared. + + Writing to immutable SkBitmap pixels triggers an assert on debug builds. + + example: https://fiddle.skia.org/c/@Bitmap_setImmutable + */ + void setImmutable(); + + /** Returns true if SkAlphaType is set to hint that all pixels are opaque; their + alpha value is implicitly or explicitly 1.0. If true, and all pixels are + not opaque, Skia may draw incorrectly. + + Does not check if SkColorType allows alpha, or if any pixel value has + transparency. + + @return true if SkImageInfo SkAlphaType is kOpaque_SkAlphaType + */ + bool isOpaque() const { + return SkAlphaTypeIsOpaque(this->alphaType()); + } + + /** Resets to its initial state; all fields are set to zero, as if SkBitmap had + been initialized by SkBitmap(). + + Sets width, height, row bytes to zero; pixel address to nullptr; SkColorType to + kUnknown_SkColorType; and SkAlphaType to kUnknown_SkAlphaType. + + If SkPixelRef is allocated, its reference count is decreased by one, releasing + its memory if SkBitmap is the sole owner. + + example: https://fiddle.skia.org/c/@Bitmap_reset + */ + void reset(); + + /** Returns true if all pixels are opaque. SkColorType determines how pixels + are encoded, and whether pixel describes alpha. Returns true for SkColorType + without alpha in each pixel; for other SkColorType, returns true if all + pixels have alpha values equivalent to 1.0 or greater. + + For SkColorType kRGB_565_SkColorType or kGray_8_SkColorType: always + returns true. For SkColorType kAlpha_8_SkColorType, kBGRA_8888_SkColorType, + kRGBA_8888_SkColorType: returns true if all pixel alpha values are 255. + For SkColorType kARGB_4444_SkColorType: returns true if all pixel alpha values are 15. + For kRGBA_F16_SkColorType: returns true if all pixel alpha values are 1.0 or + greater. + + Returns false for kUnknown_SkColorType. + + @param bm SkBitmap to check + @return true if all pixels have opaque values or SkColorType is opaque + */ + static bool ComputeIsOpaque(const SkBitmap& bm) { + return bm.pixmap().computeIsOpaque(); + } + + /** Returns SkRect { 0, 0, width(), height() }. + + @param bounds container for floating point rectangle + + example: https://fiddle.skia.org/c/@Bitmap_getBounds + */ + void getBounds(SkRect* bounds) const; + + /** Returns SkIRect { 0, 0, width(), height() }. + + @param bounds container for integral rectangle + + example: https://fiddle.skia.org/c/@Bitmap_getBounds_2 + */ + void getBounds(SkIRect* bounds) const; + + /** Returns SkIRect { 0, 0, width(), height() }. + + @return integral rectangle from origin to width() and height() + */ + SkIRect bounds() const { return fPixmap.info().bounds(); } + + /** Returns SkISize { width(), height() }. + + @return integral size of width() and height() + */ + SkISize dimensions() const { return fPixmap.info().dimensions(); } + + /** Returns the bounds of this bitmap, offset by its SkPixelRef origin. + + @return bounds within SkPixelRef bounds + */ + SkIRect getSubset() const { + SkIPoint origin = this->pixelRefOrigin(); + return SkIRect::MakeXYWH(origin.x(), origin.y(), this->width(), this->height()); + } + + /** Sets width, height, SkAlphaType, SkColorType, SkColorSpace, and optional + rowBytes. Frees pixels, and returns true if successful. + + imageInfo.alphaType() may be altered to a value permitted by imageInfo.colorSpace(). + If imageInfo.colorType() is kUnknown_SkColorType, imageInfo.alphaType() is + set to kUnknown_SkAlphaType. + If imageInfo.colorType() is kAlpha_8_SkColorType and imageInfo.alphaType() is + kUnpremul_SkAlphaType, imageInfo.alphaType() is replaced by kPremul_SkAlphaType. + If imageInfo.colorType() is kRGB_565_SkColorType or kGray_8_SkColorType, + imageInfo.alphaType() is set to kOpaque_SkAlphaType. + If imageInfo.colorType() is kARGB_4444_SkColorType, kRGBA_8888_SkColorType, + kBGRA_8888_SkColorType, or kRGBA_F16_SkColorType: imageInfo.alphaType() remains + unchanged. + + rowBytes must equal or exceed imageInfo.minRowBytes(). If imageInfo.colorSpace() is + kUnknown_SkColorType, rowBytes is ignored and treated as zero; for all other + SkColorSpace values, rowBytes of zero is treated as imageInfo.minRowBytes(). + + Calls reset() and returns false if: + - rowBytes exceeds 31 bits + - imageInfo.width() is negative + - imageInfo.height() is negative + - rowBytes is positive and less than imageInfo.width() times imageInfo.bytesPerPixel() + + @param imageInfo contains width, height, SkAlphaType, SkColorType, SkColorSpace + @param rowBytes imageInfo.minRowBytes() or larger; or zero + @return true if SkImageInfo set successfully + + example: https://fiddle.skia.org/c/@Bitmap_setInfo + */ + bool setInfo(const SkImageInfo& imageInfo, size_t rowBytes = 0); + + /** \enum SkBitmap::AllocFlags + AllocFlags is obsolete. We always zero pixel memory when allocated. + */ + enum AllocFlags { + kZeroPixels_AllocFlag = 1 << 0, //!< zero pixel memory. No effect. This is the default. + }; + + /** Sets SkImageInfo to info following the rules in setInfo() and allocates pixel + memory. Memory is zeroed. + + Returns false and calls reset() if SkImageInfo could not be set, or memory could + not be allocated, or memory could not optionally be zeroed. + + On most platforms, allocating pixel memory may succeed even though there is + not sufficient memory to hold pixels; allocation does not take place + until the pixels are written to. The actual behavior depends on the platform + implementation of calloc(). + + @param info contains width, height, SkAlphaType, SkColorType, SkColorSpace + @param flags kZeroPixels_AllocFlag, or zero + @return true if pixels allocation is successful + */ + bool SK_WARN_UNUSED_RESULT tryAllocPixelsFlags(const SkImageInfo& info, uint32_t flags); + + /** Sets SkImageInfo to info following the rules in setInfo() and allocates pixel + memory. Memory is zeroed. + + Aborts execution if SkImageInfo could not be set, or memory could + not be allocated, or memory could not optionally + be zeroed. Abort steps may be provided by the user at compile time by defining + SK_ABORT. + + On most platforms, allocating pixel memory may succeed even though there is + not sufficient memory to hold pixels; allocation does not take place + until the pixels are written to. The actual behavior depends on the platform + implementation of calloc(). + + @param info contains width, height, SkAlphaType, SkColorType, SkColorSpace + @param flags kZeroPixels_AllocFlag, or zero + + example: https://fiddle.skia.org/c/@Bitmap_allocPixelsFlags + */ + void allocPixelsFlags(const SkImageInfo& info, uint32_t flags); + + /** Sets SkImageInfo to info following the rules in setInfo() and allocates pixel + memory. rowBytes must equal or exceed info.width() times info.bytesPerPixel(), + or equal zero. Pass in zero for rowBytes to compute the minimum valid value. + + Returns false and calls reset() if SkImageInfo could not be set, or memory could + not be allocated. + + On most platforms, allocating pixel memory may succeed even though there is + not sufficient memory to hold pixels; allocation does not take place + until the pixels are written to. The actual behavior depends on the platform + implementation of malloc(). + + @param info contains width, height, SkAlphaType, SkColorType, SkColorSpace + @param rowBytes size of pixel row or larger; may be zero + @return true if pixel storage is allocated + */ + bool SK_WARN_UNUSED_RESULT tryAllocPixels(const SkImageInfo& info, size_t rowBytes); + + /** Sets SkImageInfo to info following the rules in setInfo() and allocates pixel + memory. rowBytes must equal or exceed info.width() times info.bytesPerPixel(), + or equal zero. Pass in zero for rowBytes to compute the minimum valid value. + + Aborts execution if SkImageInfo could not be set, or memory could + not be allocated. Abort steps may be provided by + the user at compile time by defining SK_ABORT. + + On most platforms, allocating pixel memory may succeed even though there is + not sufficient memory to hold pixels; allocation does not take place + until the pixels are written to. The actual behavior depends on the platform + implementation of malloc(). + + @param info contains width, height, SkAlphaType, SkColorType, SkColorSpace + @param rowBytes size of pixel row or larger; may be zero + + example: https://fiddle.skia.org/c/@Bitmap_allocPixels + */ + void allocPixels(const SkImageInfo& info, size_t rowBytes); + + /** Sets SkImageInfo to info following the rules in setInfo() and allocates pixel + memory. + + Returns false and calls reset() if SkImageInfo could not be set, or memory could + not be allocated. + + On most platforms, allocating pixel memory may succeed even though there is + not sufficient memory to hold pixels; allocation does not take place + until the pixels are written to. The actual behavior depends on the platform + implementation of malloc(). + + @param info contains width, height, SkAlphaType, SkColorType, SkColorSpace + @return true if pixel storage is allocated + */ + bool SK_WARN_UNUSED_RESULT tryAllocPixels(const SkImageInfo& info) { + return this->tryAllocPixels(info, info.minRowBytes()); + } + + /** Sets SkImageInfo to info following the rules in setInfo() and allocates pixel + memory. + + Aborts execution if SkImageInfo could not be set, or memory could + not be allocated. Abort steps may be provided by + the user at compile time by defining SK_ABORT. + + On most platforms, allocating pixel memory may succeed even though there is + not sufficient memory to hold pixels; allocation does not take place + until the pixels are written to. The actual behavior depends on the platform + implementation of malloc(). + + @param info contains width, height, SkAlphaType, SkColorType, SkColorSpace + + example: https://fiddle.skia.org/c/@Bitmap_allocPixels_2 + */ + void allocPixels(const SkImageInfo& info); + + /** Sets SkImageInfo to width, height, and native color type; and allocates + pixel memory. If isOpaque is true, sets SkImageInfo to kOpaque_SkAlphaType; + otherwise, sets to kPremul_SkAlphaType. + + Calls reset() and returns false if width exceeds 29 bits or is negative, + or height is negative. + + Returns false if allocation fails. + + Use to create SkBitmap that matches SkPMColor, the native pixel arrangement on + the platform. SkBitmap drawn to output device skips converting its pixel format. + + @param width pixel column count; must be zero or greater + @param height pixel row count; must be zero or greater + @param isOpaque true if pixels do not have transparency + @return true if pixel storage is allocated + */ + bool SK_WARN_UNUSED_RESULT tryAllocN32Pixels(int width, int height, bool isOpaque = false); + + /** Sets SkImageInfo to width, height, and the native color type; and allocates + pixel memory. If isOpaque is true, sets SkImageInfo to kOpaque_SkAlphaType; + otherwise, sets to kPremul_SkAlphaType. + + Aborts if width exceeds 29 bits or is negative, or height is negative, or + allocation fails. Abort steps may be provided by the user at compile time by + defining SK_ABORT. + + Use to create SkBitmap that matches SkPMColor, the native pixel arrangement on + the platform. SkBitmap drawn to output device skips converting its pixel format. + + @param width pixel column count; must be zero or greater + @param height pixel row count; must be zero or greater + @param isOpaque true if pixels do not have transparency + + example: https://fiddle.skia.org/c/@Bitmap_allocN32Pixels + */ + void allocN32Pixels(int width, int height, bool isOpaque = false); + + /** Sets SkImageInfo to info following the rules in setInfo(), and creates SkPixelRef + containing pixels and rowBytes. releaseProc, if not nullptr, is called + immediately on failure or when pixels are no longer referenced. context may be + nullptr. + + If SkImageInfo could not be set, or rowBytes is less than info.minRowBytes(): + calls releaseProc if present, calls reset(), and returns false. + + Otherwise, if pixels equals nullptr: sets SkImageInfo, calls releaseProc if + present, returns true. + + If SkImageInfo is set, pixels is not nullptr, and releaseProc is not nullptr: + when pixels are no longer referenced, calls releaseProc with pixels and context + as parameters. + + @param info contains width, height, SkAlphaType, SkColorType, SkColorSpace + @param pixels address or pixel storage; may be nullptr + @param rowBytes size of pixel row or larger + @param releaseProc function called when pixels can be deleted; may be nullptr + @param context caller state passed to releaseProc; may be nullptr + @return true if SkImageInfo is set to info + */ + bool installPixels(const SkImageInfo& info, void* pixels, size_t rowBytes, + void (*releaseProc)(void* addr, void* context), void* context); + + /** Sets SkImageInfo to info following the rules in setInfo(), and creates SkPixelRef + containing pixels and rowBytes. + + If SkImageInfo could not be set, or rowBytes is less than info.minRowBytes(): + calls reset(), and returns false. + + Otherwise, if pixels equals nullptr: sets SkImageInfo, returns true. + + Caller must ensure that pixels are valid for the lifetime of SkBitmap and SkPixelRef. + + @param info contains width, height, SkAlphaType, SkColorType, SkColorSpace + @param pixels address or pixel storage; may be nullptr + @param rowBytes size of pixel row or larger + @return true if SkImageInfo is set to info + */ + bool installPixels(const SkImageInfo& info, void* pixels, size_t rowBytes) { + return this->installPixels(info, pixels, rowBytes, nullptr, nullptr); + } + + /** Sets SkImageInfo to pixmap.info() following the rules in setInfo(), and creates + SkPixelRef containing pixmap.addr() and pixmap.rowBytes(). + + If SkImageInfo could not be set, or pixmap.rowBytes() is less than + SkImageInfo::minRowBytes(): calls reset(), and returns false. + + Otherwise, if pixmap.addr() equals nullptr: sets SkImageInfo, returns true. + + Caller must ensure that pixmap is valid for the lifetime of SkBitmap and SkPixelRef. + + @param pixmap SkImageInfo, pixel address, and rowBytes() + @return true if SkImageInfo was set to pixmap.info() + + example: https://fiddle.skia.org/c/@Bitmap_installPixels_3 + */ + bool installPixels(const SkPixmap& pixmap); + + /** Deprecated. + */ + bool installMaskPixels(const SkMask& mask); + + /** Replaces SkPixelRef with pixels, preserving SkImageInfo and rowBytes(). + Sets SkPixelRef origin to (0, 0). + + If pixels is nullptr, or if info().colorType() equals kUnknown_SkColorType; + release reference to SkPixelRef, and set SkPixelRef to nullptr. + + Caller is responsible for handling ownership pixel memory for the lifetime + of SkBitmap and SkPixelRef. + + @param pixels address of pixel storage, managed by caller + + example: https://fiddle.skia.org/c/@Bitmap_setPixels + */ + void setPixels(void* pixels); + + /** Allocates pixel memory with HeapAllocator, and replaces existing SkPixelRef. + The allocation size is determined by SkImageInfo width, height, and SkColorType. + + Returns false if info().colorType() is kUnknown_SkColorType, or allocation fails. + + @return true if the allocation succeeds + */ + bool SK_WARN_UNUSED_RESULT tryAllocPixels() { + return this->tryAllocPixels((Allocator*)nullptr); + } + + /** Allocates pixel memory with HeapAllocator, and replaces existing SkPixelRef. + The allocation size is determined by SkImageInfo width, height, and SkColorType. + + Aborts if info().colorType() is kUnknown_SkColorType, or allocation fails. + Abort steps may be provided by the user at compile + time by defining SK_ABORT. + + example: https://fiddle.skia.org/c/@Bitmap_allocPixels_3 + */ + void allocPixels(); + + /** Allocates pixel memory with allocator, and replaces existing SkPixelRef. + The allocation size is determined by SkImageInfo width, height, and SkColorType. + If allocator is nullptr, use HeapAllocator instead. + + Returns false if Allocator::allocPixelRef return false. + + @param allocator instance of SkBitmap::Allocator instantiation + @return true if custom allocator reports success + */ + bool SK_WARN_UNUSED_RESULT tryAllocPixels(Allocator* allocator); + + /** Allocates pixel memory with allocator, and replaces existing SkPixelRef. + The allocation size is determined by SkImageInfo width, height, and SkColorType. + If allocator is nullptr, use HeapAllocator instead. + + Aborts if Allocator::allocPixelRef return false. Abort steps may be provided by + the user at compile time by defining SK_ABORT. + + @param allocator instance of SkBitmap::Allocator instantiation + + example: https://fiddle.skia.org/c/@Bitmap_allocPixels_4 + */ + void allocPixels(Allocator* allocator); + + /** Returns SkPixelRef, which contains: pixel base address; its dimensions; and + rowBytes(), the interval from one row to the next. Does not change SkPixelRef + reference count. SkPixelRef may be shared by multiple bitmaps. + If SkPixelRef has not been set, returns nullptr. + + @return SkPixelRef, or nullptr + */ + SkPixelRef* pixelRef() const { return fPixelRef.get(); } + + /** Returns origin of pixels within SkPixelRef. SkBitmap bounds is always contained + by SkPixelRef bounds, which may be the same size or larger. Multiple SkBitmap + can share the same SkPixelRef, where each SkBitmap has different bounds. + + The returned origin added to SkBitmap dimensions equals or is smaller than the + SkPixelRef dimensions. + + Returns (0, 0) if SkPixelRef is nullptr. + + @return pixel origin within SkPixelRef + + example: https://fiddle.skia.org/c/@Bitmap_pixelRefOrigin + */ + SkIPoint pixelRefOrigin() const; + + /** Replaces pixelRef and origin in SkBitmap. dx and dy specify the offset + within the SkPixelRef pixels for the top-left corner of the bitmap. + + Asserts in debug builds if dx or dy are out of range. Pins dx and dy + to legal range in release builds. + + The caller is responsible for ensuring that the pixels match the + SkColorType and SkAlphaType in SkImageInfo. + + @param pixelRef SkPixelRef describing pixel address and rowBytes() + @param dx column offset in SkPixelRef for bitmap origin + @param dy row offset in SkPixelRef for bitmap origin + + example: https://fiddle.skia.org/c/@Bitmap_setPixelRef + */ + void setPixelRef(sk_sp<SkPixelRef> pixelRef, int dx, int dy); + + /** Returns true if SkBitmap is can be drawn. + + @return true if getPixels() is not nullptr + */ + bool readyToDraw() const { + return this->getPixels() != nullptr; + } + + /** Returns a unique value corresponding to the pixels in SkPixelRef. + Returns a different value after notifyPixelsChanged() has been called. + Returns zero if SkPixelRef is nullptr. + + Determines if pixels have changed since last examined. + + @return unique value for pixels in SkPixelRef + + example: https://fiddle.skia.org/c/@Bitmap_getGenerationID + */ + uint32_t getGenerationID() const; + + /** Marks that pixels in SkPixelRef have changed. Subsequent calls to + getGenerationID() return a different value. + + example: https://fiddle.skia.org/c/@Bitmap_notifyPixelsChanged + */ + void notifyPixelsChanged() const; + + /** Replaces pixel values with c, interpreted as being in the sRGB SkColorSpace. + All pixels contained by bounds() are affected. If the colorType() is + kGray_8_SkColorType or kRGB_565_SkColorType, then alpha is ignored; RGB is + treated as opaque. If colorType() is kAlpha_8_SkColorType, then RGB is ignored. + + @param c unpremultiplied color + + example: https://fiddle.skia.org/c/@Bitmap_eraseColor + */ + void eraseColor(SkColor c) const; + + /** Replaces pixel values with unpremultiplied color built from a, r, g, and b, + interpreted as being in the sRGB SkColorSpace. All pixels contained by + bounds() are affected. If the colorType() is kGray_8_SkColorType or + kRGB_565_SkColorType, then a is ignored; r, g, and b are treated as opaque. + If colorType() is kAlpha_8_SkColorType, then r, g, and b are ignored. + + @param a amount of alpha, from fully transparent (0) to fully opaque (255) + @param r amount of red, from no red (0) to full red (255) + @param g amount of green, from no green (0) to full green (255) + @param b amount of blue, from no blue (0) to full blue (255) + */ + void eraseARGB(U8CPU a, U8CPU r, U8CPU g, U8CPU b) const { + this->eraseColor(SkColorSetARGB(a, r, g, b)); + } + + /** Replaces pixel values inside area with c. interpreted as being in the sRGB + SkColorSpace. If area does not intersect bounds(), call has no effect. + + If the colorType() is kGray_8_SkColorType or kRGB_565_SkColorType, then alpha + is ignored; RGB is treated as opaque. If colorType() is kAlpha_8_SkColorType, + then RGB is ignored. + + @param c unpremultiplied color + @param area rectangle to fill + + example: https://fiddle.skia.org/c/@Bitmap_erase + */ + void erase(SkColor c, const SkIRect& area) const; + + /** Deprecated. + */ + void eraseArea(const SkIRect& area, SkColor c) const { + this->erase(c, area); + } + + /** Returns pixel at (x, y) as unpremultiplied color. + Returns black with alpha if SkColorType is kAlpha_8_SkColorType. + + Input is not validated: out of bounds values of x or y trigger an assert() if + built with SK_DEBUG defined; and returns undefined values or may crash if + SK_RELEASE is defined. Fails if SkColorType is kUnknown_SkColorType or + pixel address is nullptr. + + SkColorSpace in SkImageInfo is ignored. Some color precision may be lost in the + conversion to unpremultiplied color; original pixel data may have additional + precision. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return pixel converted to unpremultiplied color + */ + SkColor getColor(int x, int y) const { + return this->pixmap().getColor(x, y); + } + + /** Look up the pixel at (x,y) and return its alpha component, normalized to [0..1]. + This is roughly equivalent to SkGetColorA(getColor()), but can be more efficent + (and more precise if the pixels store more than 8 bits per component). + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return alpha converted to normalized float + */ + float getAlphaf(int x, int y) const { + return this->pixmap().getAlphaf(x, y); + } + + /** Returns pixel address at (x, y). + + Input is not validated: out of bounds values of x or y, or kUnknown_SkColorType, + trigger an assert() if built with SK_DEBUG defined. Returns nullptr if + SkColorType is kUnknown_SkColorType, or SkPixelRef is nullptr. + + Performs a lookup of pixel size; for better performance, call + one of: getAddr8(), getAddr16(), or getAddr32(). + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return generic pointer to pixel + + example: https://fiddle.skia.org/c/@Bitmap_getAddr + */ + void* getAddr(int x, int y) const; + + /** Returns address at (x, y). + + Input is not validated. Triggers an assert() if built with SK_DEBUG defined and: + - SkPixelRef is nullptr + - bytesPerPixel() is not four + - x is negative, or not less than width() + - y is negative, or not less than height() + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return unsigned 32-bit pointer to pixel at (x, y) + */ + inline uint32_t* getAddr32(int x, int y) const; + + /** Returns address at (x, y). + + Input is not validated. Triggers an assert() if built with SK_DEBUG defined and: + - SkPixelRef is nullptr + - bytesPerPixel() is not two + - x is negative, or not less than width() + - y is negative, or not less than height() + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return unsigned 16-bit pointer to pixel at (x, y) + */ + inline uint16_t* getAddr16(int x, int y) const; + + /** Returns address at (x, y). + + Input is not validated. Triggers an assert() if built with SK_DEBUG defined and: + - SkPixelRef is nullptr + - bytesPerPixel() is not one + - x is negative, or not less than width() + - y is negative, or not less than height() + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return unsigned 8-bit pointer to pixel at (x, y) + */ + inline uint8_t* getAddr8(int x, int y) const; + + /** Shares SkPixelRef with dst. Pixels are not copied; SkBitmap and dst point + to the same pixels; dst bounds() are set to the intersection of subset + and the original bounds(). + + subset may be larger than bounds(). Any area outside of bounds() is ignored. + + Any contents of dst are discarded. + + Return false if: + - dst is nullptr + - SkPixelRef is nullptr + - subset does not intersect bounds() + + @param dst SkBitmap set to subset + @param subset rectangle of pixels to reference + @return true if dst is replaced by subset + + example: https://fiddle.skia.org/c/@Bitmap_extractSubset + */ + bool extractSubset(SkBitmap* dst, const SkIRect& subset) const; + + /** Copies a SkRect of pixels from SkBitmap to dstPixels. Copy starts at (srcX, srcY), + and does not exceed SkBitmap (width(), height()). + + dstInfo specifies width, height, SkColorType, SkAlphaType, and SkColorSpace of + destination. dstRowBytes specifics the gap from one destination row to the next. + Returns true if pixels are copied. Returns false if: + - dstInfo has no address + - dstRowBytes is less than dstInfo.minRowBytes() + - SkPixelRef is nullptr + + Pixels are copied only if pixel conversion is possible. If SkBitmap colorType() is + kGray_8_SkColorType, or kAlpha_8_SkColorType; dstInfo.colorType() must match. + If SkBitmap colorType() is kGray_8_SkColorType, dstInfo.colorSpace() must match. + If SkBitmap alphaType() is kOpaque_SkAlphaType, dstInfo.alphaType() must + match. If SkBitmap colorSpace() is nullptr, dstInfo.colorSpace() must match. Returns + false if pixel conversion is not possible. + + srcX and srcY may be negative to copy only top or left of source. Returns + false if width() or height() is zero or negative. + Returns false if abs(srcX) >= Bitmap width(), or if abs(srcY) >= Bitmap height(). + + @param dstInfo destination width, height, SkColorType, SkAlphaType, SkColorSpace + @param dstPixels destination pixel storage + @param dstRowBytes destination row length + @param srcX column index whose absolute value is less than width() + @param srcY row index whose absolute value is less than height() + @return true if pixels are copied to dstPixels + */ + bool readPixels(const SkImageInfo& dstInfo, void* dstPixels, size_t dstRowBytes, + int srcX, int srcY) const; + + /** Copies a SkRect of pixels from SkBitmap to dst. Copy starts at (srcX, srcY), and + does not exceed SkBitmap (width(), height()). + + dst specifies width, height, SkColorType, SkAlphaType, SkColorSpace, pixel storage, + and row bytes of destination. dst.rowBytes() specifics the gap from one destination + row to the next. Returns true if pixels are copied. Returns false if: + - dst pixel storage equals nullptr + - dst.rowBytes is less than SkImageInfo::minRowBytes() + - SkPixelRef is nullptr + + Pixels are copied only if pixel conversion is possible. If SkBitmap colorType() is + kGray_8_SkColorType, or kAlpha_8_SkColorType; dst SkColorType must match. + If SkBitmap colorType() is kGray_8_SkColorType, dst SkColorSpace must match. + If SkBitmap alphaType() is kOpaque_SkAlphaType, dst SkAlphaType must + match. If SkBitmap colorSpace() is nullptr, dst SkColorSpace must match. Returns + false if pixel conversion is not possible. + + srcX and srcY may be negative to copy only top or left of source. Returns + false if width() or height() is zero or negative. + Returns false if abs(srcX) >= Bitmap width(), or if abs(srcY) >= Bitmap height(). + + @param dst destination SkPixmap: SkImageInfo, pixels, row bytes + @param srcX column index whose absolute value is less than width() + @param srcY row index whose absolute value is less than height() + @return true if pixels are copied to dst + + example: https://fiddle.skia.org/c/@Bitmap_readPixels_2 + */ + bool readPixels(const SkPixmap& dst, int srcX, int srcY) const; + + /** Copies a SkRect of pixels from SkBitmap to dst. Copy starts at (0, 0), and + does not exceed SkBitmap (width(), height()). + + dst specifies width, height, SkColorType, SkAlphaType, SkColorSpace, pixel storage, + and row bytes of destination. dst.rowBytes() specifics the gap from one destination + row to the next. Returns true if pixels are copied. Returns false if: + - dst pixel storage equals nullptr + - dst.rowBytes is less than SkImageInfo::minRowBytes() + - SkPixelRef is nullptr + + Pixels are copied only if pixel conversion is possible. If SkBitmap colorType() is + kGray_8_SkColorType, or kAlpha_8_SkColorType; dst SkColorType must match. + If SkBitmap colorType() is kGray_8_SkColorType, dst SkColorSpace must match. + If SkBitmap alphaType() is kOpaque_SkAlphaType, dst SkAlphaType must + match. If SkBitmap colorSpace() is nullptr, dst SkColorSpace must match. Returns + false if pixel conversion is not possible. + + @param dst destination SkPixmap: SkImageInfo, pixels, row bytes + @return true if pixels are copied to dst + */ + bool readPixels(const SkPixmap& dst) const { + return this->readPixels(dst, 0, 0); + } + + /** Copies a SkRect of pixels from src. Copy starts at (dstX, dstY), and does not exceed + (src.width(), src.height()). + + src specifies width, height, SkColorType, SkAlphaType, SkColorSpace, pixel storage, + and row bytes of source. src.rowBytes() specifics the gap from one source + row to the next. Returns true if pixels are copied. Returns false if: + - src pixel storage equals nullptr + - src.rowBytes is less than SkImageInfo::minRowBytes() + - SkPixelRef is nullptr + + Pixels are copied only if pixel conversion is possible. If SkBitmap colorType() is + kGray_8_SkColorType, or kAlpha_8_SkColorType; src SkColorType must match. + If SkBitmap colorType() is kGray_8_SkColorType, src SkColorSpace must match. + If SkBitmap alphaType() is kOpaque_SkAlphaType, src SkAlphaType must + match. If SkBitmap colorSpace() is nullptr, src SkColorSpace must match. Returns + false if pixel conversion is not possible. + + dstX and dstY may be negative to copy only top or left of source. Returns + false if width() or height() is zero or negative. + Returns false if abs(dstX) >= Bitmap width(), or if abs(dstY) >= Bitmap height(). + + @param src source SkPixmap: SkImageInfo, pixels, row bytes + @param dstX column index whose absolute value is less than width() + @param dstY row index whose absolute value is less than height() + @return true if src pixels are copied to SkBitmap + + example: https://fiddle.skia.org/c/@Bitmap_writePixels + */ + bool writePixels(const SkPixmap& src, int dstX, int dstY); + + /** Copies a SkRect of pixels from src. Copy starts at (0, 0), and does not exceed + (src.width(), src.height()). + + src specifies width, height, SkColorType, SkAlphaType, SkColorSpace, pixel storage, + and row bytes of source. src.rowBytes() specifics the gap from one source + row to the next. Returns true if pixels are copied. Returns false if: + - src pixel storage equals nullptr + - src.rowBytes is less than SkImageInfo::minRowBytes() + - SkPixelRef is nullptr + + Pixels are copied only if pixel conversion is possible. If SkBitmap colorType() is + kGray_8_SkColorType, or kAlpha_8_SkColorType; src SkColorType must match. + If SkBitmap colorType() is kGray_8_SkColorType, src SkColorSpace must match. + If SkBitmap alphaType() is kOpaque_SkAlphaType, src SkAlphaType must + match. If SkBitmap colorSpace() is nullptr, src SkColorSpace must match. Returns + false if pixel conversion is not possible. + + @param src source SkPixmap: SkImageInfo, pixels, row bytes + @return true if src pixels are copied to SkBitmap + */ + bool writePixels(const SkPixmap& src) { + return this->writePixels(src, 0, 0); + } + + /** Sets dst to alpha described by pixels. Returns false if dst cannot be written to + or dst pixels cannot be allocated. + + Uses HeapAllocator to reserve memory for dst SkPixelRef. + + @param dst holds SkPixelRef to fill with alpha layer + @return true if alpha layer was constructed in dst SkPixelRef + */ + bool extractAlpha(SkBitmap* dst) const { + return this->extractAlpha(dst, nullptr, nullptr, nullptr); + } + + /** Sets dst to alpha described by pixels. Returns false if dst cannot be written to + or dst pixels cannot be allocated. + + If paint is not nullptr and contains SkMaskFilter, SkMaskFilter + generates mask alpha from SkBitmap. Uses HeapAllocator to reserve memory for dst + SkPixelRef. Sets offset to top-left position for dst for alignment with SkBitmap; + (0, 0) unless SkMaskFilter generates mask. + + @param dst holds SkPixelRef to fill with alpha layer + @param paint holds optional SkMaskFilter; may be nullptr + @param offset top-left position for dst; may be nullptr + @return true if alpha layer was constructed in dst SkPixelRef + */ + bool extractAlpha(SkBitmap* dst, const SkPaint* paint, + SkIPoint* offset) const { + return this->extractAlpha(dst, paint, nullptr, offset); + } + + /** Sets dst to alpha described by pixels. Returns false if dst cannot be written to + or dst pixels cannot be allocated. + + If paint is not nullptr and contains SkMaskFilter, SkMaskFilter + generates mask alpha from SkBitmap. allocator may reference a custom allocation + class or be set to nullptr to use HeapAllocator. Sets offset to top-left + position for dst for alignment with SkBitmap; (0, 0) unless SkMaskFilter generates + mask. + + @param dst holds SkPixelRef to fill with alpha layer + @param paint holds optional SkMaskFilter; may be nullptr + @param allocator function to reserve memory for SkPixelRef; may be nullptr + @param offset top-left position for dst; may be nullptr + @return true if alpha layer was constructed in dst SkPixelRef + */ + bool extractAlpha(SkBitmap* dst, const SkPaint* paint, Allocator* allocator, + SkIPoint* offset) const; + + /** Copies SkBitmap pixel address, row bytes, and SkImageInfo to pixmap, if address + is available, and returns true. If pixel address is not available, return + false and leave pixmap unchanged. + + pixmap contents become invalid on any future change to SkBitmap. + + @param pixmap storage for pixel state if pixels are readable; otherwise, ignored + @return true if SkBitmap has direct access to pixels + + example: https://fiddle.skia.org/c/@Bitmap_peekPixels + */ + bool peekPixels(SkPixmap* pixmap) const; + sk_sp<SkShader> makeShader(SkTileMode tmx, SkTileMode tmy, const SkSamplingOptions&, + const SkMatrix* = nullptr) const; + + sk_sp<SkShader> makeShader(SkTileMode tmx, SkTileMode tmy, const SkSamplingOptions& sampling, + const SkMatrix& localMatrix) const { + return this->makeShader(tmx, tmy, sampling, &localMatrix); + } + + sk_sp<SkShader> makeShader(const SkSamplingOptions& sampling, + const SkMatrix* localMatrix = nullptr) const { + return this->makeShader(SkTileMode::kClamp, SkTileMode::kClamp, sampling, localMatrix); + } + + sk_sp<SkShader> makeShader(const SkSamplingOptions& sampling, + const SkMatrix& localMatrix) const { + return this->makeShader(sampling, &localMatrix); + } + + /** + * Returns a new image from the bitmap. If the bitmap is marked immutable, this will + * share the pixel buffer. If not, it will make a copy of the pixels for the image. + */ + sk_sp<SkImage> asImage() const; + + /** Asserts if internal values are illegal or inconsistent. Only available if + SK_DEBUG is defined at compile time. + */ + SkDEBUGCODE(void validate() const;) + + /** \class SkBitmap::Allocator + Abstract subclass of HeapAllocator. + */ + class Allocator : public SkRefCnt { + public: + + /** Allocates the pixel memory for the bitmap, given its dimensions and + SkColorType. Returns true on success, where success means either setPixels() + or setPixelRef() was called. + + @param bitmap SkBitmap containing SkImageInfo as input, and SkPixelRef as output + @return true if SkPixelRef was allocated + */ + virtual bool allocPixelRef(SkBitmap* bitmap) = 0; + private: + using INHERITED = SkRefCnt; + }; + + /** \class SkBitmap::HeapAllocator + Subclass of SkBitmap::Allocator that returns a SkPixelRef that allocates its pixel + memory from the heap. This is the default SkBitmap::Allocator invoked by + allocPixels(). + */ + class HeapAllocator : public Allocator { + public: + + /** Allocates the pixel memory for the bitmap, given its dimensions and + SkColorType. Returns true on success, where success means either setPixels() + or setPixelRef() was called. + + @param bitmap SkBitmap containing SkImageInfo as input, and SkPixelRef as output + @return true if pixels are allocated + + example: https://fiddle.skia.org/c/@Bitmap_HeapAllocator_allocPixelRef + */ + bool allocPixelRef(SkBitmap* bitmap) override; + }; + +private: + sk_sp<SkPixelRef> fPixelRef; + SkPixmap fPixmap; + sk_sp<SkMipmap> fMips; + + friend class SkImage_Raster; + friend class SkReadBuffer; // unflatten +}; + +/////////////////////////////////////////////////////////////////////////////// + +inline uint32_t* SkBitmap::getAddr32(int x, int y) const { + SkASSERT(fPixmap.addr()); + return fPixmap.writable_addr32(x, y); +} + +inline uint16_t* SkBitmap::getAddr16(int x, int y) const { + SkASSERT(fPixmap.addr()); + return fPixmap.writable_addr16(x, y); +} + +inline uint8_t* SkBitmap::getAddr8(int x, int y) const { + SkASSERT(fPixmap.addr()); + return fPixmap.writable_addr8(x, y); +} + +#endif diff --git a/src/deps/skia/include/core/SkBlendMode.h b/src/deps/skia/include/core/SkBlendMode.h new file mode 100644 index 000000000..07640cf55 --- /dev/null +++ b/src/deps/skia/include/core/SkBlendMode.h @@ -0,0 +1,110 @@ +/* + * Copyright 2016 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkBlendMode_DEFINED +#define SkBlendMode_DEFINED + +#include "include/core/SkTypes.h" + +/** + * Blends are operators that take in two colors (source, destination) and return a new color. + * Many of these operate the same on all 4 components: red, green, blue, alpha. For these, + * we just document what happens to one component, rather than naming each one separately. + * + * Different SkColorTypes have different representations for color components: + * 8-bit: 0..255 + * 6-bit: 0..63 + * 5-bit: 0..31 + * 4-bit: 0..15 + * floats: 0...1 + * + * The documentation is expressed as if the component values are always 0..1 (floats). + * + * For brevity, the documentation uses the following abbreviations + * s : source + * d : destination + * sa : source alpha + * da : destination alpha + * + * Results are abbreviated + * r : if all 4 components are computed in the same manner + * ra : result alpha component + * rc : result "color": red, green, blue components + */ +enum class SkBlendMode { + kClear, //!< r = 0 + kSrc, //!< r = s + kDst, //!< r = d + kSrcOver, //!< r = s + (1-sa)*d + kDstOver, //!< r = d + (1-da)*s + kSrcIn, //!< r = s * da + kDstIn, //!< r = d * sa + kSrcOut, //!< r = s * (1-da) + kDstOut, //!< r = d * (1-sa) + kSrcATop, //!< r = s*da + d*(1-sa) + kDstATop, //!< r = d*sa + s*(1-da) + kXor, //!< r = s*(1-da) + d*(1-sa) + kPlus, //!< r = min(s + d, 1) + kModulate, //!< r = s*d + kScreen, //!< r = s + d - s*d + + kOverlay, //!< multiply or screen, depending on destination + kDarken, //!< rc = s + d - max(s*da, d*sa), ra = kSrcOver + kLighten, //!< rc = s + d - min(s*da, d*sa), ra = kSrcOver + kColorDodge, //!< brighten destination to reflect source + kColorBurn, //!< darken destination to reflect source + kHardLight, //!< multiply or screen, depending on source + kSoftLight, //!< lighten or darken, depending on source + kDifference, //!< rc = s + d - 2*(min(s*da, d*sa)), ra = kSrcOver + kExclusion, //!< rc = s + d - two(s*d), ra = kSrcOver + kMultiply, //!< r = s*(1-da) + d*(1-sa) + s*d + + kHue, //!< hue of source with saturation and luminosity of destination + kSaturation, //!< saturation of source with hue and luminosity of destination + kColor, //!< hue and saturation of source with luminosity of destination + kLuminosity, //!< luminosity of source with hue and saturation of destination + + kLastCoeffMode = kScreen, //!< last porter duff blend mode + kLastSeparableMode = kMultiply, //!< last blend mode operating separately on components + kLastMode = kLuminosity, //!< last valid value +}; + +/** + * For Porter-Duff SkBlendModes (those <= kLastCoeffMode), these coefficients describe the blend + * equation used. Coefficient-based blend modes specify an equation: + * ('dstCoeff' * dst + 'srcCoeff' * src), where the coefficient values are constants, functions of + * the src or dst alpha, or functions of the src or dst color. + */ +enum class SkBlendModeCoeff { + kZero, /** 0 */ + kOne, /** 1 */ + kSC, /** src color */ + kISC, /** inverse src color (i.e. 1 - sc) */ + kDC, /** dst color */ + kIDC, /** inverse dst color (i.e. 1 - dc) */ + kSA, /** src alpha */ + kISA, /** inverse src alpha (i.e. 1 - sa) */ + kDA, /** dst alpha */ + kIDA, /** inverse dst alpha (i.e. 1 - da) */ + + kCoeffCount +}; + +/** + * Returns true if 'mode' is a coefficient-based blend mode (<= kLastCoeffMode). If true is + * returned, the mode's src and dst coefficient functions are set in 'src' and 'dst'. + */ +SK_API bool SkBlendMode_AsCoeff(SkBlendMode mode, SkBlendModeCoeff* src, SkBlendModeCoeff* dst); + + +/** Returns name of blendMode as null-terminated C string. + + @return C string +*/ +SK_API const char* SkBlendMode_Name(SkBlendMode blendMode); + +#endif diff --git a/src/deps/skia/include/core/SkBlender.h b/src/deps/skia/include/core/SkBlender.h new file mode 100644 index 000000000..7acba87f5 --- /dev/null +++ b/src/deps/skia/include/core/SkBlender.h @@ -0,0 +1,33 @@ +/* + * Copyright 2021 Google LLC + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkBlender_DEFINED +#define SkBlender_DEFINED + +#include "include/core/SkBlendMode.h" +#include "include/core/SkFlattenable.h" + +/** + * SkBlender represents a custom blend function in the Skia pipeline. When an SkBlender is + * present in a paint, the SkBlendMode is ignored. A blender combines a source color (the + * result of our paint) and destination color (from the canvas) into a final color. + */ +class SK_API SkBlender : public SkFlattenable { +public: + /** + * Create a blender that implements the specified BlendMode. + */ + static sk_sp<SkBlender> Mode(SkBlendMode mode); + +private: + SkBlender() = default; + friend class SkBlenderBase; + + using INHERITED = SkFlattenable; +}; + +#endif diff --git a/src/deps/skia/include/core/SkBlurTypes.h b/src/deps/skia/include/core/SkBlurTypes.h new file mode 100644 index 000000000..aec37b6e6 --- /dev/null +++ b/src/deps/skia/include/core/SkBlurTypes.h @@ -0,0 +1,22 @@ +/* + * Copyright 2014 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkBlurTypes_DEFINED +#define SkBlurTypes_DEFINED + +#include "include/core/SkTypes.h" + +enum SkBlurStyle : int { + kNormal_SkBlurStyle, //!< fuzzy inside and outside + kSolid_SkBlurStyle, //!< solid inside, fuzzy outside + kOuter_SkBlurStyle, //!< nothing inside, fuzzy outside + kInner_SkBlurStyle, //!< fuzzy inside, nothing outside + + kLastEnum_SkBlurStyle = kInner_SkBlurStyle, +}; + +#endif diff --git a/src/deps/skia/include/core/SkCanvas.h b/src/deps/skia/include/core/SkCanvas.h new file mode 100644 index 000000000..a2867f9bb --- /dev/null +++ b/src/deps/skia/include/core/SkCanvas.h @@ -0,0 +1,2583 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkCanvas_DEFINED +#define SkCanvas_DEFINED + +#include "include/core/SkBlendMode.h" +#include "include/core/SkClipOp.h" +#include "include/core/SkColor.h" +#include "include/core/SkFontTypes.h" +#include "include/core/SkImageInfo.h" +#include "include/core/SkM44.h" +#include "include/core/SkMatrix.h" +#include "include/core/SkPaint.h" +#include "include/core/SkPoint.h" +#include "include/core/SkRasterHandleAllocator.h" +#include "include/core/SkRect.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkSamplingOptions.h" +#include "include/core/SkScalar.h" +#include "include/core/SkSize.h" +#include "include/core/SkString.h" +#include "include/core/SkSurfaceProps.h" +#include "include/core/SkTypes.h" +#include "include/private/SkDeque.h" +#include "include/private/SkMacros.h" + +#include <cstring> +#include <memory> +#include <vector> + +#ifndef SK_SUPPORT_LEGACY_GETTOTALMATRIX +#define SK_SUPPORT_LEGACY_GETTOTALMATRIX +#endif + +class AutoLayerForImageFilter; +class GrBackendRenderTarget; +class GrRecordingContext; +class GrSlug; +class SkBaseDevice; +class SkBitmap; +class SkData; +class SkDrawable; +struct SkDrawShadowRec; +class SkFont; +class SkGlyphRunBuilder; +class SkGlyphRunList; +class SkImage; +class SkImageFilter; +class SkPaintFilterCanvas; +class SkPath; +class SkPicture; +class SkPixmap; +class SkRegion; +class SkRRect; +struct SkRSXform; +struct SkCustomMesh; +class SkSpecialImage; +class SkSurface; +class SkSurface_Base; +class SkTextBlob; +class SkVertices; + +namespace skstd { + template<typename T> class optional; +} + +/** \class SkCanvas + SkCanvas provides an interface for drawing, and how the drawing is clipped and transformed. + SkCanvas contains a stack of SkMatrix and clip values. + + SkCanvas and SkPaint together provide the state to draw into SkSurface or SkBaseDevice. + Each SkCanvas draw call transforms the geometry of the object by the concatenation of all + SkMatrix values in the stack. The transformed geometry is clipped by the intersection + of all of clip values in the stack. The SkCanvas draw calls use SkPaint to supply drawing + state such as color, SkTypeface, text size, stroke width, SkShader and so on. + + To draw to a pixel-based destination, create raster surface or GPU surface. + Request SkCanvas from SkSurface to obtain the interface to draw. + SkCanvas generated by raster surface draws to memory visible to the CPU. + SkCanvas generated by GPU surface uses Vulkan or OpenGL to draw to the GPU. + + To draw to a document, obtain SkCanvas from SVG canvas, document PDF, or SkPictureRecorder. + SkDocument based SkCanvas and other SkCanvas subclasses reference SkBaseDevice describing the + destination. + + SkCanvas can be constructed to draw to SkBitmap without first creating raster surface. + This approach may be deprecated in the future. +*/ +class SK_API SkCanvas { +public: + + /** Allocates raster SkCanvas that will draw directly into pixels. + + SkCanvas is returned if all parameters are valid. + Valid parameters include: + info dimensions are zero or positive; + info contains SkColorType and SkAlphaType supported by raster surface; + pixels is not nullptr; + rowBytes is zero or large enough to contain info width pixels of SkColorType. + + Pass zero for rowBytes to compute rowBytes from info width and size of pixel. + If rowBytes is greater than zero, it must be equal to or greater than + info width times bytes required for SkColorType. + + Pixel buffer size should be info height times computed rowBytes. + Pixels are not initialized. + To access pixels after drawing, call flush() or peekPixels(). + + @param info width, height, SkColorType, SkAlphaType, SkColorSpace, of raster surface; + width, or height, or both, may be zero + @param pixels pointer to destination pixels buffer + @param rowBytes interval from one SkSurface row to the next, or zero + @param props LCD striping orientation and setting for device independent fonts; + may be nullptr + @return SkCanvas if all parameters are valid; otherwise, nullptr + */ + static std::unique_ptr<SkCanvas> MakeRasterDirect(const SkImageInfo& info, void* pixels, + size_t rowBytes, + const SkSurfaceProps* props = nullptr); + + /** Allocates raster SkCanvas specified by inline image specification. Subsequent SkCanvas + calls draw into pixels. + SkColorType is set to kN32_SkColorType. + SkAlphaType is set to kPremul_SkAlphaType. + To access pixels after drawing, call flush() or peekPixels(). + + SkCanvas is returned if all parameters are valid. + Valid parameters include: + width and height are zero or positive; + pixels is not nullptr; + rowBytes is zero or large enough to contain width pixels of kN32_SkColorType. + + Pass zero for rowBytes to compute rowBytes from width and size of pixel. + If rowBytes is greater than zero, it must be equal to or greater than + width times bytes required for SkColorType. + + Pixel buffer size should be height times rowBytes. + + @param width pixel column count on raster surface created; must be zero or greater + @param height pixel row count on raster surface created; must be zero or greater + @param pixels pointer to destination pixels buffer; buffer size should be height + times rowBytes + @param rowBytes interval from one SkSurface row to the next, or zero + @return SkCanvas if all parameters are valid; otherwise, nullptr + */ + static std::unique_ptr<SkCanvas> MakeRasterDirectN32(int width, int height, SkPMColor* pixels, + size_t rowBytes) { + return MakeRasterDirect(SkImageInfo::MakeN32Premul(width, height), pixels, rowBytes); + } + + /** Creates an empty SkCanvas with no backing device or pixels, with + a width and height of zero. + + @return empty SkCanvas + + example: https://fiddle.skia.org/c/@Canvas_empty_constructor + */ + SkCanvas(); + + /** Creates SkCanvas of the specified dimensions without a SkSurface. + Used by subclasses with custom implementations for draw member functions. + + If props equals nullptr, SkSurfaceProps are created with + SkSurfaceProps::InitType settings, which choose the pixel striping + direction and order. Since a platform may dynamically change its direction when + the device is rotated, and since a platform may have multiple monitors with + different characteristics, it is best not to rely on this legacy behavior. + + @param width zero or greater + @param height zero or greater + @param props LCD striping orientation and setting for device independent fonts; + may be nullptr + @return SkCanvas placeholder with dimensions + + example: https://fiddle.skia.org/c/@Canvas_int_int_const_SkSurfaceProps_star + */ + SkCanvas(int width, int height, const SkSurfaceProps* props = nullptr); + + /** Private. For internal use only. + */ + explicit SkCanvas(sk_sp<SkBaseDevice> device); + + /** Constructs a canvas that draws into bitmap. + Sets kUnknown_SkPixelGeometry in constructed SkSurface. + + SkBitmap is copied so that subsequently editing bitmap will not affect + constructed SkCanvas. + + May be deprecated in the future. + + @param bitmap width, height, SkColorType, SkAlphaType, and pixel + storage of raster surface + @return SkCanvas that can be used to draw into bitmap + + example: https://fiddle.skia.org/c/@Canvas_copy_const_SkBitmap + */ + explicit SkCanvas(const SkBitmap& bitmap); + +#ifdef SK_BUILD_FOR_ANDROID_FRAMEWORK + /** Private. + */ + enum class ColorBehavior { + kLegacy, //!< placeholder + }; + + /** Private. For use by Android framework only. + + @param bitmap specifies a bitmap for the canvas to draw into + @param behavior specializes this constructor; value is unused + @return SkCanvas that can be used to draw into bitmap + */ + SkCanvas(const SkBitmap& bitmap, ColorBehavior behavior); +#endif + + /** Constructs a canvas that draws into bitmap. + Use props to match the device characteristics, like LCD striping. + + bitmap is copied so that subsequently editing bitmap will not affect + constructed SkCanvas. + + @param bitmap width, height, SkColorType, SkAlphaType, + and pixel storage of raster surface + @param props order and orientation of RGB striping; and whether to use + device independent fonts + @return SkCanvas that can be used to draw into bitmap + + example: https://fiddle.skia.org/c/@Canvas_const_SkBitmap_const_SkSurfaceProps + */ + SkCanvas(const SkBitmap& bitmap, const SkSurfaceProps& props); + + /** Draws saved layers, if any. + Frees up resources used by SkCanvas. + + example: https://fiddle.skia.org/c/@Canvas_destructor + */ + virtual ~SkCanvas(); + + /** Returns SkImageInfo for SkCanvas. If SkCanvas is not associated with raster surface or + GPU surface, returned SkColorType is set to kUnknown_SkColorType. + + @return dimensions and SkColorType of SkCanvas + + example: https://fiddle.skia.org/c/@Canvas_imageInfo + */ + SkImageInfo imageInfo() const; + + /** Copies SkSurfaceProps, if SkCanvas is associated with raster surface or + GPU surface, and returns true. Otherwise, returns false and leave props unchanged. + + @param props storage for writable SkSurfaceProps + @return true if SkSurfaceProps was copied + + example: https://fiddle.skia.org/c/@Canvas_getProps + */ + bool getProps(SkSurfaceProps* props) const; + + /** Triggers the immediate execution of all pending draw operations. + If SkCanvas is associated with GPU surface, resolves all pending GPU operations. + If SkCanvas is associated with raster surface, has no effect; raster draw + operations are never deferred. + + DEPRECATED: Replace usage with GrDirectContext::flush() + */ + void flush(); + + /** Gets the size of the base or root layer in global canvas coordinates. The + origin of the base layer is always (0,0). The area available for drawing may be + smaller (due to clipping or saveLayer). + + @return integral width and height of base layer + + example: https://fiddle.skia.org/c/@Canvas_getBaseLayerSize + */ + virtual SkISize getBaseLayerSize() const; + + /** Creates SkSurface matching info and props, and associates it with SkCanvas. + Returns nullptr if no match found. + + If props is nullptr, matches SkSurfaceProps in SkCanvas. If props is nullptr and SkCanvas + does not have SkSurfaceProps, creates SkSurface with default SkSurfaceProps. + + @param info width, height, SkColorType, SkAlphaType, and SkColorSpace + @param props SkSurfaceProps to match; may be nullptr to match SkCanvas + @return SkSurface matching info and props, or nullptr if no match is available + + example: https://fiddle.skia.org/c/@Canvas_makeSurface + */ + sk_sp<SkSurface> makeSurface(const SkImageInfo& info, const SkSurfaceProps* props = nullptr); + + /** Returns GPU context of the GPU surface associated with SkCanvas. + + @return GPU context, if available; nullptr otherwise + + example: https://fiddle.skia.org/c/@Canvas_recordingContext + */ + virtual GrRecordingContext* recordingContext(); + + /** Sometimes a canvas is owned by a surface. If it is, getSurface() will return a bare + * pointer to that surface, else this will return nullptr. + */ + SkSurface* getSurface() const; + + /** Returns the pixel base address, SkImageInfo, rowBytes, and origin if the pixels + can be read directly. The returned address is only valid + while SkCanvas is in scope and unchanged. Any SkCanvas call or SkSurface call + may invalidate the returned address and other returned values. + + If pixels are inaccessible, info, rowBytes, and origin are unchanged. + + @param info storage for writable pixels' SkImageInfo; may be nullptr + @param rowBytes storage for writable pixels' row bytes; may be nullptr + @param origin storage for SkCanvas top layer origin, its top-left corner; + may be nullptr + @return address of pixels, or nullptr if inaccessible + + example: https://fiddle.skia.org/c/@Canvas_accessTopLayerPixels_a + example: https://fiddle.skia.org/c/@Canvas_accessTopLayerPixels_b + */ + void* accessTopLayerPixels(SkImageInfo* info, size_t* rowBytes, SkIPoint* origin = nullptr); + + /** Returns custom context that tracks the SkMatrix and clip. + + Use SkRasterHandleAllocator to blend Skia drawing with custom drawing, typically performed + by the host platform user interface. The custom context returned is generated by + SkRasterHandleAllocator::MakeCanvas, which creates a custom canvas with raster storage for + the drawing destination. + + @return context of custom allocation + + example: https://fiddle.skia.org/c/@Canvas_accessTopRasterHandle + */ + SkRasterHandleAllocator::Handle accessTopRasterHandle() const; + + /** Returns true if SkCanvas has direct access to its pixels. + + Pixels are readable when SkBaseDevice is raster. Pixels are not readable when SkCanvas + is returned from GPU surface, returned by SkDocument::beginPage, returned by + SkPictureRecorder::beginRecording, or SkCanvas is the base of a utility class + like DebugCanvas. + + pixmap is valid only while SkCanvas is in scope and unchanged. Any + SkCanvas or SkSurface call may invalidate the pixmap values. + + @param pixmap storage for pixel state if pixels are readable; otherwise, ignored + @return true if SkCanvas has direct access to pixels + + example: https://fiddle.skia.org/c/@Canvas_peekPixels + */ + bool peekPixels(SkPixmap* pixmap); + + /** Copies SkRect of pixels from SkCanvas into dstPixels. SkMatrix and clip are + ignored. + + Source SkRect corners are (srcX, srcY) and (imageInfo().width(), imageInfo().height()). + Destination SkRect corners are (0, 0) and (dstInfo.width(), dstInfo.height()). + Copies each readable pixel intersecting both rectangles, without scaling, + converting to dstInfo.colorType() and dstInfo.alphaType() if required. + + Pixels are readable when SkBaseDevice is raster, or backed by a GPU. + Pixels are not readable when SkCanvas is returned by SkDocument::beginPage, + returned by SkPictureRecorder::beginRecording, or SkCanvas is the base of a utility + class like DebugCanvas. + + The destination pixel storage must be allocated by the caller. + + Pixel values are converted only if SkColorType and SkAlphaType + do not match. Only pixels within both source and destination rectangles + are copied. dstPixels contents outside SkRect intersection are unchanged. + + Pass negative values for srcX or srcY to offset pixels across or down destination. + + Does not copy, and returns false if: + - Source and destination rectangles do not intersect. + - SkCanvas pixels could not be converted to dstInfo.colorType() or dstInfo.alphaType(). + - SkCanvas pixels are not readable; for instance, SkCanvas is document-based. + - dstRowBytes is too small to contain one row of pixels. + + @param dstInfo width, height, SkColorType, and SkAlphaType of dstPixels + @param dstPixels storage for pixels; dstInfo.height() times dstRowBytes, or larger + @param dstRowBytes size of one destination row; dstInfo.width() times pixel size, or larger + @param srcX offset into readable pixels on x-axis; may be negative + @param srcY offset into readable pixels on y-axis; may be negative + @return true if pixels were copied + */ + bool readPixels(const SkImageInfo& dstInfo, void* dstPixels, size_t dstRowBytes, + int srcX, int srcY); + + /** Copies SkRect of pixels from SkCanvas into pixmap. SkMatrix and clip are + ignored. + + Source SkRect corners are (srcX, srcY) and (imageInfo().width(), imageInfo().height()). + Destination SkRect corners are (0, 0) and (pixmap.width(), pixmap.height()). + Copies each readable pixel intersecting both rectangles, without scaling, + converting to pixmap.colorType() and pixmap.alphaType() if required. + + Pixels are readable when SkBaseDevice is raster, or backed by a GPU. + Pixels are not readable when SkCanvas is returned by SkDocument::beginPage, + returned by SkPictureRecorder::beginRecording, or SkCanvas is the base of a utility + class like DebugCanvas. + + Caller must allocate pixel storage in pixmap if needed. + + Pixel values are converted only if SkColorType and SkAlphaType + do not match. Only pixels within both source and destination SkRect + are copied. pixmap pixels contents outside SkRect intersection are unchanged. + + Pass negative values for srcX or srcY to offset pixels across or down pixmap. + + Does not copy, and returns false if: + - Source and destination rectangles do not intersect. + - SkCanvas pixels could not be converted to pixmap.colorType() or pixmap.alphaType(). + - SkCanvas pixels are not readable; for instance, SkCanvas is document-based. + - SkPixmap pixels could not be allocated. + - pixmap.rowBytes() is too small to contain one row of pixels. + + @param pixmap storage for pixels copied from SkCanvas + @param srcX offset into readable pixels on x-axis; may be negative + @param srcY offset into readable pixels on y-axis; may be negative + @return true if pixels were copied + + example: https://fiddle.skia.org/c/@Canvas_readPixels_2 + */ + bool readPixels(const SkPixmap& pixmap, int srcX, int srcY); + + /** Copies SkRect of pixels from SkCanvas into bitmap. SkMatrix and clip are + ignored. + + Source SkRect corners are (srcX, srcY) and (imageInfo().width(), imageInfo().height()). + Destination SkRect corners are (0, 0) and (bitmap.width(), bitmap.height()). + Copies each readable pixel intersecting both rectangles, without scaling, + converting to bitmap.colorType() and bitmap.alphaType() if required. + + Pixels are readable when SkBaseDevice is raster, or backed by a GPU. + Pixels are not readable when SkCanvas is returned by SkDocument::beginPage, + returned by SkPictureRecorder::beginRecording, or SkCanvas is the base of a utility + class like DebugCanvas. + + Caller must allocate pixel storage in bitmap if needed. + + SkBitmap values are converted only if SkColorType and SkAlphaType + do not match. Only pixels within both source and destination rectangles + are copied. SkBitmap pixels outside SkRect intersection are unchanged. + + Pass negative values for srcX or srcY to offset pixels across or down bitmap. + + Does not copy, and returns false if: + - Source and destination rectangles do not intersect. + - SkCanvas pixels could not be converted to bitmap.colorType() or bitmap.alphaType(). + - SkCanvas pixels are not readable; for instance, SkCanvas is document-based. + - bitmap pixels could not be allocated. + - bitmap.rowBytes() is too small to contain one row of pixels. + + @param bitmap storage for pixels copied from SkCanvas + @param srcX offset into readable pixels on x-axis; may be negative + @param srcY offset into readable pixels on y-axis; may be negative + @return true if pixels were copied + + example: https://fiddle.skia.org/c/@Canvas_readPixels_3 + */ + bool readPixels(const SkBitmap& bitmap, int srcX, int srcY); + + /** Copies SkRect from pixels to SkCanvas. SkMatrix and clip are ignored. + Source SkRect corners are (0, 0) and (info.width(), info.height()). + Destination SkRect corners are (x, y) and + (imageInfo().width(), imageInfo().height()). + + Copies each readable pixel intersecting both rectangles, without scaling, + converting to imageInfo().colorType() and imageInfo().alphaType() if required. + + Pixels are writable when SkBaseDevice is raster, or backed by a GPU. + Pixels are not writable when SkCanvas is returned by SkDocument::beginPage, + returned by SkPictureRecorder::beginRecording, or SkCanvas is the base of a utility + class like DebugCanvas. + + Pixel values are converted only if SkColorType and SkAlphaType + do not match. Only pixels within both source and destination rectangles + are copied. SkCanvas pixels outside SkRect intersection are unchanged. + + Pass negative values for x or y to offset pixels to the left or + above SkCanvas pixels. + + Does not copy, and returns false if: + - Source and destination rectangles do not intersect. + - pixels could not be converted to SkCanvas imageInfo().colorType() or + imageInfo().alphaType(). + - SkCanvas pixels are not writable; for instance, SkCanvas is document-based. + - rowBytes is too small to contain one row of pixels. + + @param info width, height, SkColorType, and SkAlphaType of pixels + @param pixels pixels to copy, of size info.height() times rowBytes, or larger + @param rowBytes size of one row of pixels; info.width() times pixel size, or larger + @param x offset into SkCanvas writable pixels on x-axis; may be negative + @param y offset into SkCanvas writable pixels on y-axis; may be negative + @return true if pixels were written to SkCanvas + + example: https://fiddle.skia.org/c/@Canvas_writePixels + */ + bool writePixels(const SkImageInfo& info, const void* pixels, size_t rowBytes, int x, int y); + + /** Copies SkRect from pixels to SkCanvas. SkMatrix and clip are ignored. + Source SkRect corners are (0, 0) and (bitmap.width(), bitmap.height()). + + Destination SkRect corners are (x, y) and + (imageInfo().width(), imageInfo().height()). + + Copies each readable pixel intersecting both rectangles, without scaling, + converting to imageInfo().colorType() and imageInfo().alphaType() if required. + + Pixels are writable when SkBaseDevice is raster, or backed by a GPU. + Pixels are not writable when SkCanvas is returned by SkDocument::beginPage, + returned by SkPictureRecorder::beginRecording, or SkCanvas is the base of a utility + class like DebugCanvas. + + Pixel values are converted only if SkColorType and SkAlphaType + do not match. Only pixels within both source and destination rectangles + are copied. SkCanvas pixels outside SkRect intersection are unchanged. + + Pass negative values for x or y to offset pixels to the left or + above SkCanvas pixels. + + Does not copy, and returns false if: + - Source and destination rectangles do not intersect. + - bitmap does not have allocated pixels. + - bitmap pixels could not be converted to SkCanvas imageInfo().colorType() or + imageInfo().alphaType(). + - SkCanvas pixels are not writable; for instance, SkCanvas is document based. + - bitmap pixels are inaccessible; for instance, bitmap wraps a texture. + + @param bitmap contains pixels copied to SkCanvas + @param x offset into SkCanvas writable pixels on x-axis; may be negative + @param y offset into SkCanvas writable pixels on y-axis; may be negative + @return true if pixels were written to SkCanvas + + example: https://fiddle.skia.org/c/@Canvas_writePixels_2 + example: https://fiddle.skia.org/c/@State_Stack_a + example: https://fiddle.skia.org/c/@State_Stack_b + */ + bool writePixels(const SkBitmap& bitmap, int x, int y); + + /** Saves SkMatrix and clip. + Calling restore() discards changes to SkMatrix and clip, + restoring the SkMatrix and clip to their state when save() was called. + + SkMatrix may be changed by translate(), scale(), rotate(), skew(), concat(), setMatrix(), + and resetMatrix(). Clip may be changed by clipRect(), clipRRect(), clipPath(), clipRegion(). + + Saved SkCanvas state is put on a stack; multiple calls to save() should be balance + by an equal number of calls to restore(). + + Call restoreToCount() with result to restore this and subsequent saves. + + @return depth of saved stack + + example: https://fiddle.skia.org/c/@Canvas_save + */ + int save(); + + /** Saves SkMatrix and clip, and allocates a SkBitmap for subsequent drawing. + Calling restore() discards changes to SkMatrix and clip, and draws the SkBitmap. + + SkMatrix may be changed by translate(), scale(), rotate(), skew(), concat(), + setMatrix(), and resetMatrix(). Clip may be changed by clipRect(), clipRRect(), + clipPath(), clipRegion(). + + SkRect bounds suggests but does not define the SkBitmap size. To clip drawing to + a specific rectangle, use clipRect(). + + Optional SkPaint paint applies alpha, SkColorFilter, SkImageFilter, and + SkBlendMode when restore() is called. + + Call restoreToCount() with returned value to restore this and subsequent saves. + + @param bounds hint to limit the size of the layer; may be nullptr + @param paint graphics state for layer; may be nullptr + @return depth of saved stack + + example: https://fiddle.skia.org/c/@Canvas_saveLayer + example: https://fiddle.skia.org/c/@Canvas_saveLayer_4 + */ + int saveLayer(const SkRect* bounds, const SkPaint* paint); + + /** Saves SkMatrix and clip, and allocates a SkBitmap for subsequent drawing. + Calling restore() discards changes to SkMatrix and clip, and draws the SkBitmap. + + SkMatrix may be changed by translate(), scale(), rotate(), skew(), concat(), + setMatrix(), and resetMatrix(). Clip may be changed by clipRect(), clipRRect(), + clipPath(), clipRegion(). + + SkRect bounds suggests but does not define the layer size. To clip drawing to + a specific rectangle, use clipRect(). + + Optional SkPaint paint applies alpha, SkColorFilter, SkImageFilter, and + SkBlendMode when restore() is called. + + Call restoreToCount() with returned value to restore this and subsequent saves. + + @param bounds hint to limit the size of layer; may be nullptr + @param paint graphics state for layer; may be nullptr + @return depth of saved stack + */ + int saveLayer(const SkRect& bounds, const SkPaint* paint) { + return this->saveLayer(&bounds, paint); + } + + /** Saves SkMatrix and clip, and allocates SkBitmap for subsequent drawing. + + Calling restore() discards changes to SkMatrix and clip, + and blends layer with alpha opacity onto prior layer. + + SkMatrix may be changed by translate(), scale(), rotate(), skew(), concat(), + setMatrix(), and resetMatrix(). Clip may be changed by clipRect(), clipRRect(), + clipPath(), clipRegion(). + + SkRect bounds suggests but does not define layer size. To clip drawing to + a specific rectangle, use clipRect(). + + alpha of zero is fully transparent, 255 is fully opaque. + + Call restoreToCount() with returned value to restore this and subsequent saves. + + @param bounds hint to limit the size of layer; may be nullptr + @param alpha opacity of layer + @return depth of saved stack + + example: https://fiddle.skia.org/c/@Canvas_saveLayerAlpha + */ + int saveLayerAlpha(const SkRect* bounds, U8CPU alpha); + + /** \enum SkCanvas::SaveLayerFlagsSet + SaveLayerFlags provides options that may be used in any combination in SaveLayerRec, + defining how layer allocated by saveLayer() operates. It may be set to zero, + kPreserveLCDText_SaveLayerFlag, kInitWithPrevious_SaveLayerFlag, or both flags. + */ + enum SaveLayerFlagsSet { + kPreserveLCDText_SaveLayerFlag = 1 << 1, + kInitWithPrevious_SaveLayerFlag = 1 << 2, //!< initializes with previous contents + // instead of matching previous layer's colortype, use F16 + kF16ColorType = 1 << 4, + }; + + typedef uint32_t SaveLayerFlags; + + /** \struct SkCanvas::SaveLayerRec + SaveLayerRec contains the state used to create the layer. + */ + struct SaveLayerRec { + /** Sets fBounds, fPaint, and fBackdrop to nullptr. Clears fSaveLayerFlags. + + @return empty SaveLayerRec + */ + SaveLayerRec() {} + + /** Sets fBounds, fPaint, and fSaveLayerFlags; sets fBackdrop to nullptr. + + @param bounds layer dimensions; may be nullptr + @param paint applied to layer when overlaying prior layer; may be nullptr + @param saveLayerFlags SaveLayerRec options to modify layer + @return SaveLayerRec with empty fBackdrop + */ + SaveLayerRec(const SkRect* bounds, const SkPaint* paint, SaveLayerFlags saveLayerFlags = 0) + : SaveLayerRec(bounds, paint, nullptr, 1.f, saveLayerFlags) {} + + /** Sets fBounds, fPaint, fBackdrop, and fSaveLayerFlags. + + @param bounds layer dimensions; may be nullptr + @param paint applied to layer when overlaying prior layer; + may be nullptr + @param backdrop If not null, this causes the current layer to be filtered by + backdrop, and then drawn into the new layer + (respecting the current clip). + If null, the new layer is initialized with transparent-black. + @param saveLayerFlags SaveLayerRec options to modify layer + @return SaveLayerRec fully specified + */ + SaveLayerRec(const SkRect* bounds, const SkPaint* paint, const SkImageFilter* backdrop, + SaveLayerFlags saveLayerFlags) + : SaveLayerRec(bounds, paint, backdrop, 1.f, saveLayerFlags) {} + + /** hints at layer size limit */ + const SkRect* fBounds = nullptr; + + /** modifies overlay */ + const SkPaint* fPaint = nullptr; + + /** + * If not null, this triggers the same initialization behavior as setting + * kInitWithPrevious_SaveLayerFlag on fSaveLayerFlags: the current layer is copied into + * the new layer, rather than initializing the new layer with transparent-black. + * This is then filtered by fBackdrop (respecting the current clip). + */ + const SkImageFilter* fBackdrop = nullptr; + + /** preserves LCD text, creates with prior layer contents */ + SaveLayerFlags fSaveLayerFlags = 0; + + private: + friend class SkCanvas; + friend class SkCanvasPriv; + + SaveLayerRec(const SkRect* bounds, const SkPaint* paint, const SkImageFilter* backdrop, + SkScalar backdropScale, SaveLayerFlags saveLayerFlags) + : fBounds(bounds) + , fPaint(paint) + , fBackdrop(backdrop) + , fSaveLayerFlags(saveLayerFlags) + , fExperimentalBackdropScale(backdropScale) {} + + // Relative scale factor that the image content used to initialize the layer when the + // kInitFromPrevious flag or a backdrop filter is used. + SkScalar fExperimentalBackdropScale = 1.f; + }; + + /** Saves SkMatrix and clip, and allocates SkBitmap for subsequent drawing. + + Calling restore() discards changes to SkMatrix and clip, + and blends SkBitmap with alpha opacity onto the prior layer. + + SkMatrix may be changed by translate(), scale(), rotate(), skew(), concat(), + setMatrix(), and resetMatrix(). Clip may be changed by clipRect(), clipRRect(), + clipPath(), clipRegion(). + + SaveLayerRec contains the state used to create the layer. + + Call restoreToCount() with returned value to restore this and subsequent saves. + + @param layerRec layer state + @return depth of save state stack before this call was made. + + example: https://fiddle.skia.org/c/@Canvas_saveLayer_3 + */ + int saveLayer(const SaveLayerRec& layerRec); + + /** Removes changes to SkMatrix and clip since SkCanvas state was + last saved. The state is removed from the stack. + + Does nothing if the stack is empty. + + example: https://fiddle.skia.org/c/@AutoCanvasRestore_restore + + example: https://fiddle.skia.org/c/@Canvas_restore + */ + void restore(); + + /** Returns the number of saved states, each containing: SkMatrix and clip. + Equals the number of save() calls less the number of restore() calls plus one. + The save count of a new canvas is one. + + @return depth of save state stack + + example: https://fiddle.skia.org/c/@Canvas_getSaveCount + */ + int getSaveCount() const; + + /** Restores state to SkMatrix and clip values when save(), saveLayer(), + saveLayerPreserveLCDTextRequests(), or saveLayerAlpha() returned saveCount. + + Does nothing if saveCount is greater than state stack count. + Restores state to initial values if saveCount is less than or equal to one. + + @param saveCount depth of state stack to restore + + example: https://fiddle.skia.org/c/@Canvas_restoreToCount + */ + void restoreToCount(int saveCount); + + /** Translates SkMatrix by dx along the x-axis and dy along the y-axis. + + Mathematically, replaces SkMatrix with a translation matrix + premultiplied with SkMatrix. + + This has the effect of moving the drawing by (dx, dy) before transforming + the result with SkMatrix. + + @param dx distance to translate on x-axis + @param dy distance to translate on y-axis + + example: https://fiddle.skia.org/c/@Canvas_translate + */ + void translate(SkScalar dx, SkScalar dy); + + /** Scales SkMatrix by sx on the x-axis and sy on the y-axis. + + Mathematically, replaces SkMatrix with a scale matrix + premultiplied with SkMatrix. + + This has the effect of scaling the drawing by (sx, sy) before transforming + the result with SkMatrix. + + @param sx amount to scale on x-axis + @param sy amount to scale on y-axis + + example: https://fiddle.skia.org/c/@Canvas_scale + */ + void scale(SkScalar sx, SkScalar sy); + + /** Rotates SkMatrix by degrees. Positive degrees rotates clockwise. + + Mathematically, replaces SkMatrix with a rotation matrix + premultiplied with SkMatrix. + + This has the effect of rotating the drawing by degrees before transforming + the result with SkMatrix. + + @param degrees amount to rotate, in degrees + + example: https://fiddle.skia.org/c/@Canvas_rotate + */ + void rotate(SkScalar degrees); + + /** Rotates SkMatrix by degrees about a point at (px, py). Positive degrees rotates + clockwise. + + Mathematically, constructs a rotation matrix; premultiplies the rotation matrix by + a translation matrix; then replaces SkMatrix with the resulting matrix + premultiplied with SkMatrix. + + This has the effect of rotating the drawing about a given point before + transforming the result with SkMatrix. + + @param degrees amount to rotate, in degrees + @param px x-axis value of the point to rotate about + @param py y-axis value of the point to rotate about + + example: https://fiddle.skia.org/c/@Canvas_rotate_2 + */ + void rotate(SkScalar degrees, SkScalar px, SkScalar py); + + /** Skews SkMatrix by sx on the x-axis and sy on the y-axis. A positive value of sx + skews the drawing right as y-axis values increase; a positive value of sy skews + the drawing down as x-axis values increase. + + Mathematically, replaces SkMatrix with a skew matrix premultiplied with SkMatrix. + + This has the effect of skewing the drawing by (sx, sy) before transforming + the result with SkMatrix. + + @param sx amount to skew on x-axis + @param sy amount to skew on y-axis + + example: https://fiddle.skia.org/c/@Canvas_skew + */ + void skew(SkScalar sx, SkScalar sy); + + /** Replaces SkMatrix with matrix premultiplied with existing SkMatrix. + + This has the effect of transforming the drawn geometry by matrix, before + transforming the result with existing SkMatrix. + + @param matrix matrix to premultiply with existing SkMatrix + + example: https://fiddle.skia.org/c/@Canvas_concat + */ + void concat(const SkMatrix& matrix); + void concat(const SkM44&); + + /** Replaces SkMatrix with matrix. + Unlike concat(), any prior matrix state is overwritten. + + @param matrix matrix to copy, replacing existing SkMatrix + + example: https://fiddle.skia.org/c/@Canvas_setMatrix + */ + void setMatrix(const SkM44& matrix); + + // DEPRECATED -- use SkM44 version + void setMatrix(const SkMatrix& matrix); + + /** Sets SkMatrix to the identity matrix. + Any prior matrix state is overwritten. + + example: https://fiddle.skia.org/c/@Canvas_resetMatrix + */ + void resetMatrix(); + + /** Replaces clip with the intersection or difference of clip and rect, + with an aliased or anti-aliased clip edge. rect is transformed by SkMatrix + before it is combined with clip. + + @param rect SkRect to combine with clip + @param op SkClipOp to apply to clip + @param doAntiAlias true if clip is to be anti-aliased + + example: https://fiddle.skia.org/c/@Canvas_clipRect + */ + void clipRect(const SkRect& rect, SkClipOp op, bool doAntiAlias); + + /** Replaces clip with the intersection or difference of clip and rect. + Resulting clip is aliased; pixels are fully contained by the clip. + rect is transformed by SkMatrix before it is combined with clip. + + @param rect SkRect to combine with clip + @param op SkClipOp to apply to clip + */ + void clipRect(const SkRect& rect, SkClipOp op) { + this->clipRect(rect, op, false); + } + + /** Replaces clip with the intersection of clip and rect. + Resulting clip is aliased; pixels are fully contained by the clip. + rect is transformed by SkMatrix + before it is combined with clip. + + @param rect SkRect to combine with clip + @param doAntiAlias true if clip is to be anti-aliased + */ + void clipRect(const SkRect& rect, bool doAntiAlias = false) { + this->clipRect(rect, SkClipOp::kIntersect, doAntiAlias); + } + + void clipIRect(const SkIRect& irect, SkClipOp op = SkClipOp::kIntersect) { + this->clipRect(SkRect::Make(irect), op, false); + } + + /** Sets the maximum clip rectangle, which can be set by clipRect(), clipRRect() and + clipPath() and intersect the current clip with the specified rect. + The maximum clip affects only future clipping operations; it is not retroactive. + The clip restriction is not recorded in pictures. + + Pass an empty rect to disable maximum clip. + This private API is for use by Android framework only. + + DEPRECATED: Replace usage with SkAndroidFrameworkUtils::replaceClip() + + @param rect maximum allowed clip in device coordinates + */ + void androidFramework_setDeviceClipRestriction(const SkIRect& rect); + + /** Replaces clip with the intersection or difference of clip and rrect, + with an aliased or anti-aliased clip edge. + rrect is transformed by SkMatrix + before it is combined with clip. + + @param rrect SkRRect to combine with clip + @param op SkClipOp to apply to clip + @param doAntiAlias true if clip is to be anti-aliased + + example: https://fiddle.skia.org/c/@Canvas_clipRRect + */ + void clipRRect(const SkRRect& rrect, SkClipOp op, bool doAntiAlias); + + /** Replaces clip with the intersection or difference of clip and rrect. + Resulting clip is aliased; pixels are fully contained by the clip. + rrect is transformed by SkMatrix before it is combined with clip. + + @param rrect SkRRect to combine with clip + @param op SkClipOp to apply to clip + */ + void clipRRect(const SkRRect& rrect, SkClipOp op) { + this->clipRRect(rrect, op, false); + } + + /** Replaces clip with the intersection of clip and rrect, + with an aliased or anti-aliased clip edge. + rrect is transformed by SkMatrix before it is combined with clip. + + @param rrect SkRRect to combine with clip + @param doAntiAlias true if clip is to be anti-aliased + */ + void clipRRect(const SkRRect& rrect, bool doAntiAlias = false) { + this->clipRRect(rrect, SkClipOp::kIntersect, doAntiAlias); + } + + /** Replaces clip with the intersection or difference of clip and path, + with an aliased or anti-aliased clip edge. SkPath::FillType determines if path + describes the area inside or outside its contours; and if path contour overlaps + itself or another path contour, whether the overlaps form part of the area. + path is transformed by SkMatrix before it is combined with clip. + + @param path SkPath to combine with clip + @param op SkClipOp to apply to clip + @param doAntiAlias true if clip is to be anti-aliased + + example: https://fiddle.skia.org/c/@Canvas_clipPath + */ + void clipPath(const SkPath& path, SkClipOp op, bool doAntiAlias); + + /** Replaces clip with the intersection or difference of clip and path. + Resulting clip is aliased; pixels are fully contained by the clip. + SkPath::FillType determines if path + describes the area inside or outside its contours; and if path contour overlaps + itself or another path contour, whether the overlaps form part of the area. + path is transformed by SkMatrix + before it is combined with clip. + + @param path SkPath to combine with clip + @param op SkClipOp to apply to clip + */ + void clipPath(const SkPath& path, SkClipOp op) { + this->clipPath(path, op, false); + } + + /** Replaces clip with the intersection of clip and path. + Resulting clip is aliased; pixels are fully contained by the clip. + SkPath::FillType determines if path + describes the area inside or outside its contours; and if path contour overlaps + itself or another path contour, whether the overlaps form part of the area. + path is transformed by SkMatrix before it is combined with clip. + + @param path SkPath to combine with clip + @param doAntiAlias true if clip is to be anti-aliased + */ + void clipPath(const SkPath& path, bool doAntiAlias = false) { + this->clipPath(path, SkClipOp::kIntersect, doAntiAlias); + } + + void clipShader(sk_sp<SkShader>, SkClipOp = SkClipOp::kIntersect); + + /** Replaces clip with the intersection or difference of clip and SkRegion deviceRgn. + Resulting clip is aliased; pixels are fully contained by the clip. + deviceRgn is unaffected by SkMatrix. + + @param deviceRgn SkRegion to combine with clip + @param op SkClipOp to apply to clip + + example: https://fiddle.skia.org/c/@Canvas_clipRegion + */ + void clipRegion(const SkRegion& deviceRgn, SkClipOp op = SkClipOp::kIntersect); + + /** Returns true if SkRect rect, transformed by SkMatrix, can be quickly determined to be + outside of clip. May return false even though rect is outside of clip. + + Use to check if an area to be drawn is clipped out, to skip subsequent draw calls. + + @param rect SkRect to compare with clip + @return true if rect, transformed by SkMatrix, does not intersect clip + + example: https://fiddle.skia.org/c/@Canvas_quickReject + */ + bool quickReject(const SkRect& rect) const; + + /** Returns true if path, transformed by SkMatrix, can be quickly determined to be + outside of clip. May return false even though path is outside of clip. + + Use to check if an area to be drawn is clipped out, to skip subsequent draw calls. + + @param path SkPath to compare with clip + @return true if path, transformed by SkMatrix, does not intersect clip + + example: https://fiddle.skia.org/c/@Canvas_quickReject_2 + */ + bool quickReject(const SkPath& path) const; + + /** Returns bounds of clip, transformed by inverse of SkMatrix. If clip is empty, + return SkRect::MakeEmpty, where all SkRect sides equal zero. + + SkRect returned is outset by one to account for partial pixel coverage if clip + is anti-aliased. + + @return bounds of clip in local coordinates + + example: https://fiddle.skia.org/c/@Canvas_getLocalClipBounds + */ + SkRect getLocalClipBounds() const; + + /** Returns bounds of clip, transformed by inverse of SkMatrix. If clip is empty, + return false, and set bounds to SkRect::MakeEmpty, where all SkRect sides equal zero. + + bounds is outset by one to account for partial pixel coverage if clip + is anti-aliased. + + @param bounds SkRect of clip in local coordinates + @return true if clip bounds is not empty + */ + bool getLocalClipBounds(SkRect* bounds) const { + *bounds = this->getLocalClipBounds(); + return !bounds->isEmpty(); + } + + /** Returns SkIRect bounds of clip, unaffected by SkMatrix. If clip is empty, + return SkRect::MakeEmpty, where all SkRect sides equal zero. + + Unlike getLocalClipBounds(), returned SkIRect is not outset. + + @return bounds of clip in SkBaseDevice coordinates + + example: https://fiddle.skia.org/c/@Canvas_getDeviceClipBounds + */ + SkIRect getDeviceClipBounds() const; + + /** Returns SkIRect bounds of clip, unaffected by SkMatrix. If clip is empty, + return false, and set bounds to SkRect::MakeEmpty, where all SkRect sides equal zero. + + Unlike getLocalClipBounds(), bounds is not outset. + + @param bounds SkRect of clip in device coordinates + @return true if clip bounds is not empty + */ + bool getDeviceClipBounds(SkIRect* bounds) const { + *bounds = this->getDeviceClipBounds(); + return !bounds->isEmpty(); + } + + /** Fills clip with color color. + mode determines how ARGB is combined with destination. + + @param color unpremultiplied ARGB + @param mode SkBlendMode used to combine source color and destination + + example: https://fiddle.skia.org/c/@Canvas_drawColor + */ + void drawColor(SkColor color, SkBlendMode mode = SkBlendMode::kSrcOver) { + this->drawColor(SkColor4f::FromColor(color), mode); + } + + /** Fills clip with color color. + mode determines how ARGB is combined with destination. + + @param color SkColor4f representing unpremultiplied color. + @param mode SkBlendMode used to combine source color and destination + */ + void drawColor(const SkColor4f& color, SkBlendMode mode = SkBlendMode::kSrcOver); + + /** Fills clip with color color using SkBlendMode::kSrc. + This has the effect of replacing all pixels contained by clip with color. + + @param color unpremultiplied ARGB + */ + void clear(SkColor color) { + this->clear(SkColor4f::FromColor(color)); + } + + /** Fills clip with color color using SkBlendMode::kSrc. + This has the effect of replacing all pixels contained by clip with color. + + @param color SkColor4f representing unpremultiplied color. + */ + void clear(const SkColor4f& color) { + this->drawColor(color, SkBlendMode::kSrc); + } + + /** Makes SkCanvas contents undefined. Subsequent calls that read SkCanvas pixels, + such as drawing with SkBlendMode, return undefined results. discard() does + not change clip or SkMatrix. + + discard() may do nothing, depending on the implementation of SkSurface or SkBaseDevice + that created SkCanvas. + + discard() allows optimized performance on subsequent draws by removing + cached data associated with SkSurface or SkBaseDevice. + It is not necessary to call discard() once done with SkCanvas; + any cached data is deleted when owning SkSurface or SkBaseDevice is deleted. + */ + void discard() { this->onDiscard(); } + + /** Fills clip with SkPaint paint. SkPaint components, SkShader, + SkColorFilter, SkImageFilter, and SkBlendMode affect drawing; + SkMaskFilter and SkPathEffect in paint are ignored. + + @param paint graphics state used to fill SkCanvas + + example: https://fiddle.skia.org/c/@Canvas_drawPaint + */ + void drawPaint(const SkPaint& paint); + + /** \enum SkCanvas::PointMode + Selects if an array of points are drawn as discrete points, as lines, or as + an open polygon. + */ + enum PointMode { + kPoints_PointMode, //!< draw each point separately + kLines_PointMode, //!< draw each pair of points as a line segment + kPolygon_PointMode, //!< draw the array of points as a open polygon + }; + + /** Draws pts using clip, SkMatrix and SkPaint paint. + count is the number of points; if count is less than one, has no effect. + mode may be one of: kPoints_PointMode, kLines_PointMode, or kPolygon_PointMode. + + If mode is kPoints_PointMode, the shape of point drawn depends on paint + SkPaint::Cap. If paint is set to SkPaint::kRound_Cap, each point draws a + circle of diameter SkPaint stroke width. If paint is set to SkPaint::kSquare_Cap + or SkPaint::kButt_Cap, each point draws a square of width and height + SkPaint stroke width. + + If mode is kLines_PointMode, each pair of points draws a line segment. + One line is drawn for every two points; each point is used once. If count is odd, + the final point is ignored. + + If mode is kPolygon_PointMode, each adjacent pair of points draws a line segment. + count minus one lines are drawn; the first and last point are used once. + + Each line segment respects paint SkPaint::Cap and SkPaint stroke width. + SkPaint::Style is ignored, as if were set to SkPaint::kStroke_Style. + + Always draws each element one at a time; is not affected by + SkPaint::Join, and unlike drawPath(), does not create a mask from all points + and lines before drawing. + + @param mode whether pts draws points or lines + @param count number of points in the array + @param pts array of points to draw + @param paint stroke, blend, color, and so on, used to draw + + example: https://fiddle.skia.org/c/@Canvas_drawPoints + */ + void drawPoints(PointMode mode, size_t count, const SkPoint pts[], const SkPaint& paint); + + /** Draws point at (x, y) using clip, SkMatrix and SkPaint paint. + + The shape of point drawn depends on paint SkPaint::Cap. + If paint is set to SkPaint::kRound_Cap, draw a circle of diameter + SkPaint stroke width. If paint is set to SkPaint::kSquare_Cap or SkPaint::kButt_Cap, + draw a square of width and height SkPaint stroke width. + SkPaint::Style is ignored, as if were set to SkPaint::kStroke_Style. + + @param x left edge of circle or square + @param y top edge of circle or square + @param paint stroke, blend, color, and so on, used to draw + + example: https://fiddle.skia.org/c/@Canvas_drawPoint + */ + void drawPoint(SkScalar x, SkScalar y, const SkPaint& paint); + + /** Draws point p using clip, SkMatrix and SkPaint paint. + + The shape of point drawn depends on paint SkPaint::Cap. + If paint is set to SkPaint::kRound_Cap, draw a circle of diameter + SkPaint stroke width. If paint is set to SkPaint::kSquare_Cap or SkPaint::kButt_Cap, + draw a square of width and height SkPaint stroke width. + SkPaint::Style is ignored, as if were set to SkPaint::kStroke_Style. + + @param p top-left edge of circle or square + @param paint stroke, blend, color, and so on, used to draw + */ + void drawPoint(SkPoint p, const SkPaint& paint) { + this->drawPoint(p.x(), p.y(), paint); + } + + /** Draws line segment from (x0, y0) to (x1, y1) using clip, SkMatrix, and SkPaint paint. + In paint: SkPaint stroke width describes the line thickness; + SkPaint::Cap draws the end rounded or square; + SkPaint::Style is ignored, as if were set to SkPaint::kStroke_Style. + + @param x0 start of line segment on x-axis + @param y0 start of line segment on y-axis + @param x1 end of line segment on x-axis + @param y1 end of line segment on y-axis + @param paint stroke, blend, color, and so on, used to draw + + example: https://fiddle.skia.org/c/@Canvas_drawLine + */ + void drawLine(SkScalar x0, SkScalar y0, SkScalar x1, SkScalar y1, const SkPaint& paint); + + /** Draws line segment from p0 to p1 using clip, SkMatrix, and SkPaint paint. + In paint: SkPaint stroke width describes the line thickness; + SkPaint::Cap draws the end rounded or square; + SkPaint::Style is ignored, as if were set to SkPaint::kStroke_Style. + + @param p0 start of line segment + @param p1 end of line segment + @param paint stroke, blend, color, and so on, used to draw + */ + void drawLine(SkPoint p0, SkPoint p1, const SkPaint& paint) { + this->drawLine(p0.x(), p0.y(), p1.x(), p1.y(), paint); + } + + /** Draws SkRect rect using clip, SkMatrix, and SkPaint paint. + In paint: SkPaint::Style determines if rectangle is stroked or filled; + if stroked, SkPaint stroke width describes the line thickness, and + SkPaint::Join draws the corners rounded or square. + + @param rect rectangle to draw + @param paint stroke or fill, blend, color, and so on, used to draw + + example: https://fiddle.skia.org/c/@Canvas_drawRect + */ + void drawRect(const SkRect& rect, const SkPaint& paint); + + /** Draws SkIRect rect using clip, SkMatrix, and SkPaint paint. + In paint: SkPaint::Style determines if rectangle is stroked or filled; + if stroked, SkPaint stroke width describes the line thickness, and + SkPaint::Join draws the corners rounded or square. + + @param rect rectangle to draw + @param paint stroke or fill, blend, color, and so on, used to draw + */ + void drawIRect(const SkIRect& rect, const SkPaint& paint) { + SkRect r; + r.set(rect); // promotes the ints to scalars + this->drawRect(r, paint); + } + + /** Draws SkRegion region using clip, SkMatrix, and SkPaint paint. + In paint: SkPaint::Style determines if rectangle is stroked or filled; + if stroked, SkPaint stroke width describes the line thickness, and + SkPaint::Join draws the corners rounded or square. + + @param region region to draw + @param paint SkPaint stroke or fill, blend, color, and so on, used to draw + + example: https://fiddle.skia.org/c/@Canvas_drawRegion + */ + void drawRegion(const SkRegion& region, const SkPaint& paint); + + /** Draws oval oval using clip, SkMatrix, and SkPaint. + In paint: SkPaint::Style determines if oval is stroked or filled; + if stroked, SkPaint stroke width describes the line thickness. + + @param oval SkRect bounds of oval + @param paint SkPaint stroke or fill, blend, color, and so on, used to draw + + example: https://fiddle.skia.org/c/@Canvas_drawOval + */ + void drawOval(const SkRect& oval, const SkPaint& paint); + + /** Draws SkRRect rrect using clip, SkMatrix, and SkPaint paint. + In paint: SkPaint::Style determines if rrect is stroked or filled; + if stroked, SkPaint stroke width describes the line thickness. + + rrect may represent a rectangle, circle, oval, uniformly rounded rectangle, or + may have any combination of positive non-square radii for the four corners. + + @param rrect SkRRect with up to eight corner radii to draw + @param paint SkPaint stroke or fill, blend, color, and so on, used to draw + + example: https://fiddle.skia.org/c/@Canvas_drawRRect + */ + void drawRRect(const SkRRect& rrect, const SkPaint& paint); + + /** Draws SkRRect outer and inner + using clip, SkMatrix, and SkPaint paint. + outer must contain inner or the drawing is undefined. + In paint: SkPaint::Style determines if SkRRect is stroked or filled; + if stroked, SkPaint stroke width describes the line thickness. + If stroked and SkRRect corner has zero length radii, SkPaint::Join can + draw corners rounded or square. + + GPU-backed platforms optimize drawing when both outer and inner are + concave and outer contains inner. These platforms may not be able to draw + SkPath built with identical data as fast. + + @param outer SkRRect outer bounds to draw + @param inner SkRRect inner bounds to draw + @param paint SkPaint stroke or fill, blend, color, and so on, used to draw + + example: https://fiddle.skia.org/c/@Canvas_drawDRRect_a + example: https://fiddle.skia.org/c/@Canvas_drawDRRect_b + */ + void drawDRRect(const SkRRect& outer, const SkRRect& inner, const SkPaint& paint); + + /** Draws circle at (cx, cy) with radius using clip, SkMatrix, and SkPaint paint. + If radius is zero or less, nothing is drawn. + In paint: SkPaint::Style determines if circle is stroked or filled; + if stroked, SkPaint stroke width describes the line thickness. + + @param cx circle center on the x-axis + @param cy circle center on the y-axis + @param radius half the diameter of circle + @param paint SkPaint stroke or fill, blend, color, and so on, used to draw + + example: https://fiddle.skia.org/c/@Canvas_drawCircle + */ + void drawCircle(SkScalar cx, SkScalar cy, SkScalar radius, const SkPaint& paint); + + /** Draws circle at center with radius using clip, SkMatrix, and SkPaint paint. + If radius is zero or less, nothing is drawn. + In paint: SkPaint::Style determines if circle is stroked or filled; + if stroked, SkPaint stroke width describes the line thickness. + + @param center circle center + @param radius half the diameter of circle + @param paint SkPaint stroke or fill, blend, color, and so on, used to draw + */ + void drawCircle(SkPoint center, SkScalar radius, const SkPaint& paint) { + this->drawCircle(center.x(), center.y(), radius, paint); + } + + /** Draws arc using clip, SkMatrix, and SkPaint paint. + + Arc is part of oval bounded by oval, sweeping from startAngle to startAngle plus + sweepAngle. startAngle and sweepAngle are in degrees. + + startAngle of zero places start point at the right middle edge of oval. + A positive sweepAngle places arc end point clockwise from start point; + a negative sweepAngle places arc end point counterclockwise from start point. + sweepAngle may exceed 360 degrees, a full circle. + If useCenter is true, draw a wedge that includes lines from oval + center to arc end points. If useCenter is false, draw arc between end points. + + If SkRect oval is empty or sweepAngle is zero, nothing is drawn. + + @param oval SkRect bounds of oval containing arc to draw + @param startAngle angle in degrees where arc begins + @param sweepAngle sweep angle in degrees; positive is clockwise + @param useCenter if true, include the center of the oval + @param paint SkPaint stroke or fill, blend, color, and so on, used to draw + */ + void drawArc(const SkRect& oval, SkScalar startAngle, SkScalar sweepAngle, + bool useCenter, const SkPaint& paint); + + /** Draws SkRRect bounded by SkRect rect, with corner radii (rx, ry) using clip, + SkMatrix, and SkPaint paint. + + In paint: SkPaint::Style determines if SkRRect is stroked or filled; + if stroked, SkPaint stroke width describes the line thickness. + If rx or ry are less than zero, they are treated as if they are zero. + If rx plus ry exceeds rect width or rect height, radii are scaled down to fit. + If rx and ry are zero, SkRRect is drawn as SkRect and if stroked is affected by + SkPaint::Join. + + @param rect SkRect bounds of SkRRect to draw + @param rx axis length on x-axis of oval describing rounded corners + @param ry axis length on y-axis of oval describing rounded corners + @param paint stroke, blend, color, and so on, used to draw + + example: https://fiddle.skia.org/c/@Canvas_drawRoundRect + */ + void drawRoundRect(const SkRect& rect, SkScalar rx, SkScalar ry, const SkPaint& paint); + + /** Draws SkPath path using clip, SkMatrix, and SkPaint paint. + SkPath contains an array of path contour, each of which may be open or closed. + + In paint: SkPaint::Style determines if SkRRect is stroked or filled: + if filled, SkPath::FillType determines whether path contour describes inside or + outside of fill; if stroked, SkPaint stroke width describes the line thickness, + SkPaint::Cap describes line ends, and SkPaint::Join describes how + corners are drawn. + + @param path SkPath to draw + @param paint stroke, blend, color, and so on, used to draw + + example: https://fiddle.skia.org/c/@Canvas_drawPath + */ + void drawPath(const SkPath& path, const SkPaint& paint); + + void drawImage(const SkImage* image, SkScalar left, SkScalar top) { + this->drawImage(image, left, top, SkSamplingOptions(), nullptr); + } + void drawImage(const sk_sp<SkImage>& image, SkScalar left, SkScalar top) { + this->drawImage(image.get(), left, top, SkSamplingOptions(), nullptr); + } + + /** \enum SkCanvas::SrcRectConstraint + SrcRectConstraint controls the behavior at the edge of source SkRect, + provided to drawImageRect() when there is any filtering. If kStrict is set, + then extra code is used to ensure it nevers samples outside of the src-rect. + */ + enum SrcRectConstraint { + kStrict_SrcRectConstraint, //!< sample only inside bounds; slower + kFast_SrcRectConstraint, //!< sample outside bounds; faster + }; + + void drawImage(const SkImage*, SkScalar x, SkScalar y, const SkSamplingOptions&, + const SkPaint* = nullptr); + void drawImage(const sk_sp<SkImage>& image, SkScalar x, SkScalar y, + const SkSamplingOptions& sampling, const SkPaint* paint = nullptr) { + this->drawImage(image.get(), x, y, sampling, paint); + } + void drawImageRect(const SkImage*, const SkRect& src, const SkRect& dst, + const SkSamplingOptions&, const SkPaint*, SrcRectConstraint); + void drawImageRect(const SkImage*, const SkRect& dst, const SkSamplingOptions&, + const SkPaint* = nullptr); + void drawImageRect(const sk_sp<SkImage>& image, const SkRect& src, const SkRect& dst, + const SkSamplingOptions& sampling, const SkPaint* paint, + SrcRectConstraint constraint) { + this->drawImageRect(image.get(), src, dst, sampling, paint, constraint); + } + void drawImageRect(const sk_sp<SkImage>& image, const SkRect& dst, + const SkSamplingOptions& sampling, const SkPaint* paint = nullptr) { + this->drawImageRect(image.get(), dst, sampling, paint); + } + + /** Draws SkImage image stretched proportionally to fit into SkRect dst. + SkIRect center divides the image into nine sections: four sides, four corners, and + the center. Corners are unmodified or scaled down proportionately if their sides + are larger than dst; center and four sides are scaled to fit remaining space, if any. + + Additionally transform draw using clip, SkMatrix, and optional SkPaint paint. + + If SkPaint paint is supplied, apply SkColorFilter, alpha, SkImageFilter, and + SkBlendMode. If image is kAlpha_8_SkColorType, apply SkShader. + If paint contains SkMaskFilter, generate mask from image bounds. + Any SkMaskFilter on paint is ignored as is paint anti-aliasing state. + + If generated mask extends beyond image bounds, replicate image edge colors, just + as SkShader made from SkImage::makeShader with SkShader::kClamp_TileMode set + replicates the image edge color when it samples outside of its bounds. + + @param image SkImage containing pixels, dimensions, and format + @param center SkIRect edge of image corners and sides + @param dst destination SkRect of image to draw to + @param filter what technique to use when sampling the image + @param paint SkPaint containing SkBlendMode, SkColorFilter, SkImageFilter, + and so on; or nullptr + */ + void drawImageNine(const SkImage* image, const SkIRect& center, const SkRect& dst, + SkFilterMode filter, const SkPaint* paint = nullptr); + + /** \struct SkCanvas::Lattice + SkCanvas::Lattice divides SkBitmap or SkImage into a rectangular grid. + Grid entries on even columns and even rows are fixed; these entries are + always drawn at their original size if the destination is large enough. + If the destination side is too small to hold the fixed entries, all fixed + entries are proportionately scaled down to fit. + The grid entries not on even columns and rows are scaled to fit the + remaining space, if any. + */ + struct Lattice { + + /** \enum SkCanvas::Lattice::RectType + Optional setting per rectangular grid entry to make it transparent, + or to fill the grid entry with a color. + */ + enum RectType : uint8_t { + kDefault = 0, //!< draws SkBitmap into lattice rectangle + kTransparent, //!< skips lattice rectangle by making it transparent + kFixedColor, //!< draws one of fColors into lattice rectangle + }; + + const int* fXDivs; //!< x-axis values dividing bitmap + const int* fYDivs; //!< y-axis values dividing bitmap + const RectType* fRectTypes; //!< array of fill types + int fXCount; //!< number of x-coordinates + int fYCount; //!< number of y-coordinates + const SkIRect* fBounds; //!< source bounds to draw from + const SkColor* fColors; //!< array of colors + }; + + /** Draws SkImage image stretched proportionally to fit into SkRect dst. + + SkCanvas::Lattice lattice divides image into a rectangular grid. + Each intersection of an even-numbered row and column is fixed; + fixed lattice elements never scale larger than their initial + size and shrink proportionately when all fixed elements exceed the bitmap + dimension. All other grid elements scale to fill the available space, if any. + + Additionally transform draw using clip, SkMatrix, and optional SkPaint paint. + + If SkPaint paint is supplied, apply SkColorFilter, alpha, SkImageFilter, and + SkBlendMode. If image is kAlpha_8_SkColorType, apply SkShader. + If paint contains SkMaskFilter, generate mask from image bounds. + Any SkMaskFilter on paint is ignored as is paint anti-aliasing state. + + If generated mask extends beyond bitmap bounds, replicate bitmap edge colors, + just as SkShader made from SkShader::MakeBitmapShader with + SkShader::kClamp_TileMode set replicates the bitmap edge color when it samples + outside of its bounds. + + @param image SkImage containing pixels, dimensions, and format + @param lattice division of bitmap into fixed and variable rectangles + @param dst destination SkRect of image to draw to + @param filter what technique to use when sampling the image + @param paint SkPaint containing SkBlendMode, SkColorFilter, SkImageFilter, + and so on; or nullptr + */ + void drawImageLattice(const SkImage* image, const Lattice& lattice, const SkRect& dst, + SkFilterMode filter, const SkPaint* paint = nullptr); + void drawImageLattice(const SkImage* image, const Lattice& lattice, const SkRect& dst) { + this->drawImageLattice(image, lattice, dst, SkFilterMode::kNearest, nullptr); + } + + /** + * Experimental. Controls anti-aliasing of each edge of images in an image-set. + */ + enum QuadAAFlags : unsigned { + kLeft_QuadAAFlag = 0b0001, + kTop_QuadAAFlag = 0b0010, + kRight_QuadAAFlag = 0b0100, + kBottom_QuadAAFlag = 0b1000, + + kNone_QuadAAFlags = 0b0000, + kAll_QuadAAFlags = 0b1111, + }; + + /** This is used by the experimental API below. */ + struct SK_API ImageSetEntry { + ImageSetEntry(sk_sp<const SkImage> image, const SkRect& srcRect, const SkRect& dstRect, + int matrixIndex, float alpha, unsigned aaFlags, bool hasClip); + + ImageSetEntry(sk_sp<const SkImage> image, const SkRect& srcRect, const SkRect& dstRect, + float alpha, unsigned aaFlags); + + ImageSetEntry(); + ~ImageSetEntry(); + ImageSetEntry(const ImageSetEntry&); + ImageSetEntry& operator=(const ImageSetEntry&); + + sk_sp<const SkImage> fImage; + SkRect fSrcRect; + SkRect fDstRect; + int fMatrixIndex = -1; // Index into the preViewMatrices arg, or < 0 + float fAlpha = 1.f; + unsigned fAAFlags = kNone_QuadAAFlags; // QuadAAFlags + bool fHasClip = false; // True to use next 4 points in dstClip arg as quad + }; + + /** + * This is an experimental API for the SkiaRenderer Chromium project, and its API will surely + * evolve if it is not removed outright. + * + * This behaves very similarly to drawRect() combined with a clipPath() formed by clip + * quadrilateral. 'rect' and 'clip' are in the same coordinate space. If 'clip' is null, then it + * is as if the rectangle was not clipped (or, alternatively, clipped to itself). If not null, + * then it must provide 4 points. + * + * In addition to combining the draw and clipping into one operation, this function adds the + * additional capability of controlling each of the rectangle's edges anti-aliasing + * independently. The edges of the clip will respect the per-edge AA flags. It is required that + * 'clip' be contained inside 'rect'. In terms of mapping to edge labels, the 'clip' points + * should be ordered top-left, top-right, bottom-right, bottom-left so that the edge between [0] + * and [1] is "top", [1] and [2] is "right", [2] and [3] is "bottom", and [3] and [0] is "left". + * This ordering matches SkRect::toQuad(). + * + * This API only draws solid color, filled rectangles so it does not accept a full SkPaint. + */ + void experimental_DrawEdgeAAQuad(const SkRect& rect, const SkPoint clip[4], QuadAAFlags aaFlags, + const SkColor4f& color, SkBlendMode mode); + void experimental_DrawEdgeAAQuad(const SkRect& rect, const SkPoint clip[4], QuadAAFlags aaFlags, + SkColor color, SkBlendMode mode) { + this->experimental_DrawEdgeAAQuad(rect, clip, aaFlags, SkColor4f::FromColor(color), mode); + } + + /** + * This is an bulk variant of experimental_DrawEdgeAAQuad() that renders 'cnt' textured quads. + * For each entry, 'fDstRect' is rendered with its clip (determined by entry's 'fHasClip' and + * the current index in 'dstClip'). The entry's fImage is applied to the destination rectangle + * by sampling from 'fSrcRect' sub-image. The corners of 'fSrcRect' map to the corners of + * 'fDstRect', just like in drawImageRect(), and they will be properly interpolated when + * applying a clip. + * + * Like experimental_DrawEdgeAAQuad(), each entry can specify edge AA flags that apply to both + * the destination rect and its clip. + * + * If provided, the 'dstClips' array must have length equal 4 * the number of entries with + * fHasClip true. If 'dstClips' is null, every entry must have 'fHasClip' set to false. The + * destination clip coordinates will be read consecutively with the image set entries, advancing + * by 4 points every time an entry with fHasClip is passed. + * + * This entry point supports per-entry manipulations to the canvas's current matrix. If an + * entry provides 'fMatrixIndex' >= 0, it will be drawn as if the canvas's CTM was + * canvas->getTotalMatrix() * preViewMatrices[fMatrixIndex]. If 'fMatrixIndex' is less than 0, + * the pre-view matrix transform is implicitly the identity, so it will be drawn using just the + * current canvas matrix. The pre-view matrix modifies the canvas's view matrix, it does not + * affect the local coordinates of each entry. + * + * An optional paint may be provided, which supports the same subset of features usable with + * drawImageRect (i.e. assumed to be filled and no path effects). When a paint is provided, the + * image set is drawn as if each image used the applied paint independently, so each is affected + * by the image, color, and/or mask filter. + */ + void experimental_DrawEdgeAAImageSet(const ImageSetEntry imageSet[], int cnt, + const SkPoint dstClips[], const SkMatrix preViewMatrices[], + const SkSamplingOptions&, const SkPaint* paint = nullptr, + SrcRectConstraint constraint = kStrict_SrcRectConstraint); + + /** Draws text, with origin at (x, y), using clip, SkMatrix, SkFont font, + and SkPaint paint. + + When encoding is SkTextEncoding::kUTF8, SkTextEncoding::kUTF16, or + SkTextEncoding::kUTF32, this function uses the default + character-to-glyph mapping from the SkTypeface in font. It does not + perform typeface fallback for characters not found in the SkTypeface. + It does not perform kerning or other complex shaping; glyphs are + positioned based on their default advances. + + Text meaning depends on SkTextEncoding. + + Text size is affected by SkMatrix and SkFont text size. Default text + size is 12 point. + + All elements of paint: SkPathEffect, SkMaskFilter, SkShader, + SkColorFilter, and SkImageFilter; apply to text. By + default, draws filled black glyphs. + + @param text character code points or glyphs drawn + @param byteLength byte length of text array + @param encoding text encoding used in the text array + @param x start of text on x-axis + @param y start of text on y-axis + @param font typeface, text size and so, used to describe the text + @param paint blend, color, and so on, used to draw + */ + void drawSimpleText(const void* text, size_t byteLength, SkTextEncoding encoding, + SkScalar x, SkScalar y, const SkFont& font, const SkPaint& paint); + + /** Draws null terminated string, with origin at (x, y), using clip, SkMatrix, + SkFont font, and SkPaint paint. + + This function uses the default character-to-glyph mapping from the + SkTypeface in font. It does not perform typeface fallback for + characters not found in the SkTypeface. It does not perform kerning; + glyphs are positioned based on their default advances. + + String str is encoded as UTF-8. + + Text size is affected by SkMatrix and font text size. Default text + size is 12 point. + + All elements of paint: SkPathEffect, SkMaskFilter, SkShader, + SkColorFilter, and SkImageFilter; apply to text. By + default, draws filled black glyphs. + + @param str character code points drawn, + ending with a char value of zero + @param x start of string on x-axis + @param y start of string on y-axis + @param font typeface, text size and so, used to describe the text + @param paint blend, color, and so on, used to draw + */ + void drawString(const char str[], SkScalar x, SkScalar y, const SkFont& font, + const SkPaint& paint) { + this->drawSimpleText(str, strlen(str), SkTextEncoding::kUTF8, x, y, font, paint); + } + + /** Draws SkString, with origin at (x, y), using clip, SkMatrix, SkFont font, + and SkPaint paint. + + This function uses the default character-to-glyph mapping from the + SkTypeface in font. It does not perform typeface fallback for + characters not found in the SkTypeface. It does not perform kerning; + glyphs are positioned based on their default advances. + + SkString str is encoded as UTF-8. + + Text size is affected by SkMatrix and SkFont text size. Default text + size is 12 point. + + All elements of paint: SkPathEffect, SkMaskFilter, SkShader, + SkColorFilter, and SkImageFilter; apply to text. By + default, draws filled black glyphs. + + @param str character code points drawn, + ending with a char value of zero + @param x start of string on x-axis + @param y start of string on y-axis + @param font typeface, text size and so, used to describe the text + @param paint blend, color, and so on, used to draw + */ + void drawString(const SkString& str, SkScalar x, SkScalar y, const SkFont& font, + const SkPaint& paint) { + this->drawSimpleText(str.c_str(), str.size(), SkTextEncoding::kUTF8, x, y, font, paint); + } + + /** Draws count glyphs, at positions relative to origin styled with font and paint with + supporting utf8 and cluster information. + + This function draw glyphs at the given positions relative to the given origin. + It does not perform typeface fallback for glyphs not found in the SkTypeface in font. + + The drawing obeys the current transform matrix and clipping. + + All elements of paint: SkPathEffect, SkMaskFilter, SkShader, + SkColorFilter, and SkImageFilter; apply to text. By + default, draws filled black glyphs. + + @param count number of glyphs to draw + @param glyphs the array of glyphIDs to draw + @param positions where to draw each glyph relative to origin + @param clusters array of size count of cluster information + @param textByteCount size of the utf8text + @param utf8text utf8text supporting information for the glyphs + @param origin the origin of all the positions + @param font typeface, text size and so, used to describe the text + @param paint blend, color, and so on, used to draw + */ + void drawGlyphs(int count, const SkGlyphID glyphs[], const SkPoint positions[], + const uint32_t clusters[], int textByteCount, const char utf8text[], + SkPoint origin, const SkFont& font, const SkPaint& paint); + + /** Draws count glyphs, at positions relative to origin styled with font and paint. + + This function draw glyphs at the given positions relative to the given origin. + It does not perform typeface fallback for glyphs not found in the SkTypeface in font. + + The drawing obeys the current transform matrix and clipping. + + All elements of paint: SkPathEffect, SkMaskFilter, SkShader, + SkColorFilter, and SkImageFilter; apply to text. By + default, draws filled black glyphs. + + @param count number of glyphs to draw + @param glyphs the array of glyphIDs to draw + @param positions where to draw each glyph relative to origin + @param origin the origin of all the positions + @param font typeface, text size and so, used to describe the text + @param paint blend, color, and so on, used to draw + */ + void drawGlyphs(int count, const SkGlyphID glyphs[], const SkPoint positions[], + SkPoint origin, const SkFont& font, const SkPaint& paint); + + /** Draws count glyphs, at positions relative to origin styled with font and paint. + + This function draw glyphs using the given scaling and rotations. They are positioned + relative to the given origin. It does not perform typeface fallback for glyphs not found + in the SkTypeface in font. + + The drawing obeys the current transform matrix and clipping. + + All elements of paint: SkPathEffect, SkMaskFilter, SkShader, + SkColorFilter, and SkImageFilter; apply to text. By + default, draws filled black glyphs. + + @param count number of glyphs to draw + @param glyphs the array of glyphIDs to draw + @param xforms where to draw and orient each glyph + @param origin the origin of all the positions + @param font typeface, text size and so, used to describe the text + @param paint blend, color, and so on, used to draw + */ + void drawGlyphs(int count, const SkGlyphID glyphs[], const SkRSXform xforms[], + SkPoint origin, const SkFont& font, const SkPaint& paint); + + /** Draws SkTextBlob blob at (x, y), using clip, SkMatrix, and SkPaint paint. + + blob contains glyphs, their positions, and paint attributes specific to text: + SkTypeface, SkPaint text size, SkPaint text scale x, + SkPaint text skew x, SkPaint::Align, SkPaint::Hinting, anti-alias, SkPaint fake bold, + SkPaint font embedded bitmaps, SkPaint full hinting spacing, LCD text, SkPaint linear text, + and SkPaint subpixel text. + + SkTextEncoding must be set to SkTextEncoding::kGlyphID. + + Elements of paint: anti-alias, SkBlendMode, color including alpha, + SkColorFilter, SkPaint dither, SkMaskFilter, SkPathEffect, SkShader, and + SkPaint::Style; apply to blob. If SkPaint contains SkPaint::kStroke_Style: + SkPaint miter limit, SkPaint::Cap, SkPaint::Join, and SkPaint stroke width; + apply to SkPath created from blob. + + @param blob glyphs, positions, and their paints' text size, typeface, and so on + @param x horizontal offset applied to blob + @param y vertical offset applied to blob + @param paint blend, color, stroking, and so on, used to draw + + example: https://fiddle.skia.org/c/@Canvas_drawTextBlob + */ + void drawTextBlob(const SkTextBlob* blob, SkScalar x, SkScalar y, const SkPaint& paint); + + /** Draws SkTextBlob blob at (x, y), using clip, SkMatrix, and SkPaint paint. + + blob contains glyphs, their positions, and paint attributes specific to text: + SkTypeface, SkPaint text size, SkPaint text scale x, + SkPaint text skew x, SkPaint::Align, SkPaint::Hinting, anti-alias, SkPaint fake bold, + SkPaint font embedded bitmaps, SkPaint full hinting spacing, LCD text, SkPaint linear text, + and SkPaint subpixel text. + + SkTextEncoding must be set to SkTextEncoding::kGlyphID. + + Elements of paint: SkPathEffect, SkMaskFilter, SkShader, SkColorFilter, + and SkImageFilter; apply to blob. + + @param blob glyphs, positions, and their paints' text size, typeface, and so on + @param x horizontal offset applied to blob + @param y vertical offset applied to blob + @param paint blend, color, stroking, and so on, used to draw + */ + void drawTextBlob(const sk_sp<SkTextBlob>& blob, SkScalar x, SkScalar y, const SkPaint& paint) { + this->drawTextBlob(blob.get(), x, y, paint); + } + + /** Draws SkPicture picture, using clip and SkMatrix. + Clip and SkMatrix are unchanged by picture contents, as if + save() was called before and restore() was called after drawPicture(). + + SkPicture records a series of draw commands for later playback. + + @param picture recorded drawing commands to play + */ + void drawPicture(const SkPicture* picture) { + this->drawPicture(picture, nullptr, nullptr); + } + + /** Draws SkPicture picture, using clip and SkMatrix. + Clip and SkMatrix are unchanged by picture contents, as if + save() was called before and restore() was called after drawPicture(). + + SkPicture records a series of draw commands for later playback. + + @param picture recorded drawing commands to play + */ + void drawPicture(const sk_sp<SkPicture>& picture) { + this->drawPicture(picture.get()); + } + + /** Draws SkPicture picture, using clip and SkMatrix; transforming picture with + SkMatrix matrix, if provided; and use SkPaint paint alpha, SkColorFilter, + SkImageFilter, and SkBlendMode, if provided. + + If paint is non-null, then the picture is always drawn into a temporary layer before + actually landing on the canvas. Note that drawing into a layer can also change its + appearance if there are any non-associative blendModes inside any of the pictures elements. + + @param picture recorded drawing commands to play + @param matrix SkMatrix to rotate, scale, translate, and so on; may be nullptr + @param paint SkPaint to apply transparency, filtering, and so on; may be nullptr + + example: https://fiddle.skia.org/c/@Canvas_drawPicture_3 + */ + void drawPicture(const SkPicture* picture, const SkMatrix* matrix, const SkPaint* paint); + + /** Draws SkPicture picture, using clip and SkMatrix; transforming picture with + SkMatrix matrix, if provided; and use SkPaint paint alpha, SkColorFilter, + SkImageFilter, and SkBlendMode, if provided. + + If paint is non-null, then the picture is always drawn into a temporary layer before + actually landing on the canvas. Note that drawing into a layer can also change its + appearance if there are any non-associative blendModes inside any of the pictures elements. + + @param picture recorded drawing commands to play + @param matrix SkMatrix to rotate, scale, translate, and so on; may be nullptr + @param paint SkPaint to apply transparency, filtering, and so on; may be nullptr + */ + void drawPicture(const sk_sp<SkPicture>& picture, const SkMatrix* matrix, + const SkPaint* paint) { + this->drawPicture(picture.get(), matrix, paint); + } + + /** Draws SkVertices vertices, a triangle mesh, using clip and SkMatrix. + If paint contains an SkShader and vertices does not contain texCoords, the shader + is mapped using the vertices' positions. + + SkBlendMode is ignored if SkVertices does not have colors. Otherwise, it combines + - the SkShader if SkPaint contains SkShader + - or the opaque SkPaint color if SkPaint does not contain SkShader + as the src of the blend and the interpolated vertex colors as the dst. + + SkMaskFilter, SkPathEffect, and antialiasing on SkPaint are ignored. + + @param vertices triangle mesh to draw + @param mode combines vertices' colors with SkShader if present or SkPaint opaque color + if not. Ignored if the vertices do not contain color. + @param paint specifies the SkShader, used as SkVertices texture, and SkColorFilter. + + example: https://fiddle.skia.org/c/@Canvas_drawVertices + */ + void drawVertices(const SkVertices* vertices, SkBlendMode mode, const SkPaint& paint); + + /** Draws SkVertices vertices, a triangle mesh, using clip and SkMatrix. + If paint contains an SkShader and vertices does not contain texCoords, the shader + is mapped using the vertices' positions. + + SkBlendMode is ignored if SkVertices does not have colors. Otherwise, it combines + - the SkShader if SkPaint contains SkShader + - or the opaque SkPaint color if SkPaint does not contain SkShader + as the src of the blend and the interpolated vertex colors as the dst. + + SkMaskFilter, SkPathEffect, and antialiasing on SkPaint are ignored. + + @param vertices triangle mesh to draw + @param mode combines vertices' colors with SkShader if present or SkPaint opaque color + if not. Ignored if the vertices do not contain color. + @param paint specifies the SkShader, used as SkVertices texture, may be nullptr + + example: https://fiddle.skia.org/c/@Canvas_drawVertices_2 + */ + void drawVertices(const sk_sp<SkVertices>& vertices, SkBlendMode mode, const SkPaint& paint); + +#if defined(SK_ENABLE_EXPERIMENTAL_CUSTOM_MESH) && defined(SK_ENABLE_SKSL) + /** + Experimental, under active development, and subject to change without notice. + + Draws a mesh using a user-defined specification (see SkCustomMeshSpecification). + + SkBlender is ignored if SkCustomMesh's specification does not output fragment shader color. + Otherwise, it combines + - the SkShader if SkPaint contains SkShader + - or the opaque SkPaint color if SkPaint does not contain SkShader + as the src of the blend and the mesh's fragment color as the dst. + + SkMaskFilter, SkPathEffect, and antialiasing on SkPaint are ignored. + + @param cm the custom mesh vertices and compatible specification. + @param blender combines vertices colors with SkShader if present or SkPaint opaque color + if not. Ignored if the custom mesh does not output color. Defaults to + SkBlendMode::kModulate if nullptr. + @param paint specifies the SkShader, used as SkVertices texture, may be nullptr + */ + void drawCustomMesh(SkCustomMesh cm, sk_sp<SkBlender> blender, const SkPaint& paint); +#endif + + /** Draws a Coons patch: the interpolation of four cubics with shared corners, + associating a color, and optionally a texture SkPoint, with each corner. + + SkPoint array cubics specifies four SkPath cubic starting at the top-left corner, + in clockwise order, sharing every fourth point. The last SkPath cubic ends at the + first point. + + Color array color associates colors with corners in top-left, top-right, + bottom-right, bottom-left order. + + If paint contains SkShader, SkPoint array texCoords maps SkShader as texture to + corners in top-left, top-right, bottom-right, bottom-left order. If texCoords is + nullptr, SkShader is mapped using positions (derived from cubics). + + SkBlendMode is ignored if colors is null. Otherwise, it combines + - the SkShader if SkPaint contains SkShader + - or the opaque SkPaint color if SkPaint does not contain SkShader + as the src of the blend and the interpolated patch colors as the dst. + + SkMaskFilter, SkPathEffect, and antialiasing on SkPaint are ignored. + + @param cubics SkPath cubic array, sharing common points + @param colors color array, one for each corner + @param texCoords SkPoint array of texture coordinates, mapping SkShader to corners; + may be nullptr + @param mode combines patch's colors with SkShader if present or SkPaint opaque color + if not. Ignored if colors is null. + @param paint SkShader, SkColorFilter, SkBlendMode, used to draw + */ + void drawPatch(const SkPoint cubics[12], const SkColor colors[4], + const SkPoint texCoords[4], SkBlendMode mode, const SkPaint& paint); + + /** Draws a set of sprites from atlas, using clip, SkMatrix, and optional SkPaint paint. + paint uses anti-alias, alpha, SkColorFilter, SkImageFilter, and SkBlendMode + to draw, if present. For each entry in the array, SkRect tex locates sprite in + atlas, and SkRSXform xform transforms it into destination space. + + SkMaskFilter and SkPathEffect on paint are ignored. + + xform, tex, and colors if present, must contain count entries. + Optional colors are applied for each sprite using SkBlendMode mode, treating + sprite as source and colors as destination. + Optional cullRect is a conservative bounds of all transformed sprites. + If cullRect is outside of clip, canvas can skip drawing. + + If atlas is nullptr, this draws nothing. + + @param atlas SkImage containing sprites + @param xform SkRSXform mappings for sprites in atlas + @param tex SkRect locations of sprites in atlas + @param colors one per sprite, blended with sprite using SkBlendMode; may be nullptr + @param count number of sprites to draw + @param mode SkBlendMode combining colors and sprites + @param sampling SkSamplingOptions used when sampling from the atlas image + @param cullRect bounds of transformed sprites for efficient clipping; may be nullptr + @param paint SkColorFilter, SkImageFilter, SkBlendMode, and so on; may be nullptr + */ + void drawAtlas(const SkImage* atlas, const SkRSXform xform[], const SkRect tex[], + const SkColor colors[], int count, SkBlendMode mode, + const SkSamplingOptions& sampling, const SkRect* cullRect, const SkPaint* paint); + + /** Draws SkDrawable drawable using clip and SkMatrix, concatenated with + optional matrix. + + If SkCanvas has an asynchronous implementation, as is the case + when it is recording into SkPicture, then drawable will be referenced, + so that SkDrawable::draw() can be called when the operation is finalized. To force + immediate drawing, call SkDrawable::draw() instead. + + @param drawable custom struct encapsulating drawing commands + @param matrix transformation applied to drawing; may be nullptr + + example: https://fiddle.skia.org/c/@Canvas_drawDrawable + */ + void drawDrawable(SkDrawable* drawable, const SkMatrix* matrix = nullptr); + + /** Draws SkDrawable drawable using clip and SkMatrix, offset by (x, y). + + If SkCanvas has an asynchronous implementation, as is the case + when it is recording into SkPicture, then drawable will be referenced, + so that SkDrawable::draw() can be called when the operation is finalized. To force + immediate drawing, call SkDrawable::draw() instead. + + @param drawable custom struct encapsulating drawing commands + @param x offset into SkCanvas writable pixels on x-axis + @param y offset into SkCanvas writable pixels on y-axis + + example: https://fiddle.skia.org/c/@Canvas_drawDrawable_2 + */ + void drawDrawable(SkDrawable* drawable, SkScalar x, SkScalar y); + + /** Associates SkRect on SkCanvas with an annotation; a key-value pair, where the key is + a null-terminated UTF-8 string, and optional value is stored as SkData. + + Only some canvas implementations, such as recording to SkPicture, or drawing to + document PDF, use annotations. + + @param rect SkRect extent of canvas to annotate + @param key string used for lookup + @param value data holding value stored in annotation + + example: https://fiddle.skia.org/c/@Canvas_drawAnnotation_2 + */ + void drawAnnotation(const SkRect& rect, const char key[], SkData* value); + + /** Associates SkRect on SkCanvas when an annotation; a key-value pair, where the key is + a null-terminated UTF-8 string, and optional value is stored as SkData. + + Only some canvas implementations, such as recording to SkPicture, or drawing to + document PDF, use annotations. + + @param rect SkRect extent of canvas to annotate + @param key string used for lookup + @param value data holding value stored in annotation + */ + void drawAnnotation(const SkRect& rect, const char key[], const sk_sp<SkData>& value) { + this->drawAnnotation(rect, key, value.get()); + } + + /** Returns true if clip is empty; that is, nothing will draw. + + May do work when called; it should not be called + more often than needed. However, once called, subsequent calls perform no + work until clip changes. + + @return true if clip is empty + + example: https://fiddle.skia.org/c/@Canvas_isClipEmpty + */ + virtual bool isClipEmpty() const; + + /** Returns true if clip is SkRect and not empty. + Returns false if the clip is empty, or if it is not SkRect. + + @return true if clip is SkRect and not empty + + example: https://fiddle.skia.org/c/@Canvas_isClipRect + */ + virtual bool isClipRect() const; + + /** Returns the current transform from local coordinates to the 'device', which for most + * purposes means pixels. + * + * @return transformation from local coordinates to device / pixels. + */ + SkM44 getLocalToDevice() const; + + /** + * Throws away the 3rd row and column in the matrix, so be warned. + */ + SkMatrix getLocalToDeviceAs3x3() const { + return this->getLocalToDevice().asM33(); + } + +#ifdef SK_SUPPORT_LEGACY_GETTOTALMATRIX + /** DEPRECATED + * Legacy version of getLocalToDevice(), which strips away any Z information, and + * just returns a 3x3 version. + * + * @return 3x3 version of getLocalToDevice() + * + * example: https://fiddle.skia.org/c/@Canvas_getTotalMatrix + * example: https://fiddle.skia.org/c/@Clip + */ + SkMatrix getTotalMatrix() const; +#endif + + /////////////////////////////////////////////////////////////////////////// + +#if defined(SK_BUILD_FOR_ANDROID_FRAMEWORK) && SK_SUPPORT_GPU + // These methods exist to support WebView in Android Framework. + SkIRect topLayerBounds() const; + GrBackendRenderTarget topLayerBackendRenderTarget() const; +#endif + + /** + * Returns the global clip as a region. If the clip contains AA, then only the bounds + * of the clip may be returned. + */ + void temporary_internal_getRgnClip(SkRegion* region); + + void private_draw_shadow_rec(const SkPath&, const SkDrawShadowRec&); + + +protected: + // default impl defers to getDevice()->newSurface(info) + virtual sk_sp<SkSurface> onNewSurface(const SkImageInfo& info, const SkSurfaceProps& props); + + // default impl defers to its device + virtual bool onPeekPixels(SkPixmap* pixmap); + virtual bool onAccessTopLayerPixels(SkPixmap* pixmap); + virtual SkImageInfo onImageInfo() const; + virtual bool onGetProps(SkSurfaceProps* props) const; + virtual void onFlush(); + + // Subclass save/restore notifiers. + // Overriders should call the corresponding INHERITED method up the inheritance chain. + // getSaveLayerStrategy()'s return value may suppress full layer allocation. + enum SaveLayerStrategy { + kFullLayer_SaveLayerStrategy, + kNoLayer_SaveLayerStrategy, + }; + + virtual void willSave() {} + // Overriders should call the corresponding INHERITED method up the inheritance chain. + virtual SaveLayerStrategy getSaveLayerStrategy(const SaveLayerRec& ) { + return kFullLayer_SaveLayerStrategy; + } + + // returns true if we should actually perform the saveBehind, or false if we should just save. + virtual bool onDoSaveBehind(const SkRect*) { return true; } + virtual void willRestore() {} + virtual void didRestore() {} + + virtual void didConcat44(const SkM44&) {} + virtual void didSetM44(const SkM44&) {} + virtual void didTranslate(SkScalar, SkScalar) {} + virtual void didScale(SkScalar, SkScalar) {} + +#ifndef SK_ENABLE_EXPERIMENTAL_CUSTOM_MESH + // Define this in protected so we can still access internally for testing. + void drawCustomMesh(SkCustomMesh cm, sk_sp<SkBlender> blender, const SkPaint& paint); +#endif + + // NOTE: If you are adding a new onDraw virtual to SkCanvas, PLEASE add an override to + // SkCanvasVirtualEnforcer (in SkCanvasVirtualEnforcer.h). This ensures that subclasses using + // that mechanism will be required to implement the new function. + virtual void onDrawPaint(const SkPaint& paint); + virtual void onDrawBehind(const SkPaint& paint); + virtual void onDrawRect(const SkRect& rect, const SkPaint& paint); + virtual void onDrawRRect(const SkRRect& rrect, const SkPaint& paint); + virtual void onDrawDRRect(const SkRRect& outer, const SkRRect& inner, const SkPaint& paint); + virtual void onDrawOval(const SkRect& rect, const SkPaint& paint); + virtual void onDrawArc(const SkRect& rect, SkScalar startAngle, SkScalar sweepAngle, + bool useCenter, const SkPaint& paint); + virtual void onDrawPath(const SkPath& path, const SkPaint& paint); + virtual void onDrawRegion(const SkRegion& region, const SkPaint& paint); + + virtual void onDrawTextBlob(const SkTextBlob* blob, SkScalar x, SkScalar y, + const SkPaint& paint); + + virtual void onDrawGlyphRunList(const SkGlyphRunList& glyphRunList, const SkPaint& paint); + + virtual void onDrawPatch(const SkPoint cubics[12], const SkColor colors[4], + const SkPoint texCoords[4], SkBlendMode mode, const SkPaint& paint); + virtual void onDrawPoints(PointMode mode, size_t count, const SkPoint pts[], + const SkPaint& paint); + + virtual void onDrawImage2(const SkImage*, SkScalar dx, SkScalar dy, const SkSamplingOptions&, + const SkPaint*); + virtual void onDrawImageRect2(const SkImage*, const SkRect& src, const SkRect& dst, + const SkSamplingOptions&, const SkPaint*, SrcRectConstraint); + virtual void onDrawImageLattice2(const SkImage*, const Lattice&, const SkRect& dst, + SkFilterMode, const SkPaint*); + virtual void onDrawAtlas2(const SkImage*, const SkRSXform[], const SkRect src[], + const SkColor[], int count, SkBlendMode, const SkSamplingOptions&, + const SkRect* cull, const SkPaint*); + virtual void onDrawEdgeAAImageSet2(const ImageSetEntry imageSet[], int count, + const SkPoint dstClips[], const SkMatrix preViewMatrices[], + const SkSamplingOptions&, const SkPaint*, + SrcRectConstraint); + + virtual void onDrawVerticesObject(const SkVertices* vertices, SkBlendMode mode, + const SkPaint& paint); +#ifdef SK_ENABLE_SKSL + virtual void onDrawCustomMesh(SkCustomMesh, sk_sp<SkBlender>, const SkPaint&); +#endif + virtual void onDrawAnnotation(const SkRect& rect, const char key[], SkData* value); + virtual void onDrawShadowRec(const SkPath&, const SkDrawShadowRec&); + + virtual void onDrawDrawable(SkDrawable* drawable, const SkMatrix* matrix); + virtual void onDrawPicture(const SkPicture* picture, const SkMatrix* matrix, + const SkPaint* paint); + + virtual void onDrawEdgeAAQuad(const SkRect& rect, const SkPoint clip[4], QuadAAFlags aaFlags, + const SkColor4f& color, SkBlendMode mode); + + enum ClipEdgeStyle { + kHard_ClipEdgeStyle, + kSoft_ClipEdgeStyle + }; + + virtual void onClipRect(const SkRect& rect, SkClipOp op, ClipEdgeStyle edgeStyle); + virtual void onClipRRect(const SkRRect& rrect, SkClipOp op, ClipEdgeStyle edgeStyle); + virtual void onClipPath(const SkPath& path, SkClipOp op, ClipEdgeStyle edgeStyle); + virtual void onClipShader(sk_sp<SkShader>, SkClipOp); + virtual void onClipRegion(const SkRegion& deviceRgn, SkClipOp op); + virtual void onResetClip(); + + virtual void onDiscard(); + +#if SK_SUPPORT_GPU + /** Experimental + */ + virtual sk_sp<GrSlug> doConvertBlobToSlug( + const SkTextBlob& blob, SkPoint origin, const SkPaint& paint); + + /** Experimental + */ + virtual void doDrawSlug(GrSlug* slug); +#endif + +private: + + enum ShaderOverrideOpacity { + kNone_ShaderOverrideOpacity, //!< there is no overriding shader (bitmap or image) + kOpaque_ShaderOverrideOpacity, //!< the overriding shader is opaque + kNotOpaque_ShaderOverrideOpacity, //!< the overriding shader may not be opaque + }; + + // notify our surface (if we have one) that we are about to draw, so it + // can perform copy-on-write or invalidate any cached images + // returns false if the copy failed + bool SK_WARN_UNUSED_RESULT predrawNotify(bool willOverwritesEntireSurface = false); + bool SK_WARN_UNUSED_RESULT predrawNotify(const SkRect*, const SkPaint*, ShaderOverrideOpacity); + + enum class CheckForOverwrite : bool { + kNo = false, + kYes = true + }; + // call the appropriate predrawNotify and create a layer if needed. + skstd::optional<AutoLayerForImageFilter> aboutToDraw( + SkCanvas* canvas, + const SkPaint& paint, + const SkRect* rawBounds = nullptr, + CheckForOverwrite = CheckForOverwrite::kNo, + ShaderOverrideOpacity = kNone_ShaderOverrideOpacity); + + // The bottom-most device in the stack, only changed by init(). Image properties and the final + // canvas pixels are determined by this device. + SkBaseDevice* baseDevice() const { + SkASSERT(fBaseDevice); + return fBaseDevice.get(); + } + + // The top-most device in the stack, will change within saveLayer()'s. All drawing and clipping + // operations should route to this device. + SkBaseDevice* topDevice() const; + + // Canvases maintain a sparse stack of layers, where the top-most layer receives the drawing, + // clip, and matrix commands. There is a layer per call to saveLayer() using the + // kFullLayer_SaveLayerStrategy. + struct Layer { + sk_sp<SkBaseDevice> fDevice; + sk_sp<SkImageFilter> fImageFilter; // applied to layer *before* being drawn by paint + SkPaint fPaint; + bool fDiscard; + + Layer(sk_sp<SkBaseDevice> device, sk_sp<SkImageFilter> imageFilter, const SkPaint& paint); + }; + + // Encapsulate state needed to restore from saveBehind() + struct BackImage { + sk_sp<SkSpecialImage> fImage; + SkIPoint fLoc; + }; + + class MCRec { + public: + // If not null, this MCRec corresponds with the saveLayer() record that made the layer. + // The base "layer" is not stored here, since it is stored inline in SkCanvas and has no + // restoration behavior. + std::unique_ptr<Layer> fLayer; + + // This points to the device of the top-most layer (which may be lower in the stack), or + // to the canvas's fBaseDevice. The MCRec does not own the device. + SkBaseDevice* fDevice; + + std::unique_ptr<BackImage> fBackImage; + SkM44 fMatrix; + int fDeferredSaveCount = 0; + + MCRec(SkBaseDevice* device); + MCRec(const MCRec* prev); + ~MCRec(); + + void newLayer(sk_sp<SkBaseDevice> layerDevice, + sk_sp<SkImageFilter> filter, + const SkPaint& restorePaint); + + void reset(SkBaseDevice* device); + }; + + SkDeque fMCStack; + // points to top of stack + MCRec* fMCRec; + + // the first N recs that can fit here mean we won't call malloc + static constexpr int kMCRecSize = 96; // most recent measurement + static constexpr int kMCRecCount = 32; // common depth for save/restores + + intptr_t fMCRecStorage[kMCRecSize * kMCRecCount / sizeof(intptr_t)]; + + // Installed via init() + sk_sp<SkBaseDevice> fBaseDevice; + const SkSurfaceProps fProps; + + int fSaveCount; // value returned by getSaveCount() + + std::unique_ptr<SkRasterHandleAllocator> fAllocator; + + SkSurface_Base* fSurfaceBase; + SkSurface_Base* getSurfaceBase() const { return fSurfaceBase; } + void setSurfaceBase(SkSurface_Base* sb) { + fSurfaceBase = sb; + } + friend class SkSurface_Base; + friend class SkSurface_Gpu; + + SkIRect fClipRestrictionRect = SkIRect::MakeEmpty(); + int fClipRestrictionSaveCount = -1; + + void doSave(); + void checkForDeferredSave(); + void internalSetMatrix(const SkM44&); + + friend class SkAndroidFrameworkUtils; + friend class SkCanvasPriv; // needs to expose android functions for testing outside android + friend class AutoLayerForImageFilter; + friend class SkSurface_Raster; // needs getDevice() + friend class SkNoDrawCanvas; // needs resetForNextPicture() + friend class SkNWayCanvas; + friend class SkPictureRecord; // predrawNotify (why does it need it? <reed>) + friend class SkOverdrawCanvas; + friend class SkRasterHandleAllocator; +protected: + // For use by SkNoDrawCanvas (via SkCanvasVirtualEnforcer, which can't be a friend) + SkCanvas(const SkIRect& bounds); +private: + SkCanvas(const SkBitmap&, std::unique_ptr<SkRasterHandleAllocator>, + SkRasterHandleAllocator::Handle); + + SkCanvas(SkCanvas&&) = delete; + SkCanvas(const SkCanvas&) = delete; + SkCanvas& operator=(SkCanvas&&) = delete; + SkCanvas& operator=(const SkCanvas&) = delete; + +#if SK_SUPPORT_GPU + friend class GrSlug; + /** Experimental + * Convert a SkTextBlob to a GrSlug using the current canvas state. + */ + sk_sp<GrSlug> convertBlobToSlug(const SkTextBlob& blob, SkPoint origin, const SkPaint& paint); + + /** Experimental + * Draw an GrSlug given the current canvas state. + */ + void drawSlug(GrSlug* slug); +#endif + + /** Experimental + * Saves the specified subset of the current pixels in the current layer, + * and then clears those pixels to transparent black. + * Restores the pixels on restore() by drawing them in SkBlendMode::kDstOver. + * + * @param subset conservative bounds of the area to be saved / restored. + * @return depth of save state stack before this call was made. + */ + int only_axis_aligned_saveBehind(const SkRect* subset); + + /** + * Like drawPaint, but magically clipped to the most recent saveBehind buffer rectangle. + * If there is no active saveBehind, then this draws nothing. + */ + void drawClippedToSaveBehind(const SkPaint&); + + void resetForNextPicture(const SkIRect& bounds); + + // needs gettotalclip() + friend class SkCanvasStateUtils; + + void init(sk_sp<SkBaseDevice>); + + // All base onDrawX() functions should call this and skip drawing if it returns true. + // If 'matrix' is non-null, it maps the paint's fast bounds before checking for quick rejection + bool internalQuickReject(const SkRect& bounds, const SkPaint& paint, + const SkMatrix* matrix = nullptr); + + void internalDrawPaint(const SkPaint& paint); + void internalSaveLayer(const SaveLayerRec&, SaveLayerStrategy); + void internalSaveBehind(const SkRect*); + + void internalConcat44(const SkM44&); + + // shared by save() and saveLayer() + void internalSave(); + void internalRestore(); + + enum class DeviceCompatibleWithFilter : bool { + // Check the src device's local-to-device matrix for compatibility with the filter, and if + // it is not compatible, introduce an intermediate image and transformation that allows the + // filter to be evaluated on the modified src content. + kUnknown = false, + // Assume that the src device's local-to-device matrix is compatible with the filter. + kYes = true + }; + /** + * Filters the contents of 'src' and draws the result into 'dst'. The filter is evaluated + * relative to the current canvas matrix, and src is drawn to dst using their relative transform + * 'paint' is applied after the filter and must not have a mask or image filter of its own. + * A null 'filter' behaves as if the identity filter were used. + * + * 'scaleFactor' is an extra uniform scale transform applied to downscale the 'src' image + * before any filtering, or as part of the copy, and is then drawn with 1/scaleFactor to 'dst'. + * Must be 1.0 if 'compat' is kYes (i.e. any scale factor has already been baked into the + * relative transforms between the devices). + */ + void internalDrawDeviceWithFilter(SkBaseDevice* src, SkBaseDevice* dst, + const SkImageFilter* filter, const SkPaint& paint, + DeviceCompatibleWithFilter compat, + SkScalar scaleFactor = 1.f); + + /* + * Returns true if drawing the specified rect (or all if it is null) with the specified + * paint (or default if null) would overwrite the entire root device of the canvas + * (i.e. the canvas' surface if it had one). + */ + bool wouldOverwriteEntireSurface(const SkRect*, const SkPaint*, ShaderOverrideOpacity) const; + + /** + * Returns true if the paint's imagefilter can be invoked directly, without needed a layer. + */ + bool canDrawBitmapAsSprite(SkScalar x, SkScalar y, int w, int h, const SkSamplingOptions&, + const SkPaint&); + + /** + * Returns true if the clip (for any active layer) contains antialiasing. + * If the clip is empty, this will return false. + */ + bool androidFramework_isClipAA() const; + + /** + * Reset the clip to be wide-open (modulo any separately specified device clip restriction). + * This operate within the save/restore clip stack so it can be undone by restoring to an + * earlier save point. + */ + void internal_private_resetClip(); + + virtual SkPaintFilterCanvas* internal_private_asPaintFilterCanvas() const { return nullptr; } + + // Keep track of the device clip bounds in the canvas' global space to reject draws before + // invoking the top-level device. + SkRect fQuickRejectBounds; + + // Compute the clip's bounds based on all clipped SkDevice's reported device bounds transformed + // into the canvas' global space. + SkRect computeDeviceClipBounds(bool outsetForAA=true) const; + + class AutoUpdateQRBounds; + void validateClip() const; + + std::unique_ptr<SkGlyphRunBuilder> fScratchGlyphRunBuilder; + + using INHERITED = SkRefCnt; +}; + +/** \class SkAutoCanvasRestore + Stack helper class calls SkCanvas::restoreToCount when SkAutoCanvasRestore + goes out of scope. Use this to guarantee that the canvas is restored to a known + state. +*/ +class SkAutoCanvasRestore { +public: + + /** Preserves SkCanvas::save() count. Optionally saves SkCanvas clip and SkCanvas matrix. + + @param canvas SkCanvas to guard + @param doSave call SkCanvas::save() + @return utility to restore SkCanvas state on destructor + */ + SkAutoCanvasRestore(SkCanvas* canvas, bool doSave) : fCanvas(canvas), fSaveCount(0) { + if (fCanvas) { + fSaveCount = canvas->getSaveCount(); + if (doSave) { + canvas->save(); + } + } + } + + /** Restores SkCanvas to saved state. Destructor is called when container goes out of + scope. + */ + ~SkAutoCanvasRestore() { + if (fCanvas) { + fCanvas->restoreToCount(fSaveCount); + } + } + + /** Restores SkCanvas to saved state immediately. Subsequent calls and + ~SkAutoCanvasRestore() have no effect. + */ + void restore() { + if (fCanvas) { + fCanvas->restoreToCount(fSaveCount); + fCanvas = nullptr; + } + } + +private: + SkCanvas* fCanvas; + int fSaveCount; + + SkAutoCanvasRestore(SkAutoCanvasRestore&&) = delete; + SkAutoCanvasRestore(const SkAutoCanvasRestore&) = delete; + SkAutoCanvasRestore& operator=(SkAutoCanvasRestore&&) = delete; + SkAutoCanvasRestore& operator=(const SkAutoCanvasRestore&) = delete; +}; + +#endif diff --git a/src/deps/skia/include/core/SkCanvasVirtualEnforcer.h b/src/deps/skia/include/core/SkCanvasVirtualEnforcer.h new file mode 100644 index 000000000..5086b4337 --- /dev/null +++ b/src/deps/skia/include/core/SkCanvasVirtualEnforcer.h @@ -0,0 +1,61 @@ +/* + * Copyright 2018 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkCanvasVirtualEnforcer_DEFINED +#define SkCanvasVirtualEnforcer_DEFINED + +#include "include/core/SkCanvas.h" + +// If you would ordinarily want to inherit from Base (eg SkCanvas, SkNWayCanvas), instead +// inherit from SkCanvasVirtualEnforcer<Base>, which will make the build fail if you forget +// to override one of SkCanvas' key virtual hooks. +template <typename Base> +class SkCanvasVirtualEnforcer : public Base { +public: + using Base::Base; + +protected: + void onDrawPaint(const SkPaint& paint) override = 0; + void onDrawBehind(const SkPaint&) override {} // make zero after android updates + void onDrawRect(const SkRect& rect, const SkPaint& paint) override = 0; + void onDrawRRect(const SkRRect& rrect, const SkPaint& paint) override = 0; + void onDrawDRRect(const SkRRect& outer, const SkRRect& inner, + const SkPaint& paint) override = 0; + void onDrawOval(const SkRect& rect, const SkPaint& paint) override = 0; + void onDrawArc(const SkRect& rect, SkScalar startAngle, SkScalar sweepAngle, bool useCenter, + const SkPaint& paint) override = 0; + void onDrawPath(const SkPath& path, const SkPaint& paint) override = 0; + void onDrawRegion(const SkRegion& region, const SkPaint& paint) override = 0; + + void onDrawTextBlob(const SkTextBlob* blob, SkScalar x, SkScalar y, + const SkPaint& paint) override = 0; + + void onDrawPatch(const SkPoint cubics[12], const SkColor colors[4], + const SkPoint texCoords[4], SkBlendMode mode, + const SkPaint& paint) override = 0; + void onDrawPoints(SkCanvas::PointMode mode, size_t count, const SkPoint pts[], + const SkPaint& paint) override = 0; + +#ifdef SK_BUILD_FOR_ANDROID_FRAMEWORK + // This is under active development for Chrome and not used in Android. Hold off on adding + // implementations in Android's SkCanvas subclasses until this stabilizes. + void onDrawEdgeAAQuad(const SkRect& rect, const SkPoint clip[4], + SkCanvas::QuadAAFlags aaFlags, const SkColor4f& color, SkBlendMode mode) override {} +#else + void onDrawEdgeAAQuad(const SkRect& rect, const SkPoint clip[4], + SkCanvas::QuadAAFlags aaFlags, const SkColor4f& color, SkBlendMode mode) override = 0; +#endif + + void onDrawAnnotation(const SkRect& rect, const char key[], SkData* value) override = 0; + void onDrawShadowRec(const SkPath&, const SkDrawShadowRec&) override = 0; + + void onDrawDrawable(SkDrawable* drawable, const SkMatrix* matrix) override = 0; + void onDrawPicture(const SkPicture* picture, const SkMatrix* matrix, + const SkPaint* paint) override = 0; +}; + +#endif diff --git a/src/deps/skia/include/core/SkClipOp.h b/src/deps/skia/include/core/SkClipOp.h new file mode 100644 index 000000000..3da6c6113 --- /dev/null +++ b/src/deps/skia/include/core/SkClipOp.h @@ -0,0 +1,19 @@ +/* + * Copyright 2016 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkClipOp_DEFINED +#define SkClipOp_DEFINED + +#include "include/core/SkTypes.h" + +enum class SkClipOp { + kDifference = 0, + kIntersect = 1, + kMax_EnumValue = kIntersect +}; + +#endif diff --git a/src/deps/skia/include/core/SkColor.h b/src/deps/skia/include/core/SkColor.h new file mode 100644 index 000000000..9cba771dd --- /dev/null +++ b/src/deps/skia/include/core/SkColor.h @@ -0,0 +1,438 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkColor_DEFINED +#define SkColor_DEFINED + +#include "include/core/SkImageInfo.h" +#include "include/core/SkScalar.h" +#include "include/core/SkTypes.h" + +#include <array> + +/** \file SkColor.h + + Types, consts, functions, and macros for colors. +*/ + +/** 8-bit type for an alpha value. 255 is 100% opaque, zero is 100% transparent. +*/ +typedef uint8_t SkAlpha; + +/** 32-bit ARGB color value, unpremultiplied. Color components are always in + a known order. This is different from SkPMColor, which has its bytes in a configuration + dependent order, to match the format of kBGRA_8888_SkColorType bitmaps. SkColor + is the type used to specify colors in SkPaint and in gradients. + + Color that is premultiplied has the same component values as color + that is unpremultiplied if alpha is 255, fully opaque, although may have the + component values in a different order. +*/ +typedef uint32_t SkColor; + +/** Returns color value from 8-bit component values. Asserts if SK_DEBUG is defined + if a, r, g, or b exceed 255. Since color is unpremultiplied, a may be smaller + than the largest of r, g, and b. + + @param a amount of alpha, from fully transparent (0) to fully opaque (255) + @param r amount of red, from no red (0) to full red (255) + @param g amount of green, from no green (0) to full green (255) + @param b amount of blue, from no blue (0) to full blue (255) + @return color and alpha, unpremultiplied +*/ +static constexpr inline SkColor SkColorSetARGB(U8CPU a, U8CPU r, U8CPU g, U8CPU b) { + return SkASSERT(a <= 255 && r <= 255 && g <= 255 && b <= 255), + (a << 24) | (r << 16) | (g << 8) | (b << 0); +} + +/** Returns color value from 8-bit component values, with alpha set + fully opaque to 255. +*/ +#define SkColorSetRGB(r, g, b) SkColorSetARGB(0xFF, r, g, b) + +/** Returns alpha byte from color value. +*/ +#define SkColorGetA(color) (((color) >> 24) & 0xFF) + +/** Returns red component of color, from zero to 255. +*/ +#define SkColorGetR(color) (((color) >> 16) & 0xFF) + +/** Returns green component of color, from zero to 255. +*/ +#define SkColorGetG(color) (((color) >> 8) & 0xFF) + +/** Returns blue component of color, from zero to 255. +*/ +#define SkColorGetB(color) (((color) >> 0) & 0xFF) + +/** Returns unpremultiplied color with red, blue, and green set from c; and alpha set + from a. Alpha component of c is ignored and is replaced by a in result. + + @param c packed RGB, eight bits per component + @param a alpha: transparent at zero, fully opaque at 255 + @return color with transparency +*/ +static constexpr inline SkColor SK_WARN_UNUSED_RESULT SkColorSetA(SkColor c, U8CPU a) { + return (c & 0x00FFFFFF) | (a << 24); +} + +/** Represents fully transparent SkAlpha value. SkAlpha ranges from zero, + fully transparent; to 255, fully opaque. +*/ +constexpr SkAlpha SK_AlphaTRANSPARENT = 0x00; + +/** Represents fully opaque SkAlpha value. SkAlpha ranges from zero, + fully transparent; to 255, fully opaque. +*/ +constexpr SkAlpha SK_AlphaOPAQUE = 0xFF; + +/** Represents fully transparent SkColor. May be used to initialize a destination + containing a mask or a non-rectangular image. +*/ +constexpr SkColor SK_ColorTRANSPARENT = SkColorSetARGB(0x00, 0x00, 0x00, 0x00); + +/** Represents fully opaque black. +*/ +constexpr SkColor SK_ColorBLACK = SkColorSetARGB(0xFF, 0x00, 0x00, 0x00); + +/** Represents fully opaque dark gray. + Note that SVG dark gray is equivalent to 0xFFA9A9A9. +*/ +constexpr SkColor SK_ColorDKGRAY = SkColorSetARGB(0xFF, 0x44, 0x44, 0x44); + +/** Represents fully opaque gray. + Note that HTML gray is equivalent to 0xFF808080. +*/ +constexpr SkColor SK_ColorGRAY = SkColorSetARGB(0xFF, 0x88, 0x88, 0x88); + +/** Represents fully opaque light gray. HTML silver is equivalent to 0xFFC0C0C0. + Note that SVG light gray is equivalent to 0xFFD3D3D3. +*/ +constexpr SkColor SK_ColorLTGRAY = SkColorSetARGB(0xFF, 0xCC, 0xCC, 0xCC); + +/** Represents fully opaque white. +*/ +constexpr SkColor SK_ColorWHITE = SkColorSetARGB(0xFF, 0xFF, 0xFF, 0xFF); + +/** Represents fully opaque red. +*/ +constexpr SkColor SK_ColorRED = SkColorSetARGB(0xFF, 0xFF, 0x00, 0x00); + +/** Represents fully opaque green. HTML lime is equivalent. + Note that HTML green is equivalent to 0xFF008000. +*/ +constexpr SkColor SK_ColorGREEN = SkColorSetARGB(0xFF, 0x00, 0xFF, 0x00); + +/** Represents fully opaque blue. +*/ +constexpr SkColor SK_ColorBLUE = SkColorSetARGB(0xFF, 0x00, 0x00, 0xFF); + +/** Represents fully opaque yellow. +*/ +constexpr SkColor SK_ColorYELLOW = SkColorSetARGB(0xFF, 0xFF, 0xFF, 0x00); + +/** Represents fully opaque cyan. HTML aqua is equivalent. +*/ +constexpr SkColor SK_ColorCYAN = SkColorSetARGB(0xFF, 0x00, 0xFF, 0xFF); + +/** Represents fully opaque magenta. HTML fuchsia is equivalent. +*/ +constexpr SkColor SK_ColorMAGENTA = SkColorSetARGB(0xFF, 0xFF, 0x00, 0xFF); + +/** Converts RGB to its HSV components. + hsv[0] contains hsv hue, a value from zero to less than 360. + hsv[1] contains hsv saturation, a value from zero to one. + hsv[2] contains hsv value, a value from zero to one. + + @param red red component value from zero to 255 + @param green green component value from zero to 255 + @param blue blue component value from zero to 255 + @param hsv three element array which holds the resulting HSV components +*/ +SK_API void SkRGBToHSV(U8CPU red, U8CPU green, U8CPU blue, SkScalar hsv[3]); + +/** Converts ARGB to its HSV components. Alpha in ARGB is ignored. + hsv[0] contains hsv hue, and is assigned a value from zero to less than 360. + hsv[1] contains hsv saturation, a value from zero to one. + hsv[2] contains hsv value, a value from zero to one. + + @param color ARGB color to convert + @param hsv three element array which holds the resulting HSV components +*/ +static inline void SkColorToHSV(SkColor color, SkScalar hsv[3]) { + SkRGBToHSV(SkColorGetR(color), SkColorGetG(color), SkColorGetB(color), hsv); +} + +/** Converts HSV components to an ARGB color. Alpha is passed through unchanged. + hsv[0] represents hsv hue, an angle from zero to less than 360. + hsv[1] represents hsv saturation, and varies from zero to one. + hsv[2] represents hsv value, and varies from zero to one. + + Out of range hsv values are pinned. + + @param alpha alpha component of the returned ARGB color + @param hsv three element array which holds the input HSV components + @return ARGB equivalent to HSV +*/ +SK_API SkColor SkHSVToColor(U8CPU alpha, const SkScalar hsv[3]); + +/** Converts HSV components to an ARGB color. Alpha is set to 255. + hsv[0] represents hsv hue, an angle from zero to less than 360. + hsv[1] represents hsv saturation, and varies from zero to one. + hsv[2] represents hsv value, and varies from zero to one. + + Out of range hsv values are pinned. + + @param hsv three element array which holds the input HSV components + @return RGB equivalent to HSV +*/ +static inline SkColor SkHSVToColor(const SkScalar hsv[3]) { + return SkHSVToColor(0xFF, hsv); +} + +/** 32-bit ARGB color value, premultiplied. The byte order for this value is + configuration dependent, matching the format of kBGRA_8888_SkColorType bitmaps. + This is different from SkColor, which is unpremultiplied, and is always in the + same byte order. +*/ +typedef uint32_t SkPMColor; + +/** Returns a SkPMColor value from unpremultiplied 8-bit component values. + + @param a amount of alpha, from fully transparent (0) to fully opaque (255) + @param r amount of red, from no red (0) to full red (255) + @param g amount of green, from no green (0) to full green (255) + @param b amount of blue, from no blue (0) to full blue (255) + @return premultiplied color +*/ +SK_API SkPMColor SkPreMultiplyARGB(U8CPU a, U8CPU r, U8CPU g, U8CPU b); + +/** Returns pmcolor closest to color c. Multiplies c RGB components by the c alpha, + and arranges the bytes to match the format of kN32_SkColorType. + + @param c unpremultiplied ARGB color + @return premultiplied color +*/ +SK_API SkPMColor SkPreMultiplyColor(SkColor c); + +/** \enum SkColorChannel + Describes different color channels one can manipulate +*/ +enum class SkColorChannel { + kR, // the red channel + kG, // the green channel + kB, // the blue channel + kA, // the alpha channel + + kLastEnum = kA, +}; + +/** Used to represent the channels available in a color type or texture format as a mask. */ +enum SkColorChannelFlag : uint32_t { + kRed_SkColorChannelFlag = 1 << static_cast<uint32_t>(SkColorChannel::kR), + kGreen_SkColorChannelFlag = 1 << static_cast<uint32_t>(SkColorChannel::kG), + kBlue_SkColorChannelFlag = 1 << static_cast<uint32_t>(SkColorChannel::kB), + kAlpha_SkColorChannelFlag = 1 << static_cast<uint32_t>(SkColorChannel::kA), + kGray_SkColorChannelFlag = 0x10, + // Convenience values + kGrayAlpha_SkColorChannelFlags = kGray_SkColorChannelFlag | kAlpha_SkColorChannelFlag, + kRG_SkColorChannelFlags = kRed_SkColorChannelFlag | kGreen_SkColorChannelFlag, + kRGB_SkColorChannelFlags = kRG_SkColorChannelFlags | kBlue_SkColorChannelFlag, + kRGBA_SkColorChannelFlags = kRGB_SkColorChannelFlags | kAlpha_SkColorChannelFlag, +}; +static_assert(0 == (kGray_SkColorChannelFlag & kRGBA_SkColorChannelFlags), "bitfield conflict"); + +/** \struct SkRGBA4f + RGBA color value, holding four floating point components. Color components are always in + a known order. kAT determines if the SkRGBA4f's R, G, and B components are premultiplied + by alpha or not. + + Skia's public API always uses unpremultiplied colors, which can be stored as + SkRGBA4f<kUnpremul_SkAlphaType>. For convenience, this type can also be referred to + as SkColor4f. +*/ +template <SkAlphaType kAT> +struct SkRGBA4f { + float fR; //!< red component + float fG; //!< green component + float fB; //!< blue component + float fA; //!< alpha component + + /** Compares SkRGBA4f with other, and returns true if all components are equal. + + @param other SkRGBA4f to compare + @return true if SkRGBA4f equals other + */ + bool operator==(const SkRGBA4f& other) const { + return fA == other.fA && fR == other.fR && fG == other.fG && fB == other.fB; + } + + /** Compares SkRGBA4f with other, and returns true if not all components are equal. + + @param other SkRGBA4f to compare + @return true if SkRGBA4f is not equal to other + */ + bool operator!=(const SkRGBA4f& other) const { + return !(*this == other); + } + + /** Returns SkRGBA4f multiplied by scale. + + @param scale value to multiply by + @return SkRGBA4f as (fR * scale, fG * scale, fB * scale, fA * scale) + */ + SkRGBA4f operator*(float scale) const { + return { fR * scale, fG * scale, fB * scale, fA * scale }; + } + + /** Returns SkRGBA4f multiplied component-wise by scale. + + @param scale SkRGBA4f to multiply by + @return SkRGBA4f as (fR * scale.fR, fG * scale.fG, fB * scale.fB, fA * scale.fA) + */ + SkRGBA4f operator*(const SkRGBA4f& scale) const { + return { fR * scale.fR, fG * scale.fG, fB * scale.fB, fA * scale.fA }; + } + + /** Returns a pointer to components of SkRGBA4f, for array access. + + @return pointer to array [fR, fG, fB, fA] + */ + const float* vec() const { return &fR; } + + /** Returns a pointer to components of SkRGBA4f, for array access. + + @return pointer to array [fR, fG, fB, fA] + */ + float* vec() { return &fR; } + + /** As a std::array<float, 4> */ + std::array<float, 4> array() const { return {fR, fG, fB, fA}; } + + /** Returns one component. Asserts if index is out of range and SK_DEBUG is defined. + + @param index one of: 0 (fR), 1 (fG), 2 (fB), 3 (fA) + @return value corresponding to index + */ + float operator[](int index) const { + SkASSERT(index >= 0 && index < 4); + return this->vec()[index]; + } + + /** Returns one component. Asserts if index is out of range and SK_DEBUG is defined. + + @param index one of: 0 (fR), 1 (fG), 2 (fB), 3 (fA) + @return value corresponding to index + */ + float& operator[](int index) { + SkASSERT(index >= 0 && index < 4); + return this->vec()[index]; + } + + /** Returns true if SkRGBA4f is an opaque color. Asserts if fA is out of range and + SK_DEBUG is defined. + + @return true if SkRGBA4f is opaque + */ + bool isOpaque() const { + SkASSERT(fA <= 1.0f && fA >= 0.0f); + return fA == 1.0f; + } + + /** Returns true if all channels are in [0, 1]. */ + bool fitsInBytes() const { + SkASSERT(fA >= 0.0f && fA <= 1.0f); + return fR >= 0.0f && fR <= 1.0f && + fG >= 0.0f && fG <= 1.0f && + fB >= 0.0f && fB <= 1.0f; + } + + /** Returns closest SkRGBA4f to SkColor. Only allowed if SkRGBA4f is unpremultiplied. + + @param color Color with Alpha, red, blue, and green components + @return SkColor as SkRGBA4f + + example: https://fiddle.skia.org/c/@RGBA4f_FromColor + */ + static SkRGBA4f FromColor(SkColor color); // impl. depends on kAT + + /** Returns closest SkColor to SkRGBA4f. Only allowed if SkRGBA4f is unpremultiplied. + + @return color as SkColor + + example: https://fiddle.skia.org/c/@RGBA4f_toSkColor + */ + SkColor toSkColor() const; // impl. depends on kAT + + /** Returns closest SkRGBA4f to SkPMColor. Only allowed if SkRGBA4f is premultiplied. + + @return SkPMColor as SkRGBA4f + */ + static SkRGBA4f FromPMColor(SkPMColor); // impl. depends on kAT + + /** Returns SkRGBA4f premultiplied by alpha. Asserts at compile time if SkRGBA4f is + already premultiplied. + + @return premultiplied color + */ + SkRGBA4f<kPremul_SkAlphaType> premul() const { + static_assert(kAT == kUnpremul_SkAlphaType, ""); + return { fR * fA, fG * fA, fB * fA, fA }; + } + + /** Returns SkRGBA4f unpremultiplied by alpha. Asserts at compile time if SkRGBA4f is + already unpremultiplied. + + @return unpremultiplied color + */ + SkRGBA4f<kUnpremul_SkAlphaType> unpremul() const { + static_assert(kAT == kPremul_SkAlphaType, ""); + + if (fA == 0.0f) { + return { 0, 0, 0, 0 }; + } else { + float invAlpha = 1 / fA; + return { fR * invAlpha, fG * invAlpha, fB * invAlpha, fA }; + } + } + + // This produces bytes in RGBA order (eg GrColor). Impl. is the same, regardless of kAT + uint32_t toBytes_RGBA() const; + static SkRGBA4f FromBytes_RGBA(uint32_t color); + + SkRGBA4f makeOpaque() const { + return { fR, fG, fB, 1.0f }; + } +}; + +/** \struct SkColor4f + RGBA color value, holding four floating point components. Color components are always in + a known order, and are unpremultiplied. + + This is a specialization of SkRGBA4f. For details, @see SkRGBA4f. +*/ +using SkColor4f = SkRGBA4f<kUnpremul_SkAlphaType>; + +template <> SK_API SkColor4f SkColor4f::FromColor(SkColor); +template <> SK_API SkColor SkColor4f::toSkColor() const; + +namespace SkColors { +constexpr SkColor4f kTransparent = {0, 0, 0, 0}; +constexpr SkColor4f kBlack = {0, 0, 0, 1}; +constexpr SkColor4f kDkGray = {0.25f, 0.25f, 0.25f, 1}; +constexpr SkColor4f kGray = {0.50f, 0.50f, 0.50f, 1}; +constexpr SkColor4f kLtGray = {0.75f, 0.75f, 0.75f, 1}; +constexpr SkColor4f kWhite = {1, 1, 1, 1}; +constexpr SkColor4f kRed = {1, 0, 0, 1}; +constexpr SkColor4f kGreen = {0, 1, 0, 1}; +constexpr SkColor4f kBlue = {0, 0, 1, 1}; +constexpr SkColor4f kYellow = {1, 1, 0, 1}; +constexpr SkColor4f kCyan = {0, 1, 1, 1}; +constexpr SkColor4f kMagenta = {1, 0, 1, 1}; +} // namespace SkColors +#endif diff --git a/src/deps/skia/include/core/SkColorFilter.h b/src/deps/skia/include/core/SkColorFilter.h new file mode 100644 index 000000000..e949b24ac --- /dev/null +++ b/src/deps/skia/include/core/SkColorFilter.h @@ -0,0 +1,90 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkColorFilter_DEFINED +#define SkColorFilter_DEFINED + +#include "include/core/SkBlendMode.h" +#include "include/core/SkColor.h" +#include "include/core/SkFlattenable.h" + +class SkColorMatrix; + +/** +* ColorFilters are optional objects in the drawing pipeline. When present in +* a paint, they are called with the "src" colors, and return new colors, which +* are then passed onto the next stage (either ImageFilter or Xfermode). +* +* All subclasses are required to be reentrant-safe : it must be legal to share +* the same instance between several threads. +*/ +class SK_API SkColorFilter : public SkFlattenable { +public: + /** If the filter can be represented by a source color plus Mode, this + * returns true, and sets (if not NULL) the color and mode appropriately. + * If not, this returns false and ignores the parameters. + */ + bool asAColorMode(SkColor* color, SkBlendMode* mode) const; + + /** If the filter can be represented by a 5x4 matrix, this + * returns true, and sets the matrix appropriately. + * If not, this returns false and ignores the parameter. + */ + bool asAColorMatrix(float matrix[20]) const; + + // Returns true if the filter is guaranteed to never change the alpha of a color it filters. + bool isAlphaUnchanged() const; + + SkColor filterColor(SkColor) const; + + /** + * Converts the src color (in src colorspace), into the dst colorspace, + * then applies this filter to it, returning the filtered color in the dst colorspace. + */ + SkColor4f filterColor4f(const SkColor4f& srcColor, SkColorSpace* srcCS, + SkColorSpace* dstCS) const; + + /** Construct a colorfilter whose effect is to first apply the inner filter and then apply + * this filter, applied to the output of the inner filter. + * + * result = this(inner(...)) + */ + sk_sp<SkColorFilter> makeComposed(sk_sp<SkColorFilter> inner) const; + + static sk_sp<SkColorFilter> Deserialize(const void* data, size_t size, + const SkDeserialProcs* procs = nullptr); + +private: + SkColorFilter() = default; + friend class SkColorFilterBase; + + using INHERITED = SkFlattenable; +}; + +class SK_API SkColorFilters { +public: + static sk_sp<SkColorFilter> Compose(sk_sp<SkColorFilter> outer, sk_sp<SkColorFilter> inner) { + return outer ? outer->makeComposed(inner) : inner; + } + static sk_sp<SkColorFilter> Blend(SkColor c, SkBlendMode mode); + static sk_sp<SkColorFilter> Matrix(const SkColorMatrix&); + static sk_sp<SkColorFilter> Matrix(const float rowMajor[20]); + + // A version of Matrix which operates in HSLA space instead of RGBA. + // I.e. HSLA-to-RGBA(Matrix(RGBA-to-HSLA(input))). + static sk_sp<SkColorFilter> HSLAMatrix(const SkColorMatrix&); + static sk_sp<SkColorFilter> HSLAMatrix(const float rowMajor[20]); + + static sk_sp<SkColorFilter> LinearToSRGBGamma(); + static sk_sp<SkColorFilter> SRGBToLinearGamma(); + static sk_sp<SkColorFilter> Lerp(float t, sk_sp<SkColorFilter> dst, sk_sp<SkColorFilter> src); + +private: + SkColorFilters() = delete; +}; + +#endif diff --git a/src/deps/skia/include/core/SkColorPriv.h b/src/deps/skia/include/core/SkColorPriv.h new file mode 100644 index 000000000..29f64339b --- /dev/null +++ b/src/deps/skia/include/core/SkColorPriv.h @@ -0,0 +1,152 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkColorPriv_DEFINED +#define SkColorPriv_DEFINED + +#include "include/core/SkColor.h" +#include "include/core/SkMath.h" +#include "include/private/SkTPin.h" +#include "include/private/SkTo.h" + +/** Turn 0..255 into 0..256 by adding 1 at the half-way point. Used to turn a + byte into a scale value, so that we can say scale * value >> 8 instead of + alpha * value / 255. + + In debugging, asserts that alpha is 0..255 +*/ +static inline unsigned SkAlpha255To256(U8CPU alpha) { + SkASSERT(SkToU8(alpha) == alpha); + // this one assues that blending on top of an opaque dst keeps it that way + // even though it is less accurate than a+(a>>7) for non-opaque dsts + return alpha + 1; +} + +/** Multiplify value by 0..256, and shift the result down 8 + (i.e. return (value * alpha256) >> 8) + */ +#define SkAlphaMul(value, alpha256) (((value) * (alpha256)) >> 8) + +static inline U8CPU SkUnitScalarClampToByte(SkScalar x) { + return static_cast<U8CPU>(SkTPin(x, 0.0f, 1.0f) * 255 + 0.5); +} + +#define SK_A32_BITS 8 +#define SK_R32_BITS 8 +#define SK_G32_BITS 8 +#define SK_B32_BITS 8 + +#define SK_A32_MASK ((1 << SK_A32_BITS) - 1) +#define SK_R32_MASK ((1 << SK_R32_BITS) - 1) +#define SK_G32_MASK ((1 << SK_G32_BITS) - 1) +#define SK_B32_MASK ((1 << SK_B32_BITS) - 1) + +/* + * Skia's 32bit backend only supports 1 swizzle order at a time (compile-time). + * This is specified by SK_R32_SHIFT=0 or SK_R32_SHIFT=16. + * + * For easier compatibility with Skia's GPU backend, we further restrict these + * to either (in memory-byte-order) RGBA or BGRA. Note that this "order" does + * not directly correspond to the same shift-order, since we have to take endianess + * into account. + * + * Here we enforce this constraint. + */ + +#define SK_RGBA_R32_SHIFT 0 +#define SK_RGBA_G32_SHIFT 8 +#define SK_RGBA_B32_SHIFT 16 +#define SK_RGBA_A32_SHIFT 24 + +#define SK_BGRA_B32_SHIFT 0 +#define SK_BGRA_G32_SHIFT 8 +#define SK_BGRA_R32_SHIFT 16 +#define SK_BGRA_A32_SHIFT 24 + +#if defined(SK_PMCOLOR_IS_RGBA) || defined(SK_PMCOLOR_IS_BGRA) + #error "Configure PMCOLOR by setting SK_R32_SHIFT." +#endif + +// Deduce which SK_PMCOLOR_IS_ to define from the _SHIFT defines + +#if (SK_A32_SHIFT == SK_RGBA_A32_SHIFT && \ + SK_R32_SHIFT == SK_RGBA_R32_SHIFT && \ + SK_G32_SHIFT == SK_RGBA_G32_SHIFT && \ + SK_B32_SHIFT == SK_RGBA_B32_SHIFT) + #define SK_PMCOLOR_IS_RGBA +#elif (SK_A32_SHIFT == SK_BGRA_A32_SHIFT && \ + SK_R32_SHIFT == SK_BGRA_R32_SHIFT && \ + SK_G32_SHIFT == SK_BGRA_G32_SHIFT && \ + SK_B32_SHIFT == SK_BGRA_B32_SHIFT) + #define SK_PMCOLOR_IS_BGRA +#else + #error "need 32bit packing to be either RGBA or BGRA" +#endif + +#define SkGetPackedA32(packed) ((uint32_t)((packed) << (24 - SK_A32_SHIFT)) >> 24) +#define SkGetPackedR32(packed) ((uint32_t)((packed) << (24 - SK_R32_SHIFT)) >> 24) +#define SkGetPackedG32(packed) ((uint32_t)((packed) << (24 - SK_G32_SHIFT)) >> 24) +#define SkGetPackedB32(packed) ((uint32_t)((packed) << (24 - SK_B32_SHIFT)) >> 24) + +#define SkA32Assert(a) SkASSERT((unsigned)(a) <= SK_A32_MASK) +#define SkR32Assert(r) SkASSERT((unsigned)(r) <= SK_R32_MASK) +#define SkG32Assert(g) SkASSERT((unsigned)(g) <= SK_G32_MASK) +#define SkB32Assert(b) SkASSERT((unsigned)(b) <= SK_B32_MASK) + +/** + * Pack the components into a SkPMColor, checking (in the debug version) that + * the components are 0..255, and are already premultiplied (i.e. alpha >= color) + */ +static inline SkPMColor SkPackARGB32(U8CPU a, U8CPU r, U8CPU g, U8CPU b) { + SkA32Assert(a); + SkASSERT(r <= a); + SkASSERT(g <= a); + SkASSERT(b <= a); + + return (a << SK_A32_SHIFT) | (r << SK_R32_SHIFT) | + (g << SK_G32_SHIFT) | (b << SK_B32_SHIFT); +} + +/** + * Same as SkPackARGB32, but this version guarantees to not check that the + * values are premultiplied in the debug version. + */ +static inline SkPMColor SkPackARGB32NoCheck(U8CPU a, U8CPU r, U8CPU g, U8CPU b) { + return (a << SK_A32_SHIFT) | (r << SK_R32_SHIFT) | + (g << SK_G32_SHIFT) | (b << SK_B32_SHIFT); +} + +static inline +SkPMColor SkPremultiplyARGBInline(U8CPU a, U8CPU r, U8CPU g, U8CPU b) { + SkA32Assert(a); + SkR32Assert(r); + SkG32Assert(g); + SkB32Assert(b); + + if (a != 255) { + r = SkMulDiv255Round(r, a); + g = SkMulDiv255Round(g, a); + b = SkMulDiv255Round(b, a); + } + return SkPackARGB32(a, r, g, b); +} + +// When Android is compiled optimizing for size, SkAlphaMulQ doesn't get +// inlined; forcing inlining significantly improves performance. +static SK_ALWAYS_INLINE uint32_t SkAlphaMulQ(uint32_t c, unsigned scale) { + uint32_t mask = 0xFF00FF; + + uint32_t rb = ((c & mask) * scale) >> 8; + uint32_t ag = ((c >> 8) & mask) * scale; + return (rb & mask) | (ag & ~mask); +} + +static inline SkPMColor SkPMSrcOver(SkPMColor src, SkPMColor dst) { + return src + SkAlphaMulQ(dst, SkAlpha255To256(255 - SkGetPackedA32(src))); +} + +#endif diff --git a/src/deps/skia/include/core/SkColorSpace.h b/src/deps/skia/include/core/SkColorSpace.h new file mode 100644 index 000000000..9efd140e2 --- /dev/null +++ b/src/deps/skia/include/core/SkColorSpace.h @@ -0,0 +1,245 @@ +/* + * Copyright 2016 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkColorSpace_DEFINED +#define SkColorSpace_DEFINED + +#include "include/core/SkRefCnt.h" +#include "include/private/SkFixed.h" +#include "include/private/SkOnce.h" +#include "include/third_party/skcms/skcms.h" +#include <memory> + +class SkData; + +/** + * Describes a color gamut with primaries and a white point. + */ +struct SK_API SkColorSpacePrimaries { + float fRX; + float fRY; + float fGX; + float fGY; + float fBX; + float fBY; + float fWX; + float fWY; + + /** + * Convert primaries and a white point to a toXYZD50 matrix, the preferred color gamut + * representation of SkColorSpace. + */ + bool toXYZD50(skcms_Matrix3x3* toXYZD50) const; +}; + +namespace SkNamedTransferFn { + +// Like SkNamedGamut::kSRGB, keeping this bitwise exactly the same as skcms makes things fastest. +static constexpr skcms_TransferFunction kSRGB = + { 2.4f, (float)(1/1.055), (float)(0.055/1.055), (float)(1/12.92), 0.04045f, 0.0f, 0.0f }; + +static constexpr skcms_TransferFunction k2Dot2 = + { 2.2f, 1.0f, 0.0f, 0.0f, 0.0f, 0.0f, 0.0f }; + +static constexpr skcms_TransferFunction kLinear = + { 1.0f, 1.0f, 0.0f, 0.0f, 0.0f, 0.0f, 0.0f }; + +static constexpr skcms_TransferFunction kRec2020 = + {2.22222f, 0.909672f, 0.0903276f, 0.222222f, 0.0812429f, 0, 0}; + +static constexpr skcms_TransferFunction kPQ = + {-2.0f, -107/128.0f, 1.0f, 32/2523.0f, 2413/128.0f, -2392/128.0f, 8192/1305.0f }; + +static constexpr skcms_TransferFunction kHLG = + {-3.0f, 2.0f, 2.0f, 1/0.17883277f, 0.28466892f, 0.55991073f, 0.0f }; + +} // namespace SkNamedTransferFn + +namespace SkNamedGamut { + +static constexpr skcms_Matrix3x3 kSRGB = {{ + // ICC fixed-point (16.16) representation, taken from skcms. Please keep them exactly in sync. + // 0.436065674f, 0.385147095f, 0.143066406f, + // 0.222488403f, 0.716873169f, 0.060607910f, + // 0.013916016f, 0.097076416f, 0.714096069f, + { SkFixedToFloat(0x6FA2), SkFixedToFloat(0x6299), SkFixedToFloat(0x24A0) }, + { SkFixedToFloat(0x38F5), SkFixedToFloat(0xB785), SkFixedToFloat(0x0F84) }, + { SkFixedToFloat(0x0390), SkFixedToFloat(0x18DA), SkFixedToFloat(0xB6CF) }, +}}; + +static constexpr skcms_Matrix3x3 kAdobeRGB = {{ + // ICC fixed-point (16.16) repesentation of: + // 0.60974, 0.20528, 0.14919, + // 0.31111, 0.62567, 0.06322, + // 0.01947, 0.06087, 0.74457, + { SkFixedToFloat(0x9c18), SkFixedToFloat(0x348d), SkFixedToFloat(0x2631) }, + { SkFixedToFloat(0x4fa5), SkFixedToFloat(0xa02c), SkFixedToFloat(0x102f) }, + { SkFixedToFloat(0x04fc), SkFixedToFloat(0x0f95), SkFixedToFloat(0xbe9c) }, +}}; + +static constexpr skcms_Matrix3x3 kDisplayP3 = {{ + { 0.515102f, 0.291965f, 0.157153f }, + { 0.241182f, 0.692236f, 0.0665819f }, + { -0.00104941f, 0.0418818f, 0.784378f }, +}}; + +static constexpr skcms_Matrix3x3 kRec2020 = {{ + { 0.673459f, 0.165661f, 0.125100f }, + { 0.279033f, 0.675338f, 0.0456288f }, + { -0.00193139f, 0.0299794f, 0.797162f }, +}}; + +static constexpr skcms_Matrix3x3 kXYZ = {{ + { 1.0f, 0.0f, 0.0f }, + { 0.0f, 1.0f, 0.0f }, + { 0.0f, 0.0f, 1.0f }, +}}; + +} // namespace SkNamedGamut + +class SK_API SkColorSpace : public SkNVRefCnt<SkColorSpace> { +public: + /** + * Create the sRGB color space. + */ + static sk_sp<SkColorSpace> MakeSRGB(); + + /** + * Colorspace with the sRGB primaries, but a linear (1.0) gamma. + */ + static sk_sp<SkColorSpace> MakeSRGBLinear(); + + /** + * Create an SkColorSpace from a transfer function and a row-major 3x3 transformation to XYZ. + */ + static sk_sp<SkColorSpace> MakeRGB(const skcms_TransferFunction& transferFn, + const skcms_Matrix3x3& toXYZ); + + /** + * Create an SkColorSpace from a parsed (skcms) ICC profile. + */ + static sk_sp<SkColorSpace> Make(const skcms_ICCProfile&); + + /** + * Convert this color space to an skcms ICC profile struct. + */ + void toProfile(skcms_ICCProfile*) const; + + /** + * Returns true if the color space gamma is near enough to be approximated as sRGB. + */ + bool gammaCloseToSRGB() const; + + /** + * Returns true if the color space gamma is linear. + */ + bool gammaIsLinear() const; + + /** + * Sets |fn| to the transfer function from this color space. Returns true if the transfer + * function can be represented as coefficients to the standard ICC 7-parameter equation. + * Returns false otherwise (eg, PQ, HLG). + */ + bool isNumericalTransferFn(skcms_TransferFunction* fn) const; + + /** + * Returns true and sets |toXYZD50| if the color gamut can be described as a matrix. + * Returns false otherwise. + */ + bool toXYZD50(skcms_Matrix3x3* toXYZD50) const; + + /** + * Returns a hash of the gamut transformation to XYZ D50. Allows for fast equality checking + * of gamuts, at the (very small) risk of collision. + */ + uint32_t toXYZD50Hash() const { return fToXYZD50Hash; } + + /** + * Returns a color space with the same gamut as this one, but with a linear gamma. + * For color spaces whose gamut can not be described in terms of XYZ D50, returns + * linear sRGB. + */ + sk_sp<SkColorSpace> makeLinearGamma() const; + + /** + * Returns a color space with the same gamut as this one, with with the sRGB transfer + * function. For color spaces whose gamut can not be described in terms of XYZ D50, returns + * sRGB. + */ + sk_sp<SkColorSpace> makeSRGBGamma() const; + + /** + * Returns a color space with the same transfer function as this one, but with the primary + * colors rotated. For any XYZ space, this produces a new color space that maps RGB to GBR + * (when applied to a source), and maps RGB to BRG (when applied to a destination). For other + * types of color spaces, returns nullptr. + * + * This is used for testing, to construct color spaces that have severe and testable behavior. + */ + sk_sp<SkColorSpace> makeColorSpin() const; + + /** + * Returns true if the color space is sRGB. + * Returns false otherwise. + * + * This allows a little bit of tolerance, given that we might see small numerical error + * in some cases: converting ICC fixed point to float, converting white point to D50, + * rounding decisions on transfer function and matrix. + * + * This does not consider a 2.2f exponential transfer function to be sRGB. While these + * functions are similar (and it is sometimes useful to consider them together), this + * function checks for logical equality. + */ + bool isSRGB() const; + + /** + * Returns nullptr on failure. Fails when we fallback to serializing ICC data and + * the data is too large to serialize. + */ + sk_sp<SkData> serialize() const; + + /** + * If |memory| is nullptr, returns the size required to serialize. + * Otherwise, serializes into |memory| and returns the size. + */ + size_t writeToMemory(void* memory) const; + + static sk_sp<SkColorSpace> Deserialize(const void* data, size_t length); + + /** + * If both are null, we return true. If one is null and the other is not, we return false. + * If both are non-null, we do a deeper compare. + */ + static bool Equals(const SkColorSpace*, const SkColorSpace*); + + void transferFn(float gabcdef[7]) const; // DEPRECATED: Remove when webview usage is gone + void transferFn(skcms_TransferFunction* fn) const; + void invTransferFn(skcms_TransferFunction* fn) const; + void gamutTransformTo(const SkColorSpace* dst, skcms_Matrix3x3* src_to_dst) const; + + uint32_t transferFnHash() const { return fTransferFnHash; } + uint64_t hash() const { return (uint64_t)fTransferFnHash << 32 | fToXYZD50Hash; } + +private: + friend class SkColorSpaceSingletonFactory; + + SkColorSpace(const skcms_TransferFunction& transferFn, const skcms_Matrix3x3& toXYZ); + + void computeLazyDstFields() const; + + uint32_t fTransferFnHash; + uint32_t fToXYZD50Hash; + + skcms_TransferFunction fTransferFn; + skcms_Matrix3x3 fToXYZD50; + + mutable skcms_TransferFunction fInvTransferFn; + mutable skcms_Matrix3x3 fFromXYZD50; + mutable SkOnce fLazyDstFieldsOnce; +}; + +#endif diff --git a/src/deps/skia/include/core/SkContourMeasure.h b/src/deps/skia/include/core/SkContourMeasure.h new file mode 100644 index 000000000..08a50b110 --- /dev/null +++ b/src/deps/skia/include/core/SkContourMeasure.h @@ -0,0 +1,131 @@ +/* + * Copyright 2018 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkContourMeasure_DEFINED +#define SkContourMeasure_DEFINED + +#include "include/core/SkPath.h" +#include "include/core/SkRefCnt.h" +#include "include/private/SkTDArray.h" + +struct SkConic; + +class SK_API SkContourMeasure : public SkRefCnt { +public: + /** Return the length of the contour. + */ + SkScalar length() const { return fLength; } + + /** Pins distance to 0 <= distance <= length(), and then computes the corresponding + * position and tangent. + */ + bool SK_WARN_UNUSED_RESULT getPosTan(SkScalar distance, SkPoint* position, + SkVector* tangent) const; + + enum MatrixFlags { + kGetPosition_MatrixFlag = 0x01, + kGetTangent_MatrixFlag = 0x02, + kGetPosAndTan_MatrixFlag = kGetPosition_MatrixFlag | kGetTangent_MatrixFlag + }; + + /** Pins distance to 0 <= distance <= getLength(), and then computes + the corresponding matrix (by calling getPosTan). + Returns false if there is no path, or a zero-length path was specified, in which case + matrix is unchanged. + */ + bool SK_WARN_UNUSED_RESULT getMatrix(SkScalar distance, SkMatrix* matrix, + MatrixFlags flags = kGetPosAndTan_MatrixFlag) const; + + /** Given a start and stop distance, return in dst the intervening segment(s). + If the segment is zero-length, return false, else return true. + startD and stopD are pinned to legal values (0..getLength()). If startD > stopD + then return false (and leave dst untouched). + Begin the segment with a moveTo if startWithMoveTo is true + */ + bool SK_WARN_UNUSED_RESULT getSegment(SkScalar startD, SkScalar stopD, SkPath* dst, + bool startWithMoveTo) const; + + /** Return true if the contour is closed() + */ + bool isClosed() const { return fIsClosed; } + +private: + struct Segment { + SkScalar fDistance; // total distance up to this point + unsigned fPtIndex; // index into the fPts array + unsigned fTValue : 30; + unsigned fType : 2; // actually the enum SkSegType + // See SkPathMeasurePriv.h + + SkScalar getScalarT() const; + + static const Segment* Next(const Segment* seg) { + unsigned ptIndex = seg->fPtIndex; + do { + ++seg; + } while (seg->fPtIndex == ptIndex); + return seg; + } + + }; + + const SkTDArray<Segment> fSegments; + const SkTDArray<SkPoint> fPts; // Points used to define the segments + + const SkScalar fLength; + const bool fIsClosed; + + SkContourMeasure(SkTDArray<Segment>&& segs, SkTDArray<SkPoint>&& pts, + SkScalar length, bool isClosed); + ~SkContourMeasure() override {} + + const Segment* distanceToSegment(SkScalar distance, SkScalar* t) const; + + friend class SkContourMeasureIter; +}; + +class SK_API SkContourMeasureIter { +public: + SkContourMeasureIter(); + /** + * Initialize the Iter with a path. + * The parts of the path that are needed are copied, so the client is free to modify/delete + * the path after this call. + * + * resScale controls the precision of the measure. values > 1 increase the + * precision (and possibly slow down the computation). + */ + SkContourMeasureIter(const SkPath& path, bool forceClosed, SkScalar resScale = 1); + ~SkContourMeasureIter(); + + /** + * Reset the Iter with a path. + * The parts of the path that are needed are copied, so the client is free to modify/delete + * the path after this call. + */ + void reset(const SkPath& path, bool forceClosed, SkScalar resScale = 1); + + /** + * Iterates through contours in path, returning a contour-measure object for each contour + * in the path. Returns null when it is done. + * + * This only returns non-zero length contours, where a contour is the segments between + * a kMove_Verb and either ... + * - the next kMove_Verb + * - kClose_Verb (1 or more) + * - kDone_Verb + * If it encounters a zero-length contour, it is skipped. + */ + sk_sp<SkContourMeasure> next(); + +private: + class Impl; + + std::unique_ptr<Impl> fImpl; +}; + +#endif diff --git a/src/deps/skia/include/core/SkCoverageMode.h b/src/deps/skia/include/core/SkCoverageMode.h new file mode 100644 index 000000000..ea5b73d1a --- /dev/null +++ b/src/deps/skia/include/core/SkCoverageMode.h @@ -0,0 +1,30 @@ +/* + * Copyright 2018 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkCoverageMode_DEFINED +#define SkCoverageMode_DEFINED + +#include "include/core/SkTypes.h" + +/** + * Describes geometric operations (ala SkRegion::Op) that can be applied to coverage bytes. + * These can be thought of as variants of porter-duff (SkBlendMode) modes, but only applied + * to the alpha channel. + * + * See SkMaskFilter for ways to use these when combining two different masks. + */ +enum class SkCoverageMode { + kUnion, // A ∪ B A+B-A*B + kIntersect, // A ∩ B A*B + kDifference, // A - B A*(1-B) + kReverseDifference, // B - A B*(1-A) + kXor, // A ⊕ B A+B-2*A*B + + kLast = kXor, +}; + +#endif diff --git a/src/deps/skia/include/core/SkCubicMap.h b/src/deps/skia/include/core/SkCubicMap.h new file mode 100644 index 000000000..7389b92af --- /dev/null +++ b/src/deps/skia/include/core/SkCubicMap.h @@ -0,0 +1,45 @@ +/* + * Copyright 2018 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkCubicMap_DEFINED +#define SkCubicMap_DEFINED + +#include "include/core/SkPoint.h" + +/** + * Fast evaluation of a cubic ease-in / ease-out curve. This is defined as a parametric cubic + * curve inside the unit square. + * + * pt[0] is implicitly { 0, 0 } + * pt[3] is implicitly { 1, 1 } + * pts[1,2].X are inside the unit [0..1] + */ +class SK_API SkCubicMap { +public: + SkCubicMap(SkPoint p1, SkPoint p2); + + static bool IsLinear(SkPoint p1, SkPoint p2) { + return SkScalarNearlyEqual(p1.fX, p1.fY) && SkScalarNearlyEqual(p2.fX, p2.fY); + } + + float computeYFromX(float x) const; + + SkPoint computeFromT(float t) const; + +private: + enum Type { + kLine_Type, // x == y + kCubeRoot_Type, // At^3 == x + kSolver_Type, // general monotonic cubic solver + }; + + SkPoint fCoeff[3]; + Type fType; +}; + +#endif + diff --git a/src/deps/skia/include/core/SkCustomMesh.h b/src/deps/skia/include/core/SkCustomMesh.h new file mode 100644 index 000000000..f9bddf338 --- /dev/null +++ b/src/deps/skia/include/core/SkCustomMesh.h @@ -0,0 +1,202 @@ +/* + * Copyright 2021 Google LLC + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkCustomMesh_DEFINED +#define SkCustomMesh_DEFINED + +#include "include/core/SkTypes.h" + +#ifdef SK_ENABLE_SKSL +#include "include/core/SkColorSpace.h" +#include "include/core/SkImageInfo.h" +#include "include/core/SkRect.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkSpan.h" +#include "include/core/SkString.h" + +#include <vector> + +namespace SkSL { struct Program; } + +/** + * A specification for custom meshes. Specifies the vertex buffer attributes and stride, the + * vertex program that produces a user-defined set of varyings, a fragment program that ingests + * the interpolated varyings and produces local coordinates and optionally a color. + * + * The signature of the vertex program must be: + * float2 main(Attributes, out Varyings) + * where the return value is a local position that will be transformed by SkCanvas's matrix. + * + * The signature of the fragment program must be either: + * (float2|void) main(Varyings) + * or + * (float2|void) main(Varyings, out (half4|float4) color) + * + * where the return value is the local coordinates that will be used to access SkShader. If the + * return type is void then the interpolated position from vertex shader return is used as the local + * coordinate. If the color variant is used it will be blended with SkShader (or SkPaint color in + * absence of a shader) using the SkBlender provided to the SkCanvas draw call. + */ +class SkCustomMeshSpecification : public SkNVRefCnt<SkCustomMeshSpecification> { +public: + /** These values are enforced when creating a specification. */ + static constexpr size_t kMaxStride = 1024; + static constexpr size_t kMaxAttributes = 8; + static constexpr size_t kStrideAlignment = 4; + static constexpr size_t kOffsetAlignment = 4; + static constexpr size_t kMaxVaryings = 6; + + struct Attribute { + enum class Type : uint32_t { // CPU representation Shader Type + kFloat, // float float + kFloat2, // two floats float2 + kFloat3, // three floats float3 + kFloat4, // four floats float4 + kUByte4_unorm, // four bytes half4 + + kLast = kUByte4_unorm + }; + Type type; + size_t offset; + SkString name; + }; + + struct Varying { + enum class Type : uint32_t { + kFloat, // "float" + kFloat2, // "float2" + kFloat3, // "float3" + kFloat4, // "float4" + kHalf, // "half" + kHalf2, // "half2" + kHalf3, // "half3" + kHalf4, // "half4" + + kLast = kHalf4 + }; + Type type; + SkString name; + }; + + ~SkCustomMeshSpecification(); + + struct Result { + sk_sp<SkCustomMeshSpecification> specification; + SkString error; + }; + + /** + * If successful the return is a specification and an empty error string. Otherwise, it is a + * null specification a non-empty error string. + * + * @param attributes The vertex attributes that will be consumed by 'vs'. Attributes need + * not be tightly packed but attribute offsets must be aligned to + * kOffsetAlignment and offset + size may not be greater than + * 'vertexStride'. At least one attribute is required. + * @param vertexStride The offset between successive attribute values. This must be aligned to + * kStrideAlignment. + * @param varyings The varyings that will be written by 'vs' and read by 'fs'. This may + * be empty. + * @param vs The vertex shader code that computes a vertex position and the varyings + * from the attributes. + * @param fs The fragment code that computes a local coordinate and optionally a + * color from the varyings. The local coordinate is used to sample + * SkShader. + * @param cs The colorspace of the color produced by 'fs'. Ignored if 'fs's main() + * function does not have a color out param. + * @param at The alpha type of the color produced by 'fs'. Ignored if 'fs's main() + * function does not have a color out param. Cannot be kUnknown. + */ + static Result Make(SkSpan<const Attribute> attributes, + size_t vertexStride, + SkSpan<const Varying> varyings, + const SkString& vs, + const SkString& fs, + sk_sp<SkColorSpace> cs = SkColorSpace::MakeSRGB(), + SkAlphaType at = kPremul_SkAlphaType); + + SkSpan<const Attribute> attributes() const { return SkMakeSpan(fAttributes); } + + size_t stride() const { return fStride; } + +private: + friend struct SkCustomMeshSpecificationPriv; + + enum class ColorType { + kNone, + kHalf4, + kFloat4, + }; + + static Result MakeFromSourceWithStructs(SkSpan<const Attribute> attributes, + size_t stride, + SkSpan<const Varying> varyings, + const SkString& vs, + const SkString& fs, + sk_sp<SkColorSpace> cs, + SkAlphaType at); + + SkCustomMeshSpecification(SkSpan<const Attribute>, + size_t, + SkSpan<const Varying>, + std::unique_ptr<SkSL::Program>, + std::unique_ptr<SkSL::Program>, + ColorType, + bool hasLocalCoords, + sk_sp<SkColorSpace>, + SkAlphaType); + + SkCustomMeshSpecification(const SkCustomMeshSpecification&) = delete; + SkCustomMeshSpecification(SkCustomMeshSpecification&&) = delete; + + SkCustomMeshSpecification& operator=(const SkCustomMeshSpecification&) = delete; + SkCustomMeshSpecification& operator=(SkCustomMeshSpecification&&) = delete; + + const std::vector<Attribute> fAttributes; + const std::vector<Varying> fVaryings; + std::unique_ptr<SkSL::Program> fVS; + std::unique_ptr<SkSL::Program> fFS; + size_t fStride; + uint32_t fHash; + ColorType fColorType; + bool fHasLocalCoords; + sk_sp<SkColorSpace> fColorSpace; + SkAlphaType fAlphaType; +}; + +/** + * This is a placeholder object. We will want something that allows the client to incrementally + * update the mesh that can be synchronized with the GPU backend without requiring extra copies. + * + * A buffer of vertices, a topology, optionally indices, and a compatible SkCustomMeshSpecification. + * The data in 'vb' is expected to contain the attributes described in 'spec' for 'vcount' vertices. + * The size of the buffer must be at least spec->stride()*vcount (even if vertex attributes contains + * pad at the end of the stride). If 'bounds' does not contain all points output by 'spec''s vertex + * program when applied to the vertices in 'vb' a draw of the custom mesh produces undefined + * results. + * + * If indices is null then then 'icount' must be <= 0. 'vcount' vertices will be selected from 'vb' + * to create the topology indicated by 'mode'. + * + * If indices is not null then icount must be >= 3. 'vb' will be indexed by 'icount' successive + * values in 'indices' to create the topology indicated by 'mode'. The values in 'indices' must be + * less than 'vcount' + */ +struct SkCustomMesh { + enum class Mode { kTriangles, kTriangleStrip }; + sk_sp<SkCustomMeshSpecification> spec; + Mode mode = Mode::kTriangles; + SkRect bounds = SkRect::MakeEmpty(); + const void* vb = nullptr; + int vcount = 0; + const uint16_t* indices = nullptr; + int icount = 0; +}; + +#endif // SK_ENABLE_SKSL + +#endif diff --git a/src/deps/skia/include/core/SkData.h b/src/deps/skia/include/core/SkData.h new file mode 100644 index 000000000..2a4b40d5f --- /dev/null +++ b/src/deps/skia/include/core/SkData.h @@ -0,0 +1,188 @@ +/* + * Copyright 2011 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkData_DEFINED +#define SkData_DEFINED + +#include <stdio.h> + +#include "include/core/SkRefCnt.h" + +class SkStream; + +/** + * SkData holds an immutable data buffer. Not only is the data immutable, + * but the actual ptr that is returned (by data() or bytes()) is guaranteed + * to always be the same for the life of this instance. + */ +class SK_API SkData final : public SkNVRefCnt<SkData> { +public: + /** + * Returns the number of bytes stored. + */ + size_t size() const { return fSize; } + + bool isEmpty() const { return 0 == fSize; } + + /** + * Returns the ptr to the data. + */ + const void* data() const { return fPtr; } + + /** + * Like data(), returns a read-only ptr into the data, but in this case + * it is cast to uint8_t*, to make it easy to add an offset to it. + */ + const uint8_t* bytes() const { + return reinterpret_cast<const uint8_t*>(fPtr); + } + + /** + * USE WITH CAUTION. + * This call will assert that the refcnt is 1, as a precaution against modifying the + * contents when another client/thread has access to the data. + */ + void* writable_data() { + if (fSize) { + // only assert we're unique if we're not empty + SkASSERT(this->unique()); + } + return const_cast<void*>(fPtr); + } + + /** + * Helper to copy a range of the data into a caller-provided buffer. + * Returns the actual number of bytes copied, after clamping offset and + * length to the size of the data. If buffer is NULL, it is ignored, and + * only the computed number of bytes is returned. + */ + size_t copyRange(size_t offset, size_t length, void* buffer) const; + + /** + * Returns true if these two objects have the same length and contents, + * effectively returning 0 == memcmp(...) + */ + bool equals(const SkData* other) const; + + /** + * Function that, if provided, will be called when the SkData goes out + * of scope, allowing for custom allocation/freeing of the data's contents. + */ + typedef void (*ReleaseProc)(const void* ptr, void* context); + + /** + * Create a new dataref by copying the specified data + */ + static sk_sp<SkData> MakeWithCopy(const void* data, size_t length); + + + /** + * Create a new data with uninitialized contents. The caller should call writable_data() + * to write into the buffer, but this must be done before another ref() is made. + */ + static sk_sp<SkData> MakeUninitialized(size_t length); + + /** + * Create a new data with zero-initialized contents. The caller should call writable_data() + * to write into the buffer, but this must be done before another ref() is made. + */ + static sk_sp<SkData> MakeZeroInitialized(size_t length); + + /** + * Create a new dataref by copying the specified c-string + * (a null-terminated array of bytes). The returned SkData will have size() + * equal to strlen(cstr) + 1. If cstr is NULL, it will be treated the same + * as "". + */ + static sk_sp<SkData> MakeWithCString(const char cstr[]); + + /** + * Create a new dataref, taking the ptr as is, and using the + * releaseproc to free it. The proc may be NULL. + */ + static sk_sp<SkData> MakeWithProc(const void* ptr, size_t length, ReleaseProc proc, void* ctx); + + /** + * Call this when the data parameter is already const and will outlive the lifetime of the + * SkData. Suitable for with const globals. + */ + static sk_sp<SkData> MakeWithoutCopy(const void* data, size_t length) { + return MakeWithProc(data, length, NoopReleaseProc, nullptr); + } + + /** + * Create a new dataref from a pointer allocated by malloc. The Data object + * takes ownership of that allocation, and will handling calling sk_free. + */ + static sk_sp<SkData> MakeFromMalloc(const void* data, size_t length); + + /** + * Create a new dataref the file with the specified path. + * If the file cannot be opened, this returns NULL. + */ + static sk_sp<SkData> MakeFromFileName(const char path[]); + + /** + * Create a new dataref from a stdio FILE. + * This does not take ownership of the FILE, nor close it. + * The caller is free to close the FILE at its convenience. + * The FILE must be open for reading only. + * Returns NULL on failure. + */ + static sk_sp<SkData> MakeFromFILE(FILE* f); + + /** + * Create a new dataref from a file descriptor. + * This does not take ownership of the file descriptor, nor close it. + * The caller is free to close the file descriptor at its convenience. + * The file descriptor must be open for reading only. + * Returns NULL on failure. + */ + static sk_sp<SkData> MakeFromFD(int fd); + + /** + * Attempt to read size bytes into a SkData. If the read succeeds, return the data, + * else return NULL. Either way the stream's cursor may have been changed as a result + * of calling read(). + */ + static sk_sp<SkData> MakeFromStream(SkStream*, size_t size); + + /** + * Create a new dataref using a subset of the data in the specified + * src dataref. + */ + static sk_sp<SkData> MakeSubset(const SkData* src, size_t offset, size_t length); + + /** + * Returns a new empty dataref (or a reference to a shared empty dataref). + * New or shared, the caller must see that unref() is eventually called. + */ + static sk_sp<SkData> MakeEmpty(); + +private: + friend class SkNVRefCnt<SkData>; + ReleaseProc fReleaseProc; + void* fReleaseProcContext; + const void* fPtr; + size_t fSize; + + SkData(const void* ptr, size_t size, ReleaseProc, void* context); + explicit SkData(size_t size); // inplace new/delete + ~SkData(); + + // Ensure the unsized delete is called. + void operator delete(void* p); + + // shared internal factory + static sk_sp<SkData> PrivateNewWithCopy(const void* srcOrNull, size_t length); + + static void NoopReleaseProc(const void*, void*); // {} + + using INHERITED = SkRefCnt; +}; + +#endif diff --git a/src/deps/skia/include/core/SkDataTable.h b/src/deps/skia/include/core/SkDataTable.h new file mode 100644 index 000000000..a6a510b7b --- /dev/null +++ b/src/deps/skia/include/core/SkDataTable.h @@ -0,0 +1,118 @@ +/* + * Copyright 2013 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkDataTable_DEFINED +#define SkDataTable_DEFINED + +#include "include/core/SkData.h" +#include "include/private/SkTDArray.h" + +/** + * Like SkData, SkDataTable holds an immutable data buffer. The data buffer is + * organized into a table of entries, each with a length, so the entries are + * not required to all be the same size. + */ +class SK_API SkDataTable : public SkRefCnt { +public: + /** + * Returns true if the table is empty (i.e. has no entries). + */ + bool isEmpty() const { return 0 == fCount; } + + /** + * Return the number of entries in the table. 0 for an empty table + */ + int count() const { return fCount; } + + /** + * Return the size of the index'th entry in the table. The caller must + * ensure that index is valid for this table. + */ + size_t atSize(int index) const; + + /** + * Return a pointer to the data of the index'th entry in the table. + * The caller must ensure that index is valid for this table. + * + * @param size If non-null, this returns the byte size of this entry. This + * will be the same value that atSize(index) would return. + */ + const void* at(int index, size_t* size = nullptr) const; + + template <typename T> + const T* atT(int index, size_t* size = nullptr) const { + return reinterpret_cast<const T*>(this->at(index, size)); + } + + /** + * Returns the index'th entry as a c-string, and assumes that the trailing + * null byte had been copied into the table as well. + */ + const char* atStr(int index) const { + size_t size; + const char* str = this->atT<const char>(index, &size); + SkASSERT(strlen(str) + 1 == size); + return str; + } + + typedef void (*FreeProc)(void* context); + + static sk_sp<SkDataTable> MakeEmpty(); + + /** + * Return a new DataTable that contains a copy of the data stored in each + * "array". + * + * @param ptrs array of points to each element to be copied into the table. + * @param sizes array of byte-lengths for each entry in the corresponding + * ptrs[] array. + * @param count the number of array elements in ptrs[] and sizes[] to copy. + */ + static sk_sp<SkDataTable> MakeCopyArrays(const void * const * ptrs, + const size_t sizes[], int count); + + /** + * Return a new table that contains a copy of the data in array. + * + * @param array contiguous array of data for all elements to be copied. + * @param elemSize byte-length for a given element. + * @param count the number of entries to be copied out of array. The number + * of bytes that will be copied is count * elemSize. + */ + static sk_sp<SkDataTable> MakeCopyArray(const void* array, size_t elemSize, int count); + + static sk_sp<SkDataTable> MakeArrayProc(const void* array, size_t elemSize, int count, + FreeProc proc, void* context); + +private: + struct Dir { + const void* fPtr; + uintptr_t fSize; + }; + + int fCount; + size_t fElemSize; + union { + const Dir* fDir; + const char* fElems; + } fU; + + FreeProc fFreeProc; + void* fFreeProcContext; + + SkDataTable(); + SkDataTable(const void* array, size_t elemSize, int count, + FreeProc, void* context); + SkDataTable(const Dir*, int count, FreeProc, void* context); + ~SkDataTable() override; + + friend class SkDataTableBuilder; // access to Dir + + using INHERITED = SkRefCnt; +}; + +#endif diff --git a/src/deps/skia/include/core/SkDeferredDisplayList.h b/src/deps/skia/include/core/SkDeferredDisplayList.h new file mode 100644 index 000000000..28e460fa8 --- /dev/null +++ b/src/deps/skia/include/core/SkDeferredDisplayList.h @@ -0,0 +1,110 @@ +/* + * Copyright 2017 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkDeferredDisplayList_DEFINED +#define SkDeferredDisplayList_DEFINED + +#include "include/core/SkRefCnt.h" +#include "include/core/SkSurfaceCharacterization.h" +#include "include/core/SkTypes.h" + +class SkDeferredDisplayListPriv; + +#if SK_SUPPORT_GPU +#include "include/gpu/GrRecordingContext.h" +#include "include/private/SkTArray.h" +#include <map> +class GrRenderTask; +class GrRenderTargetProxy; +#else +using GrRenderTargetProxy = SkRefCnt; +#endif + +/* + * This class contains pre-processed gpu operations that can be replayed into + * an SkSurface via SkSurface::draw(SkDeferredDisplayList*). + */ +class SkDeferredDisplayList : public SkNVRefCnt<SkDeferredDisplayList> { +public: + SK_API ~SkDeferredDisplayList(); + + SK_API const SkSurfaceCharacterization& characterization() const { + return fCharacterization; + } + +#if SK_SUPPORT_GPU + /** + * Iterate through the programs required by the DDL. + */ + class SK_API ProgramIterator { + public: + ProgramIterator(GrDirectContext*, SkDeferredDisplayList*); + ~ProgramIterator(); + + // This returns true if any work was done. Getting a cache hit does not count as work. + bool compile(); + bool done() const; + void next(); + + private: + GrDirectContext* fDContext; + const SkTArray<GrRecordingContext::ProgramData>& fProgramData; + int fIndex; + }; +#endif + + // Provides access to functions that aren't part of the public API. + SkDeferredDisplayListPriv priv(); + const SkDeferredDisplayListPriv priv() const; // NOLINT(readability-const-return-type) + +private: + friend class GrDrawingManager; // for access to 'fRenderTasks', 'fLazyProxyData', 'fArenas' + friend class SkDeferredDisplayListRecorder; // for access to 'fLazyProxyData' + friend class SkDeferredDisplayListPriv; + + // This object is the source from which the lazy proxy backing the DDL will pull its backing + // texture when the DDL is replayed. It has to be separately ref counted bc the lazy proxy + // can outlive the DDL. + class LazyProxyData : public SkRefCnt { +#if SK_SUPPORT_GPU + public: + // Upon being replayed - this field will be filled in (by the DrawingManager) with the + // proxy backing the destination SkSurface. Note that, since there is no good place to + // clear it, it can become a dangling pointer. Additionally, since the renderTargetProxy + // doesn't get a ref here, the SkSurface that owns it must remain alive until the DDL + // is flushed. + // TODO: the drawing manager could ref the renderTargetProxy for the DDL and then add + // a renderingTask to unref it after the DDL's ops have been executed. + GrRenderTargetProxy* fReplayDest = nullptr; +#endif + }; + + SK_API SkDeferredDisplayList(const SkSurfaceCharacterization& characterization, + sk_sp<GrRenderTargetProxy> fTargetProxy, + sk_sp<LazyProxyData>); + +#if SK_SUPPORT_GPU + const SkTArray<GrRecordingContext::ProgramData>& programData() const { + return fProgramData; + } +#endif + + const SkSurfaceCharacterization fCharacterization; + +#if SK_SUPPORT_GPU + // These are ordered such that the destructor cleans op tasks up first (which may refer back + // to the arena and memory pool in their destructors). + GrRecordingContext::OwnedArenas fArenas; + SkTArray<sk_sp<GrRenderTask>> fRenderTasks; + + SkTArray<GrRecordingContext::ProgramData> fProgramData; + sk_sp<GrRenderTargetProxy> fTargetProxy; + sk_sp<LazyProxyData> fLazyProxyData; +#endif +}; + +#endif diff --git a/src/deps/skia/include/core/SkDeferredDisplayListRecorder.h b/src/deps/skia/include/core/SkDeferredDisplayListRecorder.h new file mode 100644 index 000000000..30a4a73ee --- /dev/null +++ b/src/deps/skia/include/core/SkDeferredDisplayListRecorder.h @@ -0,0 +1,97 @@ +/* + * Copyright 2017 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkDeferredDisplayListRecorder_DEFINED +#define SkDeferredDisplayListRecorder_DEFINED + +#include "include/core/SkDeferredDisplayList.h" +#include "include/core/SkImage.h" +#include "include/core/SkImageInfo.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkSurfaceCharacterization.h" +#include "include/core/SkTypes.h" + +class GrBackendFormat; +class GrBackendTexture; +class GrRecordingContext; +class GrYUVABackendTextureInfo; +class SkCanvas; +class SkSurface; + +/* + * This class is intended to be used as: + * Get an SkSurfaceCharacterization representing the intended gpu-backed destination SkSurface + * Create one of these (an SkDeferredDisplayListRecorder) on the stack + * Get the canvas and render into it + * Snap off and hold on to an SkDeferredDisplayList + * Once your app actually needs the pixels, call SkSurface::draw(SkDeferredDisplayList*) + * + * This class never accesses the GPU but performs all the cpu work it can. It + * is thread-safe (i.e., one can break a scene into tiles and perform their cpu-side + * work in parallel ahead of time). + */ +class SK_API SkDeferredDisplayListRecorder { +public: + SkDeferredDisplayListRecorder(const SkSurfaceCharacterization&); + ~SkDeferredDisplayListRecorder(); + + const SkSurfaceCharacterization& characterization() const { + return fCharacterization; + } + + // The backing canvas will become invalid (and this entry point will return + // null) once 'detach' is called. + // Note: ownership of the SkCanvas is not transferred via this call. + SkCanvas* getCanvas(); + + sk_sp<SkDeferredDisplayList> detach(); + +#if SK_SUPPORT_GPU + using PromiseImageTextureContext = SkImage::PromiseImageTextureContext; + using PromiseImageTextureFulfillProc = SkImage::PromiseImageTextureFulfillProc; + using PromiseImageTextureReleaseProc = SkImage::PromiseImageTextureReleaseProc; + +#ifndef SK_MAKE_PROMISE_TEXTURE_DISABLE_LEGACY_API + /** Deprecated: Use SkImage::MakePromiseTexture instead. */ + sk_sp<SkImage> makePromiseTexture(const GrBackendFormat& backendFormat, + int width, + int height, + GrMipmapped mipMapped, + GrSurfaceOrigin origin, + SkColorType colorType, + SkAlphaType alphaType, + sk_sp<SkColorSpace> colorSpace, + PromiseImageTextureFulfillProc textureFulfillProc, + PromiseImageTextureReleaseProc textureReleaseProc, + PromiseImageTextureContext textureContext); + + /** Deprecated: Use SkImage::MakePromiseYUVATexture instead. */ + sk_sp<SkImage> makeYUVAPromiseTexture(const GrYUVABackendTextureInfo& yuvaBackendTextureInfo, + sk_sp<SkColorSpace> imageColorSpace, + PromiseImageTextureFulfillProc textureFulfillProc, + PromiseImageTextureReleaseProc textureReleaseProc, + PromiseImageTextureContext textureContexts[]); +#endif // SK_MAKE_PROMISE_TEXTURE_DISABLE_LEGACY_API +#endif // SK_SUPPORT_GPU + +private: + SkDeferredDisplayListRecorder(const SkDeferredDisplayListRecorder&) = delete; + SkDeferredDisplayListRecorder& operator=(const SkDeferredDisplayListRecorder&) = delete; + + bool init(); + + const SkSurfaceCharacterization fCharacterization; + +#if SK_SUPPORT_GPU + sk_sp<GrRecordingContext> fContext; + sk_sp<GrRenderTargetProxy> fTargetProxy; + sk_sp<SkDeferredDisplayList::LazyProxyData> fLazyProxyData; + sk_sp<SkSurface> fSurface; +#endif +}; + +#endif diff --git a/src/deps/skia/include/core/SkDocument.h b/src/deps/skia/include/core/SkDocument.h new file mode 100644 index 000000000..eacfb2c04 --- /dev/null +++ b/src/deps/skia/include/core/SkDocument.h @@ -0,0 +1,91 @@ +/* + * Copyright 2013 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkDocument_DEFINED +#define SkDocument_DEFINED + +#include "include/core/SkRefCnt.h" +#include "include/core/SkScalar.h" + +class SkCanvas; +class SkWStream; +struct SkRect; + +/** SK_ScalarDefaultDPI is 72 dots per inch. */ +static constexpr SkScalar SK_ScalarDefaultRasterDPI = 72.0f; + +/** + * High-level API for creating a document-based canvas. To use.. + * + * 1. Create a document, specifying a stream to store the output. + * 2. For each "page" of content: + * a. canvas = doc->beginPage(...) + * b. draw_my_content(canvas); + * c. doc->endPage(); + * 3. Close the document with doc->close(). + */ +class SK_API SkDocument : public SkRefCnt { +public: + + /** + * Begin a new page for the document, returning the canvas that will draw + * into the page. The document owns this canvas, and it will go out of + * scope when endPage() or close() is called, or the document is deleted. + */ + SkCanvas* beginPage(SkScalar width, SkScalar height, const SkRect* content = nullptr); + + /** + * Call endPage() when the content for the current page has been drawn + * (into the canvas returned by beginPage()). After this call the canvas + * returned by beginPage() will be out-of-scope. + */ + void endPage(); + + /** + * Call close() when all pages have been drawn. This will close the file + * or stream holding the document's contents. After close() the document + * can no longer add new pages. Deleting the document will automatically + * call close() if need be. + */ + void close(); + + /** + * Call abort() to stop producing the document immediately. + * The stream output must be ignored, and should not be trusted. + */ + void abort(); + +protected: + SkDocument(SkWStream*); + + // note: subclasses must call close() in their destructor, as the base class + // cannot do this for them. + ~SkDocument() override; + + virtual SkCanvas* onBeginPage(SkScalar width, SkScalar height) = 0; + virtual void onEndPage() = 0; + virtual void onClose(SkWStream*) = 0; + virtual void onAbort() = 0; + + // Allows subclasses to write to the stream as pages are written. + SkWStream* getStream() { return fStream; } + + enum State { + kBetweenPages_State, + kInPage_State, + kClosed_State + }; + State getState() const { return fState; } + +private: + SkWStream* fStream; + State fState; + + using INHERITED = SkRefCnt; +}; + +#endif diff --git a/src/deps/skia/include/core/SkDrawLooper.h b/src/deps/skia/include/core/SkDrawLooper.h new file mode 100644 index 000000000..69d341c25 --- /dev/null +++ b/src/deps/skia/include/core/SkDrawLooper.h @@ -0,0 +1,135 @@ + +/* + * Copyright 2011 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + + +#ifndef SkDrawLooper_DEFINED +#define SkDrawLooper_DEFINED + +#include "include/core/SkBlurTypes.h" +#include "include/core/SkColor.h" +#include "include/core/SkFlattenable.h" +#include "include/core/SkPoint.h" +#include <functional> // std::function + +#ifndef SK_SUPPORT_LEGACY_DRAWLOOPER +#error "SkDrawLooper is unsupported" +#endif + +class SkArenaAlloc; +class SkCanvas; +class SkMatrix; +class SkPaint; +struct SkRect; + +/** \class SkDrawLooper + DEPRECATED: No longer supported in Skia. +*/ +class SK_API SkDrawLooper : public SkFlattenable { +public: + /** + * Holds state during a draw. Users call next() until it returns false. + * + * Subclasses of SkDrawLooper should create a subclass of this object to + * hold state specific to their subclass. + */ + class SK_API Context { + public: + Context() {} + virtual ~Context() {} + + struct Info { + SkVector fTranslate; + bool fApplyPostCTM; + + void applyToCTM(SkMatrix* ctm) const; + void applyToCanvas(SkCanvas*) const; + }; + + /** + * Called in a loop on objects returned by SkDrawLooper::createContext(). + * Each time true is returned, the object is drawn (possibly with a modified + * canvas and/or paint). When false is finally returned, drawing for the object + * stops. + * + * On each call, the paint will be in its original state, but the + * canvas will be as it was following the previous call to next() or + * createContext(). + * + * The implementation must ensure that, when next() finally returns + * false, the canvas has been restored to the state it was + * initially, before createContext() was first called. + */ + virtual bool next(Info*, SkPaint*) = 0; + + private: + Context(const Context&) = delete; + Context& operator=(const Context&) = delete; + }; + + /** + * Called right before something is being drawn. Returns a Context + * whose next() method should be called until it returns false. + */ + virtual Context* makeContext(SkArenaAlloc*) const = 0; + + /** + * The fast bounds functions are used to enable the paint to be culled early + * in the drawing pipeline. If a subclass can support this feature it must + * return true for the canComputeFastBounds() function. If that function + * returns false then computeFastBounds behavior is undefined otherwise it + * is expected to have the following behavior. Given the parent paint and + * the parent's bounding rect the subclass must fill in and return the + * storage rect, where the storage rect is with the union of the src rect + * and the looper's bounding rect. + */ + bool canComputeFastBounds(const SkPaint& paint) const; + void computeFastBounds(const SkPaint& paint, const SkRect& src, SkRect* dst) const; + + struct BlurShadowRec { + SkScalar fSigma; + SkVector fOffset; + SkColor fColor; + SkBlurStyle fStyle; + }; + /** + * If this looper can be interpreted as having two layers, such that + * 1. The first layer (bottom most) just has a blur and translate + * 2. The second layer has no modifications to either paint or canvas + * 3. No other layers. + * then return true, and if not null, fill out the BlurShadowRec). + * + * If any of the above are not met, return false and ignore the BlurShadowRec parameter. + */ + virtual bool asABlurShadow(BlurShadowRec*) const; + + static SkFlattenable::Type GetFlattenableType() { + return kSkDrawLooper_Type; + } + + SkFlattenable::Type getFlattenableType() const override { + return kSkDrawLooper_Type; + } + + static sk_sp<SkDrawLooper> Deserialize(const void* data, size_t size, + const SkDeserialProcs* procs = nullptr) { + return sk_sp<SkDrawLooper>(static_cast<SkDrawLooper*>( + SkFlattenable::Deserialize( + kSkDrawLooper_Type, data, size, procs).release())); + } + + void apply(SkCanvas* canvas, const SkPaint& paint, + std::function<void(SkCanvas*, const SkPaint&)>); + +protected: + SkDrawLooper() {} + +private: + using INHERITED = SkFlattenable; +}; + +#endif diff --git a/src/deps/skia/include/core/SkDrawable.h b/src/deps/skia/include/core/SkDrawable.h new file mode 100644 index 000000000..8d605f80d --- /dev/null +++ b/src/deps/skia/include/core/SkDrawable.h @@ -0,0 +1,160 @@ +/* + * Copyright 2014 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkDrawable_DEFINED +#define SkDrawable_DEFINED + +#include "include/core/SkFlattenable.h" +#include "include/core/SkImageInfo.h" +#include "include/core/SkScalar.h" + +class GrBackendDrawableInfo; +class SkCanvas; +class SkMatrix; +class SkPicture; +enum class GrBackendApi : unsigned; +struct SkRect; + +/** + * Base-class for objects that draw into SkCanvas. + * + * The object has a generation ID, which is guaranteed to be unique across all drawables. To + * allow for clients of the drawable that may want to cache the results, the drawable must + * change its generation ID whenever its internal state changes such that it will draw differently. + */ +class SK_API SkDrawable : public SkFlattenable { +public: + /** + * Draws into the specified content. The drawing sequence will be balanced upon return + * (i.e. the saveLevel() on the canvas will match what it was when draw() was called, + * and the current matrix and clip settings will not be changed. + */ + void draw(SkCanvas*, const SkMatrix* = nullptr); + void draw(SkCanvas*, SkScalar x, SkScalar y); + + /** + * When using the GPU backend it is possible for a drawable to execute using the underlying 3D + * API rather than the SkCanvas API. It does so by creating a GpuDrawHandler. The GPU backend + * is deferred so the handler will be given access to the 3D API at the correct point in the + * drawing stream as the GPU backend flushes. Since the drawable may mutate, each time it is + * drawn to a GPU-backed canvas a new handler is snapped, representing the drawable's state at + * the time of the snap. + * + * When the GPU backend flushes to the 3D API it will call the draw method on the + * GpuDrawHandler. At this time the drawable may add commands to the stream of GPU commands for + * the unerlying 3D API. The draw function takes a GrBackendDrawableInfo which contains + * information about the current state of 3D API which the caller must respect. See + * GrBackendDrawableInfo for more specific details on what information is sent and the + * requirements for different 3D APIs. + * + * Additionaly there may be a slight delay from when the drawable adds its commands to when + * those commands are actually submitted to the GPU. Thus the drawable or GpuDrawHandler is + * required to keep any resources that are used by its added commands alive and valid until + * those commands are submitted to the GPU. The GpuDrawHandler will be kept alive and then + * deleted once the commands are submitted to the GPU. The dtor of the GpuDrawHandler is the + * signal to the drawable that the commands have all been submitted. Different 3D APIs may have + * additional requirements for certain resources which require waiting for the GPU to finish + * all work on those resources before reusing or deleting them. In this case, the drawable can + * use the dtor call of the GpuDrawHandler to add a fence to the GPU to track when the GPU work + * has completed. + * + * Currently this is only supported for the GPU Vulkan backend. + */ + + class GpuDrawHandler { + public: + virtual ~GpuDrawHandler() {} + + virtual void draw(const GrBackendDrawableInfo&) {} + }; + + /** + * Snaps off a GpuDrawHandler to represent the state of the SkDrawable at the time the snap is + * called. This is used for executing GPU backend specific draws intermixed with normal Skia GPU + * draws. The GPU API, which will be used for the draw, as well as the full matrix, device clip + * bounds and imageInfo of the target buffer are passed in as inputs. + */ + std::unique_ptr<GpuDrawHandler> snapGpuDrawHandler(GrBackendApi backendApi, + const SkMatrix& matrix, + const SkIRect& clipBounds, + const SkImageInfo& bufferInfo) { + return this->onSnapGpuDrawHandler(backendApi, matrix, clipBounds, bufferInfo); + } + + SkPicture* newPictureSnapshot(); + + /** + * Return a unique value for this instance. If two calls to this return the same value, + * it is presumed that calling the draw() method will render the same thing as well. + * + * Subclasses that change their state should call notifyDrawingChanged() to ensure that + * a new value will be returned the next time it is called. + */ + uint32_t getGenerationID(); + + /** + * Return the (conservative) bounds of what the drawable will draw. If the drawable can + * change what it draws (e.g. animation or in response to some external change), then this + * must return a bounds that is always valid for all possible states. + */ + SkRect getBounds(); + + /** + * Calling this invalidates the previous generation ID, and causes a new one to be computed + * the next time getGenerationID() is called. Typically this is called by the object itself, + * in response to its internal state changing. + */ + void notifyDrawingChanged(); + + static SkFlattenable::Type GetFlattenableType() { + return kSkDrawable_Type; + } + + SkFlattenable::Type getFlattenableType() const override { + return kSkDrawable_Type; + } + + static sk_sp<SkDrawable> Deserialize(const void* data, size_t size, + const SkDeserialProcs* procs = nullptr) { + return sk_sp<SkDrawable>(static_cast<SkDrawable*>( + SkFlattenable::Deserialize( + kSkDrawable_Type, data, size, procs).release())); + } + + Factory getFactory() const override { return nullptr; } + const char* getTypeName() const override { return nullptr; } + +protected: + SkDrawable(); + + virtual SkRect onGetBounds() = 0; + virtual void onDraw(SkCanvas*) = 0; + + virtual std::unique_ptr<GpuDrawHandler> onSnapGpuDrawHandler(GrBackendApi, const SkMatrix&, + const SkIRect& /*clipBounds*/, + const SkImageInfo&) { + return nullptr; + } + + // TODO: Delete this once Android gets updated to take the clipBounds version above. + virtual std::unique_ptr<GpuDrawHandler> onSnapGpuDrawHandler(GrBackendApi, const SkMatrix&) { + return nullptr; + } + + /** + * Default implementation calls onDraw() with a canvas that records into a picture. Subclasses + * may override if they have a more efficient way to return a picture for the current state + * of their drawable. Note: this picture must draw the same as what would be drawn from + * onDraw(). + */ + virtual SkPicture* onNewPictureSnapshot(); + +private: + int32_t fGenerationID; +}; + +#endif diff --git a/src/deps/skia/include/core/SkEncodedImageFormat.h b/src/deps/skia/include/core/SkEncodedImageFormat.h new file mode 100644 index 000000000..97add6dea --- /dev/null +++ b/src/deps/skia/include/core/SkEncodedImageFormat.h @@ -0,0 +1,35 @@ +/* + * Copyright 2015 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkEncodedImageFormat_DEFINED +#define SkEncodedImageFormat_DEFINED + +#include <stdint.h> + +/** + * Enum describing format of encoded data. + */ +enum class SkEncodedImageFormat { +#ifdef SK_BUILD_FOR_GOOGLE3 + kUnknown, +#endif + kBMP, + kGIF, + kICO, + kJPEG, + kPNG, + kWBMP, + kWEBP, + kPKM, + kKTX, + kASTC, + kDNG, + kHEIF, + kAVIF, +}; + +#endif // SkEncodedImageFormat_DEFINED diff --git a/src/deps/skia/include/core/SkExecutor.h b/src/deps/skia/include/core/SkExecutor.h new file mode 100644 index 000000000..88e2ca6e5 --- /dev/null +++ b/src/deps/skia/include/core/SkExecutor.h @@ -0,0 +1,41 @@ +/* + * Copyright 2017 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkExecutor_DEFINED +#define SkExecutor_DEFINED + +#include <functional> +#include <memory> +#include "include/core/SkTypes.h" + +class SK_API SkExecutor { +public: + virtual ~SkExecutor(); + + // Create a thread pool SkExecutor with a fixed thread count, by default the number of cores. + static std::unique_ptr<SkExecutor> MakeFIFOThreadPool(int threads = 0, + bool allowBorrowing = true); + static std::unique_ptr<SkExecutor> MakeLIFOThreadPool(int threads = 0, + bool allowBorrowing = true); + + // There is always a default SkExecutor available by calling SkExecutor::GetDefault(). + static SkExecutor& GetDefault(); + static void SetDefault(SkExecutor*); // Does not take ownership. Not thread safe. + + // Add work to execute. + virtual void add(std::function<void(void)>) = 0; + + // If it makes sense for this executor, use this thread to execute work for a little while. + virtual void borrow() {} + +protected: + SkExecutor() = default; + SkExecutor(const SkExecutor&) = delete; + SkExecutor& operator=(const SkExecutor&) = delete; +}; + +#endif//SkExecutor_DEFINED diff --git a/src/deps/skia/include/core/SkFlattenable.h b/src/deps/skia/include/core/SkFlattenable.h new file mode 100644 index 000000000..916ee174f --- /dev/null +++ b/src/deps/skia/include/core/SkFlattenable.h @@ -0,0 +1,113 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkFlattenable_DEFINED +#define SkFlattenable_DEFINED + +#include "include/core/SkRefCnt.h" + +class SkData; +class SkReadBuffer; +class SkWriteBuffer; + +struct SkSerialProcs; +struct SkDeserialProcs; + +/** \class SkFlattenable + + SkFlattenable is the base class for objects that need to be flattened + into a data stream for either transport or as part of the key to the + font cache. + */ +class SK_API SkFlattenable : public SkRefCnt { +public: + enum Type { + kSkColorFilter_Type, + kSkBlender_Type, + kSkDrawable_Type, + kSkDrawLooper_Type, // no longer used internally by Skia + kSkImageFilter_Type, + kSkMaskFilter_Type, + kSkPathEffect_Type, + kSkShader_Type, + }; + + typedef sk_sp<SkFlattenable> (*Factory)(SkReadBuffer&); + + SkFlattenable() {} + + /** Implement this to return a factory function pointer that can be called + to recreate your class given a buffer (previously written to by your + override of flatten(). + */ + virtual Factory getFactory() const = 0; + + /** + * Returns the name of the object's class. + */ + virtual const char* getTypeName() const = 0; + + static Factory NameToFactory(const char name[]); + static const char* FactoryToName(Factory); + + static void Register(const char name[], Factory); + + /** + * Override this if your subclass needs to record data that it will need to recreate itself + * from its CreateProc (returned by getFactory()). + * + * DEPRECATED public : will move to protected ... use serialize() instead + */ + virtual void flatten(SkWriteBuffer&) const {} + + virtual Type getFlattenableType() const = 0; + + // + // public ways to serialize / deserialize + // + sk_sp<SkData> serialize(const SkSerialProcs* = nullptr) const; + size_t serialize(void* memory, size_t memory_size, + const SkSerialProcs* = nullptr) const; + static sk_sp<SkFlattenable> Deserialize(Type, const void* data, size_t length, + const SkDeserialProcs* procs = nullptr); + +protected: + class PrivateInitializer { + public: + static void InitEffects(); + static void InitImageFilters(); + }; + +private: + static void RegisterFlattenablesIfNeeded(); + static void Finalize(); + + friend class SkGraphics; + + using INHERITED = SkRefCnt; +}; + +#if defined(SK_DISABLE_EFFECT_DESERIALIZATION) + #define SK_REGISTER_FLATTENABLE(type) do{}while(false) + + #define SK_FLATTENABLE_HOOKS(type) \ + static sk_sp<SkFlattenable> CreateProc(SkReadBuffer&); \ + friend class SkFlattenable::PrivateInitializer; \ + Factory getFactory() const override { return nullptr; } \ + const char* getTypeName() const override { return #type; } +#else + #define SK_REGISTER_FLATTENABLE(type) \ + SkFlattenable::Register(#type, type::CreateProc) + + #define SK_FLATTENABLE_HOOKS(type) \ + static sk_sp<SkFlattenable> CreateProc(SkReadBuffer&); \ + friend class SkFlattenable::PrivateInitializer; \ + Factory getFactory() const override { return type::CreateProc; } \ + const char* getTypeName() const override { return #type; } +#endif + +#endif diff --git a/src/deps/skia/include/core/SkFont.h b/src/deps/skia/include/core/SkFont.h new file mode 100644 index 000000000..947e4dd77 --- /dev/null +++ b/src/deps/skia/include/core/SkFont.h @@ -0,0 +1,534 @@ +/* + * Copyright 2014 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkFont_DEFINED +#define SkFont_DEFINED + +#include "include/core/SkFontTypes.h" +#include "include/core/SkScalar.h" +#include "include/core/SkTypeface.h" + +#include <vector> + +class SkMatrix; +class SkPaint; +class SkPath; +struct SkFontMetrics; + +/** \class SkFont + SkFont controls options applied when drawing and measuring text. +*/ +class SK_API SkFont { +public: + /** Whether edge pixels draw opaque or with partial transparency. + */ + enum class Edging { + kAlias, //!< no transparent pixels on glyph edges + kAntiAlias, //!< may have transparent pixels on glyph edges + kSubpixelAntiAlias, //!< glyph positioned in pixel using transparency + }; + + /** Constructs SkFont with default values. + + @return default initialized SkFont + */ + SkFont(); + + /** Constructs SkFont with default values with SkTypeface and size in points. + + @param typeface font and style used to draw and measure text + @param size typographic height of text + @return initialized SkFont + */ + SkFont(sk_sp<SkTypeface> typeface, SkScalar size); + + /** Constructs SkFont with default values with SkTypeface. + + @param typeface font and style used to draw and measure text + @return initialized SkFont + */ + explicit SkFont(sk_sp<SkTypeface> typeface); + + + /** Constructs SkFont with default values with SkTypeface and size in points, + horizontal scale, and horizontal skew. Horizontal scale emulates condensed + and expanded fonts. Horizontal skew emulates oblique fonts. + + @param typeface font and style used to draw and measure text + @param size typographic height of text + @param scaleX text horizontal scale + @param skewX additional shear on x-axis relative to y-axis + @return initialized SkFont + */ + SkFont(sk_sp<SkTypeface> typeface, SkScalar size, SkScalar scaleX, SkScalar skewX); + + + /** Compares SkFont and font, and returns true if they are equivalent. + May return false if SkTypeface has identical contents but different pointers. + + @param font font to compare + @return true if SkFont pair are equivalent + */ + bool operator==(const SkFont& font) const; + + /** Compares SkFont and font, and returns true if they are not equivalent. + May return true if SkTypeface has identical contents but different pointers. + + @param font font to compare + @return true if SkFont pair are not equivalent + */ + bool operator!=(const SkFont& font) const { return !(*this == font); } + + /** If true, instructs the font manager to always hint glyphs. + Returned value is only meaningful if platform uses FreeType as the font manager. + + @return true if all glyphs are hinted + */ + bool isForceAutoHinting() const { return SkToBool(fFlags & kForceAutoHinting_PrivFlag); } + + /** Returns true if font engine may return glyphs from font bitmaps instead of from outlines. + + @return true if glyphs may be font bitmaps + */ + bool isEmbeddedBitmaps() const { return SkToBool(fFlags & kEmbeddedBitmaps_PrivFlag); } + + /** Returns true if glyphs may be drawn at sub-pixel offsets. + + @return true if glyphs may be drawn at sub-pixel offsets. + */ + bool isSubpixel() const { return SkToBool(fFlags & kSubpixel_PrivFlag); } + + /** Returns true if font and glyph metrics are requested to be linearly scalable. + + @return true if font and glyph metrics are requested to be linearly scalable. + */ + bool isLinearMetrics() const { return SkToBool(fFlags & kLinearMetrics_PrivFlag); } + + /** Returns true if bold is approximated by increasing the stroke width when creating glyph + bitmaps from outlines. + + @return bold is approximated through stroke width + */ + bool isEmbolden() const { return SkToBool(fFlags & kEmbolden_PrivFlag); } + + /** Returns true if baselines will be snapped to pixel positions when the current transformation + matrix is axis aligned. + + @return baselines may be snapped to pixels + */ + bool isBaselineSnap() const { return SkToBool(fFlags & kBaselineSnap_PrivFlag); } + + /** Sets whether to always hint glyphs. + If forceAutoHinting is set, instructs the font manager to always hint glyphs. + + Only affects platforms that use FreeType as the font manager. + + @param forceAutoHinting setting to always hint glyphs + */ + void setForceAutoHinting(bool forceAutoHinting); + + /** Requests, but does not require, to use bitmaps in fonts instead of outlines. + + @param embeddedBitmaps setting to use bitmaps in fonts + */ + void setEmbeddedBitmaps(bool embeddedBitmaps); + + /** Requests, but does not require, that glyphs respect sub-pixel positioning. + + @param subpixel setting for sub-pixel positioning + */ + void setSubpixel(bool subpixel); + + /** Requests, but does not require, linearly scalable font and glyph metrics. + + For outline fonts 'true' means font and glyph metrics should ignore hinting and rounding. + Note that some bitmap formats may not be able to scale linearly and will ignore this flag. + + @param linearMetrics setting for linearly scalable font and glyph metrics. + */ + void setLinearMetrics(bool linearMetrics); + + /** Increases stroke width when creating glyph bitmaps to approximate a bold typeface. + + @param embolden setting for bold approximation + */ + void setEmbolden(bool embolden); + + /** Requests that baselines be snapped to pixels when the current transformation matrix is axis + aligned. + + @param baselineSnap setting for baseline snapping to pixels + */ + void setBaselineSnap(bool baselineSnap); + + /** Whether edge pixels draw opaque or with partial transparency. + */ + Edging getEdging() const { return (Edging)fEdging; } + + /** Requests, but does not require, that edge pixels draw opaque or with + partial transparency. + */ + void setEdging(Edging edging); + + /** Sets level of glyph outline adjustment. + Does not check for valid values of hintingLevel. + */ + void setHinting(SkFontHinting hintingLevel); + + /** Returns level of glyph outline adjustment. + */ + SkFontHinting getHinting() const { return (SkFontHinting)fHinting; } + + /** Returns a font with the same attributes of this font, but with the specified size. + Returns nullptr if size is less than zero, infinite, or NaN. + + @param size typographic height of text + @return initialized SkFont + */ + SkFont makeWithSize(SkScalar size) const; + + /** Returns SkTypeface if set, or nullptr. + Does not alter SkTypeface SkRefCnt. + + @return SkTypeface if previously set, nullptr otherwise + */ + SkTypeface* getTypeface() const {return fTypeface.get(); } + + /** Returns SkTypeface if set, or the default typeface. + Does not alter SkTypeface SkRefCnt. + + @return SkTypeface if previously set or, a pointer to the default typeface if not + previously set. + */ + SkTypeface* getTypefaceOrDefault() const; + + /** Returns text size in points. + + @return typographic height of text + */ + SkScalar getSize() const { return fSize; } + + /** Returns text scale on x-axis. + Default value is 1. + + @return text horizontal scale + */ + SkScalar getScaleX() const { return fScaleX; } + + /** Returns text skew on x-axis. + Default value is zero. + + @return additional shear on x-axis relative to y-axis + */ + SkScalar getSkewX() const { return fSkewX; } + + /** Increases SkTypeface SkRefCnt by one. + + @return SkTypeface if previously set, nullptr otherwise + */ + sk_sp<SkTypeface> refTypeface() const { return fTypeface; } + + /** Increases SkTypeface SkRefCnt by one. + + @return SkTypeface if previously set or, a pointer to the default typeface if not + previously set. + */ + sk_sp<SkTypeface> refTypefaceOrDefault() const; + + /** Sets SkTypeface to typeface, decreasing SkRefCnt of the previous SkTypeface. + Pass nullptr to clear SkTypeface and use the default typeface. Increments + tf SkRefCnt by one. + + @param tf font and style used to draw text + */ + void setTypeface(sk_sp<SkTypeface> tf) { fTypeface = tf; } + + /** Sets text size in points. + Has no effect if textSize is not greater than or equal to zero. + + @param textSize typographic height of text + */ + void setSize(SkScalar textSize); + + /** Sets text scale on x-axis. + Default value is 1. + + @param scaleX text horizontal scale + */ + void setScaleX(SkScalar scaleX); + + /** Sets text skew on x-axis. + Default value is zero. + + @param skewX additional shear on x-axis relative to y-axis + */ + void setSkewX(SkScalar skewX); + + /** Converts text into glyph indices. + Returns the number of glyph indices represented by text. + SkTextEncoding specifies how text represents characters or glyphs. + glyphs may be nullptr, to compute the glyph count. + + Does not check text for valid character codes or valid glyph indices. + + If byteLength equals zero, returns zero. + If byteLength includes a partial character, the partial character is ignored. + + If encoding is SkTextEncoding::kUTF8 and text contains an invalid UTF-8 sequence, + zero is returned. + + When encoding is SkTextEncoding::kUTF8, SkTextEncoding::kUTF16, or + SkTextEncoding::kUTF32; then each Unicode codepoint is mapped to a + single glyph. This function uses the default character-to-glyph + mapping from the SkTypeface and maps characters not found in the + SkTypeface to zero. + + If maxGlyphCount is not sufficient to store all the glyphs, no glyphs are copied. + The total glyph count is returned for subsequent buffer reallocation. + + @param text character storage encoded with SkTextEncoding + @param byteLength length of character storage in bytes + @param glyphs storage for glyph indices; may be nullptr + @param maxGlyphCount storage capacity + @return number of glyphs represented by text of length byteLength + */ + int textToGlyphs(const void* text, size_t byteLength, SkTextEncoding encoding, + SkGlyphID glyphs[], int maxGlyphCount) const; + + /** Returns glyph index for Unicode character. + + If the character is not supported by the SkTypeface, returns 0. + + @param uni Unicode character + @return glyph index + */ + SkGlyphID unicharToGlyph(SkUnichar uni) const; + + void unicharsToGlyphs(const SkUnichar uni[], int count, SkGlyphID glyphs[]) const; + + /** Returns number of glyphs represented by text. + + If encoding is SkTextEncoding::kUTF8, SkTextEncoding::kUTF16, or + SkTextEncoding::kUTF32; then each Unicode codepoint is mapped to a + single glyph. + + @param text character storage encoded with SkTextEncoding + @param byteLength length of character storage in bytes + @return number of glyphs represented by text of length byteLength + */ + int countText(const void* text, size_t byteLength, SkTextEncoding encoding) const { + return this->textToGlyphs(text, byteLength, encoding, nullptr, 0); + } + + /** Returns the advance width of text. + The advance is the normal distance to move before drawing additional text. + Returns the bounding box of text if bounds is not nullptr. + + @param text character storage encoded with SkTextEncoding + @param byteLength length of character storage in bytes + @param bounds returns bounding box relative to (0, 0) if not nullptr + @return number of glyphs represented by text of length byteLength + */ + SkScalar measureText(const void* text, size_t byteLength, SkTextEncoding encoding, + SkRect* bounds = nullptr) const { + return this->measureText(text, byteLength, encoding, bounds, nullptr); + } + + /** Returns the advance width of text. + The advance is the normal distance to move before drawing additional text. + Returns the bounding box of text if bounds is not nullptr. The paint + stroke settings, mask filter, or path effect may modify the bounds. + + @param text character storage encoded with SkTextEncoding + @param byteLength length of character storage in bytes + @param bounds returns bounding box relative to (0, 0) if not nullptr + @param paint optional; may be nullptr + @return number of glyphs represented by text of length byteLength + */ + SkScalar measureText(const void* text, size_t byteLength, SkTextEncoding encoding, + SkRect* bounds, const SkPaint* paint) const; + + /** DEPRECATED + Retrieves the advance and bounds for each glyph in glyphs. + Both widths and bounds may be nullptr. + If widths is not nullptr, widths must be an array of count entries. + if bounds is not nullptr, bounds must be an array of count entries. + + @param glyphs array of glyph indices to be measured + @param count number of glyphs + @param widths returns text advances for each glyph; may be nullptr + @param bounds returns bounds for each glyph relative to (0, 0); may be nullptr + */ + void getWidths(const SkGlyphID glyphs[], int count, SkScalar widths[], SkRect bounds[]) const { + this->getWidthsBounds(glyphs, count, widths, bounds, nullptr); + } + + // DEPRECATED + void getWidths(const SkGlyphID glyphs[], int count, SkScalar widths[], std::nullptr_t) const { + this->getWidths(glyphs, count, widths); + } + + /** Retrieves the advance and bounds for each glyph in glyphs. + Both widths and bounds may be nullptr. + If widths is not nullptr, widths must be an array of count entries. + if bounds is not nullptr, bounds must be an array of count entries. + + @param glyphs array of glyph indices to be measured + @param count number of glyphs + @param widths returns text advances for each glyph + */ + void getWidths(const SkGlyphID glyphs[], int count, SkScalar widths[]) const { + this->getWidthsBounds(glyphs, count, widths, nullptr, nullptr); + } + + /** Retrieves the advance and bounds for each glyph in glyphs. + Both widths and bounds may be nullptr. + If widths is not nullptr, widths must be an array of count entries. + if bounds is not nullptr, bounds must be an array of count entries. + + @param glyphs array of glyph indices to be measured + @param count number of glyphs + @param widths returns text advances for each glyph; may be nullptr + @param bounds returns bounds for each glyph relative to (0, 0); may be nullptr + @param paint optional, specifies stroking, SkPathEffect and SkMaskFilter + */ + void getWidthsBounds(const SkGlyphID glyphs[], int count, SkScalar widths[], SkRect bounds[], + const SkPaint* paint) const; + + + /** Retrieves the bounds for each glyph in glyphs. + bounds must be an array of count entries. + If paint is not nullptr, its stroking, SkPathEffect, and SkMaskFilter fields are respected. + + @param glyphs array of glyph indices to be measured + @param count number of glyphs + @param bounds returns bounds for each glyph relative to (0, 0); may be nullptr + @param paint optional, specifies stroking, SkPathEffect, and SkMaskFilter + */ + void getBounds(const SkGlyphID glyphs[], int count, SkRect bounds[], + const SkPaint* paint) const { + this->getWidthsBounds(glyphs, count, nullptr, bounds, paint); + } + + /** Retrieves the positions for each glyph, beginning at the specified origin. The caller + must allocated at least count number of elements in the pos[] array. + + @param glyphs array of glyph indices to be positioned + @param count number of glyphs + @param pos returns glyphs positions + @param origin location of the first glyph. Defaults to {0, 0}. + */ + void getPos(const SkGlyphID glyphs[], int count, SkPoint pos[], SkPoint origin = {0, 0}) const; + + /** Retrieves the x-positions for each glyph, beginning at the specified origin. The caller + must allocated at least count number of elements in the xpos[] array. + + @param glyphs array of glyph indices to be positioned + @param count number of glyphs + @param xpos returns glyphs x-positions + @param origin x-position of the first glyph. Defaults to 0. + */ + void getXPos(const SkGlyphID glyphs[], int count, SkScalar xpos[], SkScalar origin = 0) const; + + /** Returns intervals [start, end] describing lines parallel to the advance that intersect + * with the glyphs. + * + * @param glyphs the glyphs to intersect + * @param count the number of glyphs and positions + * @param pos the position of each glyph + * @param top the top of the line intersecting + * @param bottom the bottom of the line intersecting + @return array of pairs of x values [start, end]. May be empty. + */ + std::vector<SkScalar> getIntercepts(const SkGlyphID glyphs[], int count, const SkPoint pos[], + SkScalar top, SkScalar bottom, + const SkPaint* = nullptr) const; + + /** Modifies path to be the outline of the glyph. + If the glyph has an outline, modifies path to be the glyph's outline and returns true. + The glyph outline may be empty. Degenerate contours in the glyph outline will be skipped. + If glyph is described by a bitmap, returns false and ignores path parameter. + + @param glyphID index of glyph + @param path pointer to existing SkPath + @return true if glyphID is described by path + */ + bool getPath(SkGlyphID glyphID, SkPath* path) const; + + /** Returns path corresponding to glyph array. + + @param glyphIDs array of glyph indices + @param count number of glyphs + @param glyphPathProc function returning one glyph description as path + @param ctx function context + */ + void getPaths(const SkGlyphID glyphIDs[], int count, + void (*glyphPathProc)(const SkPath* pathOrNull, const SkMatrix& mx, void* ctx), + void* ctx) const; + + /** Returns SkFontMetrics associated with SkTypeface. + The return value is the recommended spacing between lines: the sum of metrics + descent, ascent, and leading. + If metrics is not nullptr, SkFontMetrics is copied to metrics. + Results are scaled by text size but does not take into account + dimensions required by text scale, text skew, fake bold, + style stroke, and SkPathEffect. + + @param metrics storage for SkFontMetrics; may be nullptr + @return recommended spacing between lines + */ + SkScalar getMetrics(SkFontMetrics* metrics) const; + + /** Returns the recommended spacing between lines: the sum of metrics + descent, ascent, and leading. + Result is scaled by text size but does not take into account + dimensions required by stroking and SkPathEffect. + Returns the same result as getMetrics(). + + @return recommended spacing between lines + */ + SkScalar getSpacing() const { return this->getMetrics(nullptr); } + + /** Dumps fields of the font to SkDebugf. May change its output over time, so clients should + * not rely on this for anything specific. Used to aid in debugging. + */ + void dump() const; + +private: + enum PrivFlags { + kForceAutoHinting_PrivFlag = 1 << 0, + kEmbeddedBitmaps_PrivFlag = 1 << 1, + kSubpixel_PrivFlag = 1 << 2, + kLinearMetrics_PrivFlag = 1 << 3, + kEmbolden_PrivFlag = 1 << 4, + kBaselineSnap_PrivFlag = 1 << 5, + }; + + static constexpr unsigned kAllFlags = kForceAutoHinting_PrivFlag + | kEmbeddedBitmaps_PrivFlag + | kSubpixel_PrivFlag + | kLinearMetrics_PrivFlag + | kEmbolden_PrivFlag + | kBaselineSnap_PrivFlag; + + sk_sp<SkTypeface> fTypeface; + SkScalar fSize; + SkScalar fScaleX; + SkScalar fSkewX; + uint8_t fFlags; + uint8_t fEdging; + uint8_t fHinting; + + SkScalar setupForAsPaths(SkPaint*); + bool hasSomeAntiAliasing() const; + + friend class SkFontPriv; + friend class SkGlyphRunListPainter; + friend class SkStrikeSpec; +}; + +#endif diff --git a/src/deps/skia/include/core/SkFontArguments.h b/src/deps/skia/include/core/SkFontArguments.h new file mode 100644 index 000000000..2aaaf55ca --- /dev/null +++ b/src/deps/skia/include/core/SkFontArguments.h @@ -0,0 +1,62 @@ +/* + * Copyright 2017 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkFontArguments_DEFINED +#define SkFontArguments_DEFINED + +#include "include/core/SkScalar.h" +#include "include/core/SkTypes.h" + +/** Represents a set of actual arguments for a font. */ +struct SkFontArguments { + struct VariationPosition { + struct Coordinate { + SkFourByteTag axis; + float value; + }; + const Coordinate* coordinates; + int coordinateCount; + }; + + SkFontArguments() : fCollectionIndex(0), fVariationDesignPosition{nullptr, 0} {} + + /** Specify the index of the desired font. + * + * Font formats like ttc, dfont, cff, cid, pfr, t42, t1, and fon may actually be indexed + * collections of fonts. + */ + SkFontArguments& setCollectionIndex(int collectionIndex) { + fCollectionIndex = collectionIndex; + return *this; + } + + /** Specify a position in the variation design space. + * + * Any axis not specified will use the default value. + * Any specified axis not actually present in the font will be ignored. + * + * @param position not copied. The value must remain valid for life of SkFontArguments. + */ + SkFontArguments& setVariationDesignPosition(VariationPosition position) { + fVariationDesignPosition.coordinates = position.coordinates; + fVariationDesignPosition.coordinateCount = position.coordinateCount; + return *this; + } + + int getCollectionIndex() const { + return fCollectionIndex; + } + + VariationPosition getVariationDesignPosition() const { + return fVariationDesignPosition; + } +private: + int fCollectionIndex; + VariationPosition fVariationDesignPosition; +}; + +#endif diff --git a/src/deps/skia/include/core/SkFontMetrics.h b/src/deps/skia/include/core/SkFontMetrics.h new file mode 100644 index 000000000..717a87f05 --- /dev/null +++ b/src/deps/skia/include/core/SkFontMetrics.h @@ -0,0 +1,138 @@ +/* + * Copyright 2018 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkFontMetrics_DEFINED +#define SkFontMetrics_DEFINED + +#include "include/core/SkScalar.h" + +/** \class SkFontMetrics + The metrics of an SkFont. + The metric values are consistent with the Skia y-down coordinate system. + */ +struct SK_API SkFontMetrics { + bool operator==(const SkFontMetrics& that) { + return + this->fFlags == that.fFlags && + this->fTop == that.fTop && + this->fAscent == that.fAscent && + this->fDescent == that.fDescent && + this->fBottom == that.fBottom && + this->fLeading == that.fLeading && + this->fAvgCharWidth == that.fAvgCharWidth && + this->fMaxCharWidth == that.fMaxCharWidth && + this->fXMin == that.fXMin && + this->fXMax == that.fXMax && + this->fXHeight == that.fXHeight && + this->fCapHeight == that.fCapHeight && + this->fUnderlineThickness == that.fUnderlineThickness && + this->fUnderlinePosition == that.fUnderlinePosition && + this->fStrikeoutThickness == that.fStrikeoutThickness && + this->fStrikeoutPosition == that.fStrikeoutPosition; + } + + /** \enum FontMetricsFlags + FontMetricsFlags indicate when certain metrics are valid; + the underline or strikeout metrics may be valid and zero. + Fonts with embedded bitmaps may not have valid underline or strikeout metrics. + */ + enum FontMetricsFlags { + kUnderlineThicknessIsValid_Flag = 1 << 0, //!< set if fUnderlineThickness is valid + kUnderlinePositionIsValid_Flag = 1 << 1, //!< set if fUnderlinePosition is valid + kStrikeoutThicknessIsValid_Flag = 1 << 2, //!< set if fStrikeoutThickness is valid + kStrikeoutPositionIsValid_Flag = 1 << 3, //!< set if fStrikeoutPosition is valid + kBoundsInvalid_Flag = 1 << 4, //!< set if fTop, fBottom, fXMin, fXMax invalid + }; + + uint32_t fFlags; //!< FontMetricsFlags indicating which metrics are valid + SkScalar fTop; //!< greatest extent above origin of any glyph bounding box, typically negative; deprecated with variable fonts + SkScalar fAscent; //!< distance to reserve above baseline, typically negative + SkScalar fDescent; //!< distance to reserve below baseline, typically positive + SkScalar fBottom; //!< greatest extent below origin of any glyph bounding box, typically positive; deprecated with variable fonts + SkScalar fLeading; //!< distance to add between lines, typically positive or zero + SkScalar fAvgCharWidth; //!< average character width, zero if unknown + SkScalar fMaxCharWidth; //!< maximum character width, zero if unknown + SkScalar fXMin; //!< greatest extent to left of origin of any glyph bounding box, typically negative; deprecated with variable fonts + SkScalar fXMax; //!< greatest extent to right of origin of any glyph bounding box, typically positive; deprecated with variable fonts + SkScalar fXHeight; //!< height of lower-case 'x', zero if unknown, typically negative + SkScalar fCapHeight; //!< height of an upper-case letter, zero if unknown, typically negative + SkScalar fUnderlineThickness; //!< underline thickness + SkScalar fUnderlinePosition; //!< distance from baseline to top of stroke, typically positive + SkScalar fStrikeoutThickness; //!< strikeout thickness + SkScalar fStrikeoutPosition; //!< distance from baseline to bottom of stroke, typically negative + + /** Returns true if SkFontMetrics has a valid underline thickness, and sets + thickness to that value. If the underline thickness is not valid, + return false, and ignore thickness. + + @param thickness storage for underline width + @return true if font specifies underline width + */ + bool hasUnderlineThickness(SkScalar* thickness) const { + if (SkToBool(fFlags & kUnderlineThicknessIsValid_Flag)) { + *thickness = fUnderlineThickness; + return true; + } + return false; + } + + /** Returns true if SkFontMetrics has a valid underline position, and sets + position to that value. If the underline position is not valid, + return false, and ignore position. + + @param position storage for underline position + @return true if font specifies underline position + */ + bool hasUnderlinePosition(SkScalar* position) const { + if (SkToBool(fFlags & kUnderlinePositionIsValid_Flag)) { + *position = fUnderlinePosition; + return true; + } + return false; + } + + /** Returns true if SkFontMetrics has a valid strikeout thickness, and sets + thickness to that value. If the underline thickness is not valid, + return false, and ignore thickness. + + @param thickness storage for strikeout width + @return true if font specifies strikeout width + */ + bool hasStrikeoutThickness(SkScalar* thickness) const { + if (SkToBool(fFlags & kStrikeoutThicknessIsValid_Flag)) { + *thickness = fStrikeoutThickness; + return true; + } + return false; + } + + /** Returns true if SkFontMetrics has a valid strikeout position, and sets + position to that value. If the underline position is not valid, + return false, and ignore position. + + @param position storage for strikeout position + @return true if font specifies strikeout position + */ + bool hasStrikeoutPosition(SkScalar* position) const { + if (SkToBool(fFlags & kStrikeoutPositionIsValid_Flag)) { + *position = fStrikeoutPosition; + return true; + } + return false; + } + + /** Returns true if SkFontMetrics has a valid fTop, fBottom, fXMin, and fXMax. + If the bounds are not valid, return false. + + @return true if font specifies maximum glyph bounds + */ + bool hasBounds() const { + return !SkToBool(fFlags & kBoundsInvalid_Flag); + } +}; + +#endif diff --git a/src/deps/skia/include/core/SkFontMgr.h b/src/deps/skia/include/core/SkFontMgr.h new file mode 100644 index 000000000..611faa3aa --- /dev/null +++ b/src/deps/skia/include/core/SkFontMgr.h @@ -0,0 +1,157 @@ +/* + * Copyright 2013 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkFontMgr_DEFINED +#define SkFontMgr_DEFINED + +#include "include/core/SkFontArguments.h" +#include "include/core/SkFontStyle.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkTypes.h" + +class SkData; +class SkFontData; +class SkStreamAsset; +class SkString; +class SkTypeface; + +class SK_API SkFontStyleSet : public SkRefCnt { +public: + virtual int count() = 0; + virtual void getStyle(int index, SkFontStyle*, SkString* style) = 0; + virtual SkTypeface* createTypeface(int index) = 0; + virtual SkTypeface* matchStyle(const SkFontStyle& pattern) = 0; + + static SkFontStyleSet* CreateEmpty(); + +protected: + SkTypeface* matchStyleCSS3(const SkFontStyle& pattern); + +private: + using INHERITED = SkRefCnt; +}; + +class SK_API SkFontMgr : public SkRefCnt { +public: + int countFamilies() const; + void getFamilyName(int index, SkString* familyName) const; + SkFontStyleSet* createStyleSet(int index) const; + + /** + * The caller must call unref() on the returned object. + * Never returns NULL; will return an empty set if the name is not found. + * + * Passing nullptr as the parameter will return the default system family. + * Note that most systems don't have a default system family, so passing nullptr will often + * result in the empty set. + * + * It is possible that this will return a style set not accessible from + * createStyleSet(int) due to hidden or auto-activated fonts. + */ + SkFontStyleSet* matchFamily(const char familyName[]) const; + + /** + * Find the closest matching typeface to the specified familyName and style + * and return a ref to it. The caller must call unref() on the returned + * object. Will return nullptr if no 'good' match is found. + * + * Passing |nullptr| as the parameter for |familyName| will return the + * default system font. + * + * It is possible that this will return a style set not accessible from + * createStyleSet(int) or matchFamily(const char[]) due to hidden or + * auto-activated fonts. + */ + SkTypeface* matchFamilyStyle(const char familyName[], const SkFontStyle&) const; + + /** + * Use the system fallback to find a typeface for the given character. + * Note that bcp47 is a combination of ISO 639, 15924, and 3166-1 codes, + * so it is fine to just pass a ISO 639 here. + * + * Will return NULL if no family can be found for the character + * in the system fallback. + * + * Passing |nullptr| as the parameter for |familyName| will return the + * default system font. + * + * bcp47[0] is the least significant fallback, bcp47[bcp47Count-1] is the + * most significant. If no specified bcp47 codes match, any font with the + * requested character will be matched. + */ + SkTypeface* matchFamilyStyleCharacter(const char familyName[], const SkFontStyle&, + const char* bcp47[], int bcp47Count, + SkUnichar character) const; + + /** + * Create a typeface for the specified data and TTC index (pass 0 for none) + * or NULL if the data is not recognized. The caller must call unref() on + * the returned object if it is not null. + */ + sk_sp<SkTypeface> makeFromData(sk_sp<SkData>, int ttcIndex = 0) const; + + /** + * Create a typeface for the specified stream and TTC index + * (pass 0 for none) or NULL if the stream is not recognized. The caller + * must call unref() on the returned object if it is not null. + */ + sk_sp<SkTypeface> makeFromStream(std::unique_ptr<SkStreamAsset>, int ttcIndex = 0) const; + + /* Experimental, API subject to change. */ + sk_sp<SkTypeface> makeFromStream(std::unique_ptr<SkStreamAsset>, const SkFontArguments&) const; + + /** + * Create a typeface for the specified fileName and TTC index + * (pass 0 for none) or NULL if the file is not found, or its contents are + * not recognized. The caller must call unref() on the returned object + * if it is not null. + */ + sk_sp<SkTypeface> makeFromFile(const char path[], int ttcIndex = 0) const; + + sk_sp<SkTypeface> legacyMakeTypeface(const char familyName[], SkFontStyle style) const; + + /** Return the default fontmgr. */ + static sk_sp<SkFontMgr> RefDefault(); + +protected: + virtual int onCountFamilies() const = 0; + virtual void onGetFamilyName(int index, SkString* familyName) const = 0; + virtual SkFontStyleSet* onCreateStyleSet(int index)const = 0; + + /** May return NULL if the name is not found. */ + virtual SkFontStyleSet* onMatchFamily(const char familyName[]) const = 0; + + virtual SkTypeface* onMatchFamilyStyle(const char familyName[], + const SkFontStyle&) const = 0; + virtual SkTypeface* onMatchFamilyStyleCharacter(const char familyName[], const SkFontStyle&, + const char* bcp47[], int bcp47Count, + SkUnichar character) const = 0; + + virtual sk_sp<SkTypeface> onMakeFromData(sk_sp<SkData>, int ttcIndex) const = 0; + virtual sk_sp<SkTypeface> onMakeFromStreamIndex(std::unique_ptr<SkStreamAsset>, + int ttcIndex) const = 0; + virtual sk_sp<SkTypeface> onMakeFromStreamArgs(std::unique_ptr<SkStreamAsset>, + const SkFontArguments&) const = 0; + virtual sk_sp<SkTypeface> onMakeFromFile(const char path[], int ttcIndex) const = 0; + + virtual sk_sp<SkTypeface> onLegacyMakeTypeface(const char familyName[], SkFontStyle) const = 0; + + // this method is never called -- will be removed + virtual SkTypeface* onMatchFaceStyle(const SkTypeface*, + const SkFontStyle&) const { + return nullptr; + } + +private: + + /** Implemented by porting layer to return the default factory. */ + static sk_sp<SkFontMgr> Factory(); + + using INHERITED = SkRefCnt; +}; + +#endif diff --git a/src/deps/skia/include/core/SkFontParameters.h b/src/deps/skia/include/core/SkFontParameters.h new file mode 100644 index 000000000..ae4f1d68b --- /dev/null +++ b/src/deps/skia/include/core/SkFontParameters.h @@ -0,0 +1,42 @@ +/* + * Copyright 2018 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkFontParameters_DEFINED +#define SkFontParameters_DEFINED + +#include "include/core/SkScalar.h" +#include "include/core/SkTypes.h" + +struct SkFontParameters { + struct Variation { + // Parameters in a variation font axis. + struct Axis { + constexpr Axis() : tag(0), min(0), def(0), max(0), flags(0) {} + constexpr Axis(SkFourByteTag tag, float min, float def, float max, bool hidden) : + tag(tag), min(min), def(def), max(max), flags(hidden ? HIDDEN : 0) {} + + // Four character identifier of the font axis (weight, width, slant, italic...). + SkFourByteTag tag; + // Minimum value supported by this axis. + float min; + // Default value set by this axis. + float def; + // Maximum value supported by this axis. The maximum can equal the minimum. + float max; + // Return whether this axis is recommended to be remain hidden in user interfaces. + bool isHidden() const { return flags & HIDDEN; } + // Set this axis to be remain hidden in user interfaces. + void setHidden(bool hidden) { flags = hidden ? (flags | HIDDEN) : (flags & ~HIDDEN); } + private: + static constexpr uint16_t HIDDEN = 0x0001; + // Attributes for a font axis. + uint16_t flags; + }; + }; +}; + +#endif diff --git a/src/deps/skia/include/core/SkFontStyle.h b/src/deps/skia/include/core/SkFontStyle.h new file mode 100644 index 000000000..04893ef2f --- /dev/null +++ b/src/deps/skia/include/core/SkFontStyle.h @@ -0,0 +1,81 @@ +/* + * Copyright 2013 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkFontStyle_DEFINED +#define SkFontStyle_DEFINED + +#include "include/core/SkTypes.h" +#include "include/private/SkTPin.h" + +class SK_API SkFontStyle { +public: + enum Weight { + kInvisible_Weight = 0, + kThin_Weight = 100, + kExtraLight_Weight = 200, + kLight_Weight = 300, + kNormal_Weight = 400, + kMedium_Weight = 500, + kSemiBold_Weight = 600, + kBold_Weight = 700, + kExtraBold_Weight = 800, + kBlack_Weight = 900, + kExtraBlack_Weight = 1000, + }; + + enum Width { + kUltraCondensed_Width = 1, + kExtraCondensed_Width = 2, + kCondensed_Width = 3, + kSemiCondensed_Width = 4, + kNormal_Width = 5, + kSemiExpanded_Width = 6, + kExpanded_Width = 7, + kExtraExpanded_Width = 8, + kUltraExpanded_Width = 9, + }; + + enum Slant { + kUpright_Slant, + kItalic_Slant, + kOblique_Slant, + }; + + constexpr SkFontStyle(int weight, int width, Slant slant) : fValue( + (SkTPin<int>(weight, kInvisible_Weight, kExtraBlack_Weight)) + + (SkTPin<int>(width, kUltraCondensed_Width, kUltraExpanded_Width) << 16) + + (SkTPin<int>(slant, kUpright_Slant, kOblique_Slant) << 24) + ) { } + + constexpr SkFontStyle() : SkFontStyle{kNormal_Weight, kNormal_Width, kUpright_Slant} { } + + bool operator==(const SkFontStyle& rhs) const { + return fValue == rhs.fValue; + } + + int weight() const { return fValue & 0xFFFF; } + int width() const { return (fValue >> 16) & 0xFF; } + Slant slant() const { return (Slant)((fValue >> 24) & 0xFF); } + + static constexpr SkFontStyle Normal() { + return SkFontStyle(kNormal_Weight, kNormal_Width, kUpright_Slant); + } + static constexpr SkFontStyle Bold() { + return SkFontStyle(kBold_Weight, kNormal_Width, kUpright_Slant); + } + static constexpr SkFontStyle Italic() { + return SkFontStyle(kNormal_Weight, kNormal_Width, kItalic_Slant ); + } + static constexpr SkFontStyle BoldItalic() { + return SkFontStyle(kBold_Weight, kNormal_Width, kItalic_Slant ); + } + +private: + int32_t fValue; +}; + +#endif diff --git a/src/deps/skia/include/core/SkFontTypes.h b/src/deps/skia/include/core/SkFontTypes.h new file mode 100644 index 000000000..76f5dde67 --- /dev/null +++ b/src/deps/skia/include/core/SkFontTypes.h @@ -0,0 +1,25 @@ +/* + * Copyright 2018 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkFontTypes_DEFINED +#define SkFontTypes_DEFINED + +enum class SkTextEncoding { + kUTF8, //!< uses bytes to represent UTF-8 or ASCII + kUTF16, //!< uses two byte words to represent most of Unicode + kUTF32, //!< uses four byte words to represent all of Unicode + kGlyphID, //!< uses two byte words to represent glyph indices +}; + +enum class SkFontHinting { + kNone, //!< glyph outlines unchanged + kSlight, //!< minimal modification to improve constrast + kNormal, //!< glyph outlines modified to improve constrast + kFull, //!< modifies glyph outlines for maximum constrast +}; + +#endif diff --git a/src/deps/skia/include/core/SkGraphics.h b/src/deps/skia/include/core/SkGraphics.h new file mode 100644 index 000000000..b68bb78ba --- /dev/null +++ b/src/deps/skia/include/core/SkGraphics.h @@ -0,0 +1,153 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkGraphics_DEFINED +#define SkGraphics_DEFINED + +#include "include/core/SkRefCnt.h" + +class SkData; +class SkImageGenerator; +class SkTraceMemoryDump; + +class SK_API SkGraphics { +public: + /** + * Call this at process initialization time if your environment does not + * permit static global initializers that execute code. + * Init() is thread-safe and idempotent. + */ + static void Init(); + + /** + * Return the max number of bytes that should be used by the font cache. + * If the cache needs to allocate more, it will purge previous entries. + * This max can be changed by calling SetFontCacheLimit(). + */ + static size_t GetFontCacheLimit(); + + /** + * Specify the max number of bytes that should be used by the font cache. + * If the cache needs to allocate more, it will purge previous entries. + * + * This function returns the previous setting, as if GetFontCacheLimit() + * had be called before the new limit was set. + */ + static size_t SetFontCacheLimit(size_t bytes); + + /** + * Return the number of bytes currently used by the font cache. + */ + static size_t GetFontCacheUsed(); + + /** + * Return the number of entries in the font cache. + * A cache "entry" is associated with each typeface + pointSize + matrix. + */ + static int GetFontCacheCountUsed(); + + /** + * Return the current limit to the number of entries in the font cache. + * A cache "entry" is associated with each typeface + pointSize + matrix. + */ + static int GetFontCacheCountLimit(); + + /** + * Set the limit to the number of entries in the font cache, and return + * the previous value. If this new value is lower than the previous, + * it will automatically try to purge entries to meet the new limit. + */ + static int SetFontCacheCountLimit(int count); + + /** + * For debugging purposes, this will attempt to purge the font cache. It + * does not change the limit, but will cause subsequent font measures and + * draws to be recreated, since they will no longer be in the cache. + */ + static void PurgeFontCache(); + + /** + * This function returns the memory used for temporary images and other resources. + */ + static size_t GetResourceCacheTotalBytesUsed(); + + /** + * These functions get/set the memory usage limit for the resource cache, used for temporary + * bitmaps and other resources. Entries are purged from the cache when the memory useage + * exceeds this limit. + */ + static size_t GetResourceCacheTotalByteLimit(); + static size_t SetResourceCacheTotalByteLimit(size_t newLimit); + + /** + * For debugging purposes, this will attempt to purge the resource cache. It + * does not change the limit. + */ + static void PurgeResourceCache(); + + /** + * When the cachable entry is very lage (e.g. a large scaled bitmap), adding it to the cache + * can cause most/all of the existing entries to be purged. To avoid the, the client can set + * a limit for a single allocation. If a cacheable entry would have been cached, but its size + * exceeds this limit, then we do not attempt to cache it at all. + * + * Zero is the default value, meaning we always attempt to cache entries. + */ + static size_t GetResourceCacheSingleAllocationByteLimit(); + static size_t SetResourceCacheSingleAllocationByteLimit(size_t newLimit); + + /** + * Dumps memory usage of caches using the SkTraceMemoryDump interface. See SkTraceMemoryDump + * for usage of this method. + */ + static void DumpMemoryStatistics(SkTraceMemoryDump* dump); + + /** + * Free as much globally cached memory as possible. This will purge all private caches in Skia, + * including font and image caches. + * + * If there are caches associated with GPU context, those will not be affected by this call. + */ + static void PurgeAllCaches(); + + /** + * Applications with command line options may pass optional state, such + * as cache sizes, here, for instance: + * font-cache-limit=12345678 + * + * The flags format is name=value[;name=value...] with no spaces. + * This format is subject to change. + */ + static void SetFlags(const char* flags); + + typedef std::unique_ptr<SkImageGenerator> + (*ImageGeneratorFromEncodedDataFactory)(sk_sp<SkData>); + + /** + * To instantiate images from encoded data, first looks at this runtime function-ptr. If it + * exists, it is called to create an SkImageGenerator from SkData. If there is no function-ptr + * or there is, but it returns NULL, then skia will call its internal default implementation. + * + * Returns the previous factory (which could be NULL). + */ + static ImageGeneratorFromEncodedDataFactory + SetImageGeneratorFromEncodedDataFactory(ImageGeneratorFromEncodedDataFactory); + + /** + * Call early in main() to allow Skia to use a JIT to accelerate CPU-bound operations. + */ + static void AllowJIT(); +}; + +class SkAutoGraphics { +public: + SkAutoGraphics() { + SkGraphics::Init(); + } +}; + +#endif diff --git a/src/deps/skia/include/core/SkICC.h b/src/deps/skia/include/core/SkICC.h new file mode 100644 index 000000000..cb84c1ffb --- /dev/null +++ b/src/deps/skia/include/core/SkICC.h @@ -0,0 +1,19 @@ +/* + * Copyright 2016 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkICC_DEFINED +#define SkICC_DEFINED + +#include "include/core/SkData.h" + +struct skcms_Matrix3x3; +struct skcms_TransferFunction; + +SK_API sk_sp<SkData> SkWriteICCProfile(const skcms_TransferFunction&, + const skcms_Matrix3x3& toXYZD50); + +#endif//SkICC_DEFINED diff --git a/src/deps/skia/include/core/SkImage.h b/src/deps/skia/include/core/SkImage.h new file mode 100644 index 000000000..bdcfff3fa --- /dev/null +++ b/src/deps/skia/include/core/SkImage.h @@ -0,0 +1,1302 @@ +/* + * Copyright 2012 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkImage_DEFINED +#define SkImage_DEFINED + +#include "include/core/SkImageEncoder.h" +#include "include/core/SkImageInfo.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkSamplingOptions.h" +#include "include/core/SkScalar.h" +#include "include/core/SkShader.h" +#include "include/core/SkTileMode.h" +#include "include/private/SkTOptional.h" +#if SK_SUPPORT_GPU +#include "include/gpu/GrTypes.h" +#endif +#include <functional> // std::function + +#if defined(SK_BUILD_FOR_ANDROID) && __ANDROID_API__ >= 26 +#include <android/hardware_buffer.h> +#endif + +class SkData; +class SkCanvas; +class SkImage; +class SkImageFilter; +class SkImageGenerator; +class SkMipmap; +class SkPaint; +class SkPicture; +class SkPromiseImageTexture; +class SkSurface; +class SkYUVAPixmaps; +class GrBackendFormat; +class GrBackendTexture; +class GrDirectContext; +class GrRecordingContext; +class GrContextThreadSafeProxy; +class GrYUVABackendTextureInfo; +class GrYUVABackendTextures; + +/** \class SkImage + SkImage describes a two dimensional array of pixels to draw. The pixels may be + decoded in a raster bitmap, encoded in a SkPicture or compressed data stream, + or located in GPU memory as a GPU texture. + + SkImage cannot be modified after it is created. SkImage may allocate additional + storage as needed; for instance, an encoded SkImage may decode when drawn. + + SkImage width and height are greater than zero. Creating an SkImage with zero width + or height returns SkImage equal to nullptr. + + SkImage may be created from SkBitmap, SkPixmap, SkSurface, SkPicture, encoded streams, + GPU texture, YUV_ColorSpace data, or hardware buffer. Encoded streams supported + include BMP, GIF, HEIF, ICO, JPEG, PNG, WBMP, WebP. Supported encoding details + vary with platform. +*/ +class SK_API SkImage : public SkRefCnt { +public: + + /** Caller data passed to RasterReleaseProc; may be nullptr. + */ + typedef void* ReleaseContext; + + /** Creates SkImage from SkPixmap and copy of pixels. Since pixels are copied, SkPixmap + pixels may be modified or deleted without affecting SkImage. + + SkImage is returned if SkPixmap is valid. Valid SkPixmap parameters include: + dimensions are greater than zero; + each dimension fits in 29 bits; + SkColorType and SkAlphaType are valid, and SkColorType is not kUnknown_SkColorType; + row bytes are large enough to hold one row of pixels; + pixel address is not nullptr. + + @param pixmap SkImageInfo, pixel address, and row bytes + @return copy of SkPixmap pixels, or nullptr + + example: https://fiddle.skia.org/c/@Image_MakeRasterCopy + */ + static sk_sp<SkImage> MakeRasterCopy(const SkPixmap& pixmap); + + /** Creates SkImage from SkImageInfo, sharing pixels. + + SkImage is returned if SkImageInfo is valid. Valid SkImageInfo parameters include: + dimensions are greater than zero; + each dimension fits in 29 bits; + SkColorType and SkAlphaType are valid, and SkColorType is not kUnknown_SkColorType; + rowBytes are large enough to hold one row of pixels; + pixels is not nullptr, and contains enough data for SkImage. + + @param info contains width, height, SkAlphaType, SkColorType, SkColorSpace + @param pixels address or pixel storage + @param rowBytes size of pixel row or larger + @return SkImage sharing pixels, or nullptr + */ + static sk_sp<SkImage> MakeRasterData(const SkImageInfo& info, sk_sp<SkData> pixels, + size_t rowBytes); + + /** Function called when SkImage no longer shares pixels. ReleaseContext is + provided by caller when SkImage is created, and may be nullptr. + */ + typedef void (*RasterReleaseProc)(const void* pixels, ReleaseContext); + + /** Creates SkImage from pixmap, sharing SkPixmap pixels. Pixels must remain valid and + unchanged until rasterReleaseProc is called. rasterReleaseProc is passed + releaseContext when SkImage is deleted or no longer refers to pixmap pixels. + + Pass nullptr for rasterReleaseProc to share SkPixmap without requiring a callback + when SkImage is released. Pass nullptr for releaseContext if rasterReleaseProc + does not require state. + + SkImage is returned if pixmap is valid. Valid SkPixmap parameters include: + dimensions are greater than zero; + each dimension fits in 29 bits; + SkColorType and SkAlphaType are valid, and SkColorType is not kUnknown_SkColorType; + row bytes are large enough to hold one row of pixels; + pixel address is not nullptr. + + @param pixmap SkImageInfo, pixel address, and row bytes + @param rasterReleaseProc function called when pixels can be released; or nullptr + @param releaseContext state passed to rasterReleaseProc; or nullptr + @return SkImage sharing pixmap + */ + static sk_sp<SkImage> MakeFromRaster(const SkPixmap& pixmap, + RasterReleaseProc rasterReleaseProc, + ReleaseContext releaseContext); + + /** Creates SkImage from bitmap, sharing or copying bitmap pixels. If the bitmap + is marked immutable, and its pixel memory is shareable, it may be shared + instead of copied. + + SkImage is returned if bitmap is valid. Valid SkBitmap parameters include: + dimensions are greater than zero; + each dimension fits in 29 bits; + SkColorType and SkAlphaType are valid, and SkColorType is not kUnknown_SkColorType; + row bytes are large enough to hold one row of pixels; + pixel address is not nullptr. + + @param bitmap SkImageInfo, row bytes, and pixels + @return created SkImage, or nullptr + + example: https://fiddle.skia.org/c/@Image_MakeFromBitmap + */ + static sk_sp<SkImage> MakeFromBitmap(const SkBitmap& bitmap); + + /** Creates SkImage from data returned by imageGenerator. Generated data is owned by SkImage and + may not be shared or accessed. + + SkImage is returned if generator data is valid. Valid data parameters vary by type of data + and platform. + + imageGenerator may wrap SkPicture data, codec data, or custom data. + + @param imageGenerator stock or custom routines to retrieve SkImage + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakeFromGenerator(std::unique_ptr<SkImageGenerator> imageGenerator); + + /** + * Return an image backed by the encoded data, but attempt to defer decoding until the image + * is actually used/drawn. This deferral allows the system to cache the result, either on the + * CPU or on the GPU, depending on where the image is drawn. If memory is low, the cache may + * be purged, causing the next draw of the image to have to re-decode. + * + * If alphaType is nullopt, the image's alpha type will be chosen automatically based on the + * image format. Transparent images will default to kPremul_SkAlphaType. If alphaType contains + * kPremul_SkAlphaType or kUnpremul_SkAlphaType, that alpha type will be used. Forcing opaque + * (passing kOpaque_SkAlphaType) is not allowed, and will return nullptr. + * + * This is similar to DecodeTo[Raster,Texture], but this method will attempt to defer the + * actual decode, while the DecodeTo... method explicitly decode and allocate the backend + * when the call is made. + * + * If the encoded format is not supported, nullptr is returned. + * + * @param encoded the encoded data + * @return created SkImage, or nullptr + + example: https://fiddle.skia.org/c/@Image_MakeFromEncoded + */ + static sk_sp<SkImage> MakeFromEncoded(sk_sp<SkData> encoded, + skstd::optional<SkAlphaType> alphaType = skstd::nullopt); + + /* + * Experimental: + * Skia | GL_COMPRESSED_* | MTLPixelFormat* | VK_FORMAT_*_BLOCK + * -------------------------------------------------------------------------------------- + * kETC2_RGB8_UNORM | ETC1_RGB8 | ETC2_RGB8 (iOS-only) | ETC2_R8G8B8_UNORM + * | RGB8_ETC2 | | + * -------------------------------------------------------------------------------------- + * kBC1_RGB8_UNORM | RGB_S3TC_DXT1_EXT | N/A | BC1_RGB_UNORM + * -------------------------------------------------------------------------------------- + * kBC1_RGBA8_UNORM | RGBA_S3TC_DXT1_EXT | BC1_RGBA (macOS-only)| BC1_RGBA_UNORM + */ + enum class CompressionType { + kNone, + kETC2_RGB8_UNORM, // the same as ETC1 + + kBC1_RGB8_UNORM, + kBC1_RGBA8_UNORM, + kLast = kBC1_RGBA8_UNORM, + }; + + static constexpr int kCompressionTypeCount = static_cast<int>(CompressionType::kLast) + 1; + + static const CompressionType kETC1_CompressionType = CompressionType::kETC2_RGB8_UNORM; + + /** Creates a CPU-backed SkImage from compressed data. + + This method will decompress the compressed data and create an image wrapping + it. Any mipmap levels present in the compressed data are discarded. + + @param data compressed data to store in SkImage + @param width width of full SkImage + @param height height of full SkImage + @param type type of compression used + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakeRasterFromCompressed(sk_sp<SkData> data, + int width, int height, + CompressionType type); + + enum class BitDepth { + kU8, //!< uses 8-bit unsigned int per color component + kF16, //!< uses 16-bit float per color component + }; + + /** Creates SkImage from picture. Returned SkImage width and height are set by dimensions. + SkImage draws picture with matrix and paint, set to bitDepth and colorSpace. + + If matrix is nullptr, draws with identity SkMatrix. If paint is nullptr, draws + with default SkPaint. colorSpace may be nullptr. + + @param picture stream of drawing commands + @param dimensions width and height + @param matrix SkMatrix to rotate, scale, translate, and so on; may be nullptr + @param paint SkPaint to apply transparency, filtering, and so on; may be nullptr + @param bitDepth 8-bit integer or 16-bit float: per component + @param colorSpace range of colors; may be nullptr + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakeFromPicture(sk_sp<SkPicture> picture, const SkISize& dimensions, + const SkMatrix* matrix, const SkPaint* paint, + BitDepth bitDepth, + sk_sp<SkColorSpace> colorSpace); + +#if SK_SUPPORT_GPU + /** Creates a GPU-backed SkImage from compressed data. + + This method will return an SkImage representing the compressed data. + If the GPU doesn't support the specified compression method, the data + will be decompressed and then wrapped in a GPU-backed image. + + Note: one can query the supported compression formats via + GrRecordingContext::compressedBackendFormat. + + @param context GPU context + @param data compressed data to store in SkImage + @param width width of full SkImage + @param height height of full SkImage + @param type type of compression used + @param mipMapped does 'data' contain data for all the mipmap levels? + @param isProtected do the contents of 'data' require DRM protection (on Vulkan)? + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakeTextureFromCompressed(GrDirectContext* direct, + sk_sp<SkData> data, + int width, int height, + CompressionType type, + GrMipmapped mipMapped = GrMipmapped::kNo, + GrProtected isProtected = GrProtected::kNo); + + /** User function called when supplied texture may be deleted. + */ + typedef void (*TextureReleaseProc)(ReleaseContext releaseContext); + + /** Creates SkImage from GPU texture associated with context. GPU texture must stay + valid and unchanged until textureReleaseProc is called. textureReleaseProc is + passed releaseContext when SkImage is deleted or no longer refers to texture. + + SkImage is returned if format of backendTexture is recognized and supported. + Recognized formats vary by GPU back-end. + + @note When using a DDL recording context, textureReleaseProc will be called on the + GPU thread after the DDL is played back on the direct context. + + @param context GPU context + @param backendTexture texture residing on GPU + @param colorSpace This describes the color space of this image's contents, as + seen after sampling. In general, if the format of the backend + texture is SRGB, some linear colorSpace should be supplied + (e.g., SkColorSpace::MakeSRGBLinear()). If the format of the + backend texture is linear, then the colorSpace should include + a description of the transfer function as + well (e.g., SkColorSpace::MakeSRGB()). + @param textureReleaseProc function called when texture can be released + @param releaseContext state passed to textureReleaseProc + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakeFromTexture(GrRecordingContext* context, + const GrBackendTexture& backendTexture, + GrSurfaceOrigin origin, + SkColorType colorType, + SkAlphaType alphaType, + sk_sp<SkColorSpace> colorSpace, + TextureReleaseProc textureReleaseProc = nullptr, + ReleaseContext releaseContext = nullptr); + + /** Creates an SkImage from a GPU backend texture. The backend texture must stay + valid and unchanged until textureReleaseProc is called. The textureReleaseProc is + called when the SkImage is deleted or no longer refers to the texture and will be + passed the releaseContext. + + An SkImage is returned if the format of backendTexture is recognized and supported. + Recognized formats vary by GPU back-end. + + @note When using a DDL recording context, textureReleaseProc will be called on the + GPU thread after the DDL is played back on the direct context. + + @param context the GPU context + @param backendTexture a texture already allocated by the GPU + @param alphaType This characterizes the nature of the alpha values in the + backend texture. For opaque compressed formats (e.g., ETC1) + this should usually be set to kOpaque_SkAlphaType. + @param colorSpace This describes the color space of this image's contents, as + seen after sampling. In general, if the format of the backend + texture is SRGB, some linear colorSpace should be supplied + (e.g., SkColorSpace::MakeSRGBLinear()). If the format of the + backend texture is linear, then the colorSpace should include + a description of the transfer function as + well (e.g., SkColorSpace::MakeSRGB()). + @param textureReleaseProc function called when the backend texture can be released + @param releaseContext state passed to textureReleaseProc + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakeFromCompressedTexture(GrRecordingContext* context, + const GrBackendTexture& backendTexture, + GrSurfaceOrigin origin, + SkAlphaType alphaType, + sk_sp<SkColorSpace> colorSpace, + TextureReleaseProc textureReleaseProc = nullptr, + ReleaseContext releaseContext = nullptr); + + /** Creates SkImage from pixmap. SkImage is uploaded to GPU back-end using context. + + Created SkImage is available to other GPU contexts, and is available across thread + boundaries. All contexts must be in the same GPU share group, or otherwise + share resources. + + When SkImage is no longer referenced, context releases texture memory + asynchronously. + + GrBackendTexture created from pixmap is uploaded to match SkSurface created with + dstColorSpace. SkColorSpace of SkImage is determined by pixmap.colorSpace(). + + SkImage is returned referring to GPU back-end if context is not nullptr, + format of data is recognized and supported, and if context supports moving + resources between contexts. Otherwise, pixmap pixel data is copied and SkImage + as returned in raster format if possible; nullptr may be returned. + Recognized GPU formats vary by platform and GPU back-end. + + @param context GPU context + @param pixmap SkImageInfo, pixel address, and row bytes + @param buildMips create SkImage as mip map if true + @param dstColorSpace range of colors of matching SkSurface on GPU + @param limitToMaxTextureSize downscale image to GPU maximum texture size, if necessary + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakeCrossContextFromPixmap(GrDirectContext* context, + const SkPixmap& pixmap, + bool buildMips, + bool limitToMaxTextureSize = false); + + /** Creates SkImage from backendTexture associated with context. backendTexture and + returned SkImage are managed internally, and are released when no longer needed. + + SkImage is returned if format of backendTexture is recognized and supported. + Recognized formats vary by GPU back-end. + + @param context GPU context + @param backendTexture texture residing on GPU + @param textureOrigin origin of backendTexture + @param colorType color type of the resulting image + @param alphaType alpha type of the resulting image + @param colorSpace range of colors; may be nullptr + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakeFromAdoptedTexture(GrRecordingContext* context, + const GrBackendTexture& backendTexture, + GrSurfaceOrigin textureOrigin, + SkColorType colorType, + SkAlphaType alphaType = kPremul_SkAlphaType, + sk_sp<SkColorSpace> colorSpace = nullptr); + + /** Creates an SkImage from YUV[A] planar textures. This requires that the textures stay valid + for the lifetime of the image. The ReleaseContext can be used to know when it is safe to + either delete or overwrite the textures. If ReleaseProc is provided it is also called before + return on failure. + + @param context GPU context + @param yuvaTextures A set of textures containing YUVA data and a description of the + data and transformation to RGBA. + @param imageColorSpace range of colors of the resulting image after conversion to RGB; + may be nullptr + @param textureReleaseProc called when the backend textures can be released + @param releaseContext state passed to textureReleaseProc + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakeFromYUVATextures(GrRecordingContext* context, + const GrYUVABackendTextures& yuvaTextures, + sk_sp<SkColorSpace> imageColorSpace = nullptr, + TextureReleaseProc textureReleaseProc = nullptr, + ReleaseContext releaseContext = nullptr); + + /** Creates SkImage from SkYUVAPixmaps. + + The image will remain planar with each plane converted to a texture using the passed + GrRecordingContext. + + SkYUVAPixmaps has a SkYUVAInfo which specifies the transformation from YUV to RGB. + The SkColorSpace of the resulting RGB values is specified by imageColorSpace. This will + be the SkColorSpace reported by the image and when drawn the RGB values will be converted + from this space into the destination space (if the destination is tagged). + + Currently, this is only supported using the GPU backend and will fail if context is nullptr. + + SkYUVAPixmaps does not need to remain valid after this returns. + + @param context GPU context + @param pixmaps The planes as pixmaps with supported SkYUVAInfo that + specifies conversion to RGB. + @param buildMips create internal YUVA textures as mip map if kYes. This is + silently ignored if the context does not support mip maps. + @param limitToMaxTextureSize downscale image to GPU maximum texture size, if necessary + @param imageColorSpace range of colors of the resulting image; may be nullptr + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakeFromYUVAPixmaps(GrRecordingContext* context, + const SkYUVAPixmaps& pixmaps, + GrMipMapped buildMips = GrMipmapped::kNo, + bool limitToMaxTextureSize = false, + sk_sp<SkColorSpace> imageColorSpace = nullptr); + + using PromiseImageTextureContext = void*; + using PromiseImageTextureFulfillProc = + sk_sp<SkPromiseImageTexture> (*)(PromiseImageTextureContext); + using PromiseImageTextureReleaseProc = void (*)(PromiseImageTextureContext); + + /** Create a new SkImage that is very similar to an SkImage created by MakeFromTexture. The + difference is that the caller need not have created the texture nor populated it with the + image pixel data. Moreover, the SkImage may be created on a thread as the creation of the + image does not require access to the backend API or GrDirectContext. Instead of passing a + GrBackendTexture the client supplies a description of the texture consisting of + GrBackendFormat, width, height, and GrMipmapped state. The resulting SkImage can be drawn + to a SkDeferredDisplayListRecorder or directly to a GPU-backed SkSurface. + + When the actual texture is required to perform a backend API draw, textureFulfillProc will + be called to receive a GrBackendTexture. The properties of the GrBackendTexture must match + those set during the SkImage creation, and it must refer to a valid existing texture in the + backend API context/device, and be populated with the image pixel data. The texture cannot + be deleted until textureReleaseProc is called. + + There is at most one call to each of textureFulfillProc and textureReleaseProc. + textureReleaseProc is always called even if image creation fails or if the + image is never fulfilled (e.g. it is never drawn or all draws are clipped out) + + @param gpuContextProxy the thread-safe proxy of the gpu context. required. + @param backendFormat format of promised gpu texture + @param dimensions width & height of promised gpu texture + @param mipMapped mip mapped state of promised gpu texture + @param origin surface origin of promised gpu texture + @param colorType color type of promised gpu texture + @param alphaType alpha type of promised gpu texture + @param colorSpace range of colors; may be nullptr + @param textureFulfillProc function called to get actual gpu texture + @param textureReleaseProc function called when texture can be deleted + @param textureContext state passed to textureFulfillProc and textureReleaseProc + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakePromiseTexture(sk_sp<GrContextThreadSafeProxy> gpuContextProxy, + const GrBackendFormat& backendFormat, + SkISize dimensions, + GrMipmapped mipMapped, + GrSurfaceOrigin origin, + SkColorType colorType, + SkAlphaType alphaType, + sk_sp<SkColorSpace> colorSpace, + PromiseImageTextureFulfillProc textureFulfillProc, + PromiseImageTextureReleaseProc textureReleaseProc, + PromiseImageTextureContext textureContext); + + /** This entry point operates like 'MakePromiseTexture' but it is used to construct a SkImage + from YUV[A] data. The source data may be planar (i.e. spread across multiple textures). In + the extreme Y, U, V, and A are all in different planes and thus the image is specified by + four textures. 'backendTextureInfo' describes the planar arrangement, texture formats, + conversion to RGB, and origin of the textures. Separate 'textureFulfillProc' and + 'textureReleaseProc' calls are made for each texture. Each texture has its own + PromiseImageTextureContext. If 'backendTextureInfo' is not valid then no release proc + calls are made. Otherwise, the calls will be made even on failure. 'textureContexts' has one + entry for each of the up to four textures, as indicated by 'backendTextureInfo'. + + Currently the mip mapped property of 'backendTextureInfo' is ignored. However, in the + near future it will be required that if it is kYes then textureFulfillProc must return + a mip mapped texture for each plane in order to successfully draw the image. + + @param gpuContextProxy the thread-safe proxy of the gpu context. required. + @param backendTextureInfo info about the promised yuva gpu texture + @param imageColorSpace range of colors; may be nullptr + @param textureFulfillProc function called to get actual gpu texture + @param textureReleaseProc function called when texture can be deleted + @param textureContexts state passed to textureFulfillProc and textureReleaseProc + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakePromiseYUVATexture(sk_sp<GrContextThreadSafeProxy> gpuContextProxy, + const GrYUVABackendTextureInfo& backendTextureInfo, + sk_sp<SkColorSpace> imageColorSpace, + PromiseImageTextureFulfillProc textureFulfillProc, + PromiseImageTextureReleaseProc textureReleaseProc, + PromiseImageTextureContext textureContexts[]); + +#endif // SK_SUPPORT_GPU + +#if defined(SK_BUILD_FOR_ANDROID) && __ANDROID_API__ >= 26 + /** (See Skia bug 7447) + Creates SkImage from Android hardware buffer. + Returned SkImage takes a reference on the buffer. + + Only available on Android, when __ANDROID_API__ is defined to be 26 or greater. + + @param hardwareBuffer AHardwareBuffer Android hardware buffer + @param colorSpace range of colors; may be nullptr + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakeFromAHardwareBuffer( + AHardwareBuffer* hardwareBuffer, + SkAlphaType alphaType = kPremul_SkAlphaType, + sk_sp<SkColorSpace> colorSpace = nullptr, + GrSurfaceOrigin surfaceOrigin = kTopLeft_GrSurfaceOrigin); + + /** Creates SkImage from Android hardware buffer and uploads the data from the SkPixmap to it. + Returned SkImage takes a reference on the buffer. + + Only available on Android, when __ANDROID_API__ is defined to be 26 or greater. + + @param context GPU context + @param pixmap SkPixmap that contains data to be uploaded to the AHardwareBuffer + @param hardwareBuffer AHardwareBuffer Android hardware buffer + @param surfaceOrigin surface origin for resulting image + @return created SkImage, or nullptr + */ + static sk_sp<SkImage> MakeFromAHardwareBufferWithData( + GrDirectContext* context, + const SkPixmap& pixmap, + AHardwareBuffer* hardwareBuffer, + GrSurfaceOrigin surfaceOrigin = kTopLeft_GrSurfaceOrigin); +#endif + + /** Returns a SkImageInfo describing the width, height, color type, alpha type, and color space + of the SkImage. + + @return image info of SkImage. + */ + const SkImageInfo& imageInfo() const { return fInfo; } + + /** Returns pixel count in each row. + + @return pixel width in SkImage + */ + int width() const { return fInfo.width(); } + + /** Returns pixel row count. + + @return pixel height in SkImage + */ + int height() const { return fInfo.height(); } + + /** Returns SkISize { width(), height() }. + + @return integral size of width() and height() + */ + SkISize dimensions() const { return SkISize::Make(fInfo.width(), fInfo.height()); } + + /** Returns SkIRect { 0, 0, width(), height() }. + + @return integral rectangle from origin to width() and height() + */ + SkIRect bounds() const { return SkIRect::MakeWH(fInfo.width(), fInfo.height()); } + + /** Returns value unique to image. SkImage contents cannot change after SkImage is + created. Any operation to create a new SkImage will receive generate a new + unique number. + + @return unique identifier + */ + uint32_t uniqueID() const { return fUniqueID; } + + /** Returns SkAlphaType. + + SkAlphaType returned was a parameter to an SkImage constructor, + or was parsed from encoded data. + + @return SkAlphaType in SkImage + + example: https://fiddle.skia.org/c/@Image_alphaType + */ + SkAlphaType alphaType() const; + + /** Returns SkColorType if known; otherwise, returns kUnknown_SkColorType. + + @return SkColorType of SkImage + + example: https://fiddle.skia.org/c/@Image_colorType + */ + SkColorType colorType() const; + + /** Returns SkColorSpace, the range of colors, associated with SkImage. The + reference count of SkColorSpace is unchanged. The returned SkColorSpace is + immutable. + + SkColorSpace returned was passed to an SkImage constructor, + or was parsed from encoded data. SkColorSpace returned may be ignored when SkImage + is drawn, depending on the capabilities of the SkSurface receiving the drawing. + + @return SkColorSpace in SkImage, or nullptr + + example: https://fiddle.skia.org/c/@Image_colorSpace + */ + SkColorSpace* colorSpace() const; + + /** Returns a smart pointer to SkColorSpace, the range of colors, associated with + SkImage. The smart pointer tracks the number of objects sharing this + SkColorSpace reference so the memory is released when the owners destruct. + + The returned SkColorSpace is immutable. + + SkColorSpace returned was passed to an SkImage constructor, + or was parsed from encoded data. SkColorSpace returned may be ignored when SkImage + is drawn, depending on the capabilities of the SkSurface receiving the drawing. + + @return SkColorSpace in SkImage, or nullptr, wrapped in a smart pointer + + example: https://fiddle.skia.org/c/@Image_refColorSpace + */ + sk_sp<SkColorSpace> refColorSpace() const; + + /** Returns true if SkImage pixels represent transparency only. If true, each pixel + is packed in 8 bits as defined by kAlpha_8_SkColorType. + + @return true if pixels represent a transparency mask + + example: https://fiddle.skia.org/c/@Image_isAlphaOnly + */ + bool isAlphaOnly() const; + + /** Returns true if pixels ignore their alpha value and are treated as fully opaque. + + @return true if SkAlphaType is kOpaque_SkAlphaType + */ + bool isOpaque() const { return SkAlphaTypeIsOpaque(this->alphaType()); } + + /** + * Make a shader with the specified tiling and mipmap sampling. + */ + sk_sp<SkShader> makeShader(SkTileMode tmx, SkTileMode tmy, const SkSamplingOptions&, + const SkMatrix* localMatrix = nullptr) const; + + sk_sp<SkShader> makeShader(SkTileMode tmx, SkTileMode tmy, const SkSamplingOptions& sampling, + const SkMatrix& lm) const { + return this->makeShader(tmx, tmy, sampling, &lm); + } + sk_sp<SkShader> makeShader(const SkSamplingOptions& sampling, const SkMatrix& lm) const { + return this->makeShader(SkTileMode::kClamp, SkTileMode::kClamp, sampling, &lm); + } + sk_sp<SkShader> makeShader(const SkSamplingOptions& sampling, + const SkMatrix* lm = nullptr) const { + return this->makeShader(SkTileMode::kClamp, SkTileMode::kClamp, sampling, lm); + } + + /** + * makeRawShader functions like makeShader, but for images that contain non-color data. + * This includes images encoding things like normals, material properties (eg, roughness), + * heightmaps, or any other purely mathematical data that happens to be stored in an image. + * These types of images are useful with some programmable shaders (see: SkRuntimeEffect). + * + * Raw image shaders work like regular image shaders (including filtering and tiling), with + * a few major differences: + * - No color space transformation is ever applied (the color space of the image is ignored). + * - Images with an alpha type of kUnpremul are *not* automatically premultiplied. + * - Bicubic filtering is not supported. If SkSamplingOptions::useCubic is true, these + * factories will return nullptr. + */ + sk_sp<SkShader> makeRawShader(SkTileMode tmx, SkTileMode tmy, const SkSamplingOptions&, + const SkMatrix* localMatrix = nullptr) const; + + sk_sp<SkShader> makeRawShader(SkTileMode tmx, SkTileMode tmy, const SkSamplingOptions& sampling, + const SkMatrix& lm) const { + return this->makeRawShader(tmx, tmy, sampling, &lm); + } + sk_sp<SkShader> makeRawShader(const SkSamplingOptions& sampling, const SkMatrix& lm) const { + return this->makeRawShader(SkTileMode::kClamp, SkTileMode::kClamp, sampling, &lm); + } + sk_sp<SkShader> makeRawShader(const SkSamplingOptions& sampling, + const SkMatrix* lm = nullptr) const { + return this->makeRawShader(SkTileMode::kClamp, SkTileMode::kClamp, sampling, lm); + } + + using CubicResampler = SkCubicResampler; + + /** Copies SkImage pixel address, row bytes, and SkImageInfo to pixmap, if address + is available, and returns true. If pixel address is not available, return + false and leave pixmap unchanged. + + @param pixmap storage for pixel state if pixels are readable; otherwise, ignored + @return true if SkImage has direct access to pixels + + example: https://fiddle.skia.org/c/@Image_peekPixels + */ + bool peekPixels(SkPixmap* pixmap) const; + + /** Returns true the contents of SkImage was created on or uploaded to GPU memory, + and is available as a GPU texture. + + @return true if SkImage is a GPU texture + + example: https://fiddle.skia.org/c/@Image_isTextureBacked + */ + bool isTextureBacked() const; + + /** Returns an approximation of the amount of texture memory used by the image. Returns + zero if the image is not texture backed or if the texture has an external format. + */ + size_t textureSize() const; + + /** Returns true if SkImage can be drawn on either raster surface or GPU surface. + If context is nullptr, tests if SkImage draws on raster surface; + otherwise, tests if SkImage draws on GPU surface associated with context. + + SkImage backed by GPU texture may become invalid if associated context is + invalid. lazy image may be invalid and may not draw to raster surface or + GPU surface or both. + + @param context GPU context + @return true if SkImage can be drawn + + example: https://fiddle.skia.org/c/@Image_isValid + */ + bool isValid(GrRecordingContext* context) const; + +#if SK_SUPPORT_GPU + /** Flushes any pending uses of texture-backed images in the GPU backend. If the image is not + texture-backed (including promise texture images) or if the GrDirectContext does not + have the same context ID as the context backing the image then this is a no-op. + + If the image was not used in any non-culled draws in the current queue of work for the + passed GrDirectContext then this is a no-op unless the GrFlushInfo contains semaphores or + a finish proc. Those are respected even when the image has not been used. + + @param context the context on which to flush pending usages of the image. + @param info flush options + */ + GrSemaphoresSubmitted flush(GrDirectContext* context, const GrFlushInfo& flushInfo) const; + + void flush(GrDirectContext* context) const { this->flush(context, {}); } + + /** Version of flush() that uses a default GrFlushInfo. Also submits the flushed work to the + GPU. + */ + void flushAndSubmit(GrDirectContext*) const; + + /** Retrieves the back-end texture. If SkImage has no back-end texture, an invalid + object is returned. Call GrBackendTexture::isValid to determine if the result + is valid. + + If flushPendingGrContextIO is true, completes deferred I/O operations. + + If origin in not nullptr, copies location of content drawn into SkImage. + + @param flushPendingGrContextIO flag to flush outstanding requests + @return back-end API texture handle; invalid on failure + */ + GrBackendTexture getBackendTexture(bool flushPendingGrContextIO, + GrSurfaceOrigin* origin = nullptr) const; +#endif // SK_SUPPORT_GPU + + /** \enum SkImage::CachingHint + CachingHint selects whether Skia may internally cache SkBitmap generated by + decoding SkImage, or by copying SkImage from GPU to CPU. The default behavior + allows caching SkBitmap. + + Choose kDisallow_CachingHint if SkImage pixels are to be used only once, or + if SkImage pixels reside in a cache outside of Skia, or to reduce memory pressure. + + Choosing kAllow_CachingHint does not ensure that pixels will be cached. + SkImage pixels may not be cached if memory requirements are too large or + pixels are not accessible. + */ + enum CachingHint { + kAllow_CachingHint, //!< allows internally caching decoded and copied pixels + kDisallow_CachingHint, //!< disallows internally caching decoded and copied pixels + }; + + /** Copies SkRect of pixels from SkImage to dstPixels. Copy starts at offset (srcX, srcY), + and does not exceed SkImage (width(), height()). + + dstInfo specifies width, height, SkColorType, SkAlphaType, and SkColorSpace of + destination. dstRowBytes specifies the gap from one destination row to the next. + Returns true if pixels are copied. Returns false if: + - dstInfo.addr() equals nullptr + - dstRowBytes is less than dstInfo.minRowBytes() + - SkPixelRef is nullptr + + Pixels are copied only if pixel conversion is possible. If SkImage SkColorType is + kGray_8_SkColorType, or kAlpha_8_SkColorType; dstInfo.colorType() must match. + If SkImage SkColorType is kGray_8_SkColorType, dstInfo.colorSpace() must match. + If SkImage SkAlphaType is kOpaque_SkAlphaType, dstInfo.alphaType() must + match. If SkImage SkColorSpace is nullptr, dstInfo.colorSpace() must match. Returns + false if pixel conversion is not possible. + + srcX and srcY may be negative to copy only top or left of source. Returns + false if width() or height() is zero or negative. + Returns false if abs(srcX) >= Image width(), or if abs(srcY) >= Image height(). + + If cachingHint is kAllow_CachingHint, pixels may be retained locally. + If cachingHint is kDisallow_CachingHint, pixels are not added to the local cache. + + @param context the GrDirectContext in play, if it exists + @param dstInfo destination width, height, SkColorType, SkAlphaType, SkColorSpace + @param dstPixels destination pixel storage + @param dstRowBytes destination row length + @param srcX column index whose absolute value is less than width() + @param srcY row index whose absolute value is less than height() + @param cachingHint whether the pixels should be cached locally + @return true if pixels are copied to dstPixels + */ + bool readPixels(GrDirectContext* context, + const SkImageInfo& dstInfo, + void* dstPixels, + size_t dstRowBytes, + int srcX, int srcY, + CachingHint cachingHint = kAllow_CachingHint) const; + + /** Copies a SkRect of pixels from SkImage to dst. Copy starts at (srcX, srcY), and + does not exceed SkImage (width(), height()). + + dst specifies width, height, SkColorType, SkAlphaType, SkColorSpace, pixel storage, + and row bytes of destination. dst.rowBytes() specifics the gap from one destination + row to the next. Returns true if pixels are copied. Returns false if: + - dst pixel storage equals nullptr + - dst.rowBytes is less than SkImageInfo::minRowBytes + - SkPixelRef is nullptr + + Pixels are copied only if pixel conversion is possible. If SkImage SkColorType is + kGray_8_SkColorType, or kAlpha_8_SkColorType; dst.colorType() must match. + If SkImage SkColorType is kGray_8_SkColorType, dst.colorSpace() must match. + If SkImage SkAlphaType is kOpaque_SkAlphaType, dst.alphaType() must + match. If SkImage SkColorSpace is nullptr, dst.colorSpace() must match. Returns + false if pixel conversion is not possible. + + srcX and srcY may be negative to copy only top or left of source. Returns + false if width() or height() is zero or negative. + Returns false if abs(srcX) >= Image width(), or if abs(srcY) >= Image height(). + + If cachingHint is kAllow_CachingHint, pixels may be retained locally. + If cachingHint is kDisallow_CachingHint, pixels are not added to the local cache. + + @param context the GrDirectContext in play, if it exists + @param dst destination SkPixmap: SkImageInfo, pixels, row bytes + @param srcX column index whose absolute value is less than width() + @param srcY row index whose absolute value is less than height() + @param cachingHint whether the pixels should be cached locallyZ + @return true if pixels are copied to dst + */ + bool readPixels(GrDirectContext* context, + const SkPixmap& dst, + int srcX, + int srcY, + CachingHint cachingHint = kAllow_CachingHint) const; + +#ifndef SK_IMAGE_READ_PIXELS_DISABLE_LEGACY_API + /** Deprecated. Use the variants that accept a GrDirectContext. */ + bool readPixels(const SkImageInfo& dstInfo, void* dstPixels, size_t dstRowBytes, + int srcX, int srcY, CachingHint cachingHint = kAllow_CachingHint) const; + bool readPixels(const SkPixmap& dst, int srcX, int srcY, + CachingHint cachingHint = kAllow_CachingHint) const; +#endif + + /** The result from asyncRescaleAndReadPixels() or asyncRescaleAndReadPixelsYUV420(). */ + class AsyncReadResult { + public: + AsyncReadResult(const AsyncReadResult&) = delete; + AsyncReadResult(AsyncReadResult&&) = delete; + AsyncReadResult& operator=(const AsyncReadResult&) = delete; + AsyncReadResult& operator=(AsyncReadResult&&) = delete; + + virtual ~AsyncReadResult() = default; + virtual int count() const = 0; + virtual const void* data(int i) const = 0; + virtual size_t rowBytes(int i) const = 0; + + protected: + AsyncReadResult() = default; + }; + + /** Client-provided context that is passed to client-provided ReadPixelsContext. */ + using ReadPixelsContext = void*; + + /** Client-provided callback to asyncRescaleAndReadPixels() or + asyncRescaleAndReadPixelsYUV420() that is called when read result is ready or on failure. + */ + using ReadPixelsCallback = void(ReadPixelsContext, std::unique_ptr<const AsyncReadResult>); + + enum class RescaleGamma : bool { kSrc, kLinear }; + + enum class RescaleMode { + kNearest, + kRepeatedLinear, + kRepeatedCubic, + }; + + /** Makes image pixel data available to caller, possibly asynchronously. It can also rescale + the image pixels. + + Currently asynchronous reads are only supported on the GPU backend and only when the + underlying 3D API supports transfer buffers and CPU/GPU synchronization primitives. In all + other cases this operates synchronously. + + Data is read from the source sub-rectangle, is optionally converted to a linear gamma, is + rescaled to the size indicated by 'info', is then converted to the color space, color type, + and alpha type of 'info'. A 'srcRect' that is not contained by the bounds of the image + causes failure. + + When the pixel data is ready the caller's ReadPixelsCallback is called with a + AsyncReadResult containing pixel data in the requested color type, alpha type, and color + space. The AsyncReadResult will have count() == 1. Upon failure the callback is called with + nullptr for AsyncReadResult. For a GPU image this flushes work but a submit must occur to + guarantee a finite time before the callback is called. + + The data is valid for the lifetime of AsyncReadResult with the exception that if the SkImage + is GPU-backed the data is immediately invalidated if the context is abandoned or + destroyed. + + @param info info of the requested pixels + @param srcRect subrectangle of image to read + @param rescaleGamma controls whether rescaling is done in the image's gamma or whether + the source data is transformed to a linear gamma before rescaling. + @param rescaleMode controls the technique (and cost) of the rescaling + @param callback function to call with result of the read + @param context passed to callback + */ + void asyncRescaleAndReadPixels(const SkImageInfo& info, + const SkIRect& srcRect, + RescaleGamma rescaleGamma, + RescaleMode rescaleMode, + ReadPixelsCallback callback, + ReadPixelsContext context) const; + + /** + Similar to asyncRescaleAndReadPixels but performs an additional conversion to YUV. The + RGB->YUV conversion is controlled by 'yuvColorSpace'. The YUV data is returned as three + planes ordered y, u, v. The u and v planes are half the width and height of the resized + rectangle. The y, u, and v values are single bytes. Currently this fails if 'dstSize' + width and height are not even. A 'srcRect' that is not contained by the bounds of the + image causes failure. + + When the pixel data is ready the caller's ReadPixelsCallback is called with a + AsyncReadResult containing the planar data. The AsyncReadResult will have count() == 3. + Upon failure the callback is called with nullptr for AsyncReadResult. For a GPU image this + flushes work but a submit must occur to guarantee a finite time before the callback is + called. + + The data is valid for the lifetime of AsyncReadResult with the exception that if the SkImage + is GPU-backed the data is immediately invalidated if the context is abandoned or + destroyed. + + @param yuvColorSpace The transformation from RGB to YUV. Applied to the resized image + after it is converted to dstColorSpace. + @param dstColorSpace The color space to convert the resized image to, after rescaling. + @param srcRect The portion of the image to rescale and convert to YUV planes. + @param dstSize The size to rescale srcRect to + @param rescaleGamma controls whether rescaling is done in the image's gamma or whether + the source data is transformed to a linear gamma before rescaling. + @param rescaleMode controls the technique (and cost) of the rescaling + @param callback function to call with the planar read result + @param context passed to callback + */ + void asyncRescaleAndReadPixelsYUV420(SkYUVColorSpace yuvColorSpace, + sk_sp<SkColorSpace> dstColorSpace, + const SkIRect& srcRect, + const SkISize& dstSize, + RescaleGamma rescaleGamma, + RescaleMode rescaleMode, + ReadPixelsCallback callback, + ReadPixelsContext context) const; + + /** Copies SkImage to dst, scaling pixels to fit dst.width() and dst.height(), and + converting pixels to match dst.colorType() and dst.alphaType(). Returns true if + pixels are copied. Returns false if dst.addr() is nullptr, or dst.rowBytes() is + less than dst SkImageInfo::minRowBytes. + + Pixels are copied only if pixel conversion is possible. If SkImage SkColorType is + kGray_8_SkColorType, or kAlpha_8_SkColorType; dst.colorType() must match. + If SkImage SkColorType is kGray_8_SkColorType, dst.colorSpace() must match. + If SkImage SkAlphaType is kOpaque_SkAlphaType, dst.alphaType() must + match. If SkImage SkColorSpace is nullptr, dst.colorSpace() must match. Returns + false if pixel conversion is not possible. + + If cachingHint is kAllow_CachingHint, pixels may be retained locally. + If cachingHint is kDisallow_CachingHint, pixels are not added to the local cache. + + @param dst destination SkPixmap: SkImageInfo, pixels, row bytes + @return true if pixels are scaled to fit dst + */ + bool scalePixels(const SkPixmap& dst, const SkSamplingOptions&, + CachingHint cachingHint = kAllow_CachingHint) const; + + /** Encodes SkImage pixels, returning result as SkData. + + Returns nullptr if encoding fails, or if encodedImageFormat is not supported. + + SkImage encoding in a format requires both building with one or more of: + SK_ENCODE_JPEG, SK_ENCODE_PNG, SK_ENCODE_WEBP; and platform support + for the encoded format. + + If SK_BUILD_FOR_MAC or SK_BUILD_FOR_IOS is defined, encodedImageFormat can + additionally be one of: SkEncodedImageFormat::kICO, SkEncodedImageFormat::kBMP, + SkEncodedImageFormat::kGIF. + + quality is a platform and format specific metric trading off size and encoding + error. When used, quality equaling 100 encodes with the least error. quality may + be ignored by the encoder. + + @param encodedImageFormat one of: SkEncodedImageFormat::kJPEG, SkEncodedImageFormat::kPNG, + SkEncodedImageFormat::kWEBP + @param quality encoder specific metric with 100 equaling best + @return encoded SkImage, or nullptr + + example: https://fiddle.skia.org/c/@Image_encodeToData + */ + sk_sp<SkData> encodeToData(SkEncodedImageFormat encodedImageFormat, int quality) const; + + /** Encodes SkImage pixels, returning result as SkData. Returns existing encoded data + if present; otherwise, SkImage is encoded with SkEncodedImageFormat::kPNG. Skia + must be built with SK_ENCODE_PNG to encode SkImage. + + Returns nullptr if existing encoded data is missing or invalid, and + encoding fails. + + @return encoded SkImage, or nullptr + + example: https://fiddle.skia.org/c/@Image_encodeToData_2 + */ + sk_sp<SkData> encodeToData() const; + + /** Returns encoded SkImage pixels as SkData, if SkImage was created from supported + encoded stream format. Platform support for formats vary and may require building + with one or more of: SK_ENCODE_JPEG, SK_ENCODE_PNG, SK_ENCODE_WEBP. + + Returns nullptr if SkImage contents are not encoded. + + @return encoded SkImage, or nullptr + + example: https://fiddle.skia.org/c/@Image_refEncodedData + */ + sk_sp<SkData> refEncodedData() const; + + /** Returns subset of this image. + + Returns nullptr if any of the following are true: + - Subset is empty + - Subset is not contained inside the image's bounds + - Pixels in the image could not be read or copied + + If this image is texture-backed, the context parameter is required and must match the + context of the source image. If the context parameter is provided, and the image is + raster-backed, the subset will be converted to texture-backed. + + @param subset bounds of returned SkImage + @param context the GrDirectContext in play, if it exists + @return the subsetted image, or nullptr + + example: https://fiddle.skia.org/c/@Image_makeSubset + */ + sk_sp<SkImage> makeSubset(const SkIRect& subset, GrDirectContext* direct = nullptr) const; + + /** + * Returns true if the image has mipmap levels. + */ + bool hasMipmaps() const; + + /** + * Returns an image with the same "base" pixels as the this image, but with mipmap levels + * automatically generated and attached. + */ + sk_sp<SkImage> withDefaultMipmaps() const; + +#if SK_SUPPORT_GPU + /** Returns SkImage backed by GPU texture associated with context. Returned SkImage is + compatible with SkSurface created with dstColorSpace. The returned SkImage respects + mipMapped setting; if mipMapped equals GrMipmapped::kYes, the backing texture + allocates mip map levels. + + The mipMapped parameter is effectively treated as kNo if MIP maps are not supported by the + GPU. + + Returns original SkImage if the image is already texture-backed, the context matches, and + mipMapped is compatible with the backing GPU texture. SkBudgeted is ignored in this case. + + Returns nullptr if context is nullptr, or if SkImage was created with another + GrDirectContext. + + @param GrDirectContext the GrDirectContext in play, if it exists + @param GrMipmapped whether created SkImage texture must allocate mip map levels + @param SkBudgeted whether to count a newly created texture for the returned image + counts against the context's budget. + @return created SkImage, or nullptr + */ + sk_sp<SkImage> makeTextureImage(GrDirectContext*, + GrMipmapped = GrMipmapped::kNo, + SkBudgeted = SkBudgeted::kYes) const; +#endif + + /** Returns raster image or lazy image. Copies SkImage backed by GPU texture into + CPU memory if needed. Returns original SkImage if decoded in raster bitmap, + or if encoded in a stream. + + Returns nullptr if backed by GPU texture and copy fails. + + @return raster image, lazy image, or nullptr + + example: https://fiddle.skia.org/c/@Image_makeNonTextureImage + */ + sk_sp<SkImage> makeNonTextureImage() const; + + /** Returns raster image. Copies SkImage backed by GPU texture into CPU memory, + or decodes SkImage from lazy image. Returns original SkImage if decoded in + raster bitmap. + + Returns nullptr if copy, decode, or pixel read fails. + + If cachingHint is kAllow_CachingHint, pixels may be retained locally. + If cachingHint is kDisallow_CachingHint, pixels are not added to the local cache. + + @return raster image, or nullptr + + example: https://fiddle.skia.org/c/@Image_makeRasterImage + */ + sk_sp<SkImage> makeRasterImage(CachingHint cachingHint = kDisallow_CachingHint) const; + + /** Creates filtered SkImage. filter processes original SkImage, potentially changing + color, position, and size. subset is the bounds of original SkImage processed + by filter. clipBounds is the expected bounds of the filtered SkImage. outSubset + is required storage for the actual bounds of the filtered SkImage. offset is + required storage for translation of returned SkImage. + + Returns nullptr if SkImage could not be created or if the recording context provided doesn't + match the GPU context in which the image was created. If nullptr is returned, outSubset + and offset are undefined. + + Useful for animation of SkImageFilter that varies size from frame to frame. + Returned SkImage is created larger than required by filter so that GPU texture + can be reused with different sized effects. outSubset describes the valid bounds + of GPU texture returned. offset translates the returned SkImage to keep subsequent + animation frames aligned with respect to each other. + + @param context the GrRecordingContext in play - if it exists + @param filter how SkImage is sampled when transformed + @param subset bounds of SkImage processed by filter + @param clipBounds expected bounds of filtered SkImage + @param outSubset storage for returned SkImage bounds + @param offset storage for returned SkImage translation + @return filtered SkImage, or nullptr + */ + sk_sp<SkImage> makeWithFilter(GrRecordingContext* context, + const SkImageFilter* filter, const SkIRect& subset, + const SkIRect& clipBounds, SkIRect* outSubset, + SkIPoint* offset) const; + + /** Defines a callback function, taking one parameter of type GrBackendTexture with + no return value. Function is called when back-end texture is to be released. + */ + typedef std::function<void(GrBackendTexture)> BackendTextureReleaseProc; + +#if SK_SUPPORT_GPU + /** Creates a GrBackendTexture from the provided SkImage. Returns true and + stores result in backendTexture and backendTextureReleaseProc if + texture is created; otherwise, returns false and leaves + backendTexture and backendTextureReleaseProc unmodified. + + Call backendTextureReleaseProc after deleting backendTexture. + backendTextureReleaseProc cleans up auxiliary data related to returned + backendTexture. The caller must delete returned backendTexture after use. + + If SkImage is both texture backed and singly referenced, image is returned in + backendTexture without conversion or making a copy. SkImage is singly referenced + if its was transferred solely using std::move(). + + If SkImage is not texture backed, returns texture with SkImage contents. + + @param context GPU context + @param image SkImage used for texture + @param backendTexture storage for back-end texture + @param backendTextureReleaseProc storage for clean up function + @return true if back-end texture was created + */ + static bool MakeBackendTextureFromSkImage(GrDirectContext* context, + sk_sp<SkImage> image, + GrBackendTexture* backendTexture, + BackendTextureReleaseProc* backendTextureReleaseProc); +#endif + /** Deprecated. + */ + enum LegacyBitmapMode { + kRO_LegacyBitmapMode, //!< returned bitmap is read-only and immutable + }; + + /** Deprecated. + Creates raster SkBitmap with same pixels as SkImage. If legacyBitmapMode is + kRO_LegacyBitmapMode, returned bitmap is read-only and immutable. + Returns true if SkBitmap is stored in bitmap. Returns false and resets bitmap if + SkBitmap write did not succeed. + + @param bitmap storage for legacy SkBitmap + @param legacyBitmapMode bitmap is read-only and immutable + @return true if SkBitmap was created + */ + bool asLegacyBitmap(SkBitmap* bitmap, + LegacyBitmapMode legacyBitmapMode = kRO_LegacyBitmapMode) const; + + /** Returns true if SkImage is backed by an image-generator or other service that creates + and caches its pixels or texture on-demand. + + @return true if SkImage is created as needed + + example: https://fiddle.skia.org/c/@Image_isLazyGenerated_a + example: https://fiddle.skia.org/c/@Image_isLazyGenerated_b + */ + bool isLazyGenerated() const; + + /** Creates SkImage in target SkColorSpace. + Returns nullptr if SkImage could not be created. + + Returns original SkImage if it is in target SkColorSpace. + Otherwise, converts pixels from SkImage SkColorSpace to target SkColorSpace. + If SkImage colorSpace() returns nullptr, SkImage SkColorSpace is assumed to be sRGB. + + If this image is texture-backed, the context parameter is required and must match the + context of the source image. + + @param target SkColorSpace describing color range of returned SkImage + @param direct The GrDirectContext in play, if it exists + @return created SkImage in target SkColorSpace + + example: https://fiddle.skia.org/c/@Image_makeColorSpace + */ + sk_sp<SkImage> makeColorSpace(sk_sp<SkColorSpace> target, + GrDirectContext* direct = nullptr) const; + + /** Experimental. + Creates SkImage in target SkColorType and SkColorSpace. + Returns nullptr if SkImage could not be created. + + Returns original SkImage if it is in target SkColorType and SkColorSpace. + + If this image is texture-backed, the context parameter is required and must match the + context of the source image. + + @param targetColorType SkColorType of returned SkImage + @param targetColorSpace SkColorSpace of returned SkImage + @param direct The GrDirectContext in play, if it exists + @return created SkImage in target SkColorType and SkColorSpace + */ + sk_sp<SkImage> makeColorTypeAndColorSpace(SkColorType targetColorType, + sk_sp<SkColorSpace> targetColorSpace, + GrDirectContext* direct = nullptr) const; + + /** Creates a new SkImage identical to this one, but with a different SkColorSpace. + This does not convert the underlying pixel data, so the resulting image will draw + differently. + */ + sk_sp<SkImage> reinterpretColorSpace(sk_sp<SkColorSpace> newColorSpace) const; + +private: + SkImage(const SkImageInfo& info, uint32_t uniqueID); + + friend class SkBitmap; + friend class SkImage_Base; + friend class SkMipmapBuilder; + + SkImageInfo fInfo; + const uint32_t fUniqueID; + + sk_sp<SkImage> withMipmaps(sk_sp<SkMipmap>) const; + + using INHERITED = SkRefCnt; +}; + +#endif diff --git a/src/deps/skia/include/core/SkImageEncoder.h b/src/deps/skia/include/core/SkImageEncoder.h new file mode 100644 index 000000000..fd7bc8036 --- /dev/null +++ b/src/deps/skia/include/core/SkImageEncoder.h @@ -0,0 +1,72 @@ +/* + * Copyright 2011 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkImageEncoder_DEFINED +#define SkImageEncoder_DEFINED + +// TODO: update clients so we can remove this include, they should IWYU +#include "include/core/SkBitmap.h" + +#include "include/core/SkData.h" +#include "include/core/SkEncodedImageFormat.h" +#include "include/core/SkPixmap.h" +#include "include/core/SkStream.h" + +class SkBitmap; + +/** + * Encode SkPixmap in the given binary image format. + * + * @param dst results are written to this stream. + * @param src source pixels. + * @param format image format, not all formats are supported. + * @param quality range from 0-100, this is supported by jpeg and webp. + * higher values correspond to improved visual quality, but less compression. + * + * @return false iff input is bad or format is unsupported. + * + * Will always return false if Skia is compiled without image + * encoders. + * + * For SkEncodedImageFormat::kWEBP, if quality is 100, it will use lossless compression. Otherwise + * it will use lossy. + * + * For examples of encoding an image to a file or to a block of memory, + * see tools/ToolUtils.h. + */ +SK_API bool SkEncodeImage(SkWStream* dst, const SkPixmap& src, + SkEncodedImageFormat format, int quality); + +/** + * The following helper function wraps SkEncodeImage(). + */ +SK_API bool SkEncodeImage(SkWStream* dst, const SkBitmap& src, SkEncodedImageFormat f, int q); + +/** + * Encode SkPixmap in the given binary image format. + * + * @param src source pixels. + * @param format image format, not all formats are supported. + * @param quality range from 0-100, this is supported by jpeg and webp. + * higher values correspond to improved visual quality, but less compression. + * + * @return encoded data or nullptr if input is bad or format is unsupported. + * + * Will always return nullptr if Skia is compiled without image + * encoders. + * + * For SkEncodedImageFormat::kWEBP, if quality is 100, it will use lossless compression. Otherwise + * it will use lossy. + */ +SK_API sk_sp<SkData> SkEncodePixmap(const SkPixmap& src, SkEncodedImageFormat format, int quality); + +/** + * Helper that extracts the pixmap from the bitmap, and then calls SkEncodePixmap() + */ +SK_API sk_sp<SkData> SkEncodeBitmap(const SkBitmap& src, SkEncodedImageFormat format, int quality); + +#endif // SkImageEncoder_DEFINED diff --git a/src/deps/skia/include/core/SkImageFilter.h b/src/deps/skia/include/core/SkImageFilter.h new file mode 100644 index 000000000..e2240916d --- /dev/null +++ b/src/deps/skia/include/core/SkImageFilter.h @@ -0,0 +1,114 @@ +/* + * Copyright 2011 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkImageFilter_DEFINED +#define SkImageFilter_DEFINED + +#include "include/core/SkFlattenable.h" +#include "include/core/SkMatrix.h" +#include "include/core/SkRect.h" + +class SkColorFilter; + +/** + * Base class for image filters. If one is installed in the paint, then all drawing occurs as + * usual, but it is as if the drawing happened into an offscreen (before the xfermode is applied). + * This offscreen bitmap will then be handed to the imagefilter, who in turn creates a new bitmap + * which is what will finally be drawn to the device (using the original xfermode). + * + * The local space of image filters matches the local space of the drawn geometry. For instance if + * there is rotation on the canvas, the blur will be computed along those rotated axes and not in + * the device space. In order to achieve this result, the actual drawing of the geometry may happen + * in an unrotated coordinate system so that the filtered image can be computed more easily, and + * then it will be post transformed to match what would have been produced if the geometry were + * drawn with the total canvas matrix to begin with. + */ +class SK_API SkImageFilter : public SkFlattenable { +public: + enum MapDirection { + kForward_MapDirection, + kReverse_MapDirection, + }; + /** + * Map a device-space rect recursively forward or backward through the filter DAG. + * kForward_MapDirection is used to determine which pixels of the destination canvas a source + * image rect would touch after filtering. kReverse_MapDirection is used to determine which rect + * of the source image would be required to fill the given rect (typically, clip bounds). Used + * for clipping and temp-buffer allocations, so the result need not be exact, but should never + * be smaller than the real answer. The default implementation recursively unions all input + * bounds, or returns the source rect if no inputs. + * + * In kReverse mode, 'inputRect' is the device-space bounds of the input pixels. In kForward + * mode it should always be null. If 'inputRect' is null in kReverse mode the resulting answer + * may be incorrect. + */ + SkIRect filterBounds(const SkIRect& src, const SkMatrix& ctm, + MapDirection, const SkIRect* inputRect = nullptr) const; + + /** + * Returns whether this image filter is a color filter and puts the color filter into the + * "filterPtr" parameter if it can. Does nothing otherwise. + * If this returns false, then the filterPtr is unchanged. + * If this returns true, then if filterPtr is not null, it must be set to a ref'd colorfitler + * (i.e. it may not be set to NULL). + */ + bool isColorFilterNode(SkColorFilter** filterPtr) const; + + // DEPRECATED : use isColorFilterNode() instead + bool asColorFilter(SkColorFilter** filterPtr) const { + return this->isColorFilterNode(filterPtr); + } + + /** + * Returns true (and optionally returns a ref'd filter) if this imagefilter can be completely + * replaced by the returned colorfilter. i.e. the two effects will affect drawing in the same + * way. + */ + bool asAColorFilter(SkColorFilter** filterPtr) const; + + /** + * Returns the number of inputs this filter will accept (some inputs can be NULL). + */ + int countInputs() const; + + /** + * Returns the input filter at a given index, or NULL if no input is connected. The indices + * used are filter-specific. + */ + const SkImageFilter* getInput(int i) const; + + // Default impl returns union of all input bounds. + virtual SkRect computeFastBounds(const SkRect& bounds) const; + + // Can this filter DAG compute the resulting bounds of an object-space rectangle? + bool canComputeFastBounds() const; + + /** + * If this filter can be represented by another filter + a localMatrix, return that filter, + * else return null. + */ + sk_sp<SkImageFilter> makeWithLocalMatrix(const SkMatrix& matrix) const; + + static sk_sp<SkImageFilter> Deserialize(const void* data, size_t size, + const SkDeserialProcs* procs = nullptr) { + return sk_sp<SkImageFilter>(static_cast<SkImageFilter*>( + SkFlattenable::Deserialize(kSkImageFilter_Type, data, size, procs).release())); + } + +protected: + + sk_sp<SkImageFilter> refMe() const { + return sk_ref_sp(const_cast<SkImageFilter*>(this)); + } + +private: + friend class SkImageFilter_Base; + + using INHERITED = SkFlattenable; +}; + +#endif diff --git a/src/deps/skia/include/core/SkImageGenerator.h b/src/deps/skia/include/core/SkImageGenerator.h new file mode 100644 index 000000000..abc781754 --- /dev/null +++ b/src/deps/skia/include/core/SkImageGenerator.h @@ -0,0 +1,215 @@ +/* + * Copyright 2013 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkImageGenerator_DEFINED +#define SkImageGenerator_DEFINED + +#include "include/core/SkBitmap.h" +#include "include/core/SkColor.h" +#include "include/core/SkImage.h" +#include "include/core/SkImageInfo.h" +#include "include/core/SkYUVAPixmaps.h" +#include "include/private/SkTOptional.h" + +class GrRecordingContext; +class GrSurfaceProxyView; +class GrSamplerState; +class SkBitmap; +class SkData; +class SkMatrix; +class SkPaint; +class SkPicture; + +enum class GrImageTexGenPolicy : int; + +class SK_API SkImageGenerator { +public: + /** + * The PixelRef which takes ownership of this SkImageGenerator + * will call the image generator's destructor. + */ + virtual ~SkImageGenerator() { } + + uint32_t uniqueID() const { return fUniqueID; } + + /** + * Return a ref to the encoded (i.e. compressed) representation + * of this data. + * + * If non-NULL is returned, the caller is responsible for calling + * unref() on the data when it is finished. + */ + sk_sp<SkData> refEncodedData() { + return this->onRefEncodedData(); + } + + /** + * Return the ImageInfo associated with this generator. + */ + const SkImageInfo& getInfo() const { return fInfo; } + + /** + * Can this generator be used to produce images that will be drawable to the specified context + * (or to CPU, if context is nullptr)? + */ + bool isValid(GrRecordingContext* context) const { + return this->onIsValid(context); + } + + /** + * Decode into the given pixels, a block of memory of size at + * least (info.fHeight - 1) * rowBytes + (info.fWidth * + * bytesPerPixel) + * + * Repeated calls to this function should give the same results, + * allowing the PixelRef to be immutable. + * + * @param info A description of the format + * expected by the caller. This can simply be identical + * to the info returned by getInfo(). + * + * This contract also allows the caller to specify + * different output-configs, which the implementation can + * decide to support or not. + * + * A size that does not match getInfo() implies a request + * to scale. If the generator cannot perform this scale, + * it will return false. + * + * @return true on success. + */ + bool getPixels(const SkImageInfo& info, void* pixels, size_t rowBytes); + + bool getPixels(const SkPixmap& pm) { + return this->getPixels(pm.info(), pm.writable_addr(), pm.rowBytes()); + } + + /** + * If decoding to YUV is supported, this returns true. Otherwise, this + * returns false and the caller will ignore output parameter yuvaPixmapInfo. + * + * @param supportedDataTypes Indicates the data type/planar config combinations that are + * supported by the caller. If the generator supports decoding to + * YUV(A), but not as a type in supportedDataTypes, this method + * returns false. + * @param yuvaPixmapInfo Output parameter that specifies the planar configuration, subsampling, + * orientation, chroma siting, plane color types, and row bytes. + */ + bool queryYUVAInfo(const SkYUVAPixmapInfo::SupportedDataTypes& supportedDataTypes, + SkYUVAPixmapInfo* yuvaPixmapInfo) const; + + /** + * Returns true on success and false on failure. + * This always attempts to perform a full decode. To get the planar + * configuration without decoding use queryYUVAInfo(). + * + * @param yuvaPixmaps Contains preallocated pixmaps configured according to a successful call + * to queryYUVAInfo(). + */ + bool getYUVAPlanes(const SkYUVAPixmaps& yuvaPixmaps); + +#if SK_SUPPORT_GPU + /** + * If the generator can natively/efficiently return its pixels as a GPU image (backed by a + * texture) this will return that image. If not, this will return NULL. + * + * This routine also supports retrieving only a subset of the pixels. That subset is specified + * by the following rectangle: + * + * subset = SkIRect::MakeXYWH(origin.x(), origin.y(), info.width(), info.height()) + * + * If subset is not contained inside the generator's bounds, this returns false. + * + * whole = SkIRect::MakeWH(getInfo().width(), getInfo().height()) + * if (!whole.contains(subset)) { + * return false; + * } + * + * Regarding the GrRecordingContext parameter: + * + * It must be non-NULL. The generator should only succeed if: + * - its internal context is the same + * - it can somehow convert its texture into one that is valid for the provided context. + * + * If the willNeedMipMaps flag is true, the generator should try to create a TextureProxy that + * at least has the mip levels allocated and the base layer filled in. If this is not possible, + * the generator is allowed to return a non mipped proxy, but this will have some additional + * overhead in later allocating mips and copying of the base layer. + * + * GrImageTexGenPolicy determines whether or not a new texture must be created (and its budget + * status) or whether this may (but is not required to) return a pre-existing texture that is + * retained by the generator (kDraw). + */ + GrSurfaceProxyView generateTexture(GrRecordingContext*, const SkImageInfo& info, + const SkIPoint& origin, GrMipmapped, GrImageTexGenPolicy); + +#endif + + /** + * If the default image decoder system can interpret the specified (encoded) data, then + * this returns a new ImageGenerator for it. Otherwise this returns NULL. Either way + * the caller is still responsible for managing their ownership of the data. + * By default, images will be converted to premultiplied pixels. The alpha type can be + * overridden by specifying kPremul_SkAlphaType or kUnpremul_SkAlphaType. Specifying + * kOpaque_SkAlphaType is not supported, and will return NULL. + */ + static std::unique_ptr<SkImageGenerator> MakeFromEncoded( + sk_sp<SkData>, skstd::optional<SkAlphaType> = skstd::nullopt); + + /** Return a new image generator backed by the specified picture. If the size is empty or + * the picture is NULL, this returns NULL. + * The optional matrix and paint arguments are passed to drawPicture() at rasterization + * time. + */ + static std::unique_ptr<SkImageGenerator> MakeFromPicture(const SkISize&, sk_sp<SkPicture>, + const SkMatrix*, const SkPaint*, + SkImage::BitDepth, + sk_sp<SkColorSpace>); + +protected: + static constexpr int kNeedNewImageUniqueID = 0; + + SkImageGenerator(const SkImageInfo& info, uint32_t uniqueId = kNeedNewImageUniqueID); + + virtual sk_sp<SkData> onRefEncodedData() { return nullptr; } + struct Options {}; + virtual bool onGetPixels(const SkImageInfo&, void*, size_t, const Options&) { return false; } + virtual bool onIsValid(GrRecordingContext*) const { return true; } + virtual bool onQueryYUVAInfo(const SkYUVAPixmapInfo::SupportedDataTypes&, + SkYUVAPixmapInfo*) const { return false; } + virtual bool onGetYUVAPlanes(const SkYUVAPixmaps&) { return false; } +#if SK_SUPPORT_GPU + // returns nullptr + virtual GrSurfaceProxyView onGenerateTexture(GrRecordingContext*, const SkImageInfo&, + const SkIPoint&, GrMipmapped, GrImageTexGenPolicy); + + // Most internal SkImageGenerators produce textures and views that use kTopLeft_GrSurfaceOrigin. + // If the generator may produce textures with different origins (e.g. + // GrAHardwareBufferImageGenerator) it should override this function to return the correct + // origin. + virtual GrSurfaceOrigin origin() const { return kTopLeft_GrSurfaceOrigin; } +#endif + +private: + const SkImageInfo fInfo; + const uint32_t fUniqueID; + + friend class SkImage_Lazy; + + // This is our default impl, which may be different on different platforms. + // It is called from NewFromEncoded() after it has checked for any runtime factory. + // The SkData will never be NULL, as that will have been checked by NewFromEncoded. + static std::unique_ptr<SkImageGenerator> MakeFromEncodedImpl(sk_sp<SkData>, + skstd::optional<SkAlphaType>); + + SkImageGenerator(SkImageGenerator&&) = delete; + SkImageGenerator(const SkImageGenerator&) = delete; + SkImageGenerator& operator=(SkImageGenerator&&) = delete; + SkImageGenerator& operator=(const SkImageGenerator&) = delete; +}; + +#endif // SkImageGenerator_DEFINED diff --git a/src/deps/skia/include/core/SkImageInfo.h b/src/deps/skia/include/core/SkImageInfo.h new file mode 100644 index 000000000..99b65e875 --- /dev/null +++ b/src/deps/skia/include/core/SkImageInfo.h @@ -0,0 +1,721 @@ +/* + * Copyright 2013 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkImageInfo_DEFINED +#define SkImageInfo_DEFINED + +#include "include/core/SkColorSpace.h" +#include "include/core/SkMath.h" +#include "include/core/SkRect.h" +#include "include/core/SkSize.h" + +#include "include/private/SkTFitsIn.h" +#include "include/private/SkTo.h" + +class SkReadBuffer; +class SkWriteBuffer; + +/** \enum SkImageInfo::SkAlphaType + Describes how to interpret the alpha component of a pixel. A pixel may + be opaque, or alpha, describing multiple levels of transparency. + + In simple blending, alpha weights the draw color and the destination + color to create a new color. If alpha describes a weight from zero to one: + + new color = draw color * alpha + destination color * (1 - alpha) + + In practice alpha is encoded in two or more bits, where 1.0 equals all bits set. + + RGB may have alpha included in each component value; the stored + value is the original RGB multiplied by alpha. Premultiplied color + components improve performance. +*/ +enum SkAlphaType : int { + kUnknown_SkAlphaType, //!< uninitialized + kOpaque_SkAlphaType, //!< pixel is opaque + kPremul_SkAlphaType, //!< pixel components are premultiplied by alpha + kUnpremul_SkAlphaType, //!< pixel components are independent of alpha + kLastEnum_SkAlphaType = kUnpremul_SkAlphaType, //!< last valid value +}; + +/** Returns true if SkAlphaType equals kOpaque_SkAlphaType. + + kOpaque_SkAlphaType is a hint that the SkColorType is opaque, or that all + alpha values are set to their 1.0 equivalent. If SkAlphaType is + kOpaque_SkAlphaType, and SkColorType is not opaque, then the result of + drawing any pixel with a alpha value less than 1.0 is undefined. +*/ +static inline bool SkAlphaTypeIsOpaque(SkAlphaType at) { + return kOpaque_SkAlphaType == at; +} + +/////////////////////////////////////////////////////////////////////////////// + +/** \enum SkImageInfo::SkColorType + Describes how pixel bits encode color. A pixel may be an alpha mask, a grayscale, RGB, or ARGB. + + kN32_SkColorType selects the native 32-bit ARGB format for the current configuration. This can + lead to inconsistent results across platforms, so use with caution. +*/ +enum SkColorType : int { + kUnknown_SkColorType, //!< uninitialized + kAlpha_8_SkColorType, //!< pixel with alpha in 8-bit byte + kRGB_565_SkColorType, //!< pixel with 5 bits red, 6 bits green, 5 bits blue, in 16-bit word + kARGB_4444_SkColorType, //!< pixel with 4 bits for alpha, red, green, blue; in 16-bit word + kRGBA_8888_SkColorType, //!< pixel with 8 bits for red, green, blue, alpha; in 32-bit word + kRGB_888x_SkColorType, //!< pixel with 8 bits each for red, green, blue; in 32-bit word + kBGRA_8888_SkColorType, //!< pixel with 8 bits for blue, green, red, alpha; in 32-bit word + kRGBA_1010102_SkColorType, //!< 10 bits for red, green, blue; 2 bits for alpha; in 32-bit word + kBGRA_1010102_SkColorType, //!< 10 bits for blue, green, red; 2 bits for alpha; in 32-bit word + kRGB_101010x_SkColorType, //!< pixel with 10 bits each for red, green, blue; in 32-bit word + kBGR_101010x_SkColorType, //!< pixel with 10 bits each for blue, green, red; in 32-bit word + kGray_8_SkColorType, //!< pixel with grayscale level in 8-bit byte + kRGBA_F16Norm_SkColorType, //!< pixel with half floats in [0,1] for red, green, blue, alpha; + // in 64-bit word + kRGBA_F16_SkColorType, //!< pixel with half floats for red, green, blue, alpha; + // in 64-bit word + kRGBA_F32_SkColorType, //!< pixel using C float for red, green, blue, alpha; in 128-bit word + + // The following 6 colortypes are just for reading from - not for rendering to + kR8G8_unorm_SkColorType, //!< pixel with a uint8_t for red and green + + kA16_float_SkColorType, //!< pixel with a half float for alpha + kR16G16_float_SkColorType, //!< pixel with a half float for red and green + + kA16_unorm_SkColorType, //!< pixel with a little endian uint16_t for alpha + kR16G16_unorm_SkColorType, //!< pixel with a little endian uint16_t for red and green + kR16G16B16A16_unorm_SkColorType, //!< pixel with a little endian uint16_t for red, green, blue + // and alpha + + kSRGBA_8888_SkColorType, + + kLastEnum_SkColorType = kSRGBA_8888_SkColorType, //!< last valid value + +#if SK_PMCOLOR_BYTE_ORDER(B,G,R,A) + kN32_SkColorType = kBGRA_8888_SkColorType,//!< native 32-bit BGRA encoding + +#elif SK_PMCOLOR_BYTE_ORDER(R,G,B,A) + kN32_SkColorType = kRGBA_8888_SkColorType,//!< native 32-bit RGBA encoding + +#else + #error "SK_*32_SHIFT values must correspond to BGRA or RGBA byte order" +#endif +}; + +/** Returns the number of bytes required to store a pixel, including unused padding. + Returns zero if ct is kUnknown_SkColorType or invalid. + + @return bytes per pixel +*/ +SK_API int SkColorTypeBytesPerPixel(SkColorType ct); + +/** Returns true if SkColorType always decodes alpha to 1.0, making the pixel + fully opaque. If true, SkColorType does not reserve bits to encode alpha. + + @return true if alpha is always set to 1.0 +*/ +SK_API bool SkColorTypeIsAlwaysOpaque(SkColorType ct); + +/** Returns true if canonical can be set to a valid SkAlphaType for colorType. If + there is more than one valid canonical SkAlphaType, set to alphaType, if valid. + If true is returned and canonical is not nullptr, store valid SkAlphaType. + + Returns false only if alphaType is kUnknown_SkAlphaType, color type is not + kUnknown_SkColorType, and SkColorType is not always opaque. If false is returned, + canonical is ignored. + + @param canonical storage for SkAlphaType + @return true if valid SkAlphaType can be associated with colorType +*/ +SK_API bool SkColorTypeValidateAlphaType(SkColorType colorType, SkAlphaType alphaType, + SkAlphaType* canonical = nullptr); + +/** \enum SkImageInfo::SkYUVColorSpace + Describes color range of YUV pixels. The color mapping from YUV to RGB varies + depending on the source. YUV pixels may be generated by JPEG images, standard + video streams, or high definition video streams. Each has its own mapping from + YUV to RGB. + + JPEG YUV values encode the full range of 0 to 255 for all three components. + Video YUV values often range from 16 to 235 for Y and from 16 to 240 for U and V (limited). + Details of encoding and conversion to RGB are described in YCbCr color space. + + The identity colorspace exists to provide a utility mapping from Y to R, U to G and V to B. + It can be used to visualize the YUV planes or to explicitly post process the YUV channels. +*/ +enum SkYUVColorSpace : int { + kJPEG_Full_SkYUVColorSpace, //!< describes full range + kRec601_Limited_SkYUVColorSpace, //!< describes SDTV range + kRec709_Full_SkYUVColorSpace, //!< describes HDTV range + kRec709_Limited_SkYUVColorSpace, + kBT2020_8bit_Full_SkYUVColorSpace, //!< describes UHDTV range, non-constant-luminance + kBT2020_8bit_Limited_SkYUVColorSpace, + kBT2020_10bit_Full_SkYUVColorSpace, + kBT2020_10bit_Limited_SkYUVColorSpace, + kBT2020_12bit_Full_SkYUVColorSpace, + kBT2020_12bit_Limited_SkYUVColorSpace, + kIdentity_SkYUVColorSpace, //!< maps Y->R, U->G, V->B + + kLastEnum_SkYUVColorSpace = kIdentity_SkYUVColorSpace, //!< last valid value + + // Legacy (deprecated) names: + kJPEG_SkYUVColorSpace = kJPEG_Full_SkYUVColorSpace, + kRec601_SkYUVColorSpace = kRec601_Limited_SkYUVColorSpace, + kRec709_SkYUVColorSpace = kRec709_Limited_SkYUVColorSpace, + kBT2020_SkYUVColorSpace = kBT2020_8bit_Limited_SkYUVColorSpace, +}; + +/** \struct SkColorInfo + Describes pixel and encoding. SkImageInfo can be created from SkColorInfo by + providing dimensions. + + It encodes how pixel bits describe alpha, transparency; color components red, blue, + and green; and SkColorSpace, the range and linearity of colors. +*/ +class SK_API SkColorInfo { +public: + /** Creates an SkColorInfo with kUnknown_SkColorType, kUnknown_SkAlphaType, + and no SkColorSpace. + + @return empty SkImageInfo + */ + SkColorInfo() = default; + + /** Creates SkColorInfo from SkColorType ct, SkAlphaType at, and optionally SkColorSpace cs. + + If SkColorSpace cs is nullptr and SkColorInfo is part of drawing source: SkColorSpace + defaults to sRGB, mapping into SkSurface SkColorSpace. + + Parameters are not validated to see if their values are legal, or that the + combination is supported. + @return created SkColorInfo + */ + SkColorInfo(SkColorType ct, SkAlphaType at, sk_sp<SkColorSpace> cs) + : fColorSpace(std::move(cs)), fColorType(ct), fAlphaType(at) {} + + SkColorInfo(const SkColorInfo&) = default; + SkColorInfo(SkColorInfo&&) = default; + + SkColorInfo& operator=(const SkColorInfo&) = default; + SkColorInfo& operator=(SkColorInfo&&) = default; + + SkColorSpace* colorSpace() const { return fColorSpace.get(); } + sk_sp<SkColorSpace> refColorSpace() const { return fColorSpace; } + SkColorType colorType() const { return fColorType; } + SkAlphaType alphaType() const { return fAlphaType; } + + bool isOpaque() const { + return SkAlphaTypeIsOpaque(fAlphaType) + || SkColorTypeIsAlwaysOpaque(fColorType); + } + + bool gammaCloseToSRGB() const { return fColorSpace && fColorSpace->gammaCloseToSRGB(); } + + /** Does other represent the same color type, alpha type, and color space? */ + bool operator==(const SkColorInfo& other) const { + return fColorType == other.fColorType && fAlphaType == other.fAlphaType && + SkColorSpace::Equals(fColorSpace.get(), other.fColorSpace.get()); + } + + /** Does other represent a different color type, alpha type, or color space? */ + bool operator!=(const SkColorInfo& other) const { return !(*this == other); } + + /** Creates SkColorInfo with same SkColorType, SkColorSpace, with SkAlphaType set + to newAlphaType. + + Created SkColorInfo contains newAlphaType even if it is incompatible with + SkColorType, in which case SkAlphaType in SkColorInfo is ignored. + */ + SkColorInfo makeAlphaType(SkAlphaType newAlphaType) const { + return SkColorInfo(this->colorType(), newAlphaType, this->refColorSpace()); + } + + /** Creates new SkColorInfo with same SkAlphaType, SkColorSpace, with SkColorType + set to newColorType. + */ + SkColorInfo makeColorType(SkColorType newColorType) const { + return SkColorInfo(newColorType, this->alphaType(), this->refColorSpace()); + } + + /** Creates SkColorInfo with same SkAlphaType, SkColorType, with SkColorSpace + set to cs. cs may be nullptr. + */ + SkColorInfo makeColorSpace(sk_sp<SkColorSpace> cs) const { + return SkColorInfo(this->colorType(), this->alphaType(), std::move(cs)); + } + + /** Returns number of bytes per pixel required by SkColorType. + Returns zero if colorType() is kUnknown_SkColorType. + + @return bytes in pixel + + example: https://fiddle.skia.org/c/@ImageInfo_bytesPerPixel + */ + int bytesPerPixel() const; + + /** Returns bit shift converting row bytes to row pixels. + Returns zero for kUnknown_SkColorType. + + @return one of: 0, 1, 2, 3, 4; left shift to convert pixels to bytes + + example: https://fiddle.skia.org/c/@ImageInfo_shiftPerPixel + */ + int shiftPerPixel() const; + +private: + sk_sp<SkColorSpace> fColorSpace; + SkColorType fColorType = kUnknown_SkColorType; + SkAlphaType fAlphaType = kUnknown_SkAlphaType; +}; + +/** \struct SkImageInfo + Describes pixel dimensions and encoding. SkBitmap, SkImage, PixMap, and SkSurface + can be created from SkImageInfo. SkImageInfo can be retrieved from SkBitmap and + SkPixmap, but not from SkImage and SkSurface. For example, SkImage and SkSurface + implementations may defer pixel depth, so may not completely specify SkImageInfo. + + SkImageInfo contains dimensions, the pixel integral width and height. It encodes + how pixel bits describe alpha, transparency; color components red, blue, + and green; and SkColorSpace, the range and linearity of colors. +*/ +struct SK_API SkImageInfo { +public: + + /** Creates an empty SkImageInfo with kUnknown_SkColorType, kUnknown_SkAlphaType, + a width and height of zero, and no SkColorSpace. + + @return empty SkImageInfo + */ + SkImageInfo() = default; + + /** Creates SkImageInfo from integral dimensions width and height, SkColorType ct, + SkAlphaType at, and optionally SkColorSpace cs. + + If SkColorSpace cs is nullptr and SkImageInfo is part of drawing source: SkColorSpace + defaults to sRGB, mapping into SkSurface SkColorSpace. + + Parameters are not validated to see if their values are legal, or that the + combination is supported. + + @param width pixel column count; must be zero or greater + @param height pixel row count; must be zero or greater + @param cs range of colors; may be nullptr + @return created SkImageInfo + */ + static SkImageInfo Make(int width, int height, SkColorType ct, SkAlphaType at, + sk_sp<SkColorSpace> cs = nullptr) { + return SkImageInfo({width, height}, {ct, at, std::move(cs)}); + } + static SkImageInfo Make(SkISize dimensions, SkColorType ct, SkAlphaType at, + sk_sp<SkColorSpace> cs = nullptr) { + return SkImageInfo(dimensions, {ct, at, std::move(cs)}); + } + + /** Creates SkImageInfo from integral dimensions and SkColorInfo colorInfo, + + Parameters are not validated to see if their values are legal, or that the + combination is supported. + + @param dimensions pixel column and row count; must be zeros or greater + @param SkColorInfo the pixel encoding consisting of SkColorType, SkAlphaType, and + SkColorSpace (which may be nullptr) + @return created SkImageInfo + */ + static SkImageInfo Make(SkISize dimensions, const SkColorInfo& colorInfo) { + return SkImageInfo(dimensions, colorInfo); + } + static SkImageInfo Make(SkISize dimensions, SkColorInfo&& colorInfo) { + return SkImageInfo(dimensions, std::move(colorInfo)); + } + + /** Creates SkImageInfo from integral dimensions width and height, kN32_SkColorType, + SkAlphaType at, and optionally SkColorSpace cs. kN32_SkColorType will equal either + kBGRA_8888_SkColorType or kRGBA_8888_SkColorType, whichever is optimal. + + If SkColorSpace cs is nullptr and SkImageInfo is part of drawing source: SkColorSpace + defaults to sRGB, mapping into SkSurface SkColorSpace. + + Parameters are not validated to see if their values are legal, or that the + combination is supported. + + @param width pixel column count; must be zero or greater + @param height pixel row count; must be zero or greater + @param cs range of colors; may be nullptr + @return created SkImageInfo + */ + static SkImageInfo MakeN32(int width, int height, SkAlphaType at, + sk_sp<SkColorSpace> cs = nullptr) { + return Make({width, height}, kN32_SkColorType, at, std::move(cs)); + } + + /** Creates SkImageInfo from integral dimensions width and height, kN32_SkColorType, + SkAlphaType at, with sRGB SkColorSpace. + + Parameters are not validated to see if their values are legal, or that the + combination is supported. + + @param width pixel column count; must be zero or greater + @param height pixel row count; must be zero or greater + @return created SkImageInfo + + example: https://fiddle.skia.org/c/@ImageInfo_MakeS32 + */ + static SkImageInfo MakeS32(int width, int height, SkAlphaType at); + + /** Creates SkImageInfo from integral dimensions width and height, kN32_SkColorType, + kPremul_SkAlphaType, with optional SkColorSpace. + + If SkColorSpace cs is nullptr and SkImageInfo is part of drawing source: SkColorSpace + defaults to sRGB, mapping into SkSurface SkColorSpace. + + Parameters are not validated to see if their values are legal, or that the + combination is supported. + + @param width pixel column count; must be zero or greater + @param height pixel row count; must be zero or greater + @param cs range of colors; may be nullptr + @return created SkImageInfo + */ + static SkImageInfo MakeN32Premul(int width, int height, sk_sp<SkColorSpace> cs = nullptr) { + return Make({width, height}, kN32_SkColorType, kPremul_SkAlphaType, std::move(cs)); + } + + /** Creates SkImageInfo from integral dimensions width and height, kN32_SkColorType, + kPremul_SkAlphaType, with SkColorSpace set to nullptr. + + If SkImageInfo is part of drawing source: SkColorSpace defaults to sRGB, mapping + into SkSurface SkColorSpace. + + Parameters are not validated to see if their values are legal, or that the + combination is supported. + + @param dimensions width and height, each must be zero or greater + @param cs range of colors; may be nullptr + @return created SkImageInfo + */ + static SkImageInfo MakeN32Premul(SkISize dimensions, sk_sp<SkColorSpace> cs = nullptr) { + return Make(dimensions, kN32_SkColorType, kPremul_SkAlphaType, std::move(cs)); + } + + /** Creates SkImageInfo from integral dimensions width and height, kAlpha_8_SkColorType, + kPremul_SkAlphaType, with SkColorSpace set to nullptr. + + @param width pixel column count; must be zero or greater + @param height pixel row count; must be zero or greater + @return created SkImageInfo + */ + static SkImageInfo MakeA8(int width, int height) { + return Make({width, height}, kAlpha_8_SkColorType, kPremul_SkAlphaType, nullptr); + } + /** Creates SkImageInfo from integral dimensions, kAlpha_8_SkColorType, + kPremul_SkAlphaType, with SkColorSpace set to nullptr. + + @param dimensions pixel row and column count; must be zero or greater + @return created SkImageInfo + */ + static SkImageInfo MakeA8(SkISize dimensions) { + return Make(dimensions, kAlpha_8_SkColorType, kPremul_SkAlphaType, nullptr); + } + + /** Creates SkImageInfo from integral dimensions width and height, kUnknown_SkColorType, + kUnknown_SkAlphaType, with SkColorSpace set to nullptr. + + Returned SkImageInfo as part of source does not draw, and as part of destination + can not be drawn to. + + @param width pixel column count; must be zero or greater + @param height pixel row count; must be zero or greater + @return created SkImageInfo + */ + static SkImageInfo MakeUnknown(int width, int height) { + return Make({width, height}, kUnknown_SkColorType, kUnknown_SkAlphaType, nullptr); + } + + /** Creates SkImageInfo from integral dimensions width and height set to zero, + kUnknown_SkColorType, kUnknown_SkAlphaType, with SkColorSpace set to nullptr. + + Returned SkImageInfo as part of source does not draw, and as part of destination + can not be drawn to. + + @return created SkImageInfo + */ + static SkImageInfo MakeUnknown() { + return MakeUnknown(0, 0); + } + + /** Returns pixel count in each row. + + @return pixel width + */ + int width() const { return fDimensions.width(); } + + /** Returns pixel row count. + + @return pixel height + */ + int height() const { return fDimensions.height(); } + + SkColorType colorType() const { return fColorInfo.colorType(); } + + SkAlphaType alphaType() const { return fColorInfo.alphaType(); } + + /** Returns SkColorSpace, the range of colors. The reference count of + SkColorSpace is unchanged. The returned SkColorSpace is immutable. + + @return SkColorSpace, or nullptr + */ + SkColorSpace* colorSpace() const { return fColorInfo.colorSpace(); } + + /** Returns smart pointer to SkColorSpace, the range of colors. The smart pointer + tracks the number of objects sharing this SkColorSpace reference so the memory + is released when the owners destruct. + + The returned SkColorSpace is immutable. + + @return SkColorSpace wrapped in a smart pointer + */ + sk_sp<SkColorSpace> refColorSpace() const { return fColorInfo.refColorSpace(); } + + /** Returns if SkImageInfo describes an empty area of pixels by checking if either + width or height is zero or smaller. + + @return true if either dimension is zero or smaller + */ + bool isEmpty() const { return fDimensions.isEmpty(); } + + /** Returns the dimensionless SkColorInfo that represents the same color type, + alpha type, and color space as this SkImageInfo. + */ + const SkColorInfo& colorInfo() const { return fColorInfo; } + + /** Returns true if SkAlphaType is set to hint that all pixels are opaque; their + alpha value is implicitly or explicitly 1.0. If true, and all pixels are + not opaque, Skia may draw incorrectly. + + Does not check if SkColorType allows alpha, or if any pixel value has + transparency. + + @return true if SkAlphaType is kOpaque_SkAlphaType + */ + bool isOpaque() const { return fColorInfo.isOpaque(); } + + /** Returns SkISize { width(), height() }. + + @return integral size of width() and height() + */ + SkISize dimensions() const { return fDimensions; } + + /** Returns SkIRect { 0, 0, width(), height() }. + + @return integral rectangle from origin to width() and height() + */ + SkIRect bounds() const { return SkIRect::MakeSize(fDimensions); } + + /** Returns true if associated SkColorSpace is not nullptr, and SkColorSpace gamma + is approximately the same as sRGB. + This includes the + + @return true if SkColorSpace gamma is approximately the same as sRGB + */ + bool gammaCloseToSRGB() const { return fColorInfo.gammaCloseToSRGB(); } + + /** Creates SkImageInfo with the same SkColorType, SkColorSpace, and SkAlphaType, + with dimensions set to width and height. + + @param newWidth pixel column count; must be zero or greater + @param newHeight pixel row count; must be zero or greater + @return created SkImageInfo + */ + SkImageInfo makeWH(int newWidth, int newHeight) const { + return Make({newWidth, newHeight}, fColorInfo); + } + + /** Creates SkImageInfo with the same SkColorType, SkColorSpace, and SkAlphaType, + with dimensions set to newDimensions. + + @param newSize pixel column and row count; must be zero or greater + @return created SkImageInfo + */ + SkImageInfo makeDimensions(SkISize newSize) const { + return Make(newSize, fColorInfo); + } + + /** Creates SkImageInfo with same SkColorType, SkColorSpace, width, and height, + with SkAlphaType set to newAlphaType. + + Created SkImageInfo contains newAlphaType even if it is incompatible with + SkColorType, in which case SkAlphaType in SkImageInfo is ignored. + + @return created SkImageInfo + */ + SkImageInfo makeAlphaType(SkAlphaType newAlphaType) const { + return Make(fDimensions, fColorInfo.makeAlphaType(newAlphaType)); + } + + /** Creates SkImageInfo with same SkAlphaType, SkColorSpace, width, and height, + with SkColorType set to newColorType. + + @return created SkImageInfo + */ + SkImageInfo makeColorType(SkColorType newColorType) const { + return Make(fDimensions, fColorInfo.makeColorType(newColorType)); + } + + /** Creates SkImageInfo with same SkAlphaType, SkColorType, width, and height, + with SkColorSpace set to cs. + + @param cs range of colors; may be nullptr + @return created SkImageInfo + */ + SkImageInfo makeColorSpace(sk_sp<SkColorSpace> cs) const { + return Make(fDimensions, fColorInfo.makeColorSpace(std::move(cs))); + } + + /** Returns number of bytes per pixel required by SkColorType. + Returns zero if colorType( is kUnknown_SkColorType. + + @return bytes in pixel + */ + int bytesPerPixel() const { return fColorInfo.bytesPerPixel(); } + + /** Returns bit shift converting row bytes to row pixels. + Returns zero for kUnknown_SkColorType. + + @return one of: 0, 1, 2, 3; left shift to convert pixels to bytes + */ + int shiftPerPixel() const { return fColorInfo.shiftPerPixel(); } + + /** Returns minimum bytes per row, computed from pixel width() and SkColorType, which + specifies bytesPerPixel(). SkBitmap maximum value for row bytes must fit + in 31 bits. + + @return width() times bytesPerPixel() as unsigned 64-bit integer + */ + uint64_t minRowBytes64() const { + return (uint64_t)sk_64_mul(this->width(), this->bytesPerPixel()); + } + + /** Returns minimum bytes per row, computed from pixel width() and SkColorType, which + specifies bytesPerPixel(). SkBitmap maximum value for row bytes must fit + in 31 bits. + + @return width() times bytesPerPixel() as size_t + */ + size_t minRowBytes() const { + uint64_t minRowBytes = this->minRowBytes64(); + if (!SkTFitsIn<int32_t>(minRowBytes)) { + return 0; + } + return (size_t)minRowBytes; + } + + /** Returns byte offset of pixel from pixel base address. + + Asserts in debug build if x or y is outside of bounds. Does not assert if + rowBytes is smaller than minRowBytes(), even though result may be incorrect. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @param rowBytes size of pixel row or larger + @return offset within pixel array + + example: https://fiddle.skia.org/c/@ImageInfo_computeOffset + */ + size_t computeOffset(int x, int y, size_t rowBytes) const; + + /** Compares SkImageInfo with other, and returns true if width, height, SkColorType, + SkAlphaType, and SkColorSpace are equivalent. + + @param other SkImageInfo to compare + @return true if SkImageInfo equals other + */ + bool operator==(const SkImageInfo& other) const { + return fDimensions == other.fDimensions && fColorInfo == other.fColorInfo; + } + + /** Compares SkImageInfo with other, and returns true if width, height, SkColorType, + SkAlphaType, and SkColorSpace are not equivalent. + + @param other SkImageInfo to compare + @return true if SkImageInfo is not equal to other + */ + bool operator!=(const SkImageInfo& other) const { + return !(*this == other); + } + + /** Returns storage required by pixel array, given SkImageInfo dimensions, SkColorType, + and rowBytes. rowBytes is assumed to be at least as large as minRowBytes(). + + Returns zero if height is zero. + Returns SIZE_MAX if answer exceeds the range of size_t. + + @param rowBytes size of pixel row or larger + @return memory required by pixel buffer + + example: https://fiddle.skia.org/c/@ImageInfo_computeByteSize + */ + size_t computeByteSize(size_t rowBytes) const; + + /** Returns storage required by pixel array, given SkImageInfo dimensions, and + SkColorType. Uses minRowBytes() to compute bytes for pixel row. + + Returns zero if height is zero. + Returns SIZE_MAX if answer exceeds the range of size_t. + + @return least memory required by pixel buffer + */ + size_t computeMinByteSize() const { + return this->computeByteSize(this->minRowBytes()); + } + + /** Returns true if byteSize equals SIZE_MAX. computeByteSize() and + computeMinByteSize() return SIZE_MAX if size_t can not hold buffer size. + + @param byteSize result of computeByteSize() or computeMinByteSize() + @return true if computeByteSize() or computeMinByteSize() result exceeds size_t + */ + static bool ByteSizeOverflowed(size_t byteSize) { + return SIZE_MAX == byteSize; + } + + /** Returns true if rowBytes is valid for this SkImageInfo. + + @param rowBytes size of pixel row including padding + @return true if rowBytes is large enough to contain pixel row and is properly + aligned + */ + bool validRowBytes(size_t rowBytes) const { + if (rowBytes < this->minRowBytes64()) { + return false; + } + int shift = this->shiftPerPixel(); + size_t alignedRowBytes = rowBytes >> shift << shift; + return alignedRowBytes == rowBytes; + } + + /** Creates an empty SkImageInfo with kUnknown_SkColorType, kUnknown_SkAlphaType, + a width and height of zero, and no SkColorSpace. + */ + void reset() { *this = {}; } + + /** Asserts if internal values are illegal or inconsistent. Only available if + SK_DEBUG is defined at compile time. + */ + SkDEBUGCODE(void validate() const;) + +private: + SkColorInfo fColorInfo; + SkISize fDimensions = {0, 0}; + + SkImageInfo(SkISize dimensions, const SkColorInfo& colorInfo) + : fColorInfo(colorInfo), fDimensions(dimensions) {} + + SkImageInfo(SkISize dimensions, SkColorInfo&& colorInfo) + : fColorInfo(std::move(colorInfo)), fDimensions(dimensions) {} +}; + +#endif diff --git a/src/deps/skia/include/core/SkM44.h b/src/deps/skia/include/core/SkM44.h new file mode 100644 index 000000000..ae08b4400 --- /dev/null +++ b/src/deps/skia/include/core/SkM44.h @@ -0,0 +1,426 @@ +/* + * Copyright 2020 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkM44_DEFINED +#define SkM44_DEFINED + +#include "include/core/SkMatrix.h" +#include "include/core/SkRect.h" +#include "include/core/SkScalar.h" + +struct SK_API SkV2 { + float x, y; + + bool operator==(const SkV2 v) const { return x == v.x && y == v.y; } + bool operator!=(const SkV2 v) const { return !(*this == v); } + + static SkScalar Dot(SkV2 a, SkV2 b) { return a.x * b.x + a.y * b.y; } + static SkScalar Cross(SkV2 a, SkV2 b) { return a.x * b.y - a.y * b.x; } + static SkV2 Normalize(SkV2 v) { return v * (1.0f / v.length()); } + + SkV2 operator-() const { return {-x, -y}; } + SkV2 operator+(SkV2 v) const { return {x+v.x, y+v.y}; } + SkV2 operator-(SkV2 v) const { return {x-v.x, y-v.y}; } + + SkV2 operator*(SkV2 v) const { return {x*v.x, y*v.y}; } + friend SkV2 operator*(SkV2 v, SkScalar s) { return {v.x*s, v.y*s}; } + friend SkV2 operator*(SkScalar s, SkV2 v) { return {v.x*s, v.y*s}; } + friend SkV2 operator/(SkV2 v, SkScalar s) { return {v.x/s, v.y/s}; } + + void operator+=(SkV2 v) { *this = *this + v; } + void operator-=(SkV2 v) { *this = *this - v; } + void operator*=(SkV2 v) { *this = *this * v; } + void operator*=(SkScalar s) { *this = *this * s; } + void operator/=(SkScalar s) { *this = *this / s; } + + SkScalar lengthSquared() const { return Dot(*this, *this); } + SkScalar length() const { return SkScalarSqrt(this->lengthSquared()); } + + SkScalar dot(SkV2 v) const { return Dot(*this, v); } + SkScalar cross(SkV2 v) const { return Cross(*this, v); } + SkV2 normalize() const { return Normalize(*this); } + + const float* ptr() const { return &x; } + float* ptr() { return &x; } +}; + +struct SK_API SkV3 { + float x, y, z; + + bool operator==(const SkV3& v) const { + return x == v.x && y == v.y && z == v.z; + } + bool operator!=(const SkV3& v) const { return !(*this == v); } + + static SkScalar Dot(const SkV3& a, const SkV3& b) { return a.x*b.x + a.y*b.y + a.z*b.z; } + static SkV3 Cross(const SkV3& a, const SkV3& b) { + return { a.y*b.z - a.z*b.y, a.z*b.x - a.x*b.z, a.x*b.y - a.y*b.x }; + } + static SkV3 Normalize(const SkV3& v) { return v * (1.0f / v.length()); } + + SkV3 operator-() const { return {-x, -y, -z}; } + SkV3 operator+(const SkV3& v) const { return { x + v.x, y + v.y, z + v.z }; } + SkV3 operator-(const SkV3& v) const { return { x - v.x, y - v.y, z - v.z }; } + + SkV3 operator*(const SkV3& v) const { + return { x*v.x, y*v.y, z*v.z }; + } + friend SkV3 operator*(const SkV3& v, SkScalar s) { + return { v.x*s, v.y*s, v.z*s }; + } + friend SkV3 operator*(SkScalar s, const SkV3& v) { return v*s; } + + void operator+=(SkV3 v) { *this = *this + v; } + void operator-=(SkV3 v) { *this = *this - v; } + void operator*=(SkV3 v) { *this = *this * v; } + void operator*=(SkScalar s) { *this = *this * s; } + + SkScalar lengthSquared() const { return Dot(*this, *this); } + SkScalar length() const { return SkScalarSqrt(Dot(*this, *this)); } + + SkScalar dot(const SkV3& v) const { return Dot(*this, v); } + SkV3 cross(const SkV3& v) const { return Cross(*this, v); } + SkV3 normalize() const { return Normalize(*this); } + + const float* ptr() const { return &x; } + float* ptr() { return &x; } +}; + +struct SK_API SkV4 { + float x, y, z, w; + + bool operator==(const SkV4& v) const { + return x == v.x && y == v.y && z == v.z && w == v.w; + } + bool operator!=(const SkV4& v) const { return !(*this == v); } + + SkV4 operator-() const { return {-x, -y, -z, -w}; } + SkV4 operator+(const SkV4& v) const { return { x + v.x, y + v.y, z + v.z, w + v.w }; } + SkV4 operator-(const SkV4& v) const { return { x - v.x, y - v.y, z - v.z, w - v.w }; } + + SkV4 operator*(const SkV4& v) const { + return { x*v.x, y*v.y, z*v.z, w*v.w }; + } + friend SkV4 operator*(const SkV4& v, SkScalar s) { + return { v.x*s, v.y*s, v.z*s, v.w*s }; + } + friend SkV4 operator*(SkScalar s, const SkV4& v) { return v*s; } + + const float* ptr() const { return &x; } + float* ptr() { return &x; } + + float operator[](int i) const { + SkASSERT(i >= 0 && i < 4); + return this->ptr()[i]; + } + float& operator[](int i) { + SkASSERT(i >= 0 && i < 4); + return this->ptr()[i]; + } +}; + +/** + * 4x4 matrix used by SkCanvas and other parts of Skia. + * + * Skia assumes a right-handed coordinate system: + * +X goes to the right + * +Y goes down + * +Z goes into the screen (away from the viewer) + */ +class SK_API SkM44 { +public: + SkM44(const SkM44& src) = default; + SkM44& operator=(const SkM44& src) = default; + + constexpr SkM44() + : fMat{1, 0, 0, 0, + 0, 1, 0, 0, + 0, 0, 1, 0, + 0, 0, 0, 1} + {} + + SkM44(const SkM44& a, const SkM44& b) { + this->setConcat(a, b); + } + + enum Uninitialized_Constructor { + kUninitialized_Constructor + }; + SkM44(Uninitialized_Constructor) {} + + enum NaN_Constructor { + kNaN_Constructor + }; + constexpr SkM44(NaN_Constructor) + : fMat{SK_ScalarNaN, SK_ScalarNaN, SK_ScalarNaN, SK_ScalarNaN, + SK_ScalarNaN, SK_ScalarNaN, SK_ScalarNaN, SK_ScalarNaN, + SK_ScalarNaN, SK_ScalarNaN, SK_ScalarNaN, SK_ScalarNaN, + SK_ScalarNaN, SK_ScalarNaN, SK_ScalarNaN, SK_ScalarNaN} + {} + + /** + * The constructor parameters are in row-major order. + */ + constexpr SkM44(SkScalar m0, SkScalar m4, SkScalar m8, SkScalar m12, + SkScalar m1, SkScalar m5, SkScalar m9, SkScalar m13, + SkScalar m2, SkScalar m6, SkScalar m10, SkScalar m14, + SkScalar m3, SkScalar m7, SkScalar m11, SkScalar m15) + // fMat is column-major order in memory. + : fMat{m0, m1, m2, m3, + m4, m5, m6, m7, + m8, m9, m10, m11, + m12, m13, m14, m15} + {} + + static SkM44 Rows(const SkV4& r0, const SkV4& r1, const SkV4& r2, const SkV4& r3) { + SkM44 m(kUninitialized_Constructor); + m.setRow(0, r0); + m.setRow(1, r1); + m.setRow(2, r2); + m.setRow(3, r3); + return m; + } + static SkM44 Cols(const SkV4& c0, const SkV4& c1, const SkV4& c2, const SkV4& c3) { + SkM44 m(kUninitialized_Constructor); + m.setCol(0, c0); + m.setCol(1, c1); + m.setCol(2, c2); + m.setCol(3, c3); + return m; + } + + static SkM44 RowMajor(const SkScalar r[16]) { + return SkM44(r[ 0], r[ 1], r[ 2], r[ 3], + r[ 4], r[ 5], r[ 6], r[ 7], + r[ 8], r[ 9], r[10], r[11], + r[12], r[13], r[14], r[15]); + } + static SkM44 ColMajor(const SkScalar c[16]) { + return SkM44(c[0], c[4], c[ 8], c[12], + c[1], c[5], c[ 9], c[13], + c[2], c[6], c[10], c[14], + c[3], c[7], c[11], c[15]); + } + + static SkM44 Translate(SkScalar x, SkScalar y, SkScalar z = 0) { + return SkM44(1, 0, 0, x, + 0, 1, 0, y, + 0, 0, 1, z, + 0, 0, 0, 1); + } + + static SkM44 Scale(SkScalar x, SkScalar y, SkScalar z = 1) { + return SkM44(x, 0, 0, 0, + 0, y, 0, 0, + 0, 0, z, 0, + 0, 0, 0, 1); + } + + static SkM44 Rotate(SkV3 axis, SkScalar radians) { + SkM44 m(kUninitialized_Constructor); + m.setRotate(axis, radians); + return m; + } + + // Scales and translates 'src' to fill 'dst' exactly. + static SkM44 RectToRect(const SkRect& src, const SkRect& dst); + + static SkM44 LookAt(const SkV3& eye, const SkV3& center, const SkV3& up); + static SkM44 Perspective(float near, float far, float angle); + + bool operator==(const SkM44& other) const; + bool operator!=(const SkM44& other) const { + return !(other == *this); + } + + void getColMajor(SkScalar v[]) const { + memcpy(v, fMat, sizeof(fMat)); + } + void getRowMajor(SkScalar v[]) const; + + SkScalar rc(int r, int c) const { + SkASSERT(r >= 0 && r <= 3); + SkASSERT(c >= 0 && c <= 3); + return fMat[c*4 + r]; + } + void setRC(int r, int c, SkScalar value) { + SkASSERT(r >= 0 && r <= 3); + SkASSERT(c >= 0 && c <= 3); + fMat[c*4 + r] = value; + } + + SkV4 row(int i) const { + SkASSERT(i >= 0 && i <= 3); + return {fMat[i + 0], fMat[i + 4], fMat[i + 8], fMat[i + 12]}; + } + SkV4 col(int i) const { + SkASSERT(i >= 0 && i <= 3); + return {fMat[i*4 + 0], fMat[i*4 + 1], fMat[i*4 + 2], fMat[i*4 + 3]}; + } + + void setRow(int i, const SkV4& v) { + SkASSERT(i >= 0 && i <= 3); + fMat[i + 0] = v.x; + fMat[i + 4] = v.y; + fMat[i + 8] = v.z; + fMat[i + 12] = v.w; + } + void setCol(int i, const SkV4& v) { + SkASSERT(i >= 0 && i <= 3); + memcpy(&fMat[i*4], v.ptr(), sizeof(v)); + } + + SkM44& setIdentity() { + *this = { 1, 0, 0, 0, + 0, 1, 0, 0, + 0, 0, 1, 0, + 0, 0, 0, 1 }; + return *this; + } + + SkM44& setTranslate(SkScalar x, SkScalar y, SkScalar z = 0) { + *this = { 1, 0, 0, x, + 0, 1, 0, y, + 0, 0, 1, z, + 0, 0, 0, 1 }; + return *this; + } + + SkM44& setScale(SkScalar x, SkScalar y, SkScalar z = 1) { + *this = { x, 0, 0, 0, + 0, y, 0, 0, + 0, 0, z, 0, + 0, 0, 0, 1 }; + return *this; + } + + /** + * Set this matrix to rotate about the specified unit-length axis vector, + * by an angle specified by its sin() and cos(). + * + * This does not attempt to verify that axis.length() == 1 or that the sin,cos values + * are correct. + */ + SkM44& setRotateUnitSinCos(SkV3 axis, SkScalar sinAngle, SkScalar cosAngle); + + /** + * Set this matrix to rotate about the specified unit-length axis vector, + * by an angle specified in radians. + * + * This does not attempt to verify that axis.length() == 1. + */ + SkM44& setRotateUnit(SkV3 axis, SkScalar radians) { + return this->setRotateUnitSinCos(axis, SkScalarSin(radians), SkScalarCos(radians)); + } + + /** + * Set this matrix to rotate about the specified axis vector, + * by an angle specified in radians. + * + * Note: axis is not assumed to be unit-length, so it will be normalized internally. + * If axis is already unit-length, call setRotateAboutUnitRadians() instead. + */ + SkM44& setRotate(SkV3 axis, SkScalar radians); + + SkM44& setConcat(const SkM44& a, const SkM44& b); + + friend SkM44 operator*(const SkM44& a, const SkM44& b) { + return SkM44(a, b); + } + + SkM44& preConcat(const SkM44& m) { + return this->setConcat(*this, m); + } + + SkM44& postConcat(const SkM44& m) { + return this->setConcat(m, *this); + } + + /** + * A matrix is categorized as 'perspective' if the bottom row is not [0, 0, 0, 1]. + * For most uses, a bottom row of [0, 0, 0, X] behaves like a non-perspective matrix, though + * it will be categorized as perspective. Calling normalizePerspective() will change the + * matrix such that, if its bottom row was [0, 0, 0, X], it will be changed to [0, 0, 0, 1] + * by scaling the rest of the matrix by 1/X. + * + * | A B C D | | A/X B/X C/X D/X | + * | E F G H | -> | E/X F/X G/X H/X | for X != 0 + * | I J K L | | I/X J/X K/X L/X | + * | 0 0 0 X | | 0 0 0 1 | + */ + void normalizePerspective(); + + /** Returns true if all elements of the matrix are finite. Returns false if any + element is infinity, or NaN. + + @return true if matrix has only finite elements + */ + bool isFinite() const { return SkScalarsAreFinite(fMat, 16); } + + /** If this is invertible, return that in inverse and return true. If it is + * not invertible, return false and leave the inverse parameter unchanged. + */ + bool SK_WARN_UNUSED_RESULT invert(SkM44* inverse) const; + + SkM44 SK_WARN_UNUSED_RESULT transpose() const; + + void dump() const; + + //////////// + + SkV4 map(float x, float y, float z, float w) const; + SkV4 operator*(const SkV4& v) const { + return this->map(v.x, v.y, v.z, v.w); + } + SkV3 operator*(SkV3 v) const { + auto v4 = this->map(v.x, v.y, v.z, 0); + return {v4.x, v4.y, v4.z}; + } + ////////////////////// Converting to/from SkMatrix + + /* When converting from SkM44 to SkMatrix, the third row and + * column is dropped. When converting from SkMatrix to SkM44 + * the third row and column remain as identity: + * [ a b c ] [ a b 0 c ] + * [ d e f ] -> [ d e 0 f ] + * [ g h i ] [ 0 0 1 0 ] + * [ g h 0 i ] + */ + SkMatrix asM33() const { + return SkMatrix::MakeAll(fMat[0], fMat[4], fMat[12], + fMat[1], fMat[5], fMat[13], + fMat[3], fMat[7], fMat[15]); + } + + explicit SkM44(const SkMatrix& src) + : SkM44(src[SkMatrix::kMScaleX], src[SkMatrix::kMSkewX], 0, src[SkMatrix::kMTransX], + src[SkMatrix::kMSkewY], src[SkMatrix::kMScaleY], 0, src[SkMatrix::kMTransY], + 0, 0, 1, 0, + src[SkMatrix::kMPersp0], src[SkMatrix::kMPersp1], 0, src[SkMatrix::kMPersp2]) + {} + + SkM44& preTranslate(SkScalar x, SkScalar y, SkScalar z = 0); + SkM44& postTranslate(SkScalar x, SkScalar y, SkScalar z = 0); + + SkM44& preScale(SkScalar x, SkScalar y); + SkM44& preScale(SkScalar x, SkScalar y, SkScalar z); + SkM44& preConcat(const SkMatrix&); + +private: + /* Stored in column-major. + * Indices + * 0 4 8 12 1 0 0 trans_x + * 1 5 9 13 e.g. 0 1 0 trans_y + * 2 6 10 14 0 0 1 trans_z + * 3 7 11 15 0 0 0 1 + */ + SkScalar fMat[16]; + + friend class SkMatrixPriv; +}; + +#endif diff --git a/src/deps/skia/include/core/SkMallocPixelRef.h b/src/deps/skia/include/core/SkMallocPixelRef.h new file mode 100644 index 000000000..cce54b50f --- /dev/null +++ b/src/deps/skia/include/core/SkMallocPixelRef.h @@ -0,0 +1,42 @@ +/* + * Copyright 2008 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkMallocPixelRef_DEFINED +#define SkMallocPixelRef_DEFINED + +#include "include/core/SkPixelRef.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkTypes.h" +class SkData; +struct SkImageInfo; + +/** We explicitly use the same allocator for our pixels that SkMask does, + so that we can freely assign memory allocated by one class to the other. +*/ +namespace SkMallocPixelRef { + /** + * Return a new SkMallocPixelRef, automatically allocating storage for the + * pixels. If rowBytes are 0, an optimal value will be chosen automatically. + * If rowBytes is > 0, then it will be respected, or NULL will be returned + * if rowBytes is invalid for the specified info. + * + * All pixel bytes are zeroed. + * + * Returns NULL on failure. + */ + SK_API sk_sp<SkPixelRef> MakeAllocate(const SkImageInfo&, size_t rowBytes); + + /** + * Return a new SkMallocPixelRef that will use the provided SkData and + * rowBytes as pixel storage. The SkData will be ref()ed and on + * destruction of the PixelRef, the SkData will be unref()ed. + * + * Returns NULL on failure. + */ + SK_API sk_sp<SkPixelRef> MakeWithData(const SkImageInfo&, size_t rowBytes, sk_sp<SkData> data); +} // namespace SkMallocPixelRef +#endif diff --git a/src/deps/skia/include/core/SkMaskFilter.h b/src/deps/skia/include/core/SkMaskFilter.h new file mode 100644 index 000000000..3fde51b71 --- /dev/null +++ b/src/deps/skia/include/core/SkMaskFilter.h @@ -0,0 +1,50 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkMaskFilter_DEFINED +#define SkMaskFilter_DEFINED + +#include "include/core/SkBlurTypes.h" +#include "include/core/SkCoverageMode.h" +#include "include/core/SkFlattenable.h" +#include "include/core/SkScalar.h" + +class SkMatrix; +struct SkRect; + +/** \class SkMaskFilter + + SkMaskFilter is the base class for object that perform transformations on + the mask before drawing it. An example subclass is Blur. +*/ +class SK_API SkMaskFilter : public SkFlattenable { +public: + /** Create a blur maskfilter. + * @param style The SkBlurStyle to use + * @param sigma Standard deviation of the Gaussian blur to apply. Must be > 0. + * @param respectCTM if true the blur's sigma is modified by the CTM. + * @return The new blur maskfilter + */ + static sk_sp<SkMaskFilter> MakeBlur(SkBlurStyle style, SkScalar sigma, + bool respectCTM = true); + + /** + * Returns the approximate bounds that would result from filtering the src rect. + * The actual result may be different, but it should be contained within the + * returned bounds. + */ + SkRect approximateFilteredBounds(const SkRect& src) const; + + static sk_sp<SkMaskFilter> Deserialize(const void* data, size_t size, + const SkDeserialProcs* procs = nullptr); + +private: + static void RegisterFlattenables(); + friend class SkFlattenable; +}; + +#endif diff --git a/src/deps/skia/include/core/SkMath.h b/src/deps/skia/include/core/SkMath.h new file mode 100644 index 000000000..97352afab --- /dev/null +++ b/src/deps/skia/include/core/SkMath.h @@ -0,0 +1,54 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkMath_DEFINED +#define SkMath_DEFINED + +#include "include/core/SkTypes.h" + +// 64bit -> 32bit utilities + +// Handy util that can be passed two ints, and will automatically promote to +// 64bits before the multiply, so the caller doesn't have to remember to cast +// e.g. (int64_t)a * b; +static inline int64_t sk_64_mul(int64_t a, int64_t b) { + return a * b; +} + +/////////////////////////////////////////////////////////////////////////////// + +/** + * Returns true if value is a power of 2. Does not explicitly check for + * value <= 0. + */ +template <typename T> constexpr inline bool SkIsPow2(T value) { + return (value & (value - 1)) == 0; +} + +/////////////////////////////////////////////////////////////////////////////// + +/** + * Return a*b/((1 << shift) - 1), rounding any fractional bits. + * Only valid if a and b are unsigned and <= 32767 and shift is > 0 and <= 8 + */ +static inline unsigned SkMul16ShiftRound(U16CPU a, U16CPU b, int shift) { + SkASSERT(a <= 32767); + SkASSERT(b <= 32767); + SkASSERT(shift > 0 && shift <= 8); + unsigned prod = a*b + (1 << (shift - 1)); + return (prod + (prod >> shift)) >> shift; +} + +/** + * Return a*b/255, rounding any fractional bits. + * Only valid if a and b are unsigned and <= 32767. + */ +static inline U8CPU SkMulDiv255Round(U16CPU a, U16CPU b) { + return SkMul16ShiftRound(a,b,8); +} + +#endif diff --git a/src/deps/skia/include/core/SkMatrix.h b/src/deps/skia/include/core/SkMatrix.h new file mode 100644 index 000000000..03140760d --- /dev/null +++ b/src/deps/skia/include/core/SkMatrix.h @@ -0,0 +1,1986 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkMatrix_DEFINED +#define SkMatrix_DEFINED + +#include "include/core/SkRect.h" +#include "include/private/SkMacros.h" +#include "include/private/SkTo.h" + +struct SkRSXform; +struct SkPoint3; + +// Remove when clients are updated to live without this +#define SK_SUPPORT_LEGACY_MATRIX_RECTTORECT + +/** + * When we transform points through a matrix containing perspective (the bottom row is something + * other than 0,0,1), the bruteforce math can produce confusing results (since we might divide + * by 0, or a negative w value). By default, methods that map rects and paths will apply + * perspective clipping, but this can be changed by specifying kYes to those methods. + */ +enum class SkApplyPerspectiveClip { + kNo, //!< Don't pre-clip the geometry before applying the (perspective) matrix + kYes, //!< Do pre-clip the geometry before applying the (perspective) matrix +}; + +/** \class SkMatrix + SkMatrix holds a 3x3 matrix for transforming coordinates. This allows mapping + SkPoint and vectors with translation, scaling, skewing, rotation, and + perspective. + + SkMatrix elements are in row major order. + SkMatrix constexpr default constructs to identity. + + SkMatrix includes a hidden variable that classifies the type of matrix to + improve performance. SkMatrix is not thread safe unless getType() is called first. + + example: https://fiddle.skia.org/c/@Matrix_063 +*/ +SK_BEGIN_REQUIRE_DENSE +class SK_API SkMatrix { +public: + + /** Creates an identity SkMatrix: + + | 1 0 0 | + | 0 1 0 | + | 0 0 1 | + */ + constexpr SkMatrix() : SkMatrix(1,0,0, 0,1,0, 0,0,1, kIdentity_Mask | kRectStaysRect_Mask) {} + + /** Sets SkMatrix to scale by (sx, sy). Returned matrix is: + + | sx 0 0 | + | 0 sy 0 | + | 0 0 1 | + + @param sx horizontal scale factor + @param sy vertical scale factor + @return SkMatrix with scale + */ + static SkMatrix SK_WARN_UNUSED_RESULT Scale(SkScalar sx, SkScalar sy) { + SkMatrix m; + m.setScale(sx, sy); + return m; + } + + /** Sets SkMatrix to translate by (dx, dy). Returned matrix is: + + | 1 0 dx | + | 0 1 dy | + | 0 0 1 | + + @param dx horizontal translation + @param dy vertical translation + @return SkMatrix with translation + */ + static SkMatrix SK_WARN_UNUSED_RESULT Translate(SkScalar dx, SkScalar dy) { + SkMatrix m; + m.setTranslate(dx, dy); + return m; + } + static SkMatrix SK_WARN_UNUSED_RESULT Translate(SkVector t) { return Translate(t.x(), t.y()); } + static SkMatrix SK_WARN_UNUSED_RESULT Translate(SkIVector t) { return Translate(t.x(), t.y()); } + + /** Sets SkMatrix to rotate by |deg| about a pivot point at (0, 0). + + @param deg rotation angle in degrees (positive rotates clockwise) + @return SkMatrix with rotation + */ + static SkMatrix SK_WARN_UNUSED_RESULT RotateDeg(SkScalar deg) { + SkMatrix m; + m.setRotate(deg); + return m; + } + static SkMatrix SK_WARN_UNUSED_RESULT RotateDeg(SkScalar deg, SkPoint pt) { + SkMatrix m; + m.setRotate(deg, pt.x(), pt.y()); + return m; + } + static SkMatrix SK_WARN_UNUSED_RESULT RotateRad(SkScalar rad) { + return RotateDeg(SkRadiansToDegrees(rad)); + } + + /** Sets SkMatrix to skew by (kx, ky) about pivot point (0, 0). + + @param kx horizontal skew factor + @param ky vertical skew factor + @return SkMatrix with skew + */ + static SkMatrix SK_WARN_UNUSED_RESULT Skew(SkScalar kx, SkScalar ky) { + SkMatrix m; + m.setSkew(kx, ky); + return m; + } + + /** \enum SkMatrix::ScaleToFit + ScaleToFit describes how SkMatrix is constructed to map one SkRect to another. + ScaleToFit may allow SkMatrix to have unequal horizontal and vertical scaling, + or may restrict SkMatrix to square scaling. If restricted, ScaleToFit specifies + how SkMatrix maps to the side or center of the destination SkRect. + */ + enum ScaleToFit { + kFill_ScaleToFit, //!< scales in x and y to fill destination SkRect + kStart_ScaleToFit, //!< scales and aligns to left and top + kCenter_ScaleToFit, //!< scales and aligns to center + kEnd_ScaleToFit, //!< scales and aligns to right and bottom + }; + + /** Returns SkMatrix set to scale and translate src to dst. ScaleToFit selects + whether mapping completely fills dst or preserves the aspect ratio, and how to + align src within dst. Returns the identity SkMatrix if src is empty. If dst is + empty, returns SkMatrix set to: + + | 0 0 0 | + | 0 0 0 | + | 0 0 1 | + + @param src SkRect to map from + @param dst SkRect to map to + @param mode How to handle the mapping + @return SkMatrix mapping src to dst + */ + static SkMatrix SK_WARN_UNUSED_RESULT RectToRect(const SkRect& src, const SkRect& dst, + ScaleToFit mode = kFill_ScaleToFit) { + return MakeRectToRect(src, dst, mode); + } + + /** Sets SkMatrix to: + + | scaleX skewX transX | + | skewY scaleY transY | + | pers0 pers1 pers2 | + + @param scaleX horizontal scale factor + @param skewX horizontal skew factor + @param transX horizontal translation + @param skewY vertical skew factor + @param scaleY vertical scale factor + @param transY vertical translation + @param pers0 input x-axis perspective factor + @param pers1 input y-axis perspective factor + @param pers2 perspective scale factor + @return SkMatrix constructed from parameters + */ + static SkMatrix SK_WARN_UNUSED_RESULT MakeAll(SkScalar scaleX, SkScalar skewX, SkScalar transX, + SkScalar skewY, SkScalar scaleY, SkScalar transY, + SkScalar pers0, SkScalar pers1, SkScalar pers2) { + SkMatrix m; + m.setAll(scaleX, skewX, transX, skewY, scaleY, transY, pers0, pers1, pers2); + return m; + } + + /** \enum SkMatrix::TypeMask + Enum of bit fields for mask returned by getType(). + Used to identify the complexity of SkMatrix, to optimize performance. + */ + enum TypeMask { + kIdentity_Mask = 0, //!< identity SkMatrix; all bits clear + kTranslate_Mask = 0x01, //!< translation SkMatrix + kScale_Mask = 0x02, //!< scale SkMatrix + kAffine_Mask = 0x04, //!< skew or rotate SkMatrix + kPerspective_Mask = 0x08, //!< perspective SkMatrix + }; + + /** Returns a bit field describing the transformations the matrix may + perform. The bit field is computed conservatively, so it may include + false positives. For example, when kPerspective_Mask is set, all + other bits are set. + + @return kIdentity_Mask, or combinations of: kTranslate_Mask, kScale_Mask, + kAffine_Mask, kPerspective_Mask + */ + TypeMask getType() const { + if (fTypeMask & kUnknown_Mask) { + fTypeMask = this->computeTypeMask(); + } + // only return the public masks + return (TypeMask)(fTypeMask & 0xF); + } + + /** Returns true if SkMatrix is identity. Identity matrix is: + + | 1 0 0 | + | 0 1 0 | + | 0 0 1 | + + @return true if SkMatrix has no effect + */ + bool isIdentity() const { + return this->getType() == 0; + } + + /** Returns true if SkMatrix at most scales and translates. SkMatrix may be identity, + contain only scale elements, only translate elements, or both. SkMatrix form is: + + | scale-x 0 translate-x | + | 0 scale-y translate-y | + | 0 0 1 | + + @return true if SkMatrix is identity; or scales, translates, or both + */ + bool isScaleTranslate() const { + return !(this->getType() & ~(kScale_Mask | kTranslate_Mask)); + } + + /** Returns true if SkMatrix is identity, or translates. SkMatrix form is: + + | 1 0 translate-x | + | 0 1 translate-y | + | 0 0 1 | + + @return true if SkMatrix is identity, or translates + */ + bool isTranslate() const { return !(this->getType() & ~(kTranslate_Mask)); } + + /** Returns true SkMatrix maps SkRect to another SkRect. If true, SkMatrix is identity, + or scales, or rotates a multiple of 90 degrees, or mirrors on axes. In all + cases, SkMatrix may also have translation. SkMatrix form is either: + + | scale-x 0 translate-x | + | 0 scale-y translate-y | + | 0 0 1 | + + or + + | 0 rotate-x translate-x | + | rotate-y 0 translate-y | + | 0 0 1 | + + for non-zero values of scale-x, scale-y, rotate-x, and rotate-y. + + Also called preservesAxisAlignment(); use the one that provides better inline + documentation. + + @return true if SkMatrix maps one SkRect into another + */ + bool rectStaysRect() const { + if (fTypeMask & kUnknown_Mask) { + fTypeMask = this->computeTypeMask(); + } + return (fTypeMask & kRectStaysRect_Mask) != 0; + } + + /** Returns true SkMatrix maps SkRect to another SkRect. If true, SkMatrix is identity, + or scales, or rotates a multiple of 90 degrees, or mirrors on axes. In all + cases, SkMatrix may also have translation. SkMatrix form is either: + + | scale-x 0 translate-x | + | 0 scale-y translate-y | + | 0 0 1 | + + or + + | 0 rotate-x translate-x | + | rotate-y 0 translate-y | + | 0 0 1 | + + for non-zero values of scale-x, scale-y, rotate-x, and rotate-y. + + Also called rectStaysRect(); use the one that provides better inline + documentation. + + @return true if SkMatrix maps one SkRect into another + */ + bool preservesAxisAlignment() const { return this->rectStaysRect(); } + + /** Returns true if the matrix contains perspective elements. SkMatrix form is: + + | -- -- -- | + | -- -- -- | + | perspective-x perspective-y perspective-scale | + + where perspective-x or perspective-y is non-zero, or perspective-scale is + not one. All other elements may have any value. + + @return true if SkMatrix is in most general form + */ + bool hasPerspective() const { + return SkToBool(this->getPerspectiveTypeMaskOnly() & + kPerspective_Mask); + } + + /** Returns true if SkMatrix contains only translation, rotation, reflection, and + uniform scale. + Returns false if SkMatrix contains different scales, skewing, perspective, or + degenerate forms that collapse to a line or point. + + Describes that the SkMatrix makes rendering with and without the matrix are + visually alike; a transformed circle remains a circle. Mathematically, this is + referred to as similarity of a Euclidean space, or a similarity transformation. + + Preserves right angles, keeping the arms of the angle equal lengths. + + @param tol to be deprecated + @return true if SkMatrix only rotates, uniformly scales, translates + + example: https://fiddle.skia.org/c/@Matrix_isSimilarity + */ + bool isSimilarity(SkScalar tol = SK_ScalarNearlyZero) const; + + /** Returns true if SkMatrix contains only translation, rotation, reflection, and + scale. Scale may differ along rotated axes. + Returns false if SkMatrix skewing, perspective, or degenerate forms that collapse + to a line or point. + + Preserves right angles, but not requiring that the arms of the angle + retain equal lengths. + + @param tol to be deprecated + @return true if SkMatrix only rotates, scales, translates + + example: https://fiddle.skia.org/c/@Matrix_preservesRightAngles + */ + bool preservesRightAngles(SkScalar tol = SK_ScalarNearlyZero) const; + + /** SkMatrix organizes its values in row-major order. These members correspond to + each value in SkMatrix. + */ + static constexpr int kMScaleX = 0; //!< horizontal scale factor + static constexpr int kMSkewX = 1; //!< horizontal skew factor + static constexpr int kMTransX = 2; //!< horizontal translation + static constexpr int kMSkewY = 3; //!< vertical skew factor + static constexpr int kMScaleY = 4; //!< vertical scale factor + static constexpr int kMTransY = 5; //!< vertical translation + static constexpr int kMPersp0 = 6; //!< input x perspective factor + static constexpr int kMPersp1 = 7; //!< input y perspective factor + static constexpr int kMPersp2 = 8; //!< perspective bias + + /** Affine arrays are in column-major order to match the matrix used by + PDF and XPS. + */ + static constexpr int kAScaleX = 0; //!< horizontal scale factor + static constexpr int kASkewY = 1; //!< vertical skew factor + static constexpr int kASkewX = 2; //!< horizontal skew factor + static constexpr int kAScaleY = 3; //!< vertical scale factor + static constexpr int kATransX = 4; //!< horizontal translation + static constexpr int kATransY = 5; //!< vertical translation + + /** Returns one matrix value. Asserts if index is out of range and SK_DEBUG is + defined. + + @param index one of: kMScaleX, kMSkewX, kMTransX, kMSkewY, kMScaleY, kMTransY, + kMPersp0, kMPersp1, kMPersp2 + @return value corresponding to index + */ + SkScalar operator[](int index) const { + SkASSERT((unsigned)index < 9); + return fMat[index]; + } + + /** Returns one matrix value. Asserts if index is out of range and SK_DEBUG is + defined. + + @param index one of: kMScaleX, kMSkewX, kMTransX, kMSkewY, kMScaleY, kMTransY, + kMPersp0, kMPersp1, kMPersp2 + @return value corresponding to index + */ + SkScalar get(int index) const { + SkASSERT((unsigned)index < 9); + return fMat[index]; + } + + /** Returns one matrix value from a particular row/column. Asserts if index is out + of range and SK_DEBUG is defined. + + @param r matrix row to fetch + @param c matrix column to fetch + @return value at the given matrix position + */ + SkScalar rc(int r, int c) const { + SkASSERT(r >= 0 && r <= 2); + SkASSERT(c >= 0 && c <= 2); + return fMat[r*3 + c]; + } + + /** Returns scale factor multiplied by x-axis input, contributing to x-axis output. + With mapPoints(), scales SkPoint along the x-axis. + + @return horizontal scale factor + */ + SkScalar getScaleX() const { return fMat[kMScaleX]; } + + /** Returns scale factor multiplied by y-axis input, contributing to y-axis output. + With mapPoints(), scales SkPoint along the y-axis. + + @return vertical scale factor + */ + SkScalar getScaleY() const { return fMat[kMScaleY]; } + + /** Returns scale factor multiplied by x-axis input, contributing to y-axis output. + With mapPoints(), skews SkPoint along the y-axis. + Skewing both axes can rotate SkPoint. + + @return vertical skew factor + */ + SkScalar getSkewY() const { return fMat[kMSkewY]; } + + /** Returns scale factor multiplied by y-axis input, contributing to x-axis output. + With mapPoints(), skews SkPoint along the x-axis. + Skewing both axes can rotate SkPoint. + + @return horizontal scale factor + */ + SkScalar getSkewX() const { return fMat[kMSkewX]; } + + /** Returns translation contributing to x-axis output. + With mapPoints(), moves SkPoint along the x-axis. + + @return horizontal translation factor + */ + SkScalar getTranslateX() const { return fMat[kMTransX]; } + + /** Returns translation contributing to y-axis output. + With mapPoints(), moves SkPoint along the y-axis. + + @return vertical translation factor + */ + SkScalar getTranslateY() const { return fMat[kMTransY]; } + + /** Returns factor scaling input x-axis relative to input y-axis. + + @return input x-axis perspective factor + */ + SkScalar getPerspX() const { return fMat[kMPersp0]; } + + /** Returns factor scaling input y-axis relative to input x-axis. + + @return input y-axis perspective factor + */ + SkScalar getPerspY() const { return fMat[kMPersp1]; } + + /** Returns writable SkMatrix value. Asserts if index is out of range and SK_DEBUG is + defined. Clears internal cache anticipating that caller will change SkMatrix value. + + Next call to read SkMatrix state may recompute cache; subsequent writes to SkMatrix + value must be followed by dirtyMatrixTypeCache(). + + @param index one of: kMScaleX, kMSkewX, kMTransX, kMSkewY, kMScaleY, kMTransY, + kMPersp0, kMPersp1, kMPersp2 + @return writable value corresponding to index + */ + SkScalar& operator[](int index) { + SkASSERT((unsigned)index < 9); + this->setTypeMask(kUnknown_Mask); + return fMat[index]; + } + + /** Sets SkMatrix value. Asserts if index is out of range and SK_DEBUG is + defined. Safer than operator[]; internal cache is always maintained. + + @param index one of: kMScaleX, kMSkewX, kMTransX, kMSkewY, kMScaleY, kMTransY, + kMPersp0, kMPersp1, kMPersp2 + @param value scalar to store in SkMatrix + */ + SkMatrix& set(int index, SkScalar value) { + SkASSERT((unsigned)index < 9); + fMat[index] = value; + this->setTypeMask(kUnknown_Mask); + return *this; + } + + /** Sets horizontal scale factor. + + @param v horizontal scale factor to store + */ + SkMatrix& setScaleX(SkScalar v) { return this->set(kMScaleX, v); } + + /** Sets vertical scale factor. + + @param v vertical scale factor to store + */ + SkMatrix& setScaleY(SkScalar v) { return this->set(kMScaleY, v); } + + /** Sets vertical skew factor. + + @param v vertical skew factor to store + */ + SkMatrix& setSkewY(SkScalar v) { return this->set(kMSkewY, v); } + + /** Sets horizontal skew factor. + + @param v horizontal skew factor to store + */ + SkMatrix& setSkewX(SkScalar v) { return this->set(kMSkewX, v); } + + /** Sets horizontal translation. + + @param v horizontal translation to store + */ + SkMatrix& setTranslateX(SkScalar v) { return this->set(kMTransX, v); } + + /** Sets vertical translation. + + @param v vertical translation to store + */ + SkMatrix& setTranslateY(SkScalar v) { return this->set(kMTransY, v); } + + /** Sets input x-axis perspective factor, which causes mapXY() to vary input x-axis values + inversely proportional to input y-axis values. + + @param v perspective factor + */ + SkMatrix& setPerspX(SkScalar v) { return this->set(kMPersp0, v); } + + /** Sets input y-axis perspective factor, which causes mapXY() to vary input y-axis values + inversely proportional to input x-axis values. + + @param v perspective factor + */ + SkMatrix& setPerspY(SkScalar v) { return this->set(kMPersp1, v); } + + /** Sets all values from parameters. Sets matrix to: + + | scaleX skewX transX | + | skewY scaleY transY | + | persp0 persp1 persp2 | + + @param scaleX horizontal scale factor to store + @param skewX horizontal skew factor to store + @param transX horizontal translation to store + @param skewY vertical skew factor to store + @param scaleY vertical scale factor to store + @param transY vertical translation to store + @param persp0 input x-axis values perspective factor to store + @param persp1 input y-axis values perspective factor to store + @param persp2 perspective scale factor to store + */ + SkMatrix& setAll(SkScalar scaleX, SkScalar skewX, SkScalar transX, + SkScalar skewY, SkScalar scaleY, SkScalar transY, + SkScalar persp0, SkScalar persp1, SkScalar persp2) { + fMat[kMScaleX] = scaleX; + fMat[kMSkewX] = skewX; + fMat[kMTransX] = transX; + fMat[kMSkewY] = skewY; + fMat[kMScaleY] = scaleY; + fMat[kMTransY] = transY; + fMat[kMPersp0] = persp0; + fMat[kMPersp1] = persp1; + fMat[kMPersp2] = persp2; + this->setTypeMask(kUnknown_Mask); + return *this; + } + + /** Copies nine scalar values contained by SkMatrix into buffer, in member value + ascending order: kMScaleX, kMSkewX, kMTransX, kMSkewY, kMScaleY, kMTransY, + kMPersp0, kMPersp1, kMPersp2. + + @param buffer storage for nine scalar values + */ + void get9(SkScalar buffer[9]) const { + memcpy(buffer, fMat, 9 * sizeof(SkScalar)); + } + + /** Sets SkMatrix to nine scalar values in buffer, in member value ascending order: + kMScaleX, kMSkewX, kMTransX, kMSkewY, kMScaleY, kMTransY, kMPersp0, kMPersp1, + kMPersp2. + + Sets matrix to: + + | buffer[0] buffer[1] buffer[2] | + | buffer[3] buffer[4] buffer[5] | + | buffer[6] buffer[7] buffer[8] | + + In the future, set9 followed by get9 may not return the same values. Since SkMatrix + maps non-homogeneous coordinates, scaling all nine values produces an equivalent + transformation, possibly improving precision. + + @param buffer nine scalar values + */ + SkMatrix& set9(const SkScalar buffer[9]); + + /** Sets SkMatrix to identity; which has no effect on mapped SkPoint. Sets SkMatrix to: + + | 1 0 0 | + | 0 1 0 | + | 0 0 1 | + + Also called setIdentity(); use the one that provides better inline + documentation. + */ + SkMatrix& reset(); + + /** Sets SkMatrix to identity; which has no effect on mapped SkPoint. Sets SkMatrix to: + + | 1 0 0 | + | 0 1 0 | + | 0 0 1 | + + Also called reset(); use the one that provides better inline + documentation. + */ + SkMatrix& setIdentity() { return this->reset(); } + + /** Sets SkMatrix to translate by (dx, dy). + + @param dx horizontal translation + @param dy vertical translation + */ + SkMatrix& setTranslate(SkScalar dx, SkScalar dy); + + /** Sets SkMatrix to translate by (v.fX, v.fY). + + @param v vector containing horizontal and vertical translation + */ + SkMatrix& setTranslate(const SkVector& v) { return this->setTranslate(v.fX, v.fY); } + + /** Sets SkMatrix to scale by sx and sy, about a pivot point at (px, py). + The pivot point is unchanged when mapped with SkMatrix. + + @param sx horizontal scale factor + @param sy vertical scale factor + @param px pivot on x-axis + @param py pivot on y-axis + */ + SkMatrix& setScale(SkScalar sx, SkScalar sy, SkScalar px, SkScalar py); + + /** Sets SkMatrix to scale by sx and sy about at pivot point at (0, 0). + + @param sx horizontal scale factor + @param sy vertical scale factor + */ + SkMatrix& setScale(SkScalar sx, SkScalar sy); + + /** Sets SkMatrix to rotate by degrees about a pivot point at (px, py). + The pivot point is unchanged when mapped with SkMatrix. + + Positive degrees rotates clockwise. + + @param degrees angle of axes relative to upright axes + @param px pivot on x-axis + @param py pivot on y-axis + */ + SkMatrix& setRotate(SkScalar degrees, SkScalar px, SkScalar py); + + /** Sets SkMatrix to rotate by degrees about a pivot point at (0, 0). + Positive degrees rotates clockwise. + + @param degrees angle of axes relative to upright axes + */ + SkMatrix& setRotate(SkScalar degrees); + + /** Sets SkMatrix to rotate by sinValue and cosValue, about a pivot point at (px, py). + The pivot point is unchanged when mapped with SkMatrix. + + Vector (sinValue, cosValue) describes the angle of rotation relative to (0, 1). + Vector length specifies scale. + + @param sinValue rotation vector x-axis component + @param cosValue rotation vector y-axis component + @param px pivot on x-axis + @param py pivot on y-axis + */ + SkMatrix& setSinCos(SkScalar sinValue, SkScalar cosValue, + SkScalar px, SkScalar py); + + /** Sets SkMatrix to rotate by sinValue and cosValue, about a pivot point at (0, 0). + + Vector (sinValue, cosValue) describes the angle of rotation relative to (0, 1). + Vector length specifies scale. + + @param sinValue rotation vector x-axis component + @param cosValue rotation vector y-axis component + */ + SkMatrix& setSinCos(SkScalar sinValue, SkScalar cosValue); + + /** Sets SkMatrix to rotate, scale, and translate using a compressed matrix form. + + Vector (rsxForm.fSSin, rsxForm.fSCos) describes the angle of rotation relative + to (0, 1). Vector length specifies scale. Mapped point is rotated and scaled + by vector, then translated by (rsxForm.fTx, rsxForm.fTy). + + @param rsxForm compressed SkRSXform matrix + @return reference to SkMatrix + + example: https://fiddle.skia.org/c/@Matrix_setRSXform + */ + SkMatrix& setRSXform(const SkRSXform& rsxForm); + + /** Sets SkMatrix to skew by kx and ky, about a pivot point at (px, py). + The pivot point is unchanged when mapped with SkMatrix. + + @param kx horizontal skew factor + @param ky vertical skew factor + @param px pivot on x-axis + @param py pivot on y-axis + */ + SkMatrix& setSkew(SkScalar kx, SkScalar ky, SkScalar px, SkScalar py); + + /** Sets SkMatrix to skew by kx and ky, about a pivot point at (0, 0). + + @param kx horizontal skew factor + @param ky vertical skew factor + */ + SkMatrix& setSkew(SkScalar kx, SkScalar ky); + + /** Sets SkMatrix to SkMatrix a multiplied by SkMatrix b. Either a or b may be this. + + Given: + + | A B C | | J K L | + a = | D E F |, b = | M N O | + | G H I | | P Q R | + + sets SkMatrix to: + + | A B C | | J K L | | AJ+BM+CP AK+BN+CQ AL+BO+CR | + a * b = | D E F | * | M N O | = | DJ+EM+FP DK+EN+FQ DL+EO+FR | + | G H I | | P Q R | | GJ+HM+IP GK+HN+IQ GL+HO+IR | + + @param a SkMatrix on left side of multiply expression + @param b SkMatrix on right side of multiply expression + */ + SkMatrix& setConcat(const SkMatrix& a, const SkMatrix& b); + + /** Sets SkMatrix to SkMatrix multiplied by SkMatrix constructed from translation (dx, dy). + This can be thought of as moving the point to be mapped before applying SkMatrix. + + Given: + + | A B C | | 1 0 dx | + Matrix = | D E F |, T(dx, dy) = | 0 1 dy | + | G H I | | 0 0 1 | + + sets SkMatrix to: + + | A B C | | 1 0 dx | | A B A*dx+B*dy+C | + Matrix * T(dx, dy) = | D E F | | 0 1 dy | = | D E D*dx+E*dy+F | + | G H I | | 0 0 1 | | G H G*dx+H*dy+I | + + @param dx x-axis translation before applying SkMatrix + @param dy y-axis translation before applying SkMatrix + */ + SkMatrix& preTranslate(SkScalar dx, SkScalar dy); + + /** Sets SkMatrix to SkMatrix multiplied by SkMatrix constructed from scaling by (sx, sy) + about pivot point (px, py). + This can be thought of as scaling about a pivot point before applying SkMatrix. + + Given: + + | A B C | | sx 0 dx | + Matrix = | D E F |, S(sx, sy, px, py) = | 0 sy dy | + | G H I | | 0 0 1 | + + where + + dx = px - sx * px + dy = py - sy * py + + sets SkMatrix to: + + | A B C | | sx 0 dx | | A*sx B*sy A*dx+B*dy+C | + Matrix * S(sx, sy, px, py) = | D E F | | 0 sy dy | = | D*sx E*sy D*dx+E*dy+F | + | G H I | | 0 0 1 | | G*sx H*sy G*dx+H*dy+I | + + @param sx horizontal scale factor + @param sy vertical scale factor + @param px pivot on x-axis + @param py pivot on y-axis + */ + SkMatrix& preScale(SkScalar sx, SkScalar sy, SkScalar px, SkScalar py); + + /** Sets SkMatrix to SkMatrix multiplied by SkMatrix constructed from scaling by (sx, sy) + about pivot point (0, 0). + This can be thought of as scaling about the origin before applying SkMatrix. + + Given: + + | A B C | | sx 0 0 | + Matrix = | D E F |, S(sx, sy) = | 0 sy 0 | + | G H I | | 0 0 1 | + + sets SkMatrix to: + + | A B C | | sx 0 0 | | A*sx B*sy C | + Matrix * S(sx, sy) = | D E F | | 0 sy 0 | = | D*sx E*sy F | + | G H I | | 0 0 1 | | G*sx H*sy I | + + @param sx horizontal scale factor + @param sy vertical scale factor + */ + SkMatrix& preScale(SkScalar sx, SkScalar sy); + + /** Sets SkMatrix to SkMatrix multiplied by SkMatrix constructed from rotating by degrees + about pivot point (px, py). + This can be thought of as rotating about a pivot point before applying SkMatrix. + + Positive degrees rotates clockwise. + + Given: + + | A B C | | c -s dx | + Matrix = | D E F |, R(degrees, px, py) = | s c dy | + | G H I | | 0 0 1 | + + where + + c = cos(degrees) + s = sin(degrees) + dx = s * py + (1 - c) * px + dy = -s * px + (1 - c) * py + + sets SkMatrix to: + + | A B C | | c -s dx | | Ac+Bs -As+Bc A*dx+B*dy+C | + Matrix * R(degrees, px, py) = | D E F | | s c dy | = | Dc+Es -Ds+Ec D*dx+E*dy+F | + | G H I | | 0 0 1 | | Gc+Hs -Gs+Hc G*dx+H*dy+I | + + @param degrees angle of axes relative to upright axes + @param px pivot on x-axis + @param py pivot on y-axis + */ + SkMatrix& preRotate(SkScalar degrees, SkScalar px, SkScalar py); + + /** Sets SkMatrix to SkMatrix multiplied by SkMatrix constructed from rotating by degrees + about pivot point (0, 0). + This can be thought of as rotating about the origin before applying SkMatrix. + + Positive degrees rotates clockwise. + + Given: + + | A B C | | c -s 0 | + Matrix = | D E F |, R(degrees, px, py) = | s c 0 | + | G H I | | 0 0 1 | + + where + + c = cos(degrees) + s = sin(degrees) + + sets SkMatrix to: + + | A B C | | c -s 0 | | Ac+Bs -As+Bc C | + Matrix * R(degrees, px, py) = | D E F | | s c 0 | = | Dc+Es -Ds+Ec F | + | G H I | | 0 0 1 | | Gc+Hs -Gs+Hc I | + + @param degrees angle of axes relative to upright axes + */ + SkMatrix& preRotate(SkScalar degrees); + + /** Sets SkMatrix to SkMatrix multiplied by SkMatrix constructed from skewing by (kx, ky) + about pivot point (px, py). + This can be thought of as skewing about a pivot point before applying SkMatrix. + + Given: + + | A B C | | 1 kx dx | + Matrix = | D E F |, K(kx, ky, px, py) = | ky 1 dy | + | G H I | | 0 0 1 | + + where + + dx = -kx * py + dy = -ky * px + + sets SkMatrix to: + + | A B C | | 1 kx dx | | A+B*ky A*kx+B A*dx+B*dy+C | + Matrix * K(kx, ky, px, py) = | D E F | | ky 1 dy | = | D+E*ky D*kx+E D*dx+E*dy+F | + | G H I | | 0 0 1 | | G+H*ky G*kx+H G*dx+H*dy+I | + + @param kx horizontal skew factor + @param ky vertical skew factor + @param px pivot on x-axis + @param py pivot on y-axis + */ + SkMatrix& preSkew(SkScalar kx, SkScalar ky, SkScalar px, SkScalar py); + + /** Sets SkMatrix to SkMatrix multiplied by SkMatrix constructed from skewing by (kx, ky) + about pivot point (0, 0). + This can be thought of as skewing about the origin before applying SkMatrix. + + Given: + + | A B C | | 1 kx 0 | + Matrix = | D E F |, K(kx, ky) = | ky 1 0 | + | G H I | | 0 0 1 | + + sets SkMatrix to: + + | A B C | | 1 kx 0 | | A+B*ky A*kx+B C | + Matrix * K(kx, ky) = | D E F | | ky 1 0 | = | D+E*ky D*kx+E F | + | G H I | | 0 0 1 | | G+H*ky G*kx+H I | + + @param kx horizontal skew factor + @param ky vertical skew factor + */ + SkMatrix& preSkew(SkScalar kx, SkScalar ky); + + /** Sets SkMatrix to SkMatrix multiplied by SkMatrix other. + This can be thought of mapping by other before applying SkMatrix. + + Given: + + | A B C | | J K L | + Matrix = | D E F |, other = | M N O | + | G H I | | P Q R | + + sets SkMatrix to: + + | A B C | | J K L | | AJ+BM+CP AK+BN+CQ AL+BO+CR | + Matrix * other = | D E F | * | M N O | = | DJ+EM+FP DK+EN+FQ DL+EO+FR | + | G H I | | P Q R | | GJ+HM+IP GK+HN+IQ GL+HO+IR | + + @param other SkMatrix on right side of multiply expression + */ + SkMatrix& preConcat(const SkMatrix& other); + + /** Sets SkMatrix to SkMatrix constructed from translation (dx, dy) multiplied by SkMatrix. + This can be thought of as moving the point to be mapped after applying SkMatrix. + + Given: + + | J K L | | 1 0 dx | + Matrix = | M N O |, T(dx, dy) = | 0 1 dy | + | P Q R | | 0 0 1 | + + sets SkMatrix to: + + | 1 0 dx | | J K L | | J+dx*P K+dx*Q L+dx*R | + T(dx, dy) * Matrix = | 0 1 dy | | M N O | = | M+dy*P N+dy*Q O+dy*R | + | 0 0 1 | | P Q R | | P Q R | + + @param dx x-axis translation after applying SkMatrix + @param dy y-axis translation after applying SkMatrix + */ + SkMatrix& postTranslate(SkScalar dx, SkScalar dy); + + /** Sets SkMatrix to SkMatrix constructed from scaling by (sx, sy) about pivot point + (px, py), multiplied by SkMatrix. + This can be thought of as scaling about a pivot point after applying SkMatrix. + + Given: + + | J K L | | sx 0 dx | + Matrix = | M N O |, S(sx, sy, px, py) = | 0 sy dy | + | P Q R | | 0 0 1 | + + where + + dx = px - sx * px + dy = py - sy * py + + sets SkMatrix to: + + | sx 0 dx | | J K L | | sx*J+dx*P sx*K+dx*Q sx*L+dx+R | + S(sx, sy, px, py) * Matrix = | 0 sy dy | | M N O | = | sy*M+dy*P sy*N+dy*Q sy*O+dy*R | + | 0 0 1 | | P Q R | | P Q R | + + @param sx horizontal scale factor + @param sy vertical scale factor + @param px pivot on x-axis + @param py pivot on y-axis + */ + SkMatrix& postScale(SkScalar sx, SkScalar sy, SkScalar px, SkScalar py); + + /** Sets SkMatrix to SkMatrix constructed from scaling by (sx, sy) about pivot point + (0, 0), multiplied by SkMatrix. + This can be thought of as scaling about the origin after applying SkMatrix. + + Given: + + | J K L | | sx 0 0 | + Matrix = | M N O |, S(sx, sy) = | 0 sy 0 | + | P Q R | | 0 0 1 | + + sets SkMatrix to: + + | sx 0 0 | | J K L | | sx*J sx*K sx*L | + S(sx, sy) * Matrix = | 0 sy 0 | | M N O | = | sy*M sy*N sy*O | + | 0 0 1 | | P Q R | | P Q R | + + @param sx horizontal scale factor + @param sy vertical scale factor + */ + SkMatrix& postScale(SkScalar sx, SkScalar sy); + + /** Sets SkMatrix to SkMatrix constructed from rotating by degrees about pivot point + (px, py), multiplied by SkMatrix. + This can be thought of as rotating about a pivot point after applying SkMatrix. + + Positive degrees rotates clockwise. + + Given: + + | J K L | | c -s dx | + Matrix = | M N O |, R(degrees, px, py) = | s c dy | + | P Q R | | 0 0 1 | + + where + + c = cos(degrees) + s = sin(degrees) + dx = s * py + (1 - c) * px + dy = -s * px + (1 - c) * py + + sets SkMatrix to: + + |c -s dx| |J K L| |cJ-sM+dx*P cK-sN+dx*Q cL-sO+dx+R| + R(degrees, px, py) * Matrix = |s c dy| |M N O| = |sJ+cM+dy*P sK+cN+dy*Q sL+cO+dy*R| + |0 0 1| |P Q R| | P Q R| + + @param degrees angle of axes relative to upright axes + @param px pivot on x-axis + @param py pivot on y-axis + */ + SkMatrix& postRotate(SkScalar degrees, SkScalar px, SkScalar py); + + /** Sets SkMatrix to SkMatrix constructed from rotating by degrees about pivot point + (0, 0), multiplied by SkMatrix. + This can be thought of as rotating about the origin after applying SkMatrix. + + Positive degrees rotates clockwise. + + Given: + + | J K L | | c -s 0 | + Matrix = | M N O |, R(degrees, px, py) = | s c 0 | + | P Q R | | 0 0 1 | + + where + + c = cos(degrees) + s = sin(degrees) + + sets SkMatrix to: + + | c -s dx | | J K L | | cJ-sM cK-sN cL-sO | + R(degrees, px, py) * Matrix = | s c dy | | M N O | = | sJ+cM sK+cN sL+cO | + | 0 0 1 | | P Q R | | P Q R | + + @param degrees angle of axes relative to upright axes + */ + SkMatrix& postRotate(SkScalar degrees); + + /** Sets SkMatrix to SkMatrix constructed from skewing by (kx, ky) about pivot point + (px, py), multiplied by SkMatrix. + This can be thought of as skewing about a pivot point after applying SkMatrix. + + Given: + + | J K L | | 1 kx dx | + Matrix = | M N O |, K(kx, ky, px, py) = | ky 1 dy | + | P Q R | | 0 0 1 | + + where + + dx = -kx * py + dy = -ky * px + + sets SkMatrix to: + + | 1 kx dx| |J K L| |J+kx*M+dx*P K+kx*N+dx*Q L+kx*O+dx+R| + K(kx, ky, px, py) * Matrix = |ky 1 dy| |M N O| = |ky*J+M+dy*P ky*K+N+dy*Q ky*L+O+dy*R| + | 0 0 1| |P Q R| | P Q R| + + @param kx horizontal skew factor + @param ky vertical skew factor + @param px pivot on x-axis + @param py pivot on y-axis + */ + SkMatrix& postSkew(SkScalar kx, SkScalar ky, SkScalar px, SkScalar py); + + /** Sets SkMatrix to SkMatrix constructed from skewing by (kx, ky) about pivot point + (0, 0), multiplied by SkMatrix. + This can be thought of as skewing about the origin after applying SkMatrix. + + Given: + + | J K L | | 1 kx 0 | + Matrix = | M N O |, K(kx, ky) = | ky 1 0 | + | P Q R | | 0 0 1 | + + sets SkMatrix to: + + | 1 kx 0 | | J K L | | J+kx*M K+kx*N L+kx*O | + K(kx, ky) * Matrix = | ky 1 0 | | M N O | = | ky*J+M ky*K+N ky*L+O | + | 0 0 1 | | P Q R | | P Q R | + + @param kx horizontal skew factor + @param ky vertical skew factor + */ + SkMatrix& postSkew(SkScalar kx, SkScalar ky); + + /** Sets SkMatrix to SkMatrix other multiplied by SkMatrix. + This can be thought of mapping by other after applying SkMatrix. + + Given: + + | J K L | | A B C | + Matrix = | M N O |, other = | D E F | + | P Q R | | G H I | + + sets SkMatrix to: + + | A B C | | J K L | | AJ+BM+CP AK+BN+CQ AL+BO+CR | + other * Matrix = | D E F | * | M N O | = | DJ+EM+FP DK+EN+FQ DL+EO+FR | + | G H I | | P Q R | | GJ+HM+IP GK+HN+IQ GL+HO+IR | + + @param other SkMatrix on left side of multiply expression + */ + SkMatrix& postConcat(const SkMatrix& other); + +#ifndef SK_SUPPORT_LEGACY_MATRIX_RECTTORECT +private: +#endif + /** Sets SkMatrix to scale and translate src SkRect to dst SkRect. stf selects whether + mapping completely fills dst or preserves the aspect ratio, and how to align + src within dst. Returns false if src is empty, and sets SkMatrix to identity. + Returns true if dst is empty, and sets SkMatrix to: + + | 0 0 0 | + | 0 0 0 | + | 0 0 1 | + + @param src SkRect to map from + @param dst SkRect to map to + @return true if SkMatrix can represent SkRect mapping + + example: https://fiddle.skia.org/c/@Matrix_setRectToRect + */ + bool setRectToRect(const SkRect& src, const SkRect& dst, ScaleToFit stf); + + /** Returns SkMatrix set to scale and translate src SkRect to dst SkRect. stf selects + whether mapping completely fills dst or preserves the aspect ratio, and how to + align src within dst. Returns the identity SkMatrix if src is empty. If dst is + empty, returns SkMatrix set to: + + | 0 0 0 | + | 0 0 0 | + | 0 0 1 | + + @param src SkRect to map from + @param dst SkRect to map to + @return SkMatrix mapping src to dst + */ + static SkMatrix MakeRectToRect(const SkRect& src, const SkRect& dst, ScaleToFit stf) { + SkMatrix m; + m.setRectToRect(src, dst, stf); + return m; + } +#ifndef SK_SUPPORT_LEGACY_MATRIX_RECTTORECT +public: +#endif + + /** Sets SkMatrix to map src to dst. count must be zero or greater, and four or less. + + If count is zero, sets SkMatrix to identity and returns true. + If count is one, sets SkMatrix to translate and returns true. + If count is two or more, sets SkMatrix to map SkPoint if possible; returns false + if SkMatrix cannot be constructed. If count is four, SkMatrix may include + perspective. + + @param src SkPoint to map from + @param dst SkPoint to map to + @param count number of SkPoint in src and dst + @return true if SkMatrix was constructed successfully + + example: https://fiddle.skia.org/c/@Matrix_setPolyToPoly + */ + bool setPolyToPoly(const SkPoint src[], const SkPoint dst[], int count); + + /** Sets inverse to reciprocal matrix, returning true if SkMatrix can be inverted. + Geometrically, if SkMatrix maps from source to destination, inverse SkMatrix + maps from destination to source. If SkMatrix can not be inverted, inverse is + unchanged. + + @param inverse storage for inverted SkMatrix; may be nullptr + @return true if SkMatrix can be inverted + */ + bool SK_WARN_UNUSED_RESULT invert(SkMatrix* inverse) const { + // Allow the trivial case to be inlined. + if (this->isIdentity()) { + if (inverse) { + inverse->reset(); + } + return true; + } + return this->invertNonIdentity(inverse); + } + + /** Fills affine with identity values in column major order. + Sets affine to: + + | 1 0 0 | + | 0 1 0 | + + Affine 3 by 2 matrices in column major order are used by OpenGL and XPS. + + @param affine storage for 3 by 2 affine matrix + + example: https://fiddle.skia.org/c/@Matrix_SetAffineIdentity + */ + static void SetAffineIdentity(SkScalar affine[6]); + + /** Fills affine in column major order. Sets affine to: + + | scale-x skew-x translate-x | + | skew-y scale-y translate-y | + + If SkMatrix contains perspective, returns false and leaves affine unchanged. + + @param affine storage for 3 by 2 affine matrix; may be nullptr + @return true if SkMatrix does not contain perspective + */ + bool SK_WARN_UNUSED_RESULT asAffine(SkScalar affine[6]) const; + + /** Sets SkMatrix to affine values, passed in column major order. Given affine, + column, then row, as: + + | scale-x skew-x translate-x | + | skew-y scale-y translate-y | + + SkMatrix is set, row, then column, to: + + | scale-x skew-x translate-x | + | skew-y scale-y translate-y | + | 0 0 1 | + + @param affine 3 by 2 affine matrix + */ + SkMatrix& setAffine(const SkScalar affine[6]); + + /** + * A matrix is categorized as 'perspective' if the bottom row is not [0, 0, 1]. + * However, for most uses (e.g. mapPoints) a bottom row of [0, 0, X] behaves like a + * non-perspective matrix, though it will be categorized as perspective. Calling + * normalizePerspective() will change the matrix such that, if its bottom row was [0, 0, X], + * it will be changed to [0, 0, 1] by scaling the rest of the matrix by 1/X. + * + * | A B C | | A/X B/X C/X | + * | D E F | -> | D/X E/X F/X | for X != 0 + * | 0 0 X | | 0 0 1 | + */ + void normalizePerspective() { + if (fMat[8] != 1) { + this->doNormalizePerspective(); + } + } + + /** Maps src SkPoint array of length count to dst SkPoint array of equal or greater + length. SkPoint are mapped by multiplying each SkPoint by SkMatrix. Given: + + | A B C | | x | + Matrix = | D E F |, pt = | y | + | G H I | | 1 | + + where + + for (i = 0; i < count; ++i) { + x = src[i].fX + y = src[i].fY + } + + each dst SkPoint is computed as: + + |A B C| |x| Ax+By+C Dx+Ey+F + Matrix * pt = |D E F| |y| = |Ax+By+C Dx+Ey+F Gx+Hy+I| = ------- , ------- + |G H I| |1| Gx+Hy+I Gx+Hy+I + + src and dst may point to the same storage. + + @param dst storage for mapped SkPoint + @param src SkPoint to transform + @param count number of SkPoint to transform + + example: https://fiddle.skia.org/c/@Matrix_mapPoints + */ + void mapPoints(SkPoint dst[], const SkPoint src[], int count) const; + + /** Maps pts SkPoint array of length count in place. SkPoint are mapped by multiplying + each SkPoint by SkMatrix. Given: + + | A B C | | x | + Matrix = | D E F |, pt = | y | + | G H I | | 1 | + + where + + for (i = 0; i < count; ++i) { + x = pts[i].fX + y = pts[i].fY + } + + each resulting pts SkPoint is computed as: + + |A B C| |x| Ax+By+C Dx+Ey+F + Matrix * pt = |D E F| |y| = |Ax+By+C Dx+Ey+F Gx+Hy+I| = ------- , ------- + |G H I| |1| Gx+Hy+I Gx+Hy+I + + @param pts storage for mapped SkPoint + @param count number of SkPoint to transform + */ + void mapPoints(SkPoint pts[], int count) const { + this->mapPoints(pts, pts, count); + } + + /** Maps src SkPoint3 array of length count to dst SkPoint3 array, which must of length count or + greater. SkPoint3 array is mapped by multiplying each SkPoint3 by SkMatrix. Given: + + | A B C | | x | + Matrix = | D E F |, src = | y | + | G H I | | z | + + each resulting dst SkPoint is computed as: + + |A B C| |x| + Matrix * src = |D E F| |y| = |Ax+By+Cz Dx+Ey+Fz Gx+Hy+Iz| + |G H I| |z| + + @param dst storage for mapped SkPoint3 array + @param src SkPoint3 array to transform + @param count items in SkPoint3 array to transform + + example: https://fiddle.skia.org/c/@Matrix_mapHomogeneousPoints + */ + void mapHomogeneousPoints(SkPoint3 dst[], const SkPoint3 src[], int count) const; + + /** + * Returns homogeneous points, starting with 2D src points (with implied w = 1). + */ + void mapHomogeneousPoints(SkPoint3 dst[], const SkPoint src[], int count) const; + + /** Returns SkPoint pt multiplied by SkMatrix. Given: + + | A B C | | x | + Matrix = | D E F |, pt = | y | + | G H I | | 1 | + + result is computed as: + + |A B C| |x| Ax+By+C Dx+Ey+F + Matrix * pt = |D E F| |y| = |Ax+By+C Dx+Ey+F Gx+Hy+I| = ------- , ------- + |G H I| |1| Gx+Hy+I Gx+Hy+I + + @param p SkPoint to map + @return mapped SkPoint + */ + SkPoint mapPoint(SkPoint pt) const { + SkPoint result; + this->mapXY(pt.x(), pt.y(), &result); + return result; + } + + /** Maps SkPoint (x, y) to result. SkPoint is mapped by multiplying by SkMatrix. Given: + + | A B C | | x | + Matrix = | D E F |, pt = | y | + | G H I | | 1 | + + result is computed as: + + |A B C| |x| Ax+By+C Dx+Ey+F + Matrix * pt = |D E F| |y| = |Ax+By+C Dx+Ey+F Gx+Hy+I| = ------- , ------- + |G H I| |1| Gx+Hy+I Gx+Hy+I + + @param x x-axis value of SkPoint to map + @param y y-axis value of SkPoint to map + @param result storage for mapped SkPoint + + example: https://fiddle.skia.org/c/@Matrix_mapXY + */ + void mapXY(SkScalar x, SkScalar y, SkPoint* result) const; + + /** Returns SkPoint (x, y) multiplied by SkMatrix. Given: + + | A B C | | x | + Matrix = | D E F |, pt = | y | + | G H I | | 1 | + + result is computed as: + + |A B C| |x| Ax+By+C Dx+Ey+F + Matrix * pt = |D E F| |y| = |Ax+By+C Dx+Ey+F Gx+Hy+I| = ------- , ------- + |G H I| |1| Gx+Hy+I Gx+Hy+I + + @param x x-axis value of SkPoint to map + @param y y-axis value of SkPoint to map + @return mapped SkPoint + */ + SkPoint mapXY(SkScalar x, SkScalar y) const { + SkPoint result; + this->mapXY(x,y, &result); + return result; + } + + + /** Returns (0, 0) multiplied by SkMatrix. Given: + + | A B C | | 0 | + Matrix = | D E F |, pt = | 0 | + | G H I | | 1 | + + result is computed as: + + |A B C| |0| C F + Matrix * pt = |D E F| |0| = |C F I| = - , - + |G H I| |1| I I + + @return mapped (0, 0) + */ + SkPoint mapOrigin() const { + SkScalar x = this->getTranslateX(), + y = this->getTranslateY(); + if (this->hasPerspective()) { + SkScalar w = fMat[kMPersp2]; + if (w) { w = 1 / w; } + x *= w; + y *= w; + } + return {x, y}; + } + + /** Maps src vector array of length count to vector SkPoint array of equal or greater + length. Vectors are mapped by multiplying each vector by SkMatrix, treating + SkMatrix translation as zero. Given: + + | A B 0 | | x | + Matrix = | D E 0 |, src = | y | + | G H I | | 1 | + + where + + for (i = 0; i < count; ++i) { + x = src[i].fX + y = src[i].fY + } + + each dst vector is computed as: + + |A B 0| |x| Ax+By Dx+Ey + Matrix * src = |D E 0| |y| = |Ax+By Dx+Ey Gx+Hy+I| = ------- , ------- + |G H I| |1| Gx+Hy+I Gx+Hy+I + + src and dst may point to the same storage. + + @param dst storage for mapped vectors + @param src vectors to transform + @param count number of vectors to transform + + example: https://fiddle.skia.org/c/@Matrix_mapVectors + */ + void mapVectors(SkVector dst[], const SkVector src[], int count) const; + + /** Maps vecs vector array of length count in place, multiplying each vector by + SkMatrix, treating SkMatrix translation as zero. Given: + + | A B 0 | | x | + Matrix = | D E 0 |, vec = | y | + | G H I | | 1 | + + where + + for (i = 0; i < count; ++i) { + x = vecs[i].fX + y = vecs[i].fY + } + + each result vector is computed as: + + |A B 0| |x| Ax+By Dx+Ey + Matrix * vec = |D E 0| |y| = |Ax+By Dx+Ey Gx+Hy+I| = ------- , ------- + |G H I| |1| Gx+Hy+I Gx+Hy+I + + @param vecs vectors to transform, and storage for mapped vectors + @param count number of vectors to transform + */ + void mapVectors(SkVector vecs[], int count) const { + this->mapVectors(vecs, vecs, count); + } + + /** Maps vector (dx, dy) to result. Vector is mapped by multiplying by SkMatrix, + treating SkMatrix translation as zero. Given: + + | A B 0 | | dx | + Matrix = | D E 0 |, vec = | dy | + | G H I | | 1 | + + each result vector is computed as: + + |A B 0| |dx| A*dx+B*dy D*dx+E*dy + Matrix * vec = |D E 0| |dy| = |A*dx+B*dy D*dx+E*dy G*dx+H*dy+I| = ----------- , ----------- + |G H I| | 1| G*dx+H*dy+I G*dx+*dHy+I + + @param dx x-axis value of vector to map + @param dy y-axis value of vector to map + @param result storage for mapped vector + */ + void mapVector(SkScalar dx, SkScalar dy, SkVector* result) const { + SkVector vec = { dx, dy }; + this->mapVectors(result, &vec, 1); + } + + /** Returns vector (dx, dy) multiplied by SkMatrix, treating SkMatrix translation as zero. + Given: + + | A B 0 | | dx | + Matrix = | D E 0 |, vec = | dy | + | G H I | | 1 | + + each result vector is computed as: + + |A B 0| |dx| A*dx+B*dy D*dx+E*dy + Matrix * vec = |D E 0| |dy| = |A*dx+B*dy D*dx+E*dy G*dx+H*dy+I| = ----------- , ----------- + |G H I| | 1| G*dx+H*dy+I G*dx+*dHy+I + + @param dx x-axis value of vector to map + @param dy y-axis value of vector to map + @return mapped vector + */ + SkVector mapVector(SkScalar dx, SkScalar dy) const { + SkVector vec = { dx, dy }; + this->mapVectors(&vec, &vec, 1); + return vec; + } + + /** Sets dst to bounds of src corners mapped by SkMatrix. + Returns true if mapped corners are dst corners. + + Returned value is the same as calling rectStaysRect(). + + @param dst storage for bounds of mapped SkPoint + @param src SkRect to map + @param pc whether to apply perspective clipping + @return true if dst is equivalent to mapped src + + example: https://fiddle.skia.org/c/@Matrix_mapRect + */ + bool mapRect(SkRect* dst, const SkRect& src, + SkApplyPerspectiveClip pc = SkApplyPerspectiveClip::kYes) const; + + /** Sets rect to bounds of rect corners mapped by SkMatrix. + Returns true if mapped corners are computed rect corners. + + Returned value is the same as calling rectStaysRect(). + + @param rect rectangle to map, and storage for bounds of mapped corners + @param pc whether to apply perspective clipping + @return true if result is equivalent to mapped rect + */ + bool mapRect(SkRect* rect, SkApplyPerspectiveClip pc = SkApplyPerspectiveClip::kYes) const { + return this->mapRect(rect, *rect, pc); + } + + /** Returns bounds of src corners mapped by SkMatrix. + + @param src rectangle to map + @return mapped bounds + */ + SkRect mapRect(const SkRect& src, + SkApplyPerspectiveClip pc = SkApplyPerspectiveClip::kYes) const { + SkRect dst; + (void)this->mapRect(&dst, src, pc); + return dst; + } + + /** Maps four corners of rect to dst. SkPoint are mapped by multiplying each + rect corner by SkMatrix. rect corner is processed in this order: + (rect.fLeft, rect.fTop), (rect.fRight, rect.fTop), (rect.fRight, rect.fBottom), + (rect.fLeft, rect.fBottom). + + rect may be empty: rect.fLeft may be greater than or equal to rect.fRight; + rect.fTop may be greater than or equal to rect.fBottom. + + Given: + + | A B C | | x | + Matrix = | D E F |, pt = | y | + | G H I | | 1 | + + where pt is initialized from each of (rect.fLeft, rect.fTop), + (rect.fRight, rect.fTop), (rect.fRight, rect.fBottom), (rect.fLeft, rect.fBottom), + each dst SkPoint is computed as: + + |A B C| |x| Ax+By+C Dx+Ey+F + Matrix * pt = |D E F| |y| = |Ax+By+C Dx+Ey+F Gx+Hy+I| = ------- , ------- + |G H I| |1| Gx+Hy+I Gx+Hy+I + + @param dst storage for mapped corner SkPoint + @param rect SkRect to map + + Note: this does not perform perspective clipping (as that might result in more than + 4 points, so results are suspect if the matrix contains perspective. + */ + void mapRectToQuad(SkPoint dst[4], const SkRect& rect) const { + // This could potentially be faster if we only transformed each x and y of the rect once. + rect.toQuad(dst); + this->mapPoints(dst, 4); + } + + /** Sets dst to bounds of src corners mapped by SkMatrix. If matrix contains + elements other than scale or translate: asserts if SK_DEBUG is defined; + otherwise, results are undefined. + + @param dst storage for bounds of mapped SkPoint + @param src SkRect to map + + example: https://fiddle.skia.org/c/@Matrix_mapRectScaleTranslate + */ + void mapRectScaleTranslate(SkRect* dst, const SkRect& src) const; + + /** Returns geometric mean radius of ellipse formed by constructing circle of + size radius, and mapping constructed circle with SkMatrix. The result squared is + equal to the major axis length times the minor axis length. + Result is not meaningful if SkMatrix contains perspective elements. + + @param radius circle size to map + @return average mapped radius + + example: https://fiddle.skia.org/c/@Matrix_mapRadius + */ + SkScalar mapRadius(SkScalar radius) const; + + /** Compares a and b; returns true if a and b are numerically equal. Returns true + even if sign of zero values are different. Returns false if either SkMatrix + contains NaN, even if the other SkMatrix also contains NaN. + + @param a SkMatrix to compare + @param b SkMatrix to compare + @return true if SkMatrix a and SkMatrix b are numerically equal + */ + friend SK_API bool operator==(const SkMatrix& a, const SkMatrix& b); + + /** Compares a and b; returns true if a and b are not numerically equal. Returns false + even if sign of zero values are different. Returns true if either SkMatrix + contains NaN, even if the other SkMatrix also contains NaN. + + @param a SkMatrix to compare + @param b SkMatrix to compare + @return true if SkMatrix a and SkMatrix b are numerically not equal + */ + friend SK_API bool operator!=(const SkMatrix& a, const SkMatrix& b) { + return !(a == b); + } + + /** Writes text representation of SkMatrix to standard output. Floating point values + are written with limited precision; it may not be possible to reconstruct + original SkMatrix from output. + + example: https://fiddle.skia.org/c/@Matrix_dump + */ + void dump() const; + + /** Returns the minimum scaling factor of SkMatrix by decomposing the scaling and + skewing elements. + Returns -1 if scale factor overflows or SkMatrix contains perspective. + + @return minimum scale factor + + example: https://fiddle.skia.org/c/@Matrix_getMinScale + */ + SkScalar getMinScale() const; + + /** Returns the maximum scaling factor of SkMatrix by decomposing the scaling and + skewing elements. + Returns -1 if scale factor overflows or SkMatrix contains perspective. + + @return maximum scale factor + + example: https://fiddle.skia.org/c/@Matrix_getMaxScale + */ + SkScalar getMaxScale() const; + + /** Sets scaleFactors[0] to the minimum scaling factor, and scaleFactors[1] to the + maximum scaling factor. Scaling factors are computed by decomposing + the SkMatrix scaling and skewing elements. + + Returns true if scaleFactors are found; otherwise, returns false and sets + scaleFactors to undefined values. + + @param scaleFactors storage for minimum and maximum scale factors + @return true if scale factors were computed correctly + */ + bool SK_WARN_UNUSED_RESULT getMinMaxScales(SkScalar scaleFactors[2]) const; + + /** Decomposes SkMatrix into scale components and whatever remains. Returns false if + SkMatrix could not be decomposed. + + Sets scale to portion of SkMatrix that scale axes. Sets remaining to SkMatrix + with scaling factored out. remaining may be passed as nullptr + to determine if SkMatrix can be decomposed without computing remainder. + + Returns true if scale components are found. scale and remaining are + unchanged if SkMatrix contains perspective; scale factors are not finite, or + are nearly zero. + + On success: Matrix = Remaining * scale. + + @param scale axes scaling factors; may be nullptr + @param remaining SkMatrix without scaling; may be nullptr + @return true if scale can be computed + + example: https://fiddle.skia.org/c/@Matrix_decomposeScale + */ + bool decomposeScale(SkSize* scale, SkMatrix* remaining = nullptr) const; + + /** Returns reference to const identity SkMatrix. Returned SkMatrix is set to: + + | 1 0 0 | + | 0 1 0 | + | 0 0 1 | + + @return const identity SkMatrix + + example: https://fiddle.skia.org/c/@Matrix_I + */ + static const SkMatrix& I(); + + /** Returns reference to a const SkMatrix with invalid values. Returned SkMatrix is set + to: + + | SK_ScalarMax SK_ScalarMax SK_ScalarMax | + | SK_ScalarMax SK_ScalarMax SK_ScalarMax | + | SK_ScalarMax SK_ScalarMax SK_ScalarMax | + + @return const invalid SkMatrix + + example: https://fiddle.skia.org/c/@Matrix_InvalidMatrix + */ + static const SkMatrix& InvalidMatrix(); + + /** Returns SkMatrix a multiplied by SkMatrix b. + + Given: + + | A B C | | J K L | + a = | D E F |, b = | M N O | + | G H I | | P Q R | + + sets SkMatrix to: + + | A B C | | J K L | | AJ+BM+CP AK+BN+CQ AL+BO+CR | + a * b = | D E F | * | M N O | = | DJ+EM+FP DK+EN+FQ DL+EO+FR | + | G H I | | P Q R | | GJ+HM+IP GK+HN+IQ GL+HO+IR | + + @param a SkMatrix on left side of multiply expression + @param b SkMatrix on right side of multiply expression + @return SkMatrix computed from a times b + */ + static SkMatrix Concat(const SkMatrix& a, const SkMatrix& b) { + SkMatrix result; + result.setConcat(a, b); + return result; + } + + friend SkMatrix operator*(const SkMatrix& a, const SkMatrix& b) { + return Concat(a, b); + } + + /** Sets internal cache to unknown state. Use to force update after repeated + modifications to SkMatrix element reference returned by operator[](int index). + */ + void dirtyMatrixTypeCache() { + this->setTypeMask(kUnknown_Mask); + } + + /** Initializes SkMatrix with scale and translate elements. + + | sx 0 tx | + | 0 sy ty | + | 0 0 1 | + + @param sx horizontal scale factor to store + @param sy vertical scale factor to store + @param tx horizontal translation to store + @param ty vertical translation to store + */ + void setScaleTranslate(SkScalar sx, SkScalar sy, SkScalar tx, SkScalar ty) { + fMat[kMScaleX] = sx; + fMat[kMSkewX] = 0; + fMat[kMTransX] = tx; + + fMat[kMSkewY] = 0; + fMat[kMScaleY] = sy; + fMat[kMTransY] = ty; + + fMat[kMPersp0] = 0; + fMat[kMPersp1] = 0; + fMat[kMPersp2] = 1; + + int mask = 0; + if (sx != 1 || sy != 1) { + mask |= kScale_Mask; + } + if (tx != 0.0f || ty != 0.0f) { + mask |= kTranslate_Mask; + } + this->setTypeMask(mask | kRectStaysRect_Mask); + } + + /** Returns true if all elements of the matrix are finite. Returns false if any + element is infinity, or NaN. + + @return true if matrix has only finite elements + */ + bool isFinite() const { return SkScalarsAreFinite(fMat, 9); } + +private: + /** Set if the matrix will map a rectangle to another rectangle. This + can be true if the matrix is scale-only, or rotates a multiple of + 90 degrees. + + This bit will be set on identity matrices + */ + static constexpr int kRectStaysRect_Mask = 0x10; + + /** Set if the perspective bit is valid even though the rest of + the matrix is Unknown. + */ + static constexpr int kOnlyPerspectiveValid_Mask = 0x40; + + static constexpr int kUnknown_Mask = 0x80; + + static constexpr int kORableMasks = kTranslate_Mask | + kScale_Mask | + kAffine_Mask | + kPerspective_Mask; + + static constexpr int kAllMasks = kTranslate_Mask | + kScale_Mask | + kAffine_Mask | + kPerspective_Mask | + kRectStaysRect_Mask; + + SkScalar fMat[9]; + mutable int32_t fTypeMask; + + constexpr SkMatrix(SkScalar sx, SkScalar kx, SkScalar tx, + SkScalar ky, SkScalar sy, SkScalar ty, + SkScalar p0, SkScalar p1, SkScalar p2, int typeMask) + : fMat{sx, kx, tx, + ky, sy, ty, + p0, p1, p2} + , fTypeMask(typeMask) {} + + static void ComputeInv(SkScalar dst[9], const SkScalar src[9], double invDet, bool isPersp); + + uint8_t computeTypeMask() const; + uint8_t computePerspectiveTypeMask() const; + + void setTypeMask(int mask) { + // allow kUnknown or a valid mask + SkASSERT(kUnknown_Mask == mask || (mask & kAllMasks) == mask || + ((kUnknown_Mask | kOnlyPerspectiveValid_Mask) & mask) + == (kUnknown_Mask | kOnlyPerspectiveValid_Mask)); + fTypeMask = mask; + } + + void orTypeMask(int mask) { + SkASSERT((mask & kORableMasks) == mask); + fTypeMask |= mask; + } + + void clearTypeMask(int mask) { + // only allow a valid mask + SkASSERT((mask & kAllMasks) == mask); + fTypeMask &= ~mask; + } + + TypeMask getPerspectiveTypeMaskOnly() const { + if ((fTypeMask & kUnknown_Mask) && + !(fTypeMask & kOnlyPerspectiveValid_Mask)) { + fTypeMask = this->computePerspectiveTypeMask(); + } + return (TypeMask)(fTypeMask & 0xF); + } + + /** Returns true if we already know that the matrix is identity; + false otherwise. + */ + bool isTriviallyIdentity() const { + if (fTypeMask & kUnknown_Mask) { + return false; + } + return ((fTypeMask & 0xF) == 0); + } + + inline void updateTranslateMask() { + if ((fMat[kMTransX] != 0) | (fMat[kMTransY] != 0)) { + fTypeMask |= kTranslate_Mask; + } else { + fTypeMask &= ~kTranslate_Mask; + } + } + + typedef void (*MapXYProc)(const SkMatrix& mat, SkScalar x, SkScalar y, + SkPoint* result); + + static MapXYProc GetMapXYProc(TypeMask mask) { + SkASSERT((mask & ~kAllMasks) == 0); + return gMapXYProcs[mask & kAllMasks]; + } + + MapXYProc getMapXYProc() const { + return GetMapXYProc(this->getType()); + } + + typedef void (*MapPtsProc)(const SkMatrix& mat, SkPoint dst[], + const SkPoint src[], int count); + + static MapPtsProc GetMapPtsProc(TypeMask mask) { + SkASSERT((mask & ~kAllMasks) == 0); + return gMapPtsProcs[mask & kAllMasks]; + } + + MapPtsProc getMapPtsProc() const { + return GetMapPtsProc(this->getType()); + } + + bool SK_WARN_UNUSED_RESULT invertNonIdentity(SkMatrix* inverse) const; + + static bool Poly2Proc(const SkPoint[], SkMatrix*); + static bool Poly3Proc(const SkPoint[], SkMatrix*); + static bool Poly4Proc(const SkPoint[], SkMatrix*); + + static void Identity_xy(const SkMatrix&, SkScalar, SkScalar, SkPoint*); + static void Trans_xy(const SkMatrix&, SkScalar, SkScalar, SkPoint*); + static void Scale_xy(const SkMatrix&, SkScalar, SkScalar, SkPoint*); + static void ScaleTrans_xy(const SkMatrix&, SkScalar, SkScalar, SkPoint*); + static void Rot_xy(const SkMatrix&, SkScalar, SkScalar, SkPoint*); + static void RotTrans_xy(const SkMatrix&, SkScalar, SkScalar, SkPoint*); + static void Persp_xy(const SkMatrix&, SkScalar, SkScalar, SkPoint*); + + static const MapXYProc gMapXYProcs[]; + + static void Identity_pts(const SkMatrix&, SkPoint[], const SkPoint[], int); + static void Trans_pts(const SkMatrix&, SkPoint dst[], const SkPoint[], int); + static void Scale_pts(const SkMatrix&, SkPoint dst[], const SkPoint[], int); + static void ScaleTrans_pts(const SkMatrix&, SkPoint dst[], const SkPoint[], + int count); + static void Persp_pts(const SkMatrix&, SkPoint dst[], const SkPoint[], int); + + static void Affine_vpts(const SkMatrix&, SkPoint dst[], const SkPoint[], int); + + static const MapPtsProc gMapPtsProcs[]; + + // return the number of bytes written, whether or not buffer is null + size_t writeToMemory(void* buffer) const; + /** + * Reads data from the buffer parameter + * + * @param buffer Memory to read from + * @param length Amount of memory available in the buffer + * @return number of bytes read (must be a multiple of 4) or + * 0 if there was not enough memory available + */ + size_t readFromMemory(const void* buffer, size_t length); + + // legacy method -- still needed? why not just postScale(1/divx, ...)? + bool postIDiv(int divx, int divy); + void doNormalizePerspective(); + + friend class SkPerspIter; + friend class SkMatrixPriv; + friend class SerializationTest; +}; +SK_END_REQUIRE_DENSE + +#endif diff --git a/src/deps/skia/include/core/SkMilestone.h b/src/deps/skia/include/core/SkMilestone.h new file mode 100644 index 000000000..8f036e3f3 --- /dev/null +++ b/src/deps/skia/include/core/SkMilestone.h @@ -0,0 +1,9 @@ +/* + * Copyright 2016 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ +#ifndef SK_MILESTONE +#define SK_MILESTONE 99 +#endif diff --git a/src/deps/skia/include/core/SkOverdrawCanvas.h b/src/deps/skia/include/core/SkOverdrawCanvas.h new file mode 100644 index 000000000..1be26c6fa --- /dev/null +++ b/src/deps/skia/include/core/SkOverdrawCanvas.h @@ -0,0 +1,68 @@ +/* + * Copyright 2016 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkOverdrawCanvas_DEFINED +#define SkOverdrawCanvas_DEFINED + +#include "include/core/SkCanvasVirtualEnforcer.h" +#include "include/utils/SkNWayCanvas.h" + +/** + * Captures all drawing commands. Rather than draw the actual content, this device + * increments the alpha channel of each pixel every time it would have been touched + * by a draw call. This is useful for detecting overdraw. + */ +class SK_API SkOverdrawCanvas : public SkCanvasVirtualEnforcer<SkNWayCanvas> { +public: + /* Does not take ownership of canvas */ + SkOverdrawCanvas(SkCanvas*); + + void onDrawTextBlob(const SkTextBlob*, SkScalar, SkScalar, const SkPaint&) override; + void onDrawGlyphRunList(const SkGlyphRunList& glyphRunList, const SkPaint& paint) override; + void onDrawPatch(const SkPoint[12], const SkColor[4], const SkPoint[4], SkBlendMode, + const SkPaint&) override; + void onDrawPaint(const SkPaint&) override; + void onDrawBehind(const SkPaint& paint) override; + void onDrawRect(const SkRect&, const SkPaint&) override; + void onDrawRegion(const SkRegion&, const SkPaint&) override; + void onDrawOval(const SkRect&, const SkPaint&) override; + void onDrawArc(const SkRect&, SkScalar, SkScalar, bool, const SkPaint&) override; + void onDrawDRRect(const SkRRect&, const SkRRect&, const SkPaint&) override; + void onDrawRRect(const SkRRect&, const SkPaint&) override; + void onDrawPoints(PointMode, size_t, const SkPoint[], const SkPaint&) override; + void onDrawVerticesObject(const SkVertices*, SkBlendMode, const SkPaint&) override; + void onDrawPath(const SkPath&, const SkPaint&) override; + + void onDrawImage2(const SkImage*, SkScalar, SkScalar, const SkSamplingOptions&, + const SkPaint*) override; + void onDrawImageRect2(const SkImage*, const SkRect&, const SkRect&, const SkSamplingOptions&, + const SkPaint*, SrcRectConstraint) override; + void onDrawImageLattice2(const SkImage*, const Lattice&, const SkRect&, SkFilterMode, + const SkPaint*) override; + void onDrawAtlas2(const SkImage*, const SkRSXform[], const SkRect[], const SkColor[], int, + SkBlendMode, const SkSamplingOptions&, const SkRect*, const SkPaint*) override; + + void onDrawDrawable(SkDrawable*, const SkMatrix*) override; + void onDrawPicture(const SkPicture*, const SkMatrix*, const SkPaint*) override; + + void onDrawAnnotation(const SkRect&, const char key[], SkData* value) override; + void onDrawShadowRec(const SkPath&, const SkDrawShadowRec&) override; + + void onDrawEdgeAAQuad(const SkRect&, const SkPoint[4], SkCanvas::QuadAAFlags, const SkColor4f&, + SkBlendMode) override; + void onDrawEdgeAAImageSet2(const ImageSetEntry[], int count, const SkPoint[], const SkMatrix[], + const SkSamplingOptions&,const SkPaint*, SrcRectConstraint) override; + +private: + inline SkPaint overdrawPaint(const SkPaint& paint); + + SkPaint fPaint; + + using INHERITED = SkCanvasVirtualEnforcer<SkNWayCanvas>; +}; + +#endif diff --git a/src/deps/skia/include/core/SkPaint.h b/src/deps/skia/include/core/SkPaint.h new file mode 100644 index 000000000..e3cc0391d --- /dev/null +++ b/src/deps/skia/include/core/SkPaint.h @@ -0,0 +1,720 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPaint_DEFINED +#define SkPaint_DEFINED + +#include "include/core/SkBlendMode.h" +#include "include/core/SkColor.h" +#include "include/core/SkRefCnt.h" +#include "include/private/SkTOptional.h" +#include "include/private/SkTo.h" + +class SkBlender; +class SkColorFilter; +class SkColorSpace; +struct SkRect; +class SkImageFilter; +class SkMaskFilter; +class SkMatrix; +class SkPath; +class SkPathEffect; +class SkShader; + +/** \class SkPaint + SkPaint controls options applied when drawing. SkPaint collects all + options outside of the SkCanvas clip and SkCanvas matrix. + + Various options apply to strokes and fills, and images. + + SkPaint collects effects and filters that describe single-pass and multiple-pass + algorithms that alter the drawing geometry, color, and transparency. For instance, + SkPaint does not directly implement dashing or blur, but contains the objects that do so. +*/ +class SK_API SkPaint { +public: + + /** Constructs SkPaint with default values. + + @return default initialized SkPaint + + example: https://fiddle.skia.org/c/@Paint_empty_constructor + */ + SkPaint(); + + /** Constructs SkPaint with default values and the given color. + + Sets alpha and RGB used when stroking and filling. The color is four floating + point values, unpremultiplied. The color values are interpreted as being in + the colorSpace. If colorSpace is nullptr, then color is assumed to be in the + sRGB color space. + + @param color unpremultiplied RGBA + @param colorSpace SkColorSpace describing the encoding of color + @return SkPaint with the given color + */ + explicit SkPaint(const SkColor4f& color, SkColorSpace* colorSpace = nullptr); + + /** Makes a shallow copy of SkPaint. SkPathEffect, SkShader, + SkMaskFilter, SkColorFilter, and SkImageFilter are shared + between the original paint and the copy. Objects containing SkRefCnt increment + their references by one. + + The referenced objects SkPathEffect, SkShader, SkMaskFilter, SkColorFilter, + and SkImageFilter cannot be modified after they are created. + This prevents objects with SkRefCnt from being modified once SkPaint refers to them. + + @param paint original to copy + @return shallow copy of paint + + example: https://fiddle.skia.org/c/@Paint_copy_const_SkPaint + */ + SkPaint(const SkPaint& paint); + + /** Implements a move constructor to avoid increasing the reference counts + of objects referenced by the paint. + + After the call, paint is undefined, and can be safely destructed. + + @param paint original to move + @return content of paint + + example: https://fiddle.skia.org/c/@Paint_move_SkPaint + */ + SkPaint(SkPaint&& paint); + + /** Decreases SkPaint SkRefCnt of owned objects: SkPathEffect, SkShader, + SkMaskFilter, SkColorFilter, and SkImageFilter. If the + objects containing SkRefCnt go to zero, they are deleted. + */ + ~SkPaint(); + + /** Makes a shallow copy of SkPaint. SkPathEffect, SkShader, + SkMaskFilter, SkColorFilter, and SkImageFilter are shared + between the original paint and the copy. Objects containing SkRefCnt in the + prior destination are decreased by one, and the referenced objects are deleted if the + resulting count is zero. Objects containing SkRefCnt in the parameter paint + are increased by one. paint is unmodified. + + @param paint original to copy + @return content of paint + + example: https://fiddle.skia.org/c/@Paint_copy_operator + */ + SkPaint& operator=(const SkPaint& paint); + + /** Moves the paint to avoid increasing the reference counts + of objects referenced by the paint parameter. Objects containing SkRefCnt in the + prior destination are decreased by one; those objects are deleted if the resulting count + is zero. + + After the call, paint is undefined, and can be safely destructed. + + @param paint original to move + @return content of paint + + example: https://fiddle.skia.org/c/@Paint_move_operator + */ + SkPaint& operator=(SkPaint&& paint); + + /** Compares a and b, and returns true if a and b are equivalent. May return false + if SkPathEffect, SkShader, SkMaskFilter, SkColorFilter, + or SkImageFilter have identical contents but different pointers. + + @param a SkPaint to compare + @param b SkPaint to compare + @return true if SkPaint pair are equivalent + */ + SK_API friend bool operator==(const SkPaint& a, const SkPaint& b); + + /** Compares a and b, and returns true if a and b are not equivalent. May return true + if SkPathEffect, SkShader, SkMaskFilter, SkColorFilter, + or SkImageFilter have identical contents but different pointers. + + @param a SkPaint to compare + @param b SkPaint to compare + @return true if SkPaint pair are not equivalent + */ + friend bool operator!=(const SkPaint& a, const SkPaint& b) { + return !(a == b); + } + + /** Sets all SkPaint contents to their initial values. This is equivalent to replacing + SkPaint with the result of SkPaint(). + + example: https://fiddle.skia.org/c/@Paint_reset + */ + void reset(); + + /** Returns true if pixels on the active edges of SkPath may be drawn with partial transparency. + @return antialiasing state + */ + bool isAntiAlias() const { + return SkToBool(fBitfields.fAntiAlias); + } + + /** Requests, but does not require, that edge pixels draw opaque or with + partial transparency. + @param aa setting for antialiasing + */ + void setAntiAlias(bool aa) { fBitfields.fAntiAlias = static_cast<unsigned>(aa); } + + /** Returns true if color error may be distributed to smooth color transition. + @return dithering state + */ + bool isDither() const { + return SkToBool(fBitfields.fDither); + } + + /** Requests, but does not require, to distribute color error. + @param dither setting for ditering + */ + void setDither(bool dither) { fBitfields.fDither = static_cast<unsigned>(dither); } + + /** \enum SkPaint::Style + Set Style to fill, stroke, or both fill and stroke geometry. + The stroke and fill + share all paint attributes; for instance, they are drawn with the same color. + + Use kStrokeAndFill_Style to avoid hitting the same pixels twice with a stroke draw and + a fill draw. + */ + enum Style : uint8_t { + kFill_Style, //!< set to fill geometry + kStroke_Style, //!< set to stroke geometry + kStrokeAndFill_Style, //!< sets to stroke and fill geometry + }; + + /** May be used to verify that SkPaint::Style is a legal value. + */ + static constexpr int kStyleCount = kStrokeAndFill_Style + 1; + + /** Returns whether the geometry is filled, stroked, or filled and stroked. + */ + Style getStyle() const { return (Style)fBitfields.fStyle; } + + /** Sets whether the geometry is filled, stroked, or filled and stroked. + Has no effect if style is not a legal SkPaint::Style value. + + example: https://fiddle.skia.org/c/@Paint_setStyle + example: https://fiddle.skia.org/c/@Stroke_Width + */ + void setStyle(Style style); + + /** + * Set paint's style to kStroke if true, or kFill if false. + */ + void setStroke(bool); + + /** Retrieves alpha and RGB, unpremultiplied, packed into 32 bits. + Use helpers SkColorGetA(), SkColorGetR(), SkColorGetG(), and SkColorGetB() to extract + a color component. + + @return unpremultiplied ARGB + */ + SkColor getColor() const { return fColor4f.toSkColor(); } + + /** Retrieves alpha and RGB, unpremultiplied, as four floating point values. RGB are + extended sRGB values (sRGB gamut, and encoded with the sRGB transfer function). + + @return unpremultiplied RGBA + */ + SkColor4f getColor4f() const { return fColor4f; } + + /** Sets alpha and RGB used when stroking and filling. The color is a 32-bit value, + unpremultiplied, packing 8-bit components for alpha, red, blue, and green. + + @param color unpremultiplied ARGB + + example: https://fiddle.skia.org/c/@Paint_setColor + */ + void setColor(SkColor color); + + /** Sets alpha and RGB used when stroking and filling. The color is four floating + point values, unpremultiplied. The color values are interpreted as being in + the colorSpace. If colorSpace is nullptr, then color is assumed to be in the + sRGB color space. + + @param color unpremultiplied RGBA + @param colorSpace SkColorSpace describing the encoding of color + */ + void setColor(const SkColor4f& color, SkColorSpace* colorSpace = nullptr); + + void setColor4f(const SkColor4f& color, SkColorSpace* colorSpace = nullptr) { + this->setColor(color, colorSpace); + } + + /** Retrieves alpha from the color used when stroking and filling. + + @return alpha ranging from zero, fully transparent, to 255, fully opaque + */ + float getAlphaf() const { return fColor4f.fA; } + + // Helper that scales the alpha by 255. + uint8_t getAlpha() const { return sk_float_round2int(this->getAlphaf() * 255); } + + /** Replaces alpha, leaving RGB + unchanged. An out of range value triggers an assert in the debug + build. a is a value from 0.0 to 1.0. + a set to zero makes color fully transparent; a set to 1.0 makes color + fully opaque. + + @param a alpha component of color + */ + void setAlphaf(float a); + + // Helper that accepts an int between 0 and 255, and divides it by 255.0 + void setAlpha(U8CPU a) { + this->setAlphaf(a * (1.0f / 255)); + } + + /** Sets color used when drawing solid fills. The color components range from 0 to 255. + The color is unpremultiplied; alpha sets the transparency independent of RGB. + + @param a amount of alpha, from fully transparent (0) to fully opaque (255) + @param r amount of red, from no red (0) to full red (255) + @param g amount of green, from no green (0) to full green (255) + @param b amount of blue, from no blue (0) to full blue (255) + + example: https://fiddle.skia.org/c/@Paint_setARGB + */ + void setARGB(U8CPU a, U8CPU r, U8CPU g, U8CPU b); + + /** Returns the thickness of the pen used by SkPaint to + outline the shape. + + @return zero for hairline, greater than zero for pen thickness + */ + SkScalar getStrokeWidth() const { return fWidth; } + + /** Sets the thickness of the pen used by the paint to outline the shape. + A stroke-width of zero is treated as "hairline" width. Hairlines are always exactly one + pixel wide in device space (their thickness does not change as the canvas is scaled). + Negative stroke-widths are invalid; setting a negative width will have no effect. + + @param width zero thickness for hairline; greater than zero for pen thickness + + example: https://fiddle.skia.org/c/@Miter_Limit + example: https://fiddle.skia.org/c/@Paint_setStrokeWidth + */ + void setStrokeWidth(SkScalar width); + + /** Returns the limit at which a sharp corner is drawn beveled. + + @return zero and greater miter limit + */ + SkScalar getStrokeMiter() const { return fMiterLimit; } + + /** Sets the limit at which a sharp corner is drawn beveled. + Valid values are zero and greater. + Has no effect if miter is less than zero. + + @param miter zero and greater miter limit + + example: https://fiddle.skia.org/c/@Paint_setStrokeMiter + */ + void setStrokeMiter(SkScalar miter); + + /** \enum SkPaint::Cap + Cap draws at the beginning and end of an open path contour. + */ + enum Cap { + kButt_Cap, //!< no stroke extension + kRound_Cap, //!< adds circle + kSquare_Cap, //!< adds square + kLast_Cap = kSquare_Cap, //!< largest Cap value + kDefault_Cap = kButt_Cap, //!< equivalent to kButt_Cap + }; + + /** May be used to verify that SkPaint::Cap is a legal value. + */ + static constexpr int kCapCount = kLast_Cap + 1; + + /** \enum SkPaint::Join + Join specifies how corners are drawn when a shape is stroked. Join + affects the four corners of a stroked rectangle, and the connected segments in a + stroked path. + + Choose miter join to draw sharp corners. Choose round join to draw a circle with a + radius equal to the stroke width on top of the corner. Choose bevel join to minimally + connect the thick strokes. + + The fill path constructed to describe the stroked path respects the join setting but may + not contain the actual join. For instance, a fill path constructed with round joins does + not necessarily include circles at each connected segment. + */ + enum Join : uint8_t { + kMiter_Join, //!< extends to miter limit + kRound_Join, //!< adds circle + kBevel_Join, //!< connects outside edges + kLast_Join = kBevel_Join, //!< equivalent to the largest value for Join + kDefault_Join = kMiter_Join, //!< equivalent to kMiter_Join + }; + + /** May be used to verify that SkPaint::Join is a legal value. + */ + static constexpr int kJoinCount = kLast_Join + 1; + + /** Returns the geometry drawn at the beginning and end of strokes. + */ + Cap getStrokeCap() const { return (Cap)fBitfields.fCapType; } + + /** Sets the geometry drawn at the beginning and end of strokes. + + example: https://fiddle.skia.org/c/@Paint_setStrokeCap_a + example: https://fiddle.skia.org/c/@Paint_setStrokeCap_b + */ + void setStrokeCap(Cap cap); + + /** Returns the geometry drawn at the corners of strokes. + */ + Join getStrokeJoin() const { return (Join)fBitfields.fJoinType; } + + /** Sets the geometry drawn at the corners of strokes. + + example: https://fiddle.skia.org/c/@Paint_setStrokeJoin + */ + void setStrokeJoin(Join join); + + /** Returns the filled equivalent of the stroked path. + + @param src SkPath read to create a filled version + @param dst resulting SkPath; may be the same as src, but may not be nullptr + @param cullRect optional limit passed to SkPathEffect + @param resScale if > 1, increase precision, else if (0 < resScale < 1) reduce precision + to favor speed and size + @return true if the path represents style fill, or false if it represents hairline + */ + bool getFillPath(const SkPath& src, SkPath* dst, const SkRect* cullRect, + SkScalar resScale = 1) const; + + bool getFillPath(const SkPath& src, SkPath* dst, const SkRect* cullRect, + const SkMatrix& ctm) const; + + /** Returns the filled equivalent of the stroked path. + + Replaces dst with the src path modified by SkPathEffect and style stroke. + SkPathEffect, if any, is not culled. stroke width is created with default precision. + + @param src SkPath read to create a filled version + @param dst resulting SkPath dst may be the same as src, but may not be nullptr + @return true if the path represents style fill, or false if it represents hairline + */ + bool getFillPath(const SkPath& src, SkPath* dst) const { + return this->getFillPath(src, dst, nullptr, 1); + } + + /** Returns optional colors used when filling a path, such as a gradient. + + Does not alter SkShader SkRefCnt. + + @return SkShader if previously set, nullptr otherwise + */ + SkShader* getShader() const { return fShader.get(); } + + /** Returns optional colors used when filling a path, such as a gradient. + + Increases SkShader SkRefCnt by one. + + @return SkShader if previously set, nullptr otherwise + + example: https://fiddle.skia.org/c/@Paint_refShader + */ + sk_sp<SkShader> refShader() const; + + /** Sets optional colors used when filling a path, such as a gradient. + + Sets SkShader to shader, decreasing SkRefCnt of the previous SkShader. + Increments shader SkRefCnt by one. + + @param shader how geometry is filled with color; if nullptr, color is used instead + + example: https://fiddle.skia.org/c/@Color_Filter_Methods + example: https://fiddle.skia.org/c/@Paint_setShader + */ + void setShader(sk_sp<SkShader> shader); + + /** Returns SkColorFilter if set, or nullptr. + Does not alter SkColorFilter SkRefCnt. + + @return SkColorFilter if previously set, nullptr otherwise + */ + SkColorFilter* getColorFilter() const { return fColorFilter.get(); } + + /** Returns SkColorFilter if set, or nullptr. + Increases SkColorFilter SkRefCnt by one. + + @return SkColorFilter if set, or nullptr + + example: https://fiddle.skia.org/c/@Paint_refColorFilter + */ + sk_sp<SkColorFilter> refColorFilter() const; + + /** Sets SkColorFilter to filter, decreasing SkRefCnt of the previous + SkColorFilter. Pass nullptr to clear SkColorFilter. + + Increments filter SkRefCnt by one. + + @param colorFilter SkColorFilter to apply to subsequent draw + + example: https://fiddle.skia.org/c/@Blend_Mode_Methods + example: https://fiddle.skia.org/c/@Paint_setColorFilter + */ + void setColorFilter(sk_sp<SkColorFilter> colorFilter); + + /** If the current blender can be represented as a SkBlendMode enum, this returns that + * enum in the optional's value(). If it cannot, then the returned optional does not + * contain a value. + */ + skstd::optional<SkBlendMode> asBlendMode() const; + + /** + * Queries the blender, and if it can be represented as a SkBlendMode, return that mode, + * else return the defaultMode provided. + */ + SkBlendMode getBlendMode_or(SkBlendMode defaultMode) const; + + /** Returns true iff the current blender claims to be equivalent to SkBlendMode::kSrcOver. + * + * Also returns true of the current blender is nullptr. + */ + bool isSrcOver() const; + + /** Helper method for calling setBlender(). + * + * This sets a blender that implements the specified blendmode enum. + */ + void setBlendMode(SkBlendMode mode); + + /** Returns the user-supplied blend function, if one has been set. + * Does not alter SkBlender's SkRefCnt. + * + * A nullptr blender signifies the default SrcOver behavior. + * + * @return the SkBlender assigned to this paint, otherwise nullptr + */ + SkBlender* getBlender() const { return fBlender.get(); } + + /** Returns the user-supplied blend function, if one has been set. + * Increments the SkBlender's SkRefCnt by one. + * + * A nullptr blender signifies the default SrcOver behavior. + * + * @return the SkBlender assigned to this paint, otherwise nullptr + */ + sk_sp<SkBlender> refBlender() const; + + /** Sets the current blender, increasing its refcnt, and if a blender is already + * present, decreasing that object's refcnt. + * + * A nullptr blender signifies the default SrcOver behavior. + * + * For convenience, you can call setBlendMode() if the blend effect can be expressed + * as one of those values. + */ + void setBlender(sk_sp<SkBlender> blender); + + /** Returns SkPathEffect if set, or nullptr. + Does not alter SkPathEffect SkRefCnt. + + @return SkPathEffect if previously set, nullptr otherwise + */ + SkPathEffect* getPathEffect() const { return fPathEffect.get(); } + + /** Returns SkPathEffect if set, or nullptr. + Increases SkPathEffect SkRefCnt by one. + + @return SkPathEffect if previously set, nullptr otherwise + + example: https://fiddle.skia.org/c/@Paint_refPathEffect + */ + sk_sp<SkPathEffect> refPathEffect() const; + + /** Sets SkPathEffect to pathEffect, decreasing SkRefCnt of the previous + SkPathEffect. Pass nullptr to leave the path geometry unaltered. + + Increments pathEffect SkRefCnt by one. + + @param pathEffect replace SkPath with a modification when drawn + + example: https://fiddle.skia.org/c/@Mask_Filter_Methods + example: https://fiddle.skia.org/c/@Paint_setPathEffect + */ + void setPathEffect(sk_sp<SkPathEffect> pathEffect); + + /** Returns SkMaskFilter if set, or nullptr. + Does not alter SkMaskFilter SkRefCnt. + + @return SkMaskFilter if previously set, nullptr otherwise + */ + SkMaskFilter* getMaskFilter() const { return fMaskFilter.get(); } + + /** Returns SkMaskFilter if set, or nullptr. + + Increases SkMaskFilter SkRefCnt by one. + + @return SkMaskFilter if previously set, nullptr otherwise + + example: https://fiddle.skia.org/c/@Paint_refMaskFilter + */ + sk_sp<SkMaskFilter> refMaskFilter() const; + + /** Sets SkMaskFilter to maskFilter, decreasing SkRefCnt of the previous + SkMaskFilter. Pass nullptr to clear SkMaskFilter and leave SkMaskFilter effect on + mask alpha unaltered. + + Increments maskFilter SkRefCnt by one. + + @param maskFilter modifies clipping mask generated from drawn geometry + + example: https://fiddle.skia.org/c/@Paint_setMaskFilter + example: https://fiddle.skia.org/c/@Typeface_Methods + */ + void setMaskFilter(sk_sp<SkMaskFilter> maskFilter); + + /** Returns SkImageFilter if set, or nullptr. + Does not alter SkImageFilter SkRefCnt. + + @return SkImageFilter if previously set, nullptr otherwise + */ + SkImageFilter* getImageFilter() const { return fImageFilter.get(); } + + /** Returns SkImageFilter if set, or nullptr. + Increases SkImageFilter SkRefCnt by one. + + @return SkImageFilter if previously set, nullptr otherwise + + example: https://fiddle.skia.org/c/@Paint_refImageFilter + */ + sk_sp<SkImageFilter> refImageFilter() const; + + /** Sets SkImageFilter to imageFilter, decreasing SkRefCnt of the previous + SkImageFilter. Pass nullptr to clear SkImageFilter, and remove SkImageFilter effect + on drawing. + + Increments imageFilter SkRefCnt by one. + + @param imageFilter how SkImage is sampled when transformed + + example: https://fiddle.skia.org/c/@Paint_setImageFilter + */ + void setImageFilter(sk_sp<SkImageFilter> imageFilter); + + /** Returns true if SkPaint prevents all drawing; + otherwise, the SkPaint may or may not allow drawing. + + Returns true if, for example, SkBlendMode combined with alpha computes a + new alpha of zero. + + @return true if SkPaint prevents all drawing + + example: https://fiddle.skia.org/c/@Paint_nothingToDraw + */ + bool nothingToDraw() const; + + /** (to be made private) + Returns true if SkPaint does not include elements requiring extensive computation + to compute SkBaseDevice bounds of drawn geometry. For instance, SkPaint with SkPathEffect + always returns false. + + @return true if SkPaint allows for fast computation of bounds + */ + bool canComputeFastBounds() const; + + /** (to be made private) + Only call this if canComputeFastBounds() returned true. This takes a + raw rectangle (the raw bounds of a shape), and adjusts it for stylistic + effects in the paint (e.g. stroking). If needed, it uses the storage + parameter. It returns the adjusted bounds that can then be used + for SkCanvas::quickReject tests. + + The returned SkRect will either be orig or storage, thus the caller + should not rely on storage being set to the result, but should always + use the returned value. It is legal for orig and storage to be the same + SkRect. + For example: + if (!path.isInverseFillType() && paint.canComputeFastBounds()) { + SkRect storage; + if (canvas->quickReject(paint.computeFastBounds(path.getBounds(), &storage))) { + return; // do not draw the path + } + } + // draw the path + + @param orig geometry modified by SkPaint when drawn + @param storage computed bounds of geometry; may not be nullptr + @return fast computed bounds + */ + const SkRect& computeFastBounds(const SkRect& orig, SkRect* storage) const { + // Things like stroking, etc... will do math on the bounds rect, assuming that it's sorted. + SkASSERT(orig.isSorted()); + SkPaint::Style style = this->getStyle(); + // ultra fast-case: filling with no effects that affect geometry + if (kFill_Style == style) { + uintptr_t effects = 0; + effects |= reinterpret_cast<uintptr_t>(this->getMaskFilter()); + effects |= reinterpret_cast<uintptr_t>(this->getPathEffect()); + effects |= reinterpret_cast<uintptr_t>(this->getImageFilter()); + if (!effects) { + return orig; + } + } + + return this->doComputeFastBounds(orig, storage, style); + } + + /** (to be made private) + + @param orig geometry modified by SkPaint when drawn + @param storage computed bounds of geometry + @return fast computed bounds + */ + const SkRect& computeFastStrokeBounds(const SkRect& orig, + SkRect* storage) const { + return this->doComputeFastBounds(orig, storage, kStroke_Style); + } + + /** (to be made private) + Computes the bounds, overriding the SkPaint SkPaint::Style. This can be used to + account for additional width required by stroking orig, without + altering SkPaint::Style set to fill. + + @param orig geometry modified by SkPaint when drawn + @param storage computed bounds of geometry + @param style overrides SkPaint::Style + @return fast computed bounds + */ + const SkRect& doComputeFastBounds(const SkRect& orig, SkRect* storage, + Style style) const; + +private: + sk_sp<SkPathEffect> fPathEffect; + sk_sp<SkShader> fShader; + sk_sp<SkMaskFilter> fMaskFilter; + sk_sp<SkColorFilter> fColorFilter; + sk_sp<SkImageFilter> fImageFilter; + sk_sp<SkBlender> fBlender; + + SkColor4f fColor4f; + SkScalar fWidth; + SkScalar fMiterLimit; + union { + struct { + unsigned fAntiAlias : 1; + unsigned fDither : 1; + unsigned fCapType : 2; + unsigned fJoinType : 2; + unsigned fStyle : 2; + unsigned fPadding : 24; // 24 == 32 -1-1-2-2-2 + } fBitfields; + uint32_t fBitfieldsUInt; + }; + + friend class SkPaintPriv; +}; + +#endif diff --git a/src/deps/skia/include/core/SkPath.h b/src/deps/skia/include/core/SkPath.h new file mode 100644 index 000000000..178e4d22f --- /dev/null +++ b/src/deps/skia/include/core/SkPath.h @@ -0,0 +1,1891 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPath_DEFINED +#define SkPath_DEFINED + +#include "include/core/SkMatrix.h" +#include "include/core/SkPathTypes.h" +#include "include/private/SkPathRef.h" +#include "include/private/SkTo.h" + +#include <initializer_list> + +class SkAutoPathBoundsUpdate; +class SkData; +class SkRRect; +class SkWStream; + +// WIP -- define this locally, and fix call-sites to use SkPathBuilder (skbug.com/9000) +//#define SK_HIDE_PATH_EDIT_METHODS + +/** \class SkPath + SkPath contain geometry. SkPath may be empty, or contain one or more verbs that + outline a figure. SkPath always starts with a move verb to a Cartesian coordinate, + and may be followed by additional verbs that add lines or curves. + Adding a close verb makes the geometry into a continuous loop, a closed contour. + SkPath may contain any number of contours, each beginning with a move verb. + + SkPath contours may contain only a move verb, or may also contain lines, + quadratic beziers, conics, and cubic beziers. SkPath contours may be open or + closed. + + When used to draw a filled area, SkPath describes whether the fill is inside or + outside the geometry. SkPath also describes the winding rule used to fill + overlapping contours. + + Internally, SkPath lazily computes metrics likes bounds and convexity. Call + SkPath::updateBoundsCache to make SkPath thread safe. +*/ +class SK_API SkPath { +public: + /** + * Create a new path with the specified segments. + * + * The points and weights arrays are read in order, based on the sequence of verbs. + * + * Move 1 point + * Line 1 point + * Quad 2 points + * Conic 2 points and 1 weight + * Cubic 3 points + * Close 0 points + * + * If an illegal sequence of verbs is encountered, or the specified number of points + * or weights is not sufficient given the verbs, an empty Path is returned. + * + * A legal sequence of verbs consists of any number of Contours. A contour always begins + * with a Move verb, followed by 0 or more segments: Line, Quad, Conic, Cubic, followed + * by an optional Close. + */ + static SkPath Make(const SkPoint[], int pointCount, + const uint8_t[], int verbCount, + const SkScalar[], int conicWeightCount, + SkPathFillType, bool isVolatile = false); + + static SkPath Rect(const SkRect&, SkPathDirection = SkPathDirection::kCW, + unsigned startIndex = 0); + static SkPath Oval(const SkRect&, SkPathDirection = SkPathDirection::kCW); + static SkPath Oval(const SkRect&, SkPathDirection, unsigned startIndex); + static SkPath Circle(SkScalar center_x, SkScalar center_y, SkScalar radius, + SkPathDirection dir = SkPathDirection::kCW); + static SkPath RRect(const SkRRect&, SkPathDirection dir = SkPathDirection::kCW); + static SkPath RRect(const SkRRect&, SkPathDirection, unsigned startIndex); + static SkPath RRect(const SkRect& bounds, SkScalar rx, SkScalar ry, + SkPathDirection dir = SkPathDirection::kCW); + + static SkPath Polygon(const SkPoint pts[], int count, bool isClosed, + SkPathFillType = SkPathFillType::kWinding, + bool isVolatile = false); + + static SkPath Polygon(const std::initializer_list<SkPoint>& list, bool isClosed, + SkPathFillType fillType = SkPathFillType::kWinding, + bool isVolatile = false) { + return Polygon(list.begin(), SkToInt(list.size()), isClosed, fillType, isVolatile); + } + + static SkPath Line(const SkPoint a, const SkPoint b) { + return Polygon({a, b}, false); + } + + /** Constructs an empty SkPath. By default, SkPath has no verbs, no SkPoint, and no weights. + FillType is set to kWinding. + + @return empty SkPath + + example: https://fiddle.skia.org/c/@Path_empty_constructor + */ + SkPath(); + + /** Constructs a copy of an existing path. + Copy constructor makes two paths identical by value. Internally, path and + the returned result share pointer values. The underlying verb array, SkPoint array + and weights are copied when modified. + + Creating a SkPath copy is very efficient and never allocates memory. + SkPath are always copied by value from the interface; the underlying shared + pointers are not exposed. + + @param path SkPath to copy by value + @return copy of SkPath + + example: https://fiddle.skia.org/c/@Path_copy_const_SkPath + */ + SkPath(const SkPath& path); + + /** Releases ownership of any shared data and deletes data if SkPath is sole owner. + + example: https://fiddle.skia.org/c/@Path_destructor + */ + ~SkPath(); + + /** Constructs a copy of an existing path. + SkPath assignment makes two paths identical by value. Internally, assignment + shares pointer values. The underlying verb array, SkPoint array and weights + are copied when modified. + + Copying SkPath by assignment is very efficient and never allocates memory. + SkPath are always copied by value from the interface; the underlying shared + pointers are not exposed. + + @param path verb array, SkPoint array, weights, and SkPath::FillType to copy + @return SkPath copied by value + + example: https://fiddle.skia.org/c/@Path_copy_operator + */ + SkPath& operator=(const SkPath& path); + + /** Compares a and b; returns true if SkPath::FillType, verb array, SkPoint array, and weights + are equivalent. + + @param a SkPath to compare + @param b SkPath to compare + @return true if SkPath pair are equivalent + */ + friend SK_API bool operator==(const SkPath& a, const SkPath& b); + + /** Compares a and b; returns true if SkPath::FillType, verb array, SkPoint array, and weights + are not equivalent. + + @param a SkPath to compare + @param b SkPath to compare + @return true if SkPath pair are not equivalent + */ + friend bool operator!=(const SkPath& a, const SkPath& b) { + return !(a == b); + } + + /** Returns true if SkPath contain equal verbs and equal weights. + If SkPath contain one or more conics, the weights must match. + + conicTo() may add different verbs depending on conic weight, so it is not + trivial to interpolate a pair of SkPath containing conics with different + conic weight values. + + @param compare SkPath to compare + @return true if SkPath verb array and weights are equivalent + + example: https://fiddle.skia.org/c/@Path_isInterpolatable + */ + bool isInterpolatable(const SkPath& compare) const; + + /** Interpolates between SkPath with SkPoint array of equal size. + Copy verb array and weights to out, and set out SkPoint array to a weighted + average of this SkPoint array and ending SkPoint array, using the formula: + (Path Point * weight) + ending Point * (1 - weight). + + weight is most useful when between zero (ending SkPoint array) and + one (this Point_Array); will work with values outside of this + range. + + interpolate() returns false and leaves out unchanged if SkPoint array is not + the same size as ending SkPoint array. Call isInterpolatable() to check SkPath + compatibility prior to calling interpolate(). + + @param ending SkPoint array averaged with this SkPoint array + @param weight contribution of this SkPoint array, and + one minus contribution of ending SkPoint array + @param out SkPath replaced by interpolated averages + @return true if SkPath contain same number of SkPoint + + example: https://fiddle.skia.org/c/@Path_interpolate + */ + bool interpolate(const SkPath& ending, SkScalar weight, SkPath* out) const; + + /** Returns SkPathFillType, the rule used to fill SkPath. + + @return current SkPathFillType setting + */ + SkPathFillType getFillType() const { return (SkPathFillType)fFillType; } + + /** Sets FillType, the rule used to fill SkPath. While there is no check + that ft is legal, values outside of FillType are not supported. + */ + void setFillType(SkPathFillType ft) { + fFillType = SkToU8(ft); + } + + /** Returns if FillType describes area outside SkPath geometry. The inverse fill area + extends indefinitely. + + @return true if FillType is kInverseWinding or kInverseEvenOdd + */ + bool isInverseFillType() const { return SkPathFillType_IsInverse(this->getFillType()); } + + /** Replaces FillType with its inverse. The inverse of FillType describes the area + unmodified by the original FillType. + */ + void toggleInverseFillType() { + fFillType ^= 2; + } + + /** Returns true if the path is convex. If necessary, it will first compute the convexity. + */ + bool isConvex() const { + return SkPathConvexity::kConvex == this->getConvexity(); + } + + /** Returns true if this path is recognized as an oval or circle. + + bounds receives bounds of oval. + + bounds is unmodified if oval is not found. + + @param bounds storage for bounding SkRect of oval; may be nullptr + @return true if SkPath is recognized as an oval or circle + + example: https://fiddle.skia.org/c/@Path_isOval + */ + bool isOval(SkRect* bounds) const; + + /** Returns true if path is representable as SkRRect. + Returns false if path is representable as oval, circle, or SkRect. + + rrect receives bounds of SkRRect. + + rrect is unmodified if SkRRect is not found. + + @param rrect storage for bounding SkRect of SkRRect; may be nullptr + @return true if SkPath contains only SkRRect + + example: https://fiddle.skia.org/c/@Path_isRRect + */ + bool isRRect(SkRRect* rrect) const; + + /** Sets SkPath to its initial state. + Removes verb array, SkPoint array, and weights, and sets FillType to kWinding. + Internal storage associated with SkPath is released. + + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_reset + */ + SkPath& reset(); + + /** Sets SkPath to its initial state, preserving internal storage. + Removes verb array, SkPoint array, and weights, and sets FillType to kWinding. + Internal storage associated with SkPath is retained. + + Use rewind() instead of reset() if SkPath storage will be reused and performance + is critical. + + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_rewind + */ + SkPath& rewind(); + + /** Returns if SkPath is empty. + Empty SkPath may have FillType but has no SkPoint, SkPath::Verb, or conic weight. + SkPath() constructs empty SkPath; reset() and rewind() make SkPath empty. + + @return true if the path contains no SkPath::Verb array + */ + bool isEmpty() const { + SkDEBUGCODE(this->validate();) + return 0 == fPathRef->countVerbs(); + } + + /** Returns if contour is closed. + Contour is closed if SkPath SkPath::Verb array was last modified by close(). When stroked, + closed contour draws SkPaint::Join instead of SkPaint::Cap at first and last SkPoint. + + @return true if the last contour ends with a kClose_Verb + + example: https://fiddle.skia.org/c/@Path_isLastContourClosed + */ + bool isLastContourClosed() const; + + /** Returns true for finite SkPoint array values between negative SK_ScalarMax and + positive SK_ScalarMax. Returns false for any SkPoint array value of + SK_ScalarInfinity, SK_ScalarNegativeInfinity, or SK_ScalarNaN. + + @return true if all SkPoint values are finite + */ + bool isFinite() const { + SkDEBUGCODE(this->validate();) + return fPathRef->isFinite(); + } + + /** Returns true if the path is volatile; it will not be altered or discarded + by the caller after it is drawn. SkPath by default have volatile set false, allowing + SkSurface to attach a cache of data which speeds repeated drawing. If true, SkSurface + may not speed repeated drawing. + + @return true if caller will alter SkPath after drawing + */ + bool isVolatile() const { + return SkToBool(fIsVolatile); + } + + /** Specifies whether SkPath is volatile; whether it will be altered or discarded + by the caller after it is drawn. SkPath by default have volatile set false, allowing + SkBaseDevice to attach a cache of data which speeds repeated drawing. + + Mark temporary paths, discarded or modified after use, as volatile + to inform SkBaseDevice that the path need not be cached. + + Mark animating SkPath volatile to improve performance. + Mark unchanging SkPath non-volatile to improve repeated rendering. + + raster surface SkPath draws are affected by volatile for some shadows. + GPU surface SkPath draws are affected by volatile for some shadows and concave geometries. + + @param isVolatile true if caller will alter SkPath after drawing + @return reference to SkPath + */ + SkPath& setIsVolatile(bool isVolatile) { + fIsVolatile = isVolatile; + return *this; + } + + /** Tests if line between SkPoint pair is degenerate. + Line with no length or that moves a very short distance is degenerate; it is + treated as a point. + + exact changes the equality test. If true, returns true only if p1 equals p2. + If false, returns true if p1 equals or nearly equals p2. + + @param p1 line start point + @param p2 line end point + @param exact if false, allow nearly equals + @return true if line is degenerate; its length is effectively zero + + example: https://fiddle.skia.org/c/@Path_IsLineDegenerate + */ + static bool IsLineDegenerate(const SkPoint& p1, const SkPoint& p2, bool exact); + + /** Tests if quad is degenerate. + Quad with no length or that moves a very short distance is degenerate; it is + treated as a point. + + @param p1 quad start point + @param p2 quad control point + @param p3 quad end point + @param exact if true, returns true only if p1, p2, and p3 are equal; + if false, returns true if p1, p2, and p3 are equal or nearly equal + @return true if quad is degenerate; its length is effectively zero + */ + static bool IsQuadDegenerate(const SkPoint& p1, const SkPoint& p2, + const SkPoint& p3, bool exact); + + /** Tests if cubic is degenerate. + Cubic with no length or that moves a very short distance is degenerate; it is + treated as a point. + + @param p1 cubic start point + @param p2 cubic control point 1 + @param p3 cubic control point 2 + @param p4 cubic end point + @param exact if true, returns true only if p1, p2, p3, and p4 are equal; + if false, returns true if p1, p2, p3, and p4 are equal or nearly equal + @return true if cubic is degenerate; its length is effectively zero + */ + static bool IsCubicDegenerate(const SkPoint& p1, const SkPoint& p2, + const SkPoint& p3, const SkPoint& p4, bool exact); + + /** Returns true if SkPath contains only one line; + SkPath::Verb array has two entries: kMove_Verb, kLine_Verb. + If SkPath contains one line and line is not nullptr, line is set to + line start point and line end point. + Returns false if SkPath is not one line; line is unaltered. + + @param line storage for line. May be nullptr + @return true if SkPath contains exactly one line + + example: https://fiddle.skia.org/c/@Path_isLine + */ + bool isLine(SkPoint line[2]) const; + + /** Returns the number of points in SkPath. + SkPoint count is initially zero. + + @return SkPath SkPoint array length + + example: https://fiddle.skia.org/c/@Path_countPoints + */ + int countPoints() const; + + /** Returns SkPoint at index in SkPoint array. Valid range for index is + 0 to countPoints() - 1. + Returns (0, 0) if index is out of range. + + @param index SkPoint array element selector + @return SkPoint array value or (0, 0) + + example: https://fiddle.skia.org/c/@Path_getPoint + */ + SkPoint getPoint(int index) const; + + /** Returns number of points in SkPath. Up to max points are copied. + points may be nullptr; then, max must be zero. + If max is greater than number of points, excess points storage is unaltered. + + @param points storage for SkPath SkPoint array. May be nullptr + @param max maximum to copy; must be greater than or equal to zero + @return SkPath SkPoint array length + + example: https://fiddle.skia.org/c/@Path_getPoints + */ + int getPoints(SkPoint points[], int max) const; + + /** Returns the number of verbs: kMove_Verb, kLine_Verb, kQuad_Verb, kConic_Verb, + kCubic_Verb, and kClose_Verb; added to SkPath. + + @return length of verb array + + example: https://fiddle.skia.org/c/@Path_countVerbs + */ + int countVerbs() const; + + /** Returns the number of verbs in the path. Up to max verbs are copied. The + verbs are copied as one byte per verb. + + @param verbs storage for verbs, may be nullptr + @param max maximum number to copy into verbs + @return the actual number of verbs in the path + + example: https://fiddle.skia.org/c/@Path_getVerbs + */ + int getVerbs(uint8_t verbs[], int max) const; + + /** Returns the approximate byte size of the SkPath in memory. + + @return approximate size + */ + size_t approximateBytesUsed() const; + + /** Exchanges the verb array, SkPoint array, weights, and SkPath::FillType with other. + Cached state is also exchanged. swap() internally exchanges pointers, so + it is lightweight and does not allocate memory. + + swap() usage has largely been replaced by operator=(const SkPath& path). + SkPath do not copy their content on assignment until they are written to, + making assignment as efficient as swap(). + + @param other SkPath exchanged by value + + example: https://fiddle.skia.org/c/@Path_swap + */ + void swap(SkPath& other); + + /** Returns minimum and maximum axes values of SkPoint array. + Returns (0, 0, 0, 0) if SkPath contains no points. Returned bounds width and height may + be larger or smaller than area affected when SkPath is drawn. + + SkRect returned includes all SkPoint added to SkPath, including SkPoint associated with + kMove_Verb that define empty contours. + + @return bounds of all SkPoint in SkPoint array + */ + const SkRect& getBounds() const { + return fPathRef->getBounds(); + } + + /** Updates internal bounds so that subsequent calls to getBounds() are instantaneous. + Unaltered copies of SkPath may also access cached bounds through getBounds(). + + For now, identical to calling getBounds() and ignoring the returned value. + + Call to prepare SkPath subsequently drawn from multiple threads, + to avoid a race condition where each draw separately computes the bounds. + */ + void updateBoundsCache() const { + // for now, just calling getBounds() is sufficient + this->getBounds(); + } + + /** Returns minimum and maximum axes values of the lines and curves in SkPath. + Returns (0, 0, 0, 0) if SkPath contains no points. + Returned bounds width and height may be larger or smaller than area affected + when SkPath is drawn. + + Includes SkPoint associated with kMove_Verb that define empty + contours. + + Behaves identically to getBounds() when SkPath contains + only lines. If SkPath contains curves, computed bounds includes + the maximum extent of the quad, conic, or cubic; is slower than getBounds(); + and unlike getBounds(), does not cache the result. + + @return tight bounds of curves in SkPath + + example: https://fiddle.skia.org/c/@Path_computeTightBounds + */ + SkRect computeTightBounds() const; + + /** Returns true if rect is contained by SkPath. + May return false when rect is contained by SkPath. + + For now, only returns true if SkPath has one contour and is convex. + rect may share points and edges with SkPath and be contained. + Returns true if rect is empty, that is, it has zero width or height; and + the SkPoint or line described by rect is contained by SkPath. + + @param rect SkRect, line, or SkPoint checked for containment + @return true if rect is contained + + example: https://fiddle.skia.org/c/@Path_conservativelyContainsRect + */ + bool conservativelyContainsRect(const SkRect& rect) const; + + /** Grows SkPath verb array and SkPoint array to contain extraPtCount additional SkPoint. + May improve performance and use less memory by + reducing the number and size of allocations when creating SkPath. + + @param extraPtCount number of additional SkPoint to allocate + + example: https://fiddle.skia.org/c/@Path_incReserve + */ + void incReserve(int extraPtCount); + +#ifdef SK_HIDE_PATH_EDIT_METHODS +private: +#endif + + /** Adds beginning of contour at SkPoint (x, y). + + @param x x-axis value of contour start + @param y y-axis value of contour start + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_moveTo + */ + SkPath& moveTo(SkScalar x, SkScalar y); + + /** Adds beginning of contour at SkPoint p. + + @param p contour start + @return reference to SkPath + */ + SkPath& moveTo(const SkPoint& p) { + return this->moveTo(p.fX, p.fY); + } + + /** Adds beginning of contour relative to last point. + If SkPath is empty, starts contour at (dx, dy). + Otherwise, start contour at last point offset by (dx, dy). + Function name stands for "relative move to". + + @param dx offset from last point to contour start on x-axis + @param dy offset from last point to contour start on y-axis + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_rMoveTo + */ + SkPath& rMoveTo(SkScalar dx, SkScalar dy); + + /** Adds line from last point to (x, y). If SkPath is empty, or last SkPath::Verb is + kClose_Verb, last point is set to (0, 0) before adding line. + + lineTo() appends kMove_Verb to verb array and (0, 0) to SkPoint array, if needed. + lineTo() then appends kLine_Verb to verb array and (x, y) to SkPoint array. + + @param x end of added line on x-axis + @param y end of added line on y-axis + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_lineTo + */ + SkPath& lineTo(SkScalar x, SkScalar y); + + /** Adds line from last point to SkPoint p. If SkPath is empty, or last SkPath::Verb is + kClose_Verb, last point is set to (0, 0) before adding line. + + lineTo() first appends kMove_Verb to verb array and (0, 0) to SkPoint array, if needed. + lineTo() then appends kLine_Verb to verb array and SkPoint p to SkPoint array. + + @param p end SkPoint of added line + @return reference to SkPath + */ + SkPath& lineTo(const SkPoint& p) { + return this->lineTo(p.fX, p.fY); + } + + /** Adds line from last point to vector (dx, dy). If SkPath is empty, or last SkPath::Verb is + kClose_Verb, last point is set to (0, 0) before adding line. + + Appends kMove_Verb to verb array and (0, 0) to SkPoint array, if needed; + then appends kLine_Verb to verb array and line end to SkPoint array. + Line end is last point plus vector (dx, dy). + Function name stands for "relative line to". + + @param dx offset from last point to line end on x-axis + @param dy offset from last point to line end on y-axis + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_rLineTo + example: https://fiddle.skia.org/c/@Quad_a + example: https://fiddle.skia.org/c/@Quad_b + */ + SkPath& rLineTo(SkScalar dx, SkScalar dy); + + /** Adds quad from last point towards (x1, y1), to (x2, y2). + If SkPath is empty, or last SkPath::Verb is kClose_Verb, last point is set to (0, 0) + before adding quad. + + Appends kMove_Verb to verb array and (0, 0) to SkPoint array, if needed; + then appends kQuad_Verb to verb array; and (x1, y1), (x2, y2) + to SkPoint array. + + @param x1 control SkPoint of quad on x-axis + @param y1 control SkPoint of quad on y-axis + @param x2 end SkPoint of quad on x-axis + @param y2 end SkPoint of quad on y-axis + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_quadTo + */ + SkPath& quadTo(SkScalar x1, SkScalar y1, SkScalar x2, SkScalar y2); + + /** Adds quad from last point towards SkPoint p1, to SkPoint p2. + If SkPath is empty, or last SkPath::Verb is kClose_Verb, last point is set to (0, 0) + before adding quad. + + Appends kMove_Verb to verb array and (0, 0) to SkPoint array, if needed; + then appends kQuad_Verb to verb array; and SkPoint p1, p2 + to SkPoint array. + + @param p1 control SkPoint of added quad + @param p2 end SkPoint of added quad + @return reference to SkPath + */ + SkPath& quadTo(const SkPoint& p1, const SkPoint& p2) { + return this->quadTo(p1.fX, p1.fY, p2.fX, p2.fY); + } + + /** Adds quad from last point towards vector (dx1, dy1), to vector (dx2, dy2). + If SkPath is empty, or last SkPath::Verb + is kClose_Verb, last point is set to (0, 0) before adding quad. + + Appends kMove_Verb to verb array and (0, 0) to SkPoint array, + if needed; then appends kQuad_Verb to verb array; and appends quad + control and quad end to SkPoint array. + Quad control is last point plus vector (dx1, dy1). + Quad end is last point plus vector (dx2, dy2). + Function name stands for "relative quad to". + + @param dx1 offset from last point to quad control on x-axis + @param dy1 offset from last point to quad control on y-axis + @param dx2 offset from last point to quad end on x-axis + @param dy2 offset from last point to quad end on y-axis + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Conic_Weight_a + example: https://fiddle.skia.org/c/@Conic_Weight_b + example: https://fiddle.skia.org/c/@Conic_Weight_c + example: https://fiddle.skia.org/c/@Path_rQuadTo + */ + SkPath& rQuadTo(SkScalar dx1, SkScalar dy1, SkScalar dx2, SkScalar dy2); + + /** Adds conic from last point towards (x1, y1), to (x2, y2), weighted by w. + If SkPath is empty, or last SkPath::Verb is kClose_Verb, last point is set to (0, 0) + before adding conic. + + Appends kMove_Verb to verb array and (0, 0) to SkPoint array, if needed. + + If w is finite and not one, appends kConic_Verb to verb array; + and (x1, y1), (x2, y2) to SkPoint array; and w to conic weights. + + If w is one, appends kQuad_Verb to verb array, and + (x1, y1), (x2, y2) to SkPoint array. + + If w is not finite, appends kLine_Verb twice to verb array, and + (x1, y1), (x2, y2) to SkPoint array. + + @param x1 control SkPoint of conic on x-axis + @param y1 control SkPoint of conic on y-axis + @param x2 end SkPoint of conic on x-axis + @param y2 end SkPoint of conic on y-axis + @param w weight of added conic + @return reference to SkPath + */ + SkPath& conicTo(SkScalar x1, SkScalar y1, SkScalar x2, SkScalar y2, + SkScalar w); + + /** Adds conic from last point towards SkPoint p1, to SkPoint p2, weighted by w. + If SkPath is empty, or last SkPath::Verb is kClose_Verb, last point is set to (0, 0) + before adding conic. + + Appends kMove_Verb to verb array and (0, 0) to SkPoint array, if needed. + + If w is finite and not one, appends kConic_Verb to verb array; + and SkPoint p1, p2 to SkPoint array; and w to conic weights. + + If w is one, appends kQuad_Verb to verb array, and SkPoint p1, p2 + to SkPoint array. + + If w is not finite, appends kLine_Verb twice to verb array, and + SkPoint p1, p2 to SkPoint array. + + @param p1 control SkPoint of added conic + @param p2 end SkPoint of added conic + @param w weight of added conic + @return reference to SkPath + */ + SkPath& conicTo(const SkPoint& p1, const SkPoint& p2, SkScalar w) { + return this->conicTo(p1.fX, p1.fY, p2.fX, p2.fY, w); + } + + /** Adds conic from last point towards vector (dx1, dy1), to vector (dx2, dy2), + weighted by w. If SkPath is empty, or last SkPath::Verb + is kClose_Verb, last point is set to (0, 0) before adding conic. + + Appends kMove_Verb to verb array and (0, 0) to SkPoint array, + if needed. + + If w is finite and not one, next appends kConic_Verb to verb array, + and w is recorded as conic weight; otherwise, if w is one, appends + kQuad_Verb to verb array; or if w is not finite, appends kLine_Verb + twice to verb array. + + In all cases appends SkPoint control and end to SkPoint array. + control is last point plus vector (dx1, dy1). + end is last point plus vector (dx2, dy2). + + Function name stands for "relative conic to". + + @param dx1 offset from last point to conic control on x-axis + @param dy1 offset from last point to conic control on y-axis + @param dx2 offset from last point to conic end on x-axis + @param dy2 offset from last point to conic end on y-axis + @param w weight of added conic + @return reference to SkPath + */ + SkPath& rConicTo(SkScalar dx1, SkScalar dy1, SkScalar dx2, SkScalar dy2, + SkScalar w); + + /** Adds cubic from last point towards (x1, y1), then towards (x2, y2), ending at + (x3, y3). If SkPath is empty, or last SkPath::Verb is kClose_Verb, last point is set to + (0, 0) before adding cubic. + + Appends kMove_Verb to verb array and (0, 0) to SkPoint array, if needed; + then appends kCubic_Verb to verb array; and (x1, y1), (x2, y2), (x3, y3) + to SkPoint array. + + @param x1 first control SkPoint of cubic on x-axis + @param y1 first control SkPoint of cubic on y-axis + @param x2 second control SkPoint of cubic on x-axis + @param y2 second control SkPoint of cubic on y-axis + @param x3 end SkPoint of cubic on x-axis + @param y3 end SkPoint of cubic on y-axis + @return reference to SkPath + */ + SkPath& cubicTo(SkScalar x1, SkScalar y1, SkScalar x2, SkScalar y2, + SkScalar x3, SkScalar y3); + + /** Adds cubic from last point towards SkPoint p1, then towards SkPoint p2, ending at + SkPoint p3. If SkPath is empty, or last SkPath::Verb is kClose_Verb, last point is set to + (0, 0) before adding cubic. + + Appends kMove_Verb to verb array and (0, 0) to SkPoint array, if needed; + then appends kCubic_Verb to verb array; and SkPoint p1, p2, p3 + to SkPoint array. + + @param p1 first control SkPoint of cubic + @param p2 second control SkPoint of cubic + @param p3 end SkPoint of cubic + @return reference to SkPath + */ + SkPath& cubicTo(const SkPoint& p1, const SkPoint& p2, const SkPoint& p3) { + return this->cubicTo(p1.fX, p1.fY, p2.fX, p2.fY, p3.fX, p3.fY); + } + + /** Adds cubic from last point towards vector (dx1, dy1), then towards + vector (dx2, dy2), to vector (dx3, dy3). + If SkPath is empty, or last SkPath::Verb + is kClose_Verb, last point is set to (0, 0) before adding cubic. + + Appends kMove_Verb to verb array and (0, 0) to SkPoint array, + if needed; then appends kCubic_Verb to verb array; and appends cubic + control and cubic end to SkPoint array. + Cubic control is last point plus vector (dx1, dy1). + Cubic end is last point plus vector (dx2, dy2). + Function name stands for "relative cubic to". + + @param dx1 offset from last point to first cubic control on x-axis + @param dy1 offset from last point to first cubic control on y-axis + @param dx2 offset from last point to second cubic control on x-axis + @param dy2 offset from last point to second cubic control on y-axis + @param dx3 offset from last point to cubic end on x-axis + @param dy3 offset from last point to cubic end on y-axis + @return reference to SkPath + */ + SkPath& rCubicTo(SkScalar dx1, SkScalar dy1, SkScalar dx2, SkScalar dy2, + SkScalar dx3, SkScalar dy3); + + /** Appends arc to SkPath. Arc added is part of ellipse + bounded by oval, from startAngle through sweepAngle. Both startAngle and + sweepAngle are measured in degrees, where zero degrees is aligned with the + positive x-axis, and positive sweeps extends arc clockwise. + + arcTo() adds line connecting SkPath last SkPoint to initial arc SkPoint if forceMoveTo + is false and SkPath is not empty. Otherwise, added contour begins with first point + of arc. Angles greater than -360 and less than 360 are treated modulo 360. + + @param oval bounds of ellipse containing arc + @param startAngle starting angle of arc in degrees + @param sweepAngle sweep, in degrees. Positive is clockwise; treated modulo 360 + @param forceMoveTo true to start a new contour with arc + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_arcTo + */ + SkPath& arcTo(const SkRect& oval, SkScalar startAngle, SkScalar sweepAngle, bool forceMoveTo); + + /** Appends arc to SkPath, after appending line if needed. Arc is implemented by conic + weighted to describe part of circle. Arc is contained by tangent from + last SkPath point to (x1, y1), and tangent from (x1, y1) to (x2, y2). Arc + is part of circle sized to radius, positioned so it touches both tangent lines. + + If last Path Point does not start Arc, arcTo appends connecting Line to Path. + The length of Vector from (x1, y1) to (x2, y2) does not affect Arc. + + Arc sweep is always less than 180 degrees. If radius is zero, or if + tangents are nearly parallel, arcTo appends Line from last Path Point to (x1, y1). + + arcTo appends at most one Line and one conic. + arcTo implements the functionality of PostScript arct and HTML Canvas arcTo. + + @param x1 x-axis value common to pair of tangents + @param y1 y-axis value common to pair of tangents + @param x2 x-axis value end of second tangent + @param y2 y-axis value end of second tangent + @param radius distance from arc to circle center + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_arcTo_2_a + example: https://fiddle.skia.org/c/@Path_arcTo_2_b + example: https://fiddle.skia.org/c/@Path_arcTo_2_c + */ + SkPath& arcTo(SkScalar x1, SkScalar y1, SkScalar x2, SkScalar y2, SkScalar radius); + + /** Appends arc to SkPath, after appending line if needed. Arc is implemented by conic + weighted to describe part of circle. Arc is contained by tangent from + last SkPath point to p1, and tangent from p1 to p2. Arc + is part of circle sized to radius, positioned so it touches both tangent lines. + + If last SkPath SkPoint does not start arc, arcTo() appends connecting line to SkPath. + The length of vector from p1 to p2 does not affect arc. + + Arc sweep is always less than 180 degrees. If radius is zero, or if + tangents are nearly parallel, arcTo() appends line from last SkPath SkPoint to p1. + + arcTo() appends at most one line and one conic. + arcTo() implements the functionality of PostScript arct and HTML Canvas arcTo. + + @param p1 SkPoint common to pair of tangents + @param p2 end of second tangent + @param radius distance from arc to circle center + @return reference to SkPath + */ + SkPath& arcTo(const SkPoint p1, const SkPoint p2, SkScalar radius) { + return this->arcTo(p1.fX, p1.fY, p2.fX, p2.fY, radius); + } + + /** \enum SkPath::ArcSize + Four oval parts with radii (rx, ry) start at last SkPath SkPoint and ends at (x, y). + ArcSize and Direction select one of the four oval parts. + */ + enum ArcSize { + kSmall_ArcSize, //!< smaller of arc pair + kLarge_ArcSize, //!< larger of arc pair + }; + + /** Appends arc to SkPath. Arc is implemented by one or more conics weighted to + describe part of oval with radii (rx, ry) rotated by xAxisRotate degrees. Arc + curves from last SkPath SkPoint to (x, y), choosing one of four possible routes: + clockwise or counterclockwise, and smaller or larger. + + Arc sweep is always less than 360 degrees. arcTo() appends line to (x, y) if + either radii are zero, or if last SkPath SkPoint equals (x, y). arcTo() scales radii + (rx, ry) to fit last SkPath SkPoint and (x, y) if both are greater than zero but + too small. + + arcTo() appends up to four conic curves. + arcTo() implements the functionality of SVG arc, although SVG sweep-flag value + is opposite the integer value of sweep; SVG sweep-flag uses 1 for clockwise, + while kCW_Direction cast to int is zero. + + @param rx radius on x-axis before x-axis rotation + @param ry radius on y-axis before x-axis rotation + @param xAxisRotate x-axis rotation in degrees; positive values are clockwise + @param largeArc chooses smaller or larger arc + @param sweep chooses clockwise or counterclockwise arc + @param x end of arc + @param y end of arc + @return reference to SkPath + */ + SkPath& arcTo(SkScalar rx, SkScalar ry, SkScalar xAxisRotate, ArcSize largeArc, + SkPathDirection sweep, SkScalar x, SkScalar y); + + /** Appends arc to SkPath. Arc is implemented by one or more conic weighted to describe + part of oval with radii (r.fX, r.fY) rotated by xAxisRotate degrees. Arc curves + from last SkPath SkPoint to (xy.fX, xy.fY), choosing one of four possible routes: + clockwise or counterclockwise, + and smaller or larger. + + Arc sweep is always less than 360 degrees. arcTo() appends line to xy if either + radii are zero, or if last SkPath SkPoint equals (xy.fX, xy.fY). arcTo() scales radii r to + fit last SkPath SkPoint and xy if both are greater than zero but too small to describe + an arc. + + arcTo() appends up to four conic curves. + arcTo() implements the functionality of SVG arc, although SVG sweep-flag value is + opposite the integer value of sweep; SVG sweep-flag uses 1 for clockwise, while + kCW_Direction cast to int is zero. + + @param r radii on axes before x-axis rotation + @param xAxisRotate x-axis rotation in degrees; positive values are clockwise + @param largeArc chooses smaller or larger arc + @param sweep chooses clockwise or counterclockwise arc + @param xy end of arc + @return reference to SkPath + */ + SkPath& arcTo(const SkPoint r, SkScalar xAxisRotate, ArcSize largeArc, SkPathDirection sweep, + const SkPoint xy) { + return this->arcTo(r.fX, r.fY, xAxisRotate, largeArc, sweep, xy.fX, xy.fY); + } + + /** Appends arc to SkPath, relative to last SkPath SkPoint. Arc is implemented by one or + more conic, weighted to describe part of oval with radii (rx, ry) rotated by + xAxisRotate degrees. Arc curves from last SkPath SkPoint to relative end SkPoint: + (dx, dy), choosing one of four possible routes: clockwise or + counterclockwise, and smaller or larger. If SkPath is empty, the start arc SkPoint + is (0, 0). + + Arc sweep is always less than 360 degrees. arcTo() appends line to end SkPoint + if either radii are zero, or if last SkPath SkPoint equals end SkPoint. + arcTo() scales radii (rx, ry) to fit last SkPath SkPoint and end SkPoint if both are + greater than zero but too small to describe an arc. + + arcTo() appends up to four conic curves. + arcTo() implements the functionality of svg arc, although SVG "sweep-flag" value is + opposite the integer value of sweep; SVG "sweep-flag" uses 1 for clockwise, while + kCW_Direction cast to int is zero. + + @param rx radius before x-axis rotation + @param ry radius before x-axis rotation + @param xAxisRotate x-axis rotation in degrees; positive values are clockwise + @param largeArc chooses smaller or larger arc + @param sweep chooses clockwise or counterclockwise arc + @param dx x-axis offset end of arc from last SkPath SkPoint + @param dy y-axis offset end of arc from last SkPath SkPoint + @return reference to SkPath + */ + SkPath& rArcTo(SkScalar rx, SkScalar ry, SkScalar xAxisRotate, ArcSize largeArc, + SkPathDirection sweep, SkScalar dx, SkScalar dy); + + /** Appends kClose_Verb to SkPath. A closed contour connects the first and last SkPoint + with line, forming a continuous loop. Open and closed contour draw the same + with SkPaint::kFill_Style. With SkPaint::kStroke_Style, open contour draws + SkPaint::Cap at contour start and end; closed contour draws + SkPaint::Join at contour start and end. + + close() has no effect if SkPath is empty or last SkPath SkPath::Verb is kClose_Verb. + + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_close + */ + SkPath& close(); + +#ifdef SK_HIDE_PATH_EDIT_METHODS +public: +#endif + + /** Approximates conic with quad array. Conic is constructed from start SkPoint p0, + control SkPoint p1, end SkPoint p2, and weight w. + Quad array is stored in pts; this storage is supplied by caller. + Maximum quad count is 2 to the pow2. + Every third point in array shares last SkPoint of previous quad and first SkPoint of + next quad. Maximum pts storage size is given by: + (1 + 2 * (1 << pow2)) * sizeof(SkPoint). + + Returns quad count used the approximation, which may be smaller + than the number requested. + + conic weight determines the amount of influence conic control point has on the curve. + w less than one represents an elliptical section. w greater than one represents + a hyperbolic section. w equal to one represents a parabolic section. + + Two quad curves are sufficient to approximate an elliptical conic with a sweep + of up to 90 degrees; in this case, set pow2 to one. + + @param p0 conic start SkPoint + @param p1 conic control SkPoint + @param p2 conic end SkPoint + @param w conic weight + @param pts storage for quad array + @param pow2 quad count, as power of two, normally 0 to 5 (1 to 32 quad curves) + @return number of quad curves written to pts + */ + static int ConvertConicToQuads(const SkPoint& p0, const SkPoint& p1, const SkPoint& p2, + SkScalar w, SkPoint pts[], int pow2); + + /** Returns true if SkPath is equivalent to SkRect when filled. + If false: rect, isClosed, and direction are unchanged. + If true: rect, isClosed, and direction are written to if not nullptr. + + rect may be smaller than the SkPath bounds. SkPath bounds may include kMove_Verb points + that do not alter the area drawn by the returned rect. + + @param rect storage for bounds of SkRect; may be nullptr + @param isClosed storage set to true if SkPath is closed; may be nullptr + @param direction storage set to SkRect direction; may be nullptr + @return true if SkPath contains SkRect + + example: https://fiddle.skia.org/c/@Path_isRect + */ + bool isRect(SkRect* rect, bool* isClosed = nullptr, SkPathDirection* direction = nullptr) const; + +#ifdef SK_HIDE_PATH_EDIT_METHODS +private: +#endif + + /** Adds a new contour to the path, defined by the rect, and wound in the + specified direction. The verbs added to the path will be: + + kMove, kLine, kLine, kLine, kClose + + start specifies which corner to begin the contour: + 0: upper-left corner + 1: upper-right corner + 2: lower-right corner + 3: lower-left corner + + This start point also acts as the implied beginning of the subsequent, + contour, if it does not have an explicit moveTo(). e.g. + + path.addRect(...) + // if we don't say moveTo() here, we will use the rect's start point + path.lineTo(...) + + @param rect SkRect to add as a closed contour + @param dir SkPath::Direction to orient the new contour + @param start initial corner of SkRect to add + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_addRect_2 + */ + SkPath& addRect(const SkRect& rect, SkPathDirection dir, unsigned start); + + SkPath& addRect(const SkRect& rect, SkPathDirection dir = SkPathDirection::kCW) { + return this->addRect(rect, dir, 0); + } + + SkPath& addRect(SkScalar left, SkScalar top, SkScalar right, SkScalar bottom, + SkPathDirection dir = SkPathDirection::kCW) { + return this->addRect({left, top, right, bottom}, dir, 0); + } + + /** Adds oval to path, appending kMove_Verb, four kConic_Verb, and kClose_Verb. + Oval is upright ellipse bounded by SkRect oval with radii equal to half oval width + and half oval height. Oval begins at (oval.fRight, oval.centerY()) and continues + clockwise if dir is kCW_Direction, counterclockwise if dir is kCCW_Direction. + + @param oval bounds of ellipse added + @param dir SkPath::Direction to wind ellipse + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_addOval + */ + SkPath& addOval(const SkRect& oval, SkPathDirection dir = SkPathDirection::kCW); + + /** Adds oval to SkPath, appending kMove_Verb, four kConic_Verb, and kClose_Verb. + Oval is upright ellipse bounded by SkRect oval with radii equal to half oval width + and half oval height. Oval begins at start and continues + clockwise if dir is kCW_Direction, counterclockwise if dir is kCCW_Direction. + + @param oval bounds of ellipse added + @param dir SkPath::Direction to wind ellipse + @param start index of initial point of ellipse + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_addOval_2 + */ + SkPath& addOval(const SkRect& oval, SkPathDirection dir, unsigned start); + + /** Adds circle centered at (x, y) of size radius to SkPath, appending kMove_Verb, + four kConic_Verb, and kClose_Verb. Circle begins at: (x + radius, y), continuing + clockwise if dir is kCW_Direction, and counterclockwise if dir is kCCW_Direction. + + Has no effect if radius is zero or negative. + + @param x center of circle + @param y center of circle + @param radius distance from center to edge + @param dir SkPath::Direction to wind circle + @return reference to SkPath + */ + SkPath& addCircle(SkScalar x, SkScalar y, SkScalar radius, + SkPathDirection dir = SkPathDirection::kCW); + + /** Appends arc to SkPath, as the start of new contour. Arc added is part of ellipse + bounded by oval, from startAngle through sweepAngle. Both startAngle and + sweepAngle are measured in degrees, where zero degrees is aligned with the + positive x-axis, and positive sweeps extends arc clockwise. + + If sweepAngle <= -360, or sweepAngle >= 360; and startAngle modulo 90 is nearly + zero, append oval instead of arc. Otherwise, sweepAngle values are treated + modulo 360, and arc may or may not draw depending on numeric rounding. + + @param oval bounds of ellipse containing arc + @param startAngle starting angle of arc in degrees + @param sweepAngle sweep, in degrees. Positive is clockwise; treated modulo 360 + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_addArc + */ + SkPath& addArc(const SkRect& oval, SkScalar startAngle, SkScalar sweepAngle); + + /** Appends SkRRect to SkPath, creating a new closed contour. SkRRect has bounds + equal to rect; each corner is 90 degrees of an ellipse with radii (rx, ry). If + dir is kCW_Direction, SkRRect starts at top-left of the lower-left corner and + winds clockwise. If dir is kCCW_Direction, SkRRect starts at the bottom-left + of the upper-left corner and winds counterclockwise. + + If either rx or ry is too large, rx and ry are scaled uniformly until the + corners fit. If rx or ry is less than or equal to zero, addRoundRect() appends + SkRect rect to SkPath. + + After appending, SkPath may be empty, or may contain: SkRect, oval, or SkRRect. + + @param rect bounds of SkRRect + @param rx x-axis radius of rounded corners on the SkRRect + @param ry y-axis radius of rounded corners on the SkRRect + @param dir SkPath::Direction to wind SkRRect + @return reference to SkPath + */ + SkPath& addRoundRect(const SkRect& rect, SkScalar rx, SkScalar ry, + SkPathDirection dir = SkPathDirection::kCW); + + /** Appends SkRRect to SkPath, creating a new closed contour. SkRRect has bounds + equal to rect; each corner is 90 degrees of an ellipse with radii from the + array. + + @param rect bounds of SkRRect + @param radii array of 8 SkScalar values, a radius pair for each corner + @param dir SkPath::Direction to wind SkRRect + @return reference to SkPath + */ + SkPath& addRoundRect(const SkRect& rect, const SkScalar radii[], + SkPathDirection dir = SkPathDirection::kCW); + + /** Adds rrect to SkPath, creating a new closed contour. If + dir is kCW_Direction, rrect starts at top-left of the lower-left corner and + winds clockwise. If dir is kCCW_Direction, rrect starts at the bottom-left + of the upper-left corner and winds counterclockwise. + + After appending, SkPath may be empty, or may contain: SkRect, oval, or SkRRect. + + @param rrect bounds and radii of rounded rectangle + @param dir SkPath::Direction to wind SkRRect + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_addRRect + */ + SkPath& addRRect(const SkRRect& rrect, SkPathDirection dir = SkPathDirection::kCW); + + /** Adds rrect to SkPath, creating a new closed contour. If dir is kCW_Direction, rrect + winds clockwise; if dir is kCCW_Direction, rrect winds counterclockwise. + start determines the first point of rrect to add. + + @param rrect bounds and radii of rounded rectangle + @param dir SkPath::Direction to wind SkRRect + @param start index of initial point of SkRRect + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_addRRect_2 + */ + SkPath& addRRect(const SkRRect& rrect, SkPathDirection dir, unsigned start); + + /** Adds contour created from line array, adding (count - 1) line segments. + Contour added starts at pts[0], then adds a line for every additional SkPoint + in pts array. If close is true, appends kClose_Verb to SkPath, connecting + pts[count - 1] and pts[0]. + + If count is zero, append kMove_Verb to path. + Has no effect if count is less than one. + + @param pts array of line sharing end and start SkPoint + @param count length of SkPoint array + @param close true to add line connecting contour end and start + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_addPoly + */ + SkPath& addPoly(const SkPoint pts[], int count, bool close); + + /** Adds contour created from list. Contour added starts at list[0], then adds a line + for every additional SkPoint in list. If close is true, appends kClose_Verb to SkPath, + connecting last and first SkPoint in list. + + If list is empty, append kMove_Verb to path. + + @param list array of SkPoint + @param close true to add line connecting contour end and start + @return reference to SkPath + */ + SkPath& addPoly(const std::initializer_list<SkPoint>& list, bool close) { + return this->addPoly(list.begin(), SkToInt(list.size()), close); + } + +#ifdef SK_HIDE_PATH_EDIT_METHODS +public: +#endif + + /** \enum SkPath::AddPathMode + AddPathMode chooses how addPath() appends. Adding one SkPath to another can extend + the last contour or start a new contour. + */ + enum AddPathMode { + kAppend_AddPathMode, //!< appended to destination unaltered + kExtend_AddPathMode, //!< add line if prior contour is not closed + }; + + /** Appends src to SkPath, offset by (dx, dy). + + If mode is kAppend_AddPathMode, src verb array, SkPoint array, and conic weights are + added unaltered. If mode is kExtend_AddPathMode, add line before appending + verbs, SkPoint, and conic weights. + + @param src SkPath verbs, SkPoint, and conic weights to add + @param dx offset added to src SkPoint array x-axis coordinates + @param dy offset added to src SkPoint array y-axis coordinates + @param mode kAppend_AddPathMode or kExtend_AddPathMode + @return reference to SkPath + */ + SkPath& addPath(const SkPath& src, SkScalar dx, SkScalar dy, + AddPathMode mode = kAppend_AddPathMode); + + /** Appends src to SkPath. + + If mode is kAppend_AddPathMode, src verb array, SkPoint array, and conic weights are + added unaltered. If mode is kExtend_AddPathMode, add line before appending + verbs, SkPoint, and conic weights. + + @param src SkPath verbs, SkPoint, and conic weights to add + @param mode kAppend_AddPathMode or kExtend_AddPathMode + @return reference to SkPath + */ + SkPath& addPath(const SkPath& src, AddPathMode mode = kAppend_AddPathMode) { + SkMatrix m; + m.reset(); + return this->addPath(src, m, mode); + } + + /** Appends src to SkPath, transformed by matrix. Transformed curves may have different + verbs, SkPoint, and conic weights. + + If mode is kAppend_AddPathMode, src verb array, SkPoint array, and conic weights are + added unaltered. If mode is kExtend_AddPathMode, add line before appending + verbs, SkPoint, and conic weights. + + @param src SkPath verbs, SkPoint, and conic weights to add + @param matrix transform applied to src + @param mode kAppend_AddPathMode or kExtend_AddPathMode + @return reference to SkPath + */ + SkPath& addPath(const SkPath& src, const SkMatrix& matrix, + AddPathMode mode = kAppend_AddPathMode); + + /** Appends src to SkPath, from back to front. + Reversed src always appends a new contour to SkPath. + + @param src SkPath verbs, SkPoint, and conic weights to add + @return reference to SkPath + + example: https://fiddle.skia.org/c/@Path_reverseAddPath + */ + SkPath& reverseAddPath(const SkPath& src); + + /** Offsets SkPoint array by (dx, dy). Offset SkPath replaces dst. + If dst is nullptr, SkPath is replaced by offset data. + + @param dx offset added to SkPoint array x-axis coordinates + @param dy offset added to SkPoint array y-axis coordinates + @param dst overwritten, translated copy of SkPath; may be nullptr + + example: https://fiddle.skia.org/c/@Path_offset + */ + void offset(SkScalar dx, SkScalar dy, SkPath* dst) const; + + /** Offsets SkPoint array by (dx, dy). SkPath is replaced by offset data. + + @param dx offset added to SkPoint array x-axis coordinates + @param dy offset added to SkPoint array y-axis coordinates + */ + void offset(SkScalar dx, SkScalar dy) { + this->offset(dx, dy, this); + } + + /** Transforms verb array, SkPoint array, and weight by matrix. + transform may change verbs and increase their number. + Transformed SkPath replaces dst; if dst is nullptr, original data + is replaced. + + @param matrix SkMatrix to apply to SkPath + @param dst overwritten, transformed copy of SkPath; may be nullptr + @param pc whether to apply perspective clipping + + example: https://fiddle.skia.org/c/@Path_transform + */ + void transform(const SkMatrix& matrix, SkPath* dst, + SkApplyPerspectiveClip pc = SkApplyPerspectiveClip::kYes) const; + + /** Transforms verb array, SkPoint array, and weight by matrix. + transform may change verbs and increase their number. + SkPath is replaced by transformed data. + + @param matrix SkMatrix to apply to SkPath + @param pc whether to apply perspective clipping + */ + void transform(const SkMatrix& matrix, + SkApplyPerspectiveClip pc = SkApplyPerspectiveClip::kYes) { + this->transform(matrix, this, pc); + } + + SkPath makeTransform(const SkMatrix& m, + SkApplyPerspectiveClip pc = SkApplyPerspectiveClip::kYes) const { + SkPath dst; + this->transform(m, &dst, pc); + return dst; + } + + SkPath makeScale(SkScalar sx, SkScalar sy) { + return this->makeTransform(SkMatrix::Scale(sx, sy), SkApplyPerspectiveClip::kNo); + } + + /** Returns last point on SkPath in lastPt. Returns false if SkPoint array is empty, + storing (0, 0) if lastPt is not nullptr. + + @param lastPt storage for final SkPoint in SkPoint array; may be nullptr + @return true if SkPoint array contains one or more SkPoint + + example: https://fiddle.skia.org/c/@Path_getLastPt + */ + bool getLastPt(SkPoint* lastPt) const; + + /** Sets last point to (x, y). If SkPoint array is empty, append kMove_Verb to + verb array and append (x, y) to SkPoint array. + + @param x set x-axis value of last point + @param y set y-axis value of last point + + example: https://fiddle.skia.org/c/@Path_setLastPt + */ + void setLastPt(SkScalar x, SkScalar y); + + /** Sets the last point on the path. If SkPoint array is empty, append kMove_Verb to + verb array and append p to SkPoint array. + + @param p set value of last point + */ + void setLastPt(const SkPoint& p) { + this->setLastPt(p.fX, p.fY); + } + + /** \enum SkPath::SegmentMask + SegmentMask constants correspond to each drawing Verb type in SkPath; for + instance, if SkPath only contains lines, only the kLine_SegmentMask bit is set. + */ + enum SegmentMask { + kLine_SegmentMask = kLine_SkPathSegmentMask, + kQuad_SegmentMask = kQuad_SkPathSegmentMask, + kConic_SegmentMask = kConic_SkPathSegmentMask, + kCubic_SegmentMask = kCubic_SkPathSegmentMask, + }; + + /** Returns a mask, where each set bit corresponds to a SegmentMask constant + if SkPath contains one or more verbs of that type. + Returns zero if SkPath contains no lines, or curves: quads, conics, or cubics. + + getSegmentMasks() returns a cached result; it is very fast. + + @return SegmentMask bits or zero + */ + uint32_t getSegmentMasks() const { return fPathRef->getSegmentMasks(); } + + /** \enum SkPath::Verb + Verb instructs SkPath how to interpret one or more SkPoint and optional conic weight; + manage contour, and terminate SkPath. + */ + enum Verb { + kMove_Verb = static_cast<int>(SkPathVerb::kMove), + kLine_Verb = static_cast<int>(SkPathVerb::kLine), + kQuad_Verb = static_cast<int>(SkPathVerb::kQuad), + kConic_Verb = static_cast<int>(SkPathVerb::kConic), + kCubic_Verb = static_cast<int>(SkPathVerb::kCubic), + kClose_Verb = static_cast<int>(SkPathVerb::kClose), + kDone_Verb = kClose_Verb + 1 + }; + + /** \class SkPath::Iter + Iterates through verb array, and associated SkPoint array and conic weight. + Provides options to treat open contours as closed, and to ignore + degenerate data. + */ + class SK_API Iter { + public: + + /** Initializes SkPath::Iter with an empty SkPath. next() on SkPath::Iter returns + kDone_Verb. + Call setPath to initialize SkPath::Iter at a later time. + + @return SkPath::Iter of empty SkPath + + example: https://fiddle.skia.org/c/@Path_Iter_Iter + */ + Iter(); + + /** Sets SkPath::Iter to return elements of verb array, SkPoint array, and conic weight in + path. If forceClose is true, SkPath::Iter will add kLine_Verb and kClose_Verb after each + open contour. path is not altered. + + @param path SkPath to iterate + @param forceClose true if open contours generate kClose_Verb + @return SkPath::Iter of path + + example: https://fiddle.skia.org/c/@Path_Iter_const_SkPath + */ + Iter(const SkPath& path, bool forceClose); + + /** Sets SkPath::Iter to return elements of verb array, SkPoint array, and conic weight in + path. If forceClose is true, SkPath::Iter will add kLine_Verb and kClose_Verb after each + open contour. path is not altered. + + @param path SkPath to iterate + @param forceClose true if open contours generate kClose_Verb + + example: https://fiddle.skia.org/c/@Path_Iter_setPath + */ + void setPath(const SkPath& path, bool forceClose); + + /** Returns next SkPath::Verb in verb array, and advances SkPath::Iter. + When verb array is exhausted, returns kDone_Verb. + + Zero to four SkPoint are stored in pts, depending on the returned SkPath::Verb. + + @param pts storage for SkPoint data describing returned SkPath::Verb + @return next SkPath::Verb from verb array + + example: https://fiddle.skia.org/c/@Path_RawIter_next + */ + Verb next(SkPoint pts[4]); + + /** Returns conic weight if next() returned kConic_Verb. + + If next() has not been called, or next() did not return kConic_Verb, + result is undefined. + + @return conic weight for conic SkPoint returned by next() + */ + SkScalar conicWeight() const { return *fConicWeights; } + + /** Returns true if last kLine_Verb returned by next() was generated + by kClose_Verb. When true, the end point returned by next() is + also the start point of contour. + + If next() has not been called, or next() did not return kLine_Verb, + result is undefined. + + @return true if last kLine_Verb was generated by kClose_Verb + */ + bool isCloseLine() const { return SkToBool(fCloseLine); } + + /** Returns true if subsequent calls to next() return kClose_Verb before returning + kMove_Verb. if true, contour SkPath::Iter is processing may end with kClose_Verb, or + SkPath::Iter may have been initialized with force close set to true. + + @return true if contour is closed + + example: https://fiddle.skia.org/c/@Path_Iter_isClosedContour + */ + bool isClosedContour() const; + + private: + const SkPoint* fPts; + const uint8_t* fVerbs; + const uint8_t* fVerbStop; + const SkScalar* fConicWeights; + SkPoint fMoveTo; + SkPoint fLastPt; + bool fForceClose; + bool fNeedClose; + bool fCloseLine; + + Verb autoClose(SkPoint pts[2]); + }; + +private: + /** \class SkPath::RangeIter + Iterates through a raw range of path verbs, points, and conics. All values are returned + unaltered. + + NOTE: This class will be moved into SkPathPriv once RangeIter is removed. + */ + class RangeIter { + public: + RangeIter() = default; + RangeIter(const uint8_t* verbs, const SkPoint* points, const SkScalar* weights) + : fVerb(verbs), fPoints(points), fWeights(weights) { + SkDEBUGCODE(fInitialPoints = fPoints;) + } + bool operator!=(const RangeIter& that) const { + return fVerb != that.fVerb; + } + bool operator==(const RangeIter& that) const { + return fVerb == that.fVerb; + } + RangeIter& operator++() { + auto verb = static_cast<SkPathVerb>(*fVerb++); + fPoints += pts_advance_after_verb(verb); + if (verb == SkPathVerb::kConic) { + ++fWeights; + } + return *this; + } + RangeIter operator++(int) { + RangeIter copy = *this; + this->operator++(); + return copy; + } + SkPathVerb peekVerb() const { + return static_cast<SkPathVerb>(*fVerb); + } + std::tuple<SkPathVerb, const SkPoint*, const SkScalar*> operator*() const { + SkPathVerb verb = this->peekVerb(); + // We provide the starting point for beziers by peeking backwards from the current + // point, which works fine as long as there is always a kMove before any geometry. + // (SkPath::injectMoveToIfNeeded should have guaranteed this to be the case.) + int backset = pts_backset_for_verb(verb); + SkASSERT(fPoints + backset >= fInitialPoints); + return {verb, fPoints + backset, fWeights}; + } + private: + constexpr static int pts_advance_after_verb(SkPathVerb verb) { + switch (verb) { + case SkPathVerb::kMove: return 1; + case SkPathVerb::kLine: return 1; + case SkPathVerb::kQuad: return 2; + case SkPathVerb::kConic: return 2; + case SkPathVerb::kCubic: return 3; + case SkPathVerb::kClose: return 0; + } + SkUNREACHABLE; + } + constexpr static int pts_backset_for_verb(SkPathVerb verb) { + switch (verb) { + case SkPathVerb::kMove: return 0; + case SkPathVerb::kLine: return -1; + case SkPathVerb::kQuad: return -1; + case SkPathVerb::kConic: return -1; + case SkPathVerb::kCubic: return -1; + case SkPathVerb::kClose: return -1; + } + SkUNREACHABLE; + } + const uint8_t* fVerb = nullptr; + const SkPoint* fPoints = nullptr; + const SkScalar* fWeights = nullptr; + SkDEBUGCODE(const SkPoint* fInitialPoints = nullptr;) + }; +public: + + /** \class SkPath::RawIter + Use Iter instead. This class will soon be removed and RangeIter will be made private. + */ + class SK_API RawIter { + public: + + /** Initializes RawIter with an empty SkPath. next() on RawIter returns kDone_Verb. + Call setPath to initialize SkPath::Iter at a later time. + + @return RawIter of empty SkPath + */ + RawIter() {} + + /** Sets RawIter to return elements of verb array, SkPoint array, and conic weight in path. + + @param path SkPath to iterate + @return RawIter of path + */ + RawIter(const SkPath& path) { + setPath(path); + } + + /** Sets SkPath::Iter to return elements of verb array, SkPoint array, and conic weight in + path. + + @param path SkPath to iterate + */ + void setPath(const SkPath&); + + /** Returns next SkPath::Verb in verb array, and advances RawIter. + When verb array is exhausted, returns kDone_Verb. + Zero to four SkPoint are stored in pts, depending on the returned SkPath::Verb. + + @param pts storage for SkPoint data describing returned SkPath::Verb + @return next SkPath::Verb from verb array + */ + Verb next(SkPoint[4]); + + /** Returns next SkPath::Verb, but does not advance RawIter. + + @return next SkPath::Verb from verb array + */ + Verb peek() const { + return (fIter != fEnd) ? static_cast<Verb>(std::get<0>(*fIter)) : kDone_Verb; + } + + /** Returns conic weight if next() returned kConic_Verb. + + If next() has not been called, or next() did not return kConic_Verb, + result is undefined. + + @return conic weight for conic SkPoint returned by next() + */ + SkScalar conicWeight() const { + return fConicWeight; + } + + private: + RangeIter fIter; + RangeIter fEnd; + SkScalar fConicWeight = 0; + friend class SkPath; + + }; + + /** Returns true if the point (x, y) is contained by SkPath, taking into + account FillType. + + @param x x-axis value of containment test + @param y y-axis value of containment test + @return true if SkPoint is in SkPath + + example: https://fiddle.skia.org/c/@Path_contains + */ + bool contains(SkScalar x, SkScalar y) const; + + /** Writes text representation of SkPath to stream. If stream is nullptr, writes to + standard output. Set dumpAsHex true to generate exact binary representations + of floating point numbers used in SkPoint array and conic weights. + + @param stream writable SkWStream receiving SkPath text representation; may be nullptr + @param dumpAsHex true if SkScalar values are written as hexadecimal + + example: https://fiddle.skia.org/c/@Path_dump + */ + void dump(SkWStream* stream, bool dumpAsHex) const; + + void dump() const { this->dump(nullptr, false); } + void dumpHex() const { this->dump(nullptr, true); } + + // Like dump(), but outputs for the SkPath::Make() factory + void dumpArrays(SkWStream* stream, bool dumpAsHex) const; + void dumpArrays() const { this->dumpArrays(nullptr, false); } + + /** Writes SkPath to buffer, returning the number of bytes written. + Pass nullptr to obtain the storage size. + + Writes SkPath::FillType, verb array, SkPoint array, conic weight, and + additionally writes computed information like SkPath::Convexity and bounds. + + Use only be used in concert with readFromMemory(); + the format used for SkPath in memory is not guaranteed. + + @param buffer storage for SkPath; may be nullptr + @return size of storage required for SkPath; always a multiple of 4 + + example: https://fiddle.skia.org/c/@Path_writeToMemory + */ + size_t writeToMemory(void* buffer) const; + + /** Writes SkPath to buffer, returning the buffer written to, wrapped in SkData. + + serialize() writes SkPath::FillType, verb array, SkPoint array, conic weight, and + additionally writes computed information like SkPath::Convexity and bounds. + + serialize() should only be used in concert with readFromMemory(). + The format used for SkPath in memory is not guaranteed. + + @return SkPath data wrapped in SkData buffer + + example: https://fiddle.skia.org/c/@Path_serialize + */ + sk_sp<SkData> serialize() const; + + /** Initializes SkPath from buffer of size length. Returns zero if the buffer is + data is inconsistent, or the length is too small. + + Reads SkPath::FillType, verb array, SkPoint array, conic weight, and + additionally reads computed information like SkPath::Convexity and bounds. + + Used only in concert with writeToMemory(); + the format used for SkPath in memory is not guaranteed. + + @param buffer storage for SkPath + @param length buffer size in bytes; must be multiple of 4 + @return number of bytes read, or zero on failure + + example: https://fiddle.skia.org/c/@Path_readFromMemory + */ + size_t readFromMemory(const void* buffer, size_t length); + + /** (See Skia bug 1762.) + Returns a non-zero, globally unique value. A different value is returned + if verb array, SkPoint array, or conic weight changes. + + Setting SkPath::FillType does not change generation identifier. + + Each time the path is modified, a different generation identifier will be returned. + SkPath::FillType does affect generation identifier on Android framework. + + @return non-zero, globally unique value + + example: https://fiddle.skia.org/c/@Path_getGenerationID + */ + uint32_t getGenerationID() const; + + /** Returns if SkPath data is consistent. Corrupt SkPath data is detected if + internal values are out of range or internal storage does not match + array dimensions. + + @return true if SkPath data is consistent + */ + bool isValid() const { return this->isValidImpl() && fPathRef->isValid(); } + +private: + SkPath(sk_sp<SkPathRef>, SkPathFillType, bool isVolatile, SkPathConvexity, + SkPathFirstDirection firstDirection); + + sk_sp<SkPathRef> fPathRef; + int fLastMoveToIndex; + mutable std::atomic<uint8_t> fConvexity; // SkPathConvexity + mutable std::atomic<uint8_t> fFirstDirection; // SkPathFirstDirection + uint8_t fFillType : 2; + uint8_t fIsVolatile : 1; + + /** Resets all fields other than fPathRef to their initial 'empty' values. + * Assumes the caller has already emptied fPathRef. + * On Android increments fGenerationID without reseting it. + */ + void resetFields(); + + /** Sets all fields other than fPathRef to the values in 'that'. + * Assumes the caller has already set fPathRef. + * Doesn't change fGenerationID or fSourcePath on Android. + */ + void copyFields(const SkPath& that); + + size_t writeToMemoryAsRRect(void* buffer) const; + size_t readAsRRect(const void*, size_t); + size_t readFromMemory_EQ4Or5(const void*, size_t); + + friend class Iter; + friend class SkPathPriv; + friend class SkPathStroker; + + /* Append, in reverse order, the first contour of path, ignoring path's + last point. If no moveTo() call has been made for this contour, the + first point is automatically set to (0,0). + */ + SkPath& reversePathTo(const SkPath&); + + // called before we add points for lineTo, quadTo, cubicTo, checking to see + // if we need to inject a leading moveTo first + // + // SkPath path; path.lineTo(...); <--- need a leading moveTo(0, 0) + // SkPath path; ... path.close(); path.lineTo(...) <-- need a moveTo(previous moveTo) + // + inline void injectMoveToIfNeeded(); + + inline bool hasOnlyMoveTos() const; + + SkPathConvexity computeConvexity() const; + + /** Asserts if SkPath data is inconsistent. + Debugging check intended for internal use only. + */ + SkDEBUGCODE(void validate() const { SkASSERT(this->isValidImpl()); } ) + bool isValidImpl() const; + SkDEBUGCODE(void validateRef() const { fPathRef->validate(); } ) + + // called by stroker to see if all points (in the last contour) are equal and worthy of a cap + bool isZeroLengthSincePoint(int startPtIndex) const; + + /** Returns if the path can return a bound at no cost (true) or will have to + perform some computation (false). + */ + bool hasComputedBounds() const { + SkDEBUGCODE(this->validate();) + return fPathRef->hasComputedBounds(); + } + + + // 'rect' needs to be sorted + void setBounds(const SkRect& rect) { + SkPathRef::Editor ed(&fPathRef); + + ed.setBounds(rect); + } + + void setPt(int index, SkScalar x, SkScalar y); + + SkPath& dirtyAfterEdit(); + + // Bottlenecks for working with fConvexity and fFirstDirection. + // Notice the setters are const... these are mutable atomic fields. + void setConvexity(SkPathConvexity) const; + + void setFirstDirection(SkPathFirstDirection) const; + SkPathFirstDirection getFirstDirection() const; + + /** Returns the comvexity type, computing if needed. Never returns kUnknown. + @return path's convexity type (convex or concave) + */ + SkPathConvexity getConvexity() const; + + SkPathConvexity getConvexityOrUnknown() const { + return (SkPathConvexity)fConvexity.load(std::memory_order_relaxed); + } + + // Compares the cached value with a freshly computed one (computeConvexity()) + bool isConvexityAccurate() const; + + /** Stores a convexity type for this path. This is what will be returned if + * getConvexityOrUnknown() is called. If you pass kUnknown, then if getContexityType() + * is called, the real convexity will be computed. + * + * example: https://fiddle.skia.org/c/@Path_setConvexity + */ + void setConvexity(SkPathConvexity convexity); + + /** Shrinks SkPath verb array and SkPoint array storage to discard unused capacity. + * May reduce the heap overhead for SkPath known to be fully constructed. + * + * NOTE: This may relocate the underlying buffers, and thus any Iterators referencing + * this path should be discarded after calling shrinkToFit(). + */ + void shrinkToFit(); + + friend class SkAutoPathBoundsUpdate; + friend class SkAutoDisableOvalCheck; + friend class SkAutoDisableDirectionCheck; + friend class SkPathBuilder; + friend class SkPathEdgeIter; + friend class SkPathWriter; + friend class SkOpBuilder; + friend class SkBench_AddPathTest; // perf test reversePathTo + friend class PathTest_Private; // unit test reversePathTo + friend class ForceIsRRect_Private; // unit test isRRect + friend class FuzzPath; // for legacy access to validateRef +}; + +#endif diff --git a/src/deps/skia/include/core/SkPathBuilder.h b/src/deps/skia/include/core/SkPathBuilder.h new file mode 100644 index 000000000..ec10de87e --- /dev/null +++ b/src/deps/skia/include/core/SkPathBuilder.h @@ -0,0 +1,268 @@ +/* + * Copyright 2015 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPathBuilder_DEFINED +#define SkPathBuilder_DEFINED + +#include "include/core/SkMatrix.h" +#include "include/core/SkPath.h" +#include "include/core/SkPathTypes.h" +#include "include/private/SkTDArray.h" + +class SK_API SkPathBuilder { +public: + SkPathBuilder(); + SkPathBuilder(SkPathFillType); + SkPathBuilder(const SkPath&); + SkPathBuilder(const SkPathBuilder&) = default; + ~SkPathBuilder(); + + SkPathBuilder& operator=(const SkPath&); + SkPathBuilder& operator=(const SkPathBuilder&) = default; + + SkPathFillType fillType() const { return fFillType; } + SkRect computeBounds() const; + + SkPath snapshot() const; // the builder is unchanged after returning this path + SkPath detach(); // the builder is reset to empty after returning this path + + SkPathBuilder& setFillType(SkPathFillType ft) { fFillType = ft; return *this; } + SkPathBuilder& setIsVolatile(bool isVolatile) { fIsVolatile = isVolatile; return *this; } + + SkPathBuilder& reset(); + + SkPathBuilder& moveTo(SkPoint pt); + SkPathBuilder& moveTo(SkScalar x, SkScalar y) { return this->moveTo(SkPoint::Make(x, y)); } + + SkPathBuilder& lineTo(SkPoint pt); + SkPathBuilder& lineTo(SkScalar x, SkScalar y) { return this->lineTo(SkPoint::Make(x, y)); } + + SkPathBuilder& quadTo(SkPoint pt1, SkPoint pt2); + SkPathBuilder& quadTo(SkScalar x1, SkScalar y1, SkScalar x2, SkScalar y2) { + return this->quadTo(SkPoint::Make(x1, y1), SkPoint::Make(x2, y2)); + } + SkPathBuilder& quadTo(const SkPoint pts[2]) { return this->quadTo(pts[0], pts[1]); } + + SkPathBuilder& conicTo(SkPoint pt1, SkPoint pt2, SkScalar w); + SkPathBuilder& conicTo(SkScalar x1, SkScalar y1, SkScalar x2, SkScalar y2, SkScalar w) { + return this->conicTo(SkPoint::Make(x1, y1), SkPoint::Make(x2, y2), w); + } + SkPathBuilder& conicTo(const SkPoint pts[2], SkScalar w) { + return this->conicTo(pts[0], pts[1], w); + } + + SkPathBuilder& cubicTo(SkPoint pt1, SkPoint pt2, SkPoint pt3); + SkPathBuilder& cubicTo(SkScalar x1, SkScalar y1, SkScalar x2, SkScalar y2, SkScalar x3, SkScalar y3) { + return this->cubicTo(SkPoint::Make(x1, y1), SkPoint::Make(x2, y2), SkPoint::Make(x3, y3)); + } + SkPathBuilder& cubicTo(const SkPoint pts[3]) { + return this->cubicTo(pts[0], pts[1], pts[2]); + } + + SkPathBuilder& close(); + + // Append a series of lineTo(...) + SkPathBuilder& polylineTo(const SkPoint pts[], int count); + SkPathBuilder& polylineTo(const std::initializer_list<SkPoint>& list) { + return this->polylineTo(list.begin(), SkToInt(list.size())); + } + + // Relative versions of segments, relative to the previous position. + + SkPathBuilder& rLineTo(SkPoint pt); + SkPathBuilder& rLineTo(SkScalar x, SkScalar y) { return this->rLineTo({x, y}); } + SkPathBuilder& rQuadTo(SkPoint pt1, SkPoint pt2); + SkPathBuilder& rQuadTo(SkScalar x1, SkScalar y1, SkScalar x2, SkScalar y2) { + return this->rQuadTo({x1, y1}, {x2, y2}); + } + SkPathBuilder& rConicTo(SkPoint p1, SkPoint p2, SkScalar w); + SkPathBuilder& rConicTo(SkScalar x1, SkScalar y1, SkScalar x2, SkScalar y2, SkScalar w) { + return this->rConicTo({x1, y1}, {x2, y2}, w); + } + SkPathBuilder& rCubicTo(SkPoint pt1, SkPoint pt2, SkPoint pt3); + SkPathBuilder& rCubicTo(SkScalar x1, SkScalar y1, SkScalar x2, SkScalar y2, SkScalar x3, SkScalar y3) { + return this->rCubicTo({x1, y1}, {x2, y2}, {x3, y3}); + } + + // Arcs + + /** Appends arc to the builder. Arc added is part of ellipse + bounded by oval, from startAngle through sweepAngle. Both startAngle and + sweepAngle are measured in degrees, where zero degrees is aligned with the + positive x-axis, and positive sweeps extends arc clockwise. + + arcTo() adds line connecting the builder's last point to initial arc point if forceMoveTo + is false and the builder is not empty. Otherwise, added contour begins with first point + of arc. Angles greater than -360 and less than 360 are treated modulo 360. + + @param oval bounds of ellipse containing arc + @param startAngleDeg starting angle of arc in degrees + @param sweepAngleDeg sweep, in degrees. Positive is clockwise; treated modulo 360 + @param forceMoveTo true to start a new contour with arc + @return reference to the builder + */ + SkPathBuilder& arcTo(const SkRect& oval, SkScalar startAngleDeg, SkScalar sweepAngleDeg, + bool forceMoveTo); + + /** Appends arc to SkPath, after appending line if needed. Arc is implemented by conic + weighted to describe part of circle. Arc is contained by tangent from + last SkPath point to p1, and tangent from p1 to p2. Arc + is part of circle sized to radius, positioned so it touches both tangent lines. + + If last SkPath SkPoint does not start arc, arcTo() appends connecting line to SkPath. + The length of vector from p1 to p2 does not affect arc. + + Arc sweep is always less than 180 degrees. If radius is zero, or if + tangents are nearly parallel, arcTo() appends line from last SkPath SkPoint to p1. + + arcTo() appends at most one line and one conic. + arcTo() implements the functionality of PostScript arct and HTML Canvas arcTo. + + @param p1 SkPoint common to pair of tangents + @param p2 end of second tangent + @param radius distance from arc to circle center + @return reference to SkPath + */ + SkPathBuilder& arcTo(SkPoint p1, SkPoint p2, SkScalar radius); + + enum ArcSize { + kSmall_ArcSize, //!< smaller of arc pair + kLarge_ArcSize, //!< larger of arc pair + }; + + /** Appends arc to SkPath. Arc is implemented by one or more conic weighted to describe + part of oval with radii (r.fX, r.fY) rotated by xAxisRotate degrees. Arc curves + from last SkPath SkPoint to (xy.fX, xy.fY), choosing one of four possible routes: + clockwise or counterclockwise, + and smaller or larger. + + Arc sweep is always less than 360 degrees. arcTo() appends line to xy if either + radii are zero, or if last SkPath SkPoint equals (xy.fX, xy.fY). arcTo() scales radii r to + fit last SkPath SkPoint and xy if both are greater than zero but too small to describe + an arc. + + arcTo() appends up to four conic curves. + arcTo() implements the functionality of SVG arc, although SVG sweep-flag value is + opposite the integer value of sweep; SVG sweep-flag uses 1 for clockwise, while + kCW_Direction cast to int is zero. + + @param r radii on axes before x-axis rotation + @param xAxisRotate x-axis rotation in degrees; positive values are clockwise + @param largeArc chooses smaller or larger arc + @param sweep chooses clockwise or counterclockwise arc + @param xy end of arc + @return reference to SkPath + */ + SkPathBuilder& arcTo(SkPoint r, SkScalar xAxisRotate, ArcSize largeArc, SkPathDirection sweep, + SkPoint xy); + + /** Appends arc to the builder, as the start of new contour. Arc added is part of ellipse + bounded by oval, from startAngle through sweepAngle. Both startAngle and + sweepAngle are measured in degrees, where zero degrees is aligned with the + positive x-axis, and positive sweeps extends arc clockwise. + + If sweepAngle <= -360, or sweepAngle >= 360; and startAngle modulo 90 is nearly + zero, append oval instead of arc. Otherwise, sweepAngle values are treated + modulo 360, and arc may or may not draw depending on numeric rounding. + + @param oval bounds of ellipse containing arc + @param startAngleDeg starting angle of arc in degrees + @param sweepAngleDeg sweep, in degrees. Positive is clockwise; treated modulo 360 + @return reference to this builder + */ + SkPathBuilder& addArc(const SkRect& oval, SkScalar startAngleDeg, SkScalar sweepAngleDeg); + + // Add a new contour + + SkPathBuilder& addRect(const SkRect&, SkPathDirection, unsigned startIndex); + SkPathBuilder& addOval(const SkRect&, SkPathDirection, unsigned startIndex); + SkPathBuilder& addRRect(const SkRRect&, SkPathDirection, unsigned startIndex); + + SkPathBuilder& addRect(const SkRect& rect, SkPathDirection dir = SkPathDirection::kCW) { + return this->addRect(rect, dir, 0); + } + SkPathBuilder& addOval(const SkRect& rect, SkPathDirection dir = SkPathDirection::kCW) { + // legacy start index: 1 + return this->addOval(rect, dir, 1); + } + SkPathBuilder& addRRect(const SkRRect& rrect, SkPathDirection dir = SkPathDirection::kCW) { + // legacy start indices: 6 (CW) and 7 (CCW) + return this->addRRect(rrect, dir, dir == SkPathDirection::kCW ? 6 : 7); + } + + SkPathBuilder& addCircle(SkScalar center_x, SkScalar center_y, SkScalar radius, + SkPathDirection dir = SkPathDirection::kCW); + + SkPathBuilder& addPolygon(const SkPoint pts[], int count, bool isClosed); + SkPathBuilder& addPolygon(const std::initializer_list<SkPoint>& list, bool isClosed) { + return this->addPolygon(list.begin(), SkToInt(list.size()), isClosed); + } + + SkPathBuilder& addPath(const SkPath&); + + // Performance hint, to reserve extra storage for subsequent calls to lineTo, quadTo, etc. + + void incReserve(int extraPtCount, int extraVerbCount); + void incReserve(int extraPtCount) { + this->incReserve(extraPtCount, extraPtCount); + } + + SkPathBuilder& offset(SkScalar dx, SkScalar dy); + + SkPathBuilder& toggleInverseFillType() { + fFillType = (SkPathFillType)((unsigned)fFillType ^ 2); + return *this; + } + +private: + SkTDArray<SkPoint> fPts; + SkTDArray<uint8_t> fVerbs; + SkTDArray<SkScalar> fConicWeights; + + SkPathFillType fFillType; + bool fIsVolatile; + + unsigned fSegmentMask; + SkPoint fLastMovePoint; + int fLastMoveIndex; // only needed until SkPath is immutable + bool fNeedsMoveVerb; + + enum IsA { + kIsA_JustMoves, // we only have 0 or more moves + kIsA_MoreThanMoves, // we have verbs other than just move + kIsA_Oval, // we are 0 or more moves followed by an oval + kIsA_RRect, // we are 0 or more moves followed by a rrect + }; + IsA fIsA = kIsA_JustMoves; + int fIsAStart = -1; // tracks direction iff fIsA is not unknown + bool fIsACCW = false; // tracks direction iff fIsA is not unknown + + // for testing + SkPathConvexity fOverrideConvexity = SkPathConvexity::kUnknown; + + int countVerbs() const { return fVerbs.count(); } + + // called right before we add a (non-move) verb + void ensureMove() { + fIsA = kIsA_MoreThanMoves; + if (fNeedsMoveVerb) { + this->moveTo(fLastMovePoint); + } + } + + SkPath make(sk_sp<SkPathRef>) const; + + SkPathBuilder& privateReverseAddPath(const SkPath&); + + // For testing + void privateSetConvexity(SkPathConvexity c) { fOverrideConvexity = c; } + + friend class SkPathPriv; +}; + +#endif + diff --git a/src/deps/skia/include/core/SkPathEffect.h b/src/deps/skia/include/core/SkPathEffect.h new file mode 100644 index 000000000..abb370c52 --- /dev/null +++ b/src/deps/skia/include/core/SkPathEffect.h @@ -0,0 +1,106 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPathEffect_DEFINED +#define SkPathEffect_DEFINED + +#include "include/core/SkFlattenable.h" +#include "include/core/SkScalar.h" +// not needed, but some of our clients need it (they don't IWYU) +#include "include/core/SkPath.h" + +class SkPath; +struct SkRect; +class SkStrokeRec; + +/** \class SkPathEffect + + SkPathEffect is the base class for objects in the SkPaint that affect + the geometry of a drawing primitive before it is transformed by the + canvas' matrix and drawn. + + Dashing is implemented as a subclass of SkPathEffect. +*/ +class SK_API SkPathEffect : public SkFlattenable { +public: + /** + * Returns a patheffect that apples each effect (first and second) to the original path, + * and returns a path with the sum of these. + * + * result = first(path) + second(path) + * + */ + static sk_sp<SkPathEffect> MakeSum(sk_sp<SkPathEffect> first, sk_sp<SkPathEffect> second); + + /** + * Returns a patheffect that applies the inner effect to the path, and then applies the + * outer effect to the result of the inner's. + * + * result = outer(inner(path)) + */ + static sk_sp<SkPathEffect> MakeCompose(sk_sp<SkPathEffect> outer, sk_sp<SkPathEffect> inner); + + static SkFlattenable::Type GetFlattenableType() { + return kSkPathEffect_Type; + } + + // move to base? + + enum DashType { + kNone_DashType, //!< ignores the info parameter + kDash_DashType, //!< fills in all of the info parameter + }; + + struct DashInfo { + DashInfo() : fIntervals(nullptr), fCount(0), fPhase(0) {} + DashInfo(SkScalar* intervals, int32_t count, SkScalar phase) + : fIntervals(intervals), fCount(count), fPhase(phase) {} + + SkScalar* fIntervals; //!< Length of on/off intervals for dashed lines + // Even values represent ons, and odds offs + int32_t fCount; //!< Number of intervals in the dash. Should be even number + SkScalar fPhase; //!< Offset into the dashed interval pattern + // mod the sum of all intervals + }; + + DashType asADash(DashInfo* info) const; + + /** + * Given a src path (input) and a stroke-rec (input and output), apply + * this effect to the src path, returning the new path in dst, and return + * true. If this effect cannot be applied, return false and ignore dst + * and stroke-rec. + * + * The stroke-rec specifies the initial request for stroking (if any). + * The effect can treat this as input only, or it can choose to change + * the rec as well. For example, the effect can decide to change the + * stroke's width or join, or the effect can change the rec from stroke + * to fill (or fill to stroke) in addition to returning a new (dst) path. + * + * If this method returns true, the caller will apply (as needed) the + * resulting stroke-rec to dst and then draw. + */ + bool filterPath(SkPath* dst, const SkPath& src, SkStrokeRec*, const SkRect* cullR) const; + + /** Version of filterPath that can be called when the CTM is known. */ + bool filterPath(SkPath* dst, const SkPath& src, SkStrokeRec*, const SkRect* cullR, + const SkMatrix& ctm) const; + + /** True if this path effect requires a valid CTM */ + bool needsCTM() const; + + static sk_sp<SkPathEffect> Deserialize(const void* data, size_t size, + const SkDeserialProcs* procs = nullptr); + +private: + SkPathEffect() = default; + friend class SkPathEffectBase; + + using INHERITED = SkFlattenable; +}; + +#endif diff --git a/src/deps/skia/include/core/SkPathMeasure.h b/src/deps/skia/include/core/SkPathMeasure.h new file mode 100644 index 000000000..2335c7c23 --- /dev/null +++ b/src/deps/skia/include/core/SkPathMeasure.h @@ -0,0 +1,88 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPathMeasure_DEFINED +#define SkPathMeasure_DEFINED + +#include "include/core/SkContourMeasure.h" +#include "include/core/SkPath.h" +#include "include/private/SkTDArray.h" + +class SK_API SkPathMeasure { +public: + SkPathMeasure(); + /** Initialize the pathmeasure with the specified path. The parts of the path that are needed + * are copied, so the client is free to modify/delete the path after this call. + * + * resScale controls the precision of the measure. values > 1 increase the + * precision (and possibly slow down the computation). + */ + SkPathMeasure(const SkPath& path, bool forceClosed, SkScalar resScale = 1); + ~SkPathMeasure(); + + /** Reset the pathmeasure with the specified path. The parts of the path that are needed + * are copied, so the client is free to modify/delete the path after this call.. + */ + void setPath(const SkPath*, bool forceClosed); + + /** Return the total length of the current contour, or 0 if no path + is associated (e.g. resetPath(null)) + */ + SkScalar getLength(); + + /** Pins distance to 0 <= distance <= getLength(), and then computes + the corresponding position and tangent. + Returns false if there is no path, or a zero-length path was specified, in which case + position and tangent are unchanged. + */ + bool SK_WARN_UNUSED_RESULT getPosTan(SkScalar distance, SkPoint* position, + SkVector* tangent); + + enum MatrixFlags { + kGetPosition_MatrixFlag = 0x01, + kGetTangent_MatrixFlag = 0x02, + kGetPosAndTan_MatrixFlag = kGetPosition_MatrixFlag | kGetTangent_MatrixFlag + }; + + /** Pins distance to 0 <= distance <= getLength(), and then computes + the corresponding matrix (by calling getPosTan). + Returns false if there is no path, or a zero-length path was specified, in which case + matrix is unchanged. + */ + bool SK_WARN_UNUSED_RESULT getMatrix(SkScalar distance, SkMatrix* matrix, + MatrixFlags flags = kGetPosAndTan_MatrixFlag); + + /** Given a start and stop distance, return in dst the intervening segment(s). + If the segment is zero-length, return false, else return true. + startD and stopD are pinned to legal values (0..getLength()). If startD > stopD + then return false (and leave dst untouched). + Begin the segment with a moveTo if startWithMoveTo is true + */ + bool getSegment(SkScalar startD, SkScalar stopD, SkPath* dst, bool startWithMoveTo); + + /** Return true if the current contour is closed() + */ + bool isClosed(); + + /** Move to the next contour in the path. Return true if one exists, or false if + we're done with the path. + */ + bool nextContour(); + +#ifdef SK_DEBUG + void dump(); +#endif + +private: + SkContourMeasureIter fIter; + sk_sp<SkContourMeasure> fContour; + + SkPathMeasure(const SkPathMeasure&) = delete; + SkPathMeasure& operator=(const SkPathMeasure&) = delete; +}; + +#endif diff --git a/src/deps/skia/include/core/SkPathTypes.h b/src/deps/skia/include/core/SkPathTypes.h new file mode 100644 index 000000000..f589ea46c --- /dev/null +++ b/src/deps/skia/include/core/SkPathTypes.h @@ -0,0 +1,59 @@ +/* + * Copyright 2019 Google LLC. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPathTypes_DEFINED +#define SkPathTypes_DEFINED + +#include "include/core/SkTypes.h" + +enum class SkPathFillType { + /** Specifies that "inside" is computed by a non-zero sum of signed edge crossings */ + kWinding, + /** Specifies that "inside" is computed by an odd number of edge crossings */ + kEvenOdd, + /** Same as Winding, but draws outside of the path, rather than inside */ + kInverseWinding, + /** Same as EvenOdd, but draws outside of the path, rather than inside */ + kInverseEvenOdd +}; + +static inline bool SkPathFillType_IsEvenOdd(SkPathFillType ft) { + return (static_cast<int>(ft) & 1) != 0; +} + +static inline bool SkPathFillType_IsInverse(SkPathFillType ft) { + return (static_cast<int>(ft) & 2) != 0; +} + +static inline SkPathFillType SkPathFillType_ConvertToNonInverse(SkPathFillType ft) { + return static_cast<SkPathFillType>(static_cast<int>(ft) & 1); +} + +enum class SkPathDirection { + /** clockwise direction for adding closed contours */ + kCW, + /** counter-clockwise direction for adding closed contours */ + kCCW, +}; + +enum SkPathSegmentMask { + kLine_SkPathSegmentMask = 1 << 0, + kQuad_SkPathSegmentMask = 1 << 1, + kConic_SkPathSegmentMask = 1 << 2, + kCubic_SkPathSegmentMask = 1 << 3, +}; + +enum class SkPathVerb { + kMove, //!< SkPath::RawIter returns 1 point + kLine, //!< SkPath::RawIter returns 2 points + kQuad, //!< SkPath::RawIter returns 3 points + kConic, //!< SkPath::RawIter returns 3 points + 1 weight + kCubic, //!< SkPath::RawIter returns 4 points + kClose //!< SkPath::RawIter returns 0 points +}; + +#endif diff --git a/src/deps/skia/include/core/SkPicture.h b/src/deps/skia/include/core/SkPicture.h new file mode 100644 index 000000000..d05f13fc2 --- /dev/null +++ b/src/deps/skia/include/core/SkPicture.h @@ -0,0 +1,280 @@ +/* + * Copyright 2007 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPicture_DEFINED +#define SkPicture_DEFINED + +#include "include/core/SkRect.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkSamplingOptions.h" +#include "include/core/SkShader.h" +#include "include/core/SkTileMode.h" +#include "include/core/SkTypes.h" + +class SkCanvas; +class SkData; +struct SkDeserialProcs; +class SkImage; +class SkMatrix; +struct SkSerialProcs; +class SkStream; +class SkWStream; + +/** \class SkPicture + SkPicture records drawing commands made to SkCanvas. The command stream may be + played in whole or in part at a later time. + + SkPicture is an abstract class. SkPicture may be generated by SkPictureRecorder + or SkDrawable, or from SkPicture previously saved to SkData or SkStream. + + SkPicture may contain any SkCanvas drawing command, as well as one or more + SkCanvas matrix or SkCanvas clip. SkPicture has a cull SkRect, which is used as + a bounding box hint. To limit SkPicture bounds, use SkCanvas clip when + recording or drawing SkPicture. +*/ +class SK_API SkPicture : public SkRefCnt { +public: + ~SkPicture() override; + + /** Recreates SkPicture that was serialized into a stream. Returns constructed SkPicture + if successful; otherwise, returns nullptr. Fails if data does not permit + constructing valid SkPicture. + + procs->fPictureProc permits supplying a custom function to decode SkPicture. + If procs->fPictureProc is nullptr, default decoding is used. procs->fPictureCtx + may be used to provide user context to procs->fPictureProc; procs->fPictureProc + is called with a pointer to data, data byte length, and user context. + + @param stream container for serial data + @param procs custom serial data decoders; may be nullptr + @return SkPicture constructed from stream data + */ + static sk_sp<SkPicture> MakeFromStream(SkStream* stream, + const SkDeserialProcs* procs = nullptr); + + /** Recreates SkPicture that was serialized into data. Returns constructed SkPicture + if successful; otherwise, returns nullptr. Fails if data does not permit + constructing valid SkPicture. + + procs->fPictureProc permits supplying a custom function to decode SkPicture. + If procs->fPictureProc is nullptr, default decoding is used. procs->fPictureCtx + may be used to provide user context to procs->fPictureProc; procs->fPictureProc + is called with a pointer to data, data byte length, and user context. + + @param data container for serial data + @param procs custom serial data decoders; may be nullptr + @return SkPicture constructed from data + */ + static sk_sp<SkPicture> MakeFromData(const SkData* data, + const SkDeserialProcs* procs = nullptr); + + /** + + @param data pointer to serial data + @param size size of data + @param procs custom serial data decoders; may be nullptr + @return SkPicture constructed from data + */ + static sk_sp<SkPicture> MakeFromData(const void* data, size_t size, + const SkDeserialProcs* procs = nullptr); + + /** \class SkPicture::AbortCallback + AbortCallback is an abstract class. An implementation of AbortCallback may + passed as a parameter to SkPicture::playback, to stop it before all drawing + commands have been processed. + + If AbortCallback::abort returns true, SkPicture::playback is interrupted. + */ + class SK_API AbortCallback { + public: + /** Has no effect. + */ + virtual ~AbortCallback() = default; + + /** Stops SkPicture playback when some condition is met. A subclass of + AbortCallback provides an override for abort() that can stop SkPicture::playback. + + The part of SkPicture drawn when aborted is undefined. SkPicture instantiations are + free to stop drawing at different points during playback. + + If the abort happens inside one or more calls to SkCanvas::save(), stack + of SkCanvas matrix and SkCanvas clip values is restored to its state before + SkPicture::playback was called. + + @return true to stop playback + + example: https://fiddle.skia.org/c/@Picture_AbortCallback_abort + */ + virtual bool abort() = 0; + + protected: + AbortCallback() = default; + AbortCallback(const AbortCallback&) = delete; + AbortCallback& operator=(const AbortCallback&) = delete; + }; + + /** Replays the drawing commands on the specified canvas. In the case that the + commands are recorded, each command in the SkPicture is sent separately to canvas. + + To add a single command to draw SkPicture to recording canvas, call + SkCanvas::drawPicture instead. + + @param canvas receiver of drawing commands + @param callback allows interruption of playback + + example: https://fiddle.skia.org/c/@Picture_playback + */ + virtual void playback(SkCanvas* canvas, AbortCallback* callback = nullptr) const = 0; + + /** Returns cull SkRect for this picture, passed in when SkPicture was created. + Returned SkRect does not specify clipping SkRect for SkPicture; cull is hint + of SkPicture bounds. + + SkPicture is free to discard recorded drawing commands that fall outside + cull. + + @return bounds passed when SkPicture was created + + example: https://fiddle.skia.org/c/@Picture_cullRect + */ + virtual SkRect cullRect() const = 0; + + /** Returns a non-zero value unique among SkPicture in Skia process. + + @return identifier for SkPicture + */ + uint32_t uniqueID() const { return fUniqueID; } + + /** Returns storage containing SkData describing SkPicture, using optional custom + encoders. + + procs->fPictureProc permits supplying a custom function to encode SkPicture. + If procs->fPictureProc is nullptr, default encoding is used. procs->fPictureCtx + may be used to provide user context to procs->fPictureProc; procs->fPictureProc + is called with a pointer to SkPicture and user context. + + @param procs custom serial data encoders; may be nullptr + @return storage containing serialized SkPicture + + example: https://fiddle.skia.org/c/@Picture_serialize + */ + sk_sp<SkData> serialize(const SkSerialProcs* procs = nullptr) const; + + /** Writes picture to stream, using optional custom encoders. + + procs->fPictureProc permits supplying a custom function to encode SkPicture. + If procs->fPictureProc is nullptr, default encoding is used. procs->fPictureCtx + may be used to provide user context to procs->fPictureProc; procs->fPictureProc + is called with a pointer to SkPicture and user context. + + @param stream writable serial data stream + @param procs custom serial data encoders; may be nullptr + + example: https://fiddle.skia.org/c/@Picture_serialize_2 + */ + void serialize(SkWStream* stream, const SkSerialProcs* procs = nullptr) const; + + /** Returns a placeholder SkPicture. Result does not draw, and contains only + cull SkRect, a hint of its bounds. Result is immutable; it cannot be changed + later. Result identifier is unique. + + Returned placeholder can be intercepted during playback to insert other + commands into SkCanvas draw stream. + + @param cull placeholder dimensions + @return placeholder with unique identifier + + example: https://fiddle.skia.org/c/@Picture_MakePlaceholder + */ + static sk_sp<SkPicture> MakePlaceholder(SkRect cull); + + /** Returns the approximate number of operations in SkPicture. Returned value + may be greater or less than the number of SkCanvas calls + recorded: some calls may be recorded as more than one operation, other + calls may be optimized away. + + @param nested if true, include the op-counts of nested pictures as well, else + just return count the ops in the top-level picture. + @return approximate operation count + + example: https://fiddle.skia.org/c/@Picture_approximateOpCount + */ + virtual int approximateOpCount(bool nested = false) const = 0; + + /** Returns the approximate byte size of SkPicture. Does not include large objects + referenced by SkPicture. + + @return approximate size + + example: https://fiddle.skia.org/c/@Picture_approximateBytesUsed + */ + virtual size_t approximateBytesUsed() const = 0; + + /** Return a new shader that will draw with this picture. + * + * @param tmx The tiling mode to use when sampling in the x-direction. + * @param tmy The tiling mode to use when sampling in the y-direction. + * @param mode How to filter the tiles + * @param localMatrix Optional matrix used when sampling + * @param tile The tile rectangle in picture coordinates: this represents the subset + * (or superset) of the picture used when building a tile. It is not + * affected by localMatrix and does not imply scaling (only translation + * and cropping). If null, the tile rect is considered equal to the picture + * bounds. + * @return Returns a new shader object. Note: this function never returns null. + */ + sk_sp<SkShader> makeShader(SkTileMode tmx, SkTileMode tmy, SkFilterMode mode, + const SkMatrix* localMatrix, const SkRect* tileRect) const; + + sk_sp<SkShader> makeShader(SkTileMode tmx, SkTileMode tmy, SkFilterMode mode) const { + return this->makeShader(tmx, tmy, mode, nullptr, nullptr); + } + +private: + // Allowed subclasses. + SkPicture(); + friend class SkBigPicture; + friend class SkEmptyPicture; + friend class SkPicturePriv; + template <typename> friend class SkMiniPicture; + + void serialize(SkWStream*, const SkSerialProcs*, class SkRefCntSet* typefaces, + bool textBlobsOnly=false) const; + static sk_sp<SkPicture> MakeFromStream(SkStream*, const SkDeserialProcs*, + class SkTypefacePlayback*); + friend class SkPictureData; + + /** Return true if the SkStream/Buffer represents a serialized picture, and + fills out SkPictInfo. After this function returns, the data source is not + rewound so it will have to be manually reset before passing to + MakeFromStream or MakeFromBuffer. Note, MakeFromStream and + MakeFromBuffer perform this check internally so these entry points are + intended for stand alone tools. + If false is returned, SkPictInfo is unmodified. + */ + static bool StreamIsSKP(SkStream*, struct SkPictInfo*); + static bool BufferIsSKP(class SkReadBuffer*, struct SkPictInfo*); + friend bool SkPicture_StreamIsSKP(SkStream*, struct SkPictInfo*); + + // Returns NULL if this is not an SkBigPicture. + virtual const class SkBigPicture* asSkBigPicture() const { return nullptr; } + + friend struct SkPathCounter; + + static bool IsValidPictInfo(const struct SkPictInfo& info); + static sk_sp<SkPicture> Forwardport(const struct SkPictInfo&, + const class SkPictureData*, + class SkReadBuffer* buffer); + + struct SkPictInfo createHeader() const; + class SkPictureData* backport() const; + + uint32_t fUniqueID; + mutable std::atomic<bool> fAddedToCache{false}; +}; + +#endif diff --git a/src/deps/skia/include/core/SkPictureRecorder.h b/src/deps/skia/include/core/SkPictureRecorder.h new file mode 100644 index 000000000..9bc5d1aa1 --- /dev/null +++ b/src/deps/skia/include/core/SkPictureRecorder.h @@ -0,0 +1,115 @@ +/* + * Copyright 2014 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPictureRecorder_DEFINED +#define SkPictureRecorder_DEFINED + +#include "include/core/SkBBHFactory.h" +#include "include/core/SkPicture.h" +#include "include/core/SkRefCnt.h" + +#ifdef SK_BUILD_FOR_ANDROID_FRAMEWORK +namespace android { + class Picture; +}; +#endif + +class SkCanvas; +class SkDrawable; +class SkMiniRecorder; +class SkPictureRecord; +class SkRecord; +class SkRecorder; + +class SK_API SkPictureRecorder { +public: + SkPictureRecorder(); + ~SkPictureRecorder(); + + enum FinishFlags { + }; + + /** Returns the canvas that records the drawing commands. + @param bounds the cull rect used when recording this picture. Any drawing the falls outside + of this rect is undefined, and may be drawn or it may not. + @param bbh optional acceleration structure + @param recordFlags optional flags that control recording. + @return the canvas. + */ + SkCanvas* beginRecording(const SkRect& bounds, sk_sp<SkBBoxHierarchy> bbh); + + SkCanvas* beginRecording(const SkRect& bounds, SkBBHFactory* bbhFactory = nullptr); + + SkCanvas* beginRecording(SkScalar width, SkScalar height, + SkBBHFactory* bbhFactory = nullptr) { + return this->beginRecording(SkRect::MakeWH(width, height), bbhFactory); + } + + /** Returns the recording canvas if one is active, or NULL if recording is + not active. This does not alter the refcnt on the canvas (if present). + */ + SkCanvas* getRecordingCanvas(); + + /** + * Signal that the caller is done recording. This invalidates the canvas returned by + * beginRecording/getRecordingCanvas. Ownership of the object is passed to the caller, who + * must call unref() when they are done using it. + * + * The returned picture is immutable. If during recording drawables were added to the canvas, + * these will have been "drawn" into a recording canvas, so that this resulting picture will + * reflect their current state, but will not contain a live reference to the drawables + * themselves. + */ + sk_sp<SkPicture> finishRecordingAsPicture(); + + /** + * Signal that the caller is done recording, and update the cull rect to use for bounding + * box hierarchy (BBH) generation. The behavior is the same as calling + * finishRecordingAsPicture(), except that this method updates the cull rect initially passed + * into beginRecording. + * @param cullRect the new culling rectangle to use as the overall bound for BBH generation + * and subsequent culling operations. + * @return the picture containing the recorded content. + */ + sk_sp<SkPicture> finishRecordingAsPictureWithCull(const SkRect& cullRect); + + /** + * Signal that the caller is done recording. This invalidates the canvas returned by + * beginRecording/getRecordingCanvas. Ownership of the object is passed to the caller, who + * must call unref() when they are done using it. + * + * Unlike finishRecordingAsPicture(), which returns an immutable picture, the returned drawable + * may contain live references to other drawables (if they were added to the recording canvas) + * and therefore this drawable will reflect the current state of those nested drawables anytime + * it is drawn or a new picture is snapped from it (by calling drawable->newPictureSnapshot()). + */ + sk_sp<SkDrawable> finishRecordingAsDrawable(); + +private: + void reset(); + + /** Replay the current (partially recorded) operation stream into + canvas. This call doesn't close the current recording. + */ +#ifdef SK_BUILD_FOR_ANDROID_FRAMEWORK + friend class android::Picture; +#endif + friend class SkPictureRecorderReplayTester; // for unit testing + void partialReplay(SkCanvas* canvas) const; + + bool fActivelyRecording; + SkRect fCullRect; + sk_sp<SkBBoxHierarchy> fBBH; + std::unique_ptr<SkRecorder> fRecorder; + sk_sp<SkRecord> fRecord; + std::unique_ptr<SkMiniRecorder> fMiniRecorder; + + SkPictureRecorder(SkPictureRecorder&&) = delete; + SkPictureRecorder& operator=(SkPictureRecorder&&) = delete; +}; + +#endif diff --git a/src/deps/skia/include/core/SkPixelRef.h b/src/deps/skia/include/core/SkPixelRef.h new file mode 100644 index 000000000..0a55ac339 --- /dev/null +++ b/src/deps/skia/include/core/SkPixelRef.h @@ -0,0 +1,123 @@ +/* + * Copyright 2008 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPixelRef_DEFINED +#define SkPixelRef_DEFINED + +#include "include/core/SkBitmap.h" +#include "include/core/SkImageInfo.h" +#include "include/core/SkPixmap.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkSize.h" +#include "include/private/SkIDChangeListener.h" +#include "include/private/SkMutex.h" +#include "include/private/SkTDArray.h" + +#include <atomic> + +struct SkIRect; + +class GrTexture; +class SkDiscardableMemory; + +/** \class SkPixelRef + + This class is the smart container for pixel memory, and is used with SkBitmap. + This class can be shared/accessed between multiple threads. +*/ +class SK_API SkPixelRef : public SkRefCnt { +public: + SkPixelRef(int width, int height, void* addr, size_t rowBytes); + ~SkPixelRef() override; + + SkISize dimensions() const { return {fWidth, fHeight}; } + int width() const { return fWidth; } + int height() const { return fHeight; } + void* pixels() const { return fPixels; } + size_t rowBytes() const { return fRowBytes; } + + /** Returns a non-zero, unique value corresponding to the pixels in this + pixelref. Each time the pixels are changed (and notifyPixelsChanged is + called), a different generation ID will be returned. + */ + uint32_t getGenerationID() const; + + /** + * Call this if you have changed the contents of the pixels. This will in- + * turn cause a different generation ID value to be returned from + * getGenerationID(). + */ + void notifyPixelsChanged(); + + /** Returns true if this pixelref is marked as immutable, meaning that the + contents of its pixels will not change for the lifetime of the pixelref. + */ + bool isImmutable() const { return fMutability != kMutable; } + + /** Marks this pixelref is immutable, meaning that the contents of its + pixels will not change for the lifetime of the pixelref. This state can + be set on a pixelref, but it cannot be cleared once it is set. + */ + void setImmutable(); + + // Register a listener that may be called the next time our generation ID changes. + // + // We'll only call the listener if we're confident that we are the only SkPixelRef with this + // generation ID. If our generation ID changes and we decide not to call the listener, we'll + // never call it: you must add a new listener for each generation ID change. We also won't call + // the listener when we're certain no one knows what our generation ID is. + // + // This can be used to invalidate caches keyed by SkPixelRef generation ID. + // Takes ownership of listener. Threadsafe. + void addGenIDChangeListener(sk_sp<SkIDChangeListener> listener); + + // Call when this pixelref is part of the key to a resourcecache entry. This allows the cache + // to know automatically those entries can be purged when this pixelref is changed or deleted. + void notifyAddedToCache() { + fAddedToCache.store(true); + } + + virtual SkDiscardableMemory* diagnostic_only_getDiscardable() const { return nullptr; } + +protected: + void android_only_reset(int width, int height, size_t rowBytes); + +private: + int fWidth; + int fHeight; + void* fPixels; + size_t fRowBytes; + + // Bottom bit indicates the Gen ID is unique. + bool genIDIsUnique() const { return SkToBool(fTaggedGenID.load() & 1); } + mutable std::atomic<uint32_t> fTaggedGenID; + + SkIDChangeListener::List fGenIDChangeListeners; + + // Set true by caches when they cache content that's derived from the current pixels. + std::atomic<bool> fAddedToCache; + + enum Mutability { + kMutable, // PixelRefs begin mutable. + kTemporarilyImmutable, // Considered immutable, but can revert to mutable. + kImmutable, // Once set to this state, it never leaves. + } fMutability : 8; // easily fits inside a byte + + void needsNewGenID(); + void callGenIDChangeListeners(); + + void setTemporarilyImmutable(); + void restoreMutability(); + friend class SkSurface_Raster; // For the two methods above. + + void setImmutableWithID(uint32_t genID); + friend void SkBitmapCache_setImmutableWithID(SkPixelRef*, uint32_t); + + using INHERITED = SkRefCnt; +}; + +#endif diff --git a/src/deps/skia/include/core/SkPixmap.h b/src/deps/skia/include/core/SkPixmap.h new file mode 100644 index 000000000..ba1268a20 --- /dev/null +++ b/src/deps/skia/include/core/SkPixmap.h @@ -0,0 +1,720 @@ +/* + * Copyright 2015 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPixmap_DEFINED +#define SkPixmap_DEFINED + +#include "include/core/SkColor.h" +#include "include/core/SkImageInfo.h" +#include "include/core/SkSamplingOptions.h" + +class SkData; +struct SkMask; + +/** \class SkPixmap + SkPixmap provides a utility to pair SkImageInfo with pixels and row bytes. + SkPixmap is a low level class which provides convenience functions to access + raster destinations. SkCanvas can not draw SkPixmap, nor does SkPixmap provide + a direct drawing destination. + + Use SkBitmap to draw pixels referenced by SkPixmap; use SkSurface to draw into + pixels referenced by SkPixmap. + + SkPixmap does not try to manage the lifetime of the pixel memory. Use SkPixelRef + to manage pixel memory; SkPixelRef is safe across threads. +*/ +class SK_API SkPixmap { +public: + + /** Creates an empty SkPixmap without pixels, with kUnknown_SkColorType, with + kUnknown_SkAlphaType, and with a width and height of zero. Use + reset() to associate pixels, SkColorType, SkAlphaType, width, and height + after SkPixmap has been created. + + @return empty SkPixmap + */ + SkPixmap() + : fPixels(nullptr), fRowBytes(0), fInfo(SkImageInfo::MakeUnknown(0, 0)) + {} + + /** Creates SkPixmap from info width, height, SkAlphaType, and SkColorType. + addr points to pixels, or nullptr. rowBytes should be info.width() times + info.bytesPerPixel(), or larger. + + No parameter checking is performed; it is up to the caller to ensure that + addr and rowBytes agree with info. + + The memory lifetime of pixels is managed by the caller. When SkPixmap goes + out of scope, addr is unaffected. + + SkPixmap may be later modified by reset() to change its size, pixel type, or + storage. + + @param info width, height, SkAlphaType, SkColorType of SkImageInfo + @param addr pointer to pixels allocated by caller; may be nullptr + @param rowBytes size of one row of addr; width times pixel size, or larger + @return initialized SkPixmap + */ + SkPixmap(const SkImageInfo& info, const void* addr, size_t rowBytes) + : fPixels(addr), fRowBytes(rowBytes), fInfo(info) + {} + + /** Sets width, height, row bytes to zero; pixel address to nullptr; SkColorType to + kUnknown_SkColorType; and SkAlphaType to kUnknown_SkAlphaType. + + The prior pixels are unaffected; it is up to the caller to release pixels + memory if desired. + + example: https://fiddle.skia.org/c/@Pixmap_reset + */ + void reset(); + + /** Sets width, height, SkAlphaType, and SkColorType from info. + Sets pixel address from addr, which may be nullptr. + Sets row bytes from rowBytes, which should be info.width() times + info.bytesPerPixel(), or larger. + + Does not check addr. Asserts if built with SK_DEBUG defined and if rowBytes is + too small to hold one row of pixels. + + The memory lifetime pixels are managed by the caller. When SkPixmap goes + out of scope, addr is unaffected. + + @param info width, height, SkAlphaType, SkColorType of SkImageInfo + @param addr pointer to pixels allocated by caller; may be nullptr + @param rowBytes size of one row of addr; width times pixel size, or larger + + example: https://fiddle.skia.org/c/@Pixmap_reset_2 + */ + void reset(const SkImageInfo& info, const void* addr, size_t rowBytes); + + /** Changes SkColorSpace in SkImageInfo; preserves width, height, SkAlphaType, and + SkColorType in SkImage, and leaves pixel address and row bytes unchanged. + SkColorSpace reference count is incremented. + + @param colorSpace SkColorSpace moved to SkImageInfo + + example: https://fiddle.skia.org/c/@Pixmap_setColorSpace + */ + void setColorSpace(sk_sp<SkColorSpace> colorSpace); + + /** Deprecated. + */ + bool SK_WARN_UNUSED_RESULT reset(const SkMask& mask); + + /** Sets subset width, height, pixel address to intersection of SkPixmap with area, + if intersection is not empty; and return true. Otherwise, leave subset unchanged + and return false. + + Failing to read the return value generates a compile time warning. + + @param subset storage for width, height, pixel address of intersection + @param area bounds to intersect with SkPixmap + @return true if intersection of SkPixmap and area is not empty + */ + bool SK_WARN_UNUSED_RESULT extractSubset(SkPixmap* subset, const SkIRect& area) const; + + /** Returns width, height, SkAlphaType, SkColorType, and SkColorSpace. + + @return reference to SkImageInfo + */ + const SkImageInfo& info() const { return fInfo; } + + /** Returns row bytes, the interval from one pixel row to the next. Row bytes + is at least as large as: width() * info().bytesPerPixel(). + + Returns zero if colorType() is kUnknown_SkColorType. + It is up to the SkBitmap creator to ensure that row bytes is a useful value. + + @return byte length of pixel row + */ + size_t rowBytes() const { return fRowBytes; } + + /** Returns pixel address, the base address corresponding to the pixel origin. + + It is up to the SkPixmap creator to ensure that pixel address is a useful value. + + @return pixel address + */ + const void* addr() const { return fPixels; } + + /** Returns pixel count in each pixel row. Should be equal or less than: + rowBytes() / info().bytesPerPixel(). + + @return pixel width in SkImageInfo + */ + int width() const { return fInfo.width(); } + + /** Returns pixel row count. + + @return pixel height in SkImageInfo + */ + int height() const { return fInfo.height(); } + + /** + * Return the dimensions of the pixmap (from its ImageInfo) + */ + SkISize dimensions() const { return fInfo.dimensions(); } + + SkColorType colorType() const { return fInfo.colorType(); } + + SkAlphaType alphaType() const { return fInfo.alphaType(); } + + /** Returns SkColorSpace, the range of colors, associated with SkImageInfo. The + reference count of SkColorSpace is unchanged. The returned SkColorSpace is + immutable. + + @return SkColorSpace in SkImageInfo, or nullptr + */ + SkColorSpace* colorSpace() const { return fInfo.colorSpace(); } + + /** Returns smart pointer to SkColorSpace, the range of colors, associated with + SkImageInfo. The smart pointer tracks the number of objects sharing this + SkColorSpace reference so the memory is released when the owners destruct. + + The returned SkColorSpace is immutable. + + @return SkColorSpace in SkImageInfo wrapped in a smart pointer + */ + sk_sp<SkColorSpace> refColorSpace() const { return fInfo.refColorSpace(); } + + /** Returns true if SkAlphaType is kOpaque_SkAlphaType. + Does not check if SkColorType allows alpha, or if any pixel value has + transparency. + + @return true if SkImageInfo has opaque SkAlphaType + */ + bool isOpaque() const { return fInfo.isOpaque(); } + + /** Returns SkIRect { 0, 0, width(), height() }. + + @return integral rectangle from origin to width() and height() + */ + SkIRect bounds() const { return SkIRect::MakeWH(this->width(), this->height()); } + + /** Returns number of pixels that fit on row. Should be greater than or equal to + width(). + + @return maximum pixels per row + */ + int rowBytesAsPixels() const { return int(fRowBytes >> this->shiftPerPixel()); } + + /** Returns bit shift converting row bytes to row pixels. + Returns zero for kUnknown_SkColorType. + + @return one of: 0, 1, 2, 3; left shift to convert pixels to bytes + */ + int shiftPerPixel() const { return fInfo.shiftPerPixel(); } + + /** Returns minimum memory required for pixel storage. + Does not include unused memory on last row when rowBytesAsPixels() exceeds width(). + Returns SIZE_MAX if result does not fit in size_t. + Returns zero if height() or width() is 0. + Returns height() times rowBytes() if colorType() is kUnknown_SkColorType. + + @return size in bytes of image buffer + */ + size_t computeByteSize() const { return fInfo.computeByteSize(fRowBytes); } + + /** Returns true if all pixels are opaque. SkColorType determines how pixels + are encoded, and whether pixel describes alpha. Returns true for SkColorType + without alpha in each pixel; for other SkColorType, returns true if all + pixels have alpha values equivalent to 1.0 or greater. + + For SkColorType kRGB_565_SkColorType or kGray_8_SkColorType: always + returns true. For SkColorType kAlpha_8_SkColorType, kBGRA_8888_SkColorType, + kRGBA_8888_SkColorType: returns true if all pixel alpha values are 255. + For SkColorType kARGB_4444_SkColorType: returns true if all pixel alpha values are 15. + For kRGBA_F16_SkColorType: returns true if all pixel alpha values are 1.0 or + greater. + + Returns false for kUnknown_SkColorType. + + @return true if all pixels have opaque values or SkColorType is opaque + + example: https://fiddle.skia.org/c/@Pixmap_computeIsOpaque + */ + bool computeIsOpaque() const; + + /** Returns pixel at (x, y) as unpremultiplied color. + Returns black with alpha if SkColorType is kAlpha_8_SkColorType. + + Input is not validated: out of bounds values of x or y trigger an assert() if + built with SK_DEBUG defined; and returns undefined values or may crash if + SK_RELEASE is defined. Fails if SkColorType is kUnknown_SkColorType or + pixel address is nullptr. + + SkColorSpace in SkImageInfo is ignored. Some color precision may be lost in the + conversion to unpremultiplied color; original pixel data may have additional + precision. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return pixel converted to unpremultiplied color + + example: https://fiddle.skia.org/c/@Pixmap_getColor + */ + SkColor getColor(int x, int y) const; + + /** Look up the pixel at (x,y) and return its alpha component, normalized to [0..1]. + This is roughly equivalent to SkGetColorA(getColor()), but can be more efficent + (and more precise if the pixels store more than 8 bits per component). + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return alpha converted to normalized float + */ + float getAlphaf(int x, int y) const; + + /** Returns readable pixel address at (x, y). Returns nullptr if SkPixelRef is nullptr. + + Input is not validated: out of bounds values of x or y trigger an assert() if + built with SK_DEBUG defined. Returns nullptr if SkColorType is kUnknown_SkColorType. + + Performs a lookup of pixel size; for better performance, call + one of: addr8, addr16, addr32, addr64, or addrF16(). + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return readable generic pointer to pixel + */ + const void* addr(int x, int y) const { + return (const char*)fPixels + fInfo.computeOffset(x, y, fRowBytes); + } + + /** Returns readable base pixel address. Result is addressable as unsigned 8-bit bytes. + Will trigger an assert() if SkColorType is not kAlpha_8_SkColorType or + kGray_8_SkColorType, and is built with SK_DEBUG defined. + + One byte corresponds to one pixel. + + @return readable unsigned 8-bit pointer to pixels + */ + const uint8_t* addr8() const { + SkASSERT(1 == fInfo.bytesPerPixel()); + return reinterpret_cast<const uint8_t*>(fPixels); + } + + /** Returns readable base pixel address. Result is addressable as unsigned 16-bit words. + Will trigger an assert() if SkColorType is not kRGB_565_SkColorType or + kARGB_4444_SkColorType, and is built with SK_DEBUG defined. + + One word corresponds to one pixel. + + @return readable unsigned 16-bit pointer to pixels + */ + const uint16_t* addr16() const { + SkASSERT(2 == fInfo.bytesPerPixel()); + return reinterpret_cast<const uint16_t*>(fPixels); + } + + /** Returns readable base pixel address. Result is addressable as unsigned 32-bit words. + Will trigger an assert() if SkColorType is not kRGBA_8888_SkColorType or + kBGRA_8888_SkColorType, and is built with SK_DEBUG defined. + + One word corresponds to one pixel. + + @return readable unsigned 32-bit pointer to pixels + */ + const uint32_t* addr32() const { + SkASSERT(4 == fInfo.bytesPerPixel()); + return reinterpret_cast<const uint32_t*>(fPixels); + } + + /** Returns readable base pixel address. Result is addressable as unsigned 64-bit words. + Will trigger an assert() if SkColorType is not kRGBA_F16_SkColorType and is built + with SK_DEBUG defined. + + One word corresponds to one pixel. + + @return readable unsigned 64-bit pointer to pixels + */ + const uint64_t* addr64() const { + SkASSERT(8 == fInfo.bytesPerPixel()); + return reinterpret_cast<const uint64_t*>(fPixels); + } + + /** Returns readable base pixel address. Result is addressable as unsigned 16-bit words. + Will trigger an assert() if SkColorType is not kRGBA_F16_SkColorType and is built + with SK_DEBUG defined. + + Each word represents one color component encoded as a half float. + Four words correspond to one pixel. + + @return readable unsigned 16-bit pointer to first component of pixels + */ + const uint16_t* addrF16() const { + SkASSERT(8 == fInfo.bytesPerPixel()); + SkASSERT(kRGBA_F16_SkColorType == fInfo.colorType() || + kRGBA_F16Norm_SkColorType == fInfo.colorType()); + return reinterpret_cast<const uint16_t*>(fPixels); + } + + /** Returns readable pixel address at (x, y). + + Input is not validated: out of bounds values of x or y trigger an assert() if + built with SK_DEBUG defined. + + Will trigger an assert() if SkColorType is not kAlpha_8_SkColorType or + kGray_8_SkColorType, and is built with SK_DEBUG defined. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return readable unsigned 8-bit pointer to pixel at (x, y) + */ + const uint8_t* addr8(int x, int y) const { + SkASSERT((unsigned)x < (unsigned)fInfo.width()); + SkASSERT((unsigned)y < (unsigned)fInfo.height()); + return (const uint8_t*)((const char*)this->addr8() + (size_t)y * fRowBytes + (x << 0)); + } + + /** Returns readable pixel address at (x, y). + + Input is not validated: out of bounds values of x or y trigger an assert() if + built with SK_DEBUG defined. + + Will trigger an assert() if SkColorType is not kRGB_565_SkColorType or + kARGB_4444_SkColorType, and is built with SK_DEBUG defined. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return readable unsigned 16-bit pointer to pixel at (x, y) + */ + const uint16_t* addr16(int x, int y) const { + SkASSERT((unsigned)x < (unsigned)fInfo.width()); + SkASSERT((unsigned)y < (unsigned)fInfo.height()); + return (const uint16_t*)((const char*)this->addr16() + (size_t)y * fRowBytes + (x << 1)); + } + + /** Returns readable pixel address at (x, y). + + Input is not validated: out of bounds values of x or y trigger an assert() if + built with SK_DEBUG defined. + + Will trigger an assert() if SkColorType is not kRGBA_8888_SkColorType or + kBGRA_8888_SkColorType, and is built with SK_DEBUG defined. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return readable unsigned 32-bit pointer to pixel at (x, y) + */ + const uint32_t* addr32(int x, int y) const { + SkASSERT((unsigned)x < (unsigned)fInfo.width()); + SkASSERT((unsigned)y < (unsigned)fInfo.height()); + return (const uint32_t*)((const char*)this->addr32() + (size_t)y * fRowBytes + (x << 2)); + } + + /** Returns readable pixel address at (x, y). + + Input is not validated: out of bounds values of x or y trigger an assert() if + built with SK_DEBUG defined. + + Will trigger an assert() if SkColorType is not kRGBA_F16_SkColorType and is built + with SK_DEBUG defined. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return readable unsigned 64-bit pointer to pixel at (x, y) + */ + const uint64_t* addr64(int x, int y) const { + SkASSERT((unsigned)x < (unsigned)fInfo.width()); + SkASSERT((unsigned)y < (unsigned)fInfo.height()); + return (const uint64_t*)((const char*)this->addr64() + (size_t)y * fRowBytes + (x << 3)); + } + + /** Returns readable pixel address at (x, y). + + Input is not validated: out of bounds values of x or y trigger an assert() if + built with SK_DEBUG defined. + + Will trigger an assert() if SkColorType is not kRGBA_F16_SkColorType and is built + with SK_DEBUG defined. + + Each unsigned 16-bit word represents one color component encoded as a half float. + Four words correspond to one pixel. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return readable unsigned 16-bit pointer to pixel component at (x, y) + */ + const uint16_t* addrF16(int x, int y) const { + SkASSERT(kRGBA_F16_SkColorType == fInfo.colorType() || + kRGBA_F16Norm_SkColorType == fInfo.colorType()); + return reinterpret_cast<const uint16_t*>(this->addr64(x, y)); + } + + /** Returns writable base pixel address. + + @return writable generic base pointer to pixels + */ + void* writable_addr() const { return const_cast<void*>(fPixels); } + + /** Returns writable pixel address at (x, y). + + Input is not validated: out of bounds values of x or y trigger an assert() if + built with SK_DEBUG defined. Returns zero if SkColorType is kUnknown_SkColorType. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return writable generic pointer to pixel + */ + void* writable_addr(int x, int y) const { + return const_cast<void*>(this->addr(x, y)); + } + + /** Returns writable pixel address at (x, y). Result is addressable as unsigned + 8-bit bytes. Will trigger an assert() if SkColorType is not kAlpha_8_SkColorType + or kGray_8_SkColorType, and is built with SK_DEBUG defined. + + One byte corresponds to one pixel. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return writable unsigned 8-bit pointer to pixels + */ + uint8_t* writable_addr8(int x, int y) const { + return const_cast<uint8_t*>(this->addr8(x, y)); + } + + /** Returns writable_addr pixel address at (x, y). Result is addressable as unsigned + 16-bit words. Will trigger an assert() if SkColorType is not kRGB_565_SkColorType + or kARGB_4444_SkColorType, and is built with SK_DEBUG defined. + + One word corresponds to one pixel. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return writable unsigned 16-bit pointer to pixel + */ + uint16_t* writable_addr16(int x, int y) const { + return const_cast<uint16_t*>(this->addr16(x, y)); + } + + /** Returns writable pixel address at (x, y). Result is addressable as unsigned + 32-bit words. Will trigger an assert() if SkColorType is not + kRGBA_8888_SkColorType or kBGRA_8888_SkColorType, and is built with SK_DEBUG + defined. + + One word corresponds to one pixel. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return writable unsigned 32-bit pointer to pixel + */ + uint32_t* writable_addr32(int x, int y) const { + return const_cast<uint32_t*>(this->addr32(x, y)); + } + + /** Returns writable pixel address at (x, y). Result is addressable as unsigned + 64-bit words. Will trigger an assert() if SkColorType is not + kRGBA_F16_SkColorType and is built with SK_DEBUG defined. + + One word corresponds to one pixel. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return writable unsigned 64-bit pointer to pixel + */ + uint64_t* writable_addr64(int x, int y) const { + return const_cast<uint64_t*>(this->addr64(x, y)); + } + + /** Returns writable pixel address at (x, y). Result is addressable as unsigned + 16-bit words. Will trigger an assert() if SkColorType is not + kRGBA_F16_SkColorType and is built with SK_DEBUG defined. + + Each word represents one color component encoded as a half float. + Four words correspond to one pixel. + + @param x column index, zero or greater, and less than width() + @param y row index, zero or greater, and less than height() + @return writable unsigned 16-bit pointer to first component of pixel + */ + uint16_t* writable_addrF16(int x, int y) const { + return reinterpret_cast<uint16_t*>(writable_addr64(x, y)); + } + + /** Copies a SkRect of pixels to dstPixels. Copy starts at (0, 0), and does not + exceed SkPixmap (width(), height()). + + dstInfo specifies width, height, SkColorType, SkAlphaType, and + SkColorSpace of destination. dstRowBytes specifics the gap from one destination + row to the next. Returns true if pixels are copied. Returns false if + dstInfo address equals nullptr, or dstRowBytes is less than dstInfo.minRowBytes(). + + Pixels are copied only if pixel conversion is possible. If SkPixmap colorType() is + kGray_8_SkColorType, or kAlpha_8_SkColorType; dstInfo.colorType() must match. + If SkPixmap colorType() is kGray_8_SkColorType, dstInfo.colorSpace() must match. + If SkPixmap alphaType() is kOpaque_SkAlphaType, dstInfo.alphaType() must + match. If SkPixmap colorSpace() is nullptr, dstInfo.colorSpace() must match. Returns + false if pixel conversion is not possible. + + Returns false if SkPixmap width() or height() is zero or negative. + + @param dstInfo destination width, height, SkColorType, SkAlphaType, SkColorSpace + @param dstPixels destination pixel storage + @param dstRowBytes destination row length + @return true if pixels are copied to dstPixels + */ + bool readPixels(const SkImageInfo& dstInfo, void* dstPixels, size_t dstRowBytes) const { + return this->readPixels(dstInfo, dstPixels, dstRowBytes, 0, 0); + } + + /** Copies a SkRect of pixels to dstPixels. Copy starts at (srcX, srcY), and does not + exceed SkPixmap (width(), height()). + + dstInfo specifies width, height, SkColorType, SkAlphaType, and + SkColorSpace of destination. dstRowBytes specifics the gap from one destination + row to the next. Returns true if pixels are copied. Returns false if + dstInfo address equals nullptr, or dstRowBytes is less than dstInfo.minRowBytes(). + + Pixels are copied only if pixel conversion is possible. If SkPixmap colorType() is + kGray_8_SkColorType, or kAlpha_8_SkColorType; dstInfo.colorType() must match. + If SkPixmap colorType() is kGray_8_SkColorType, dstInfo.colorSpace() must match. + If SkPixmap alphaType() is kOpaque_SkAlphaType, dstInfo.alphaType() must + match. If SkPixmap colorSpace() is nullptr, dstInfo.colorSpace() must match. Returns + false if pixel conversion is not possible. + + srcX and srcY may be negative to copy only top or left of source. Returns + false if SkPixmap width() or height() is zero or negative. Returns false if: + abs(srcX) >= Pixmap width(), or if abs(srcY) >= Pixmap height(). + + @param dstInfo destination width, height, SkColorType, SkAlphaType, SkColorSpace + @param dstPixels destination pixel storage + @param dstRowBytes destination row length + @param srcX column index whose absolute value is less than width() + @param srcY row index whose absolute value is less than height() + @return true if pixels are copied to dstPixels + */ + bool readPixels(const SkImageInfo& dstInfo, void* dstPixels, size_t dstRowBytes, int srcX, + int srcY) const; + + /** Copies a SkRect of pixels to dst. Copy starts at (srcX, srcY), and does not + exceed SkPixmap (width(), height()). dst specifies width, height, SkColorType, + SkAlphaType, and SkColorSpace of destination. Returns true if pixels are copied. + Returns false if dst address equals nullptr, or dst.rowBytes() is less than + dst SkImageInfo::minRowBytes. + + Pixels are copied only if pixel conversion is possible. If SkPixmap colorType() is + kGray_8_SkColorType, or kAlpha_8_SkColorType; dst.info().colorType must match. + If SkPixmap colorType() is kGray_8_SkColorType, dst.info().colorSpace must match. + If SkPixmap alphaType() is kOpaque_SkAlphaType, dst.info().alphaType must + match. If SkPixmap colorSpace() is nullptr, dst.info().colorSpace must match. Returns + false if pixel conversion is not possible. + + srcX and srcY may be negative to copy only top or left of source. Returns + false SkPixmap width() or height() is zero or negative. Returns false if: + abs(srcX) >= Pixmap width(), or if abs(srcY) >= Pixmap height(). + + @param dst SkImageInfo and pixel address to write to + @param srcX column index whose absolute value is less than width() + @param srcY row index whose absolute value is less than height() + @return true if pixels are copied to dst + */ + bool readPixels(const SkPixmap& dst, int srcX, int srcY) const { + return this->readPixels(dst.info(), dst.writable_addr(), dst.rowBytes(), srcX, srcY); + } + + /** Copies pixels inside bounds() to dst. dst specifies width, height, SkColorType, + SkAlphaType, and SkColorSpace of destination. Returns true if pixels are copied. + Returns false if dst address equals nullptr, or dst.rowBytes() is less than + dst SkImageInfo::minRowBytes. + + Pixels are copied only if pixel conversion is possible. If SkPixmap colorType() is + kGray_8_SkColorType, or kAlpha_8_SkColorType; dst SkColorType must match. + If SkPixmap colorType() is kGray_8_SkColorType, dst SkColorSpace must match. + If SkPixmap alphaType() is kOpaque_SkAlphaType, dst SkAlphaType must + match. If SkPixmap colorSpace() is nullptr, dst SkColorSpace must match. Returns + false if pixel conversion is not possible. + + Returns false if SkPixmap width() or height() is zero or negative. + + @param dst SkImageInfo and pixel address to write to + @return true if pixels are copied to dst + */ + bool readPixels(const SkPixmap& dst) const { + return this->readPixels(dst.info(), dst.writable_addr(), dst.rowBytes(), 0, 0); + } + + /** Copies SkBitmap to dst, scaling pixels to fit dst.width() and dst.height(), and + converting pixels to match dst.colorType() and dst.alphaType(). Returns true if + pixels are copied. Returns false if dst address is nullptr, or dst.rowBytes() is + less than dst SkImageInfo::minRowBytes. + + Pixels are copied only if pixel conversion is possible. If SkPixmap colorType() is + kGray_8_SkColorType, or kAlpha_8_SkColorType; dst SkColorType must match. + If SkPixmap colorType() is kGray_8_SkColorType, dst SkColorSpace must match. + If SkPixmap alphaType() is kOpaque_SkAlphaType, dst SkAlphaType must + match. If SkPixmap colorSpace() is nullptr, dst SkColorSpace must match. Returns + false if pixel conversion is not possible. + + Returns false if SkBitmap width() or height() is zero or negative. + + @param dst SkImageInfo and pixel address to write to + @return true if pixels are scaled to fit dst + + example: https://fiddle.skia.org/c/@Pixmap_scalePixels + */ + bool scalePixels(const SkPixmap& dst, const SkSamplingOptions&) const; + + /** Writes color to pixels bounded by subset; returns true on success. + Returns false if colorType() is kUnknown_SkColorType, or if subset does + not intersect bounds(). + + @param color sRGB unpremultiplied color to write + @param subset bounding integer SkRect of written pixels + @return true if pixels are changed + + example: https://fiddle.skia.org/c/@Pixmap_erase + */ + bool erase(SkColor color, const SkIRect& subset) const; + + /** Writes color to pixels inside bounds(); returns true on success. + Returns false if colorType() is kUnknown_SkColorType, or if bounds() + is empty. + + @param color sRGB unpremultiplied color to write + @return true if pixels are changed + */ + bool erase(SkColor color) const { return this->erase(color, this->bounds()); } + + /** Writes color to pixels bounded by subset; returns true on success. + if subset is nullptr, writes colors pixels inside bounds(). Returns false if + colorType() is kUnknown_SkColorType, if subset is not nullptr and does + not intersect bounds(), or if subset is nullptr and bounds() is empty. + + @param color sRGB unpremultiplied color to write + @param subset bounding integer SkRect of pixels to write; may be nullptr + @return true if pixels are changed + + example: https://fiddle.skia.org/c/@Pixmap_erase_3 + */ + bool erase(const SkColor4f& color, const SkIRect* subset = nullptr) const { + return this->erase(color, nullptr, subset); + } + + /** Writes color to pixels bounded by subset; returns true on success. + if subset is nullptr, writes colors pixels inside bounds(). Returns false if + colorType() is kUnknown_SkColorType, if subset is not nullptr and does + not intersect bounds(), or if subset is nullptr and bounds() is empty. + + @param color unpremultiplied color to write + @param cs SkColorSpace of color + @param subset bounding integer SkRect of pixels to write; may be nullptr + @return true if pixels are changed + */ + bool erase(const SkColor4f& color, SkColorSpace* cs, const SkIRect* subset = nullptr) const; + +private: + const void* fPixels; + size_t fRowBytes; + SkImageInfo fInfo; + + friend class SkPixmapPriv; +}; + +#endif diff --git a/src/deps/skia/include/core/SkPngChunkReader.h b/src/deps/skia/include/core/SkPngChunkReader.h new file mode 100644 index 000000000..0ee8a9ecc --- /dev/null +++ b/src/deps/skia/include/core/SkPngChunkReader.h @@ -0,0 +1,45 @@ +/* + * Copyright 2015 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPngChunkReader_DEFINED +#define SkPngChunkReader_DEFINED + +#include "include/core/SkRefCnt.h" +#include "include/core/SkTypes.h" + +/** + * SkPngChunkReader + * + * Base class for optional callbacks to retrieve meta/chunk data out of a PNG + * encoded image as it is being decoded. + * Used by SkCodec. + */ +class SkPngChunkReader : public SkRefCnt { +public: + /** + * This will be called by the decoder when it sees an unknown chunk. + * + * Use by SkCodec: + * Depending on the location of the unknown chunks, this callback may be + * called by + * - the factory (NewFromStream/NewFromData) + * - getPixels + * - startScanlineDecode + * - the first call to getScanlines/skipScanlines + * The callback may be called from a different thread (e.g. if the SkCodec + * is passed to another thread), and it may be called multiple times, if + * the SkCodec is used multiple times. + * + * @param tag Name for this type of chunk. + * @param data Data to be interpreted by the subclass. + * @param length Number of bytes of data in the chunk. + * @return true to continue decoding, or false to indicate an error, which + * will cause the decoder to not return the image. + */ + virtual bool readChunk(const char tag[], const void* data, size_t length) = 0; +}; +#endif // SkPngChunkReader_DEFINED diff --git a/src/deps/skia/include/core/SkPoint.h b/src/deps/skia/include/core/SkPoint.h new file mode 100644 index 000000000..92cb0b7f0 --- /dev/null +++ b/src/deps/skia/include/core/SkPoint.h @@ -0,0 +1,566 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPoint_DEFINED +#define SkPoint_DEFINED + +#include "include/core/SkMath.h" +#include "include/core/SkScalar.h" +#include "include/private/SkSafe32.h" + +struct SkIPoint; + +/** SkIVector provides an alternative name for SkIPoint. SkIVector and SkIPoint + can be used interchangeably for all purposes. +*/ +typedef SkIPoint SkIVector; + +/** \struct SkIPoint + SkIPoint holds two 32-bit integer coordinates. +*/ +struct SkIPoint { + int32_t fX; //!< x-axis value + int32_t fY; //!< y-axis value + + /** Sets fX to x, fY to y. + + @param x integer x-axis value of constructed SkIPoint + @param y integer y-axis value of constructed SkIPoint + @return SkIPoint (x, y) + */ + static constexpr SkIPoint Make(int32_t x, int32_t y) { + return {x, y}; + } + + /** Returns x-axis value of SkIPoint. + + @return fX + */ + constexpr int32_t x() const { return fX; } + + /** Returns y-axis value of SkIPoint. + + @return fY + */ + constexpr int32_t y() const { return fY; } + + /** Returns true if fX and fY are both zero. + + @return true if fX is zero and fY is zero + */ + bool isZero() const { return (fX | fY) == 0; } + + /** Sets fX to x and fY to y. + + @param x new value for fX + @param y new value for fY + */ + void set(int32_t x, int32_t y) { + fX = x; + fY = y; + } + + /** Returns SkIPoint changing the signs of fX and fY. + + @return SkIPoint as (-fX, -fY) + */ + SkIPoint operator-() const { + return {-fX, -fY}; + } + + /** Offsets SkIPoint by ivector v. Sets SkIPoint to (fX + v.fX, fY + v.fY). + + @param v ivector to add + */ + void operator+=(const SkIVector& v) { + fX = Sk32_sat_add(fX, v.fX); + fY = Sk32_sat_add(fY, v.fY); + } + + /** Subtracts ivector v from SkIPoint. Sets SkIPoint to: (fX - v.fX, fY - v.fY). + + @param v ivector to subtract + */ + void operator-=(const SkIVector& v) { + fX = Sk32_sat_sub(fX, v.fX); + fY = Sk32_sat_sub(fY, v.fY); + } + + /** Returns true if SkIPoint is equivalent to SkIPoint constructed from (x, y). + + @param x value compared with fX + @param y value compared with fY + @return true if SkIPoint equals (x, y) + */ + bool equals(int32_t x, int32_t y) const { + return fX == x && fY == y; + } + + /** Returns true if a is equivalent to b. + + @param a SkIPoint to compare + @param b SkIPoint to compare + @return true if a.fX == b.fX and a.fY == b.fY + */ + friend bool operator==(const SkIPoint& a, const SkIPoint& b) { + return a.fX == b.fX && a.fY == b.fY; + } + + /** Returns true if a is not equivalent to b. + + @param a SkIPoint to compare + @param b SkIPoint to compare + @return true if a.fX != b.fX or a.fY != b.fY + */ + friend bool operator!=(const SkIPoint& a, const SkIPoint& b) { + return a.fX != b.fX || a.fY != b.fY; + } + + /** Returns ivector from b to a; computed as (a.fX - b.fX, a.fY - b.fY). + + Can also be used to subtract ivector from ivector, returning ivector. + + @param a SkIPoint or ivector to subtract from + @param b ivector to subtract + @return ivector from b to a + */ + friend SkIVector operator-(const SkIPoint& a, const SkIPoint& b) { + return { Sk32_sat_sub(a.fX, b.fX), Sk32_sat_sub(a.fY, b.fY) }; + } + + /** Returns SkIPoint resulting from SkIPoint a offset by ivector b, computed as: + (a.fX + b.fX, a.fY + b.fY). + + Can also be used to offset SkIPoint b by ivector a, returning SkIPoint. + Can also be used to add ivector to ivector, returning ivector. + + @param a SkIPoint or ivector to add to + @param b SkIPoint or ivector to add + @return SkIPoint equal to a offset by b + */ + friend SkIPoint operator+(const SkIPoint& a, const SkIVector& b) { + return { Sk32_sat_add(a.fX, b.fX), Sk32_sat_add(a.fY, b.fY) }; + } +}; + +struct SkPoint; + +/** SkVector provides an alternative name for SkPoint. SkVector and SkPoint can + be used interchangeably for all purposes. +*/ +typedef SkPoint SkVector; + +/** \struct SkPoint + SkPoint holds two 32-bit floating point coordinates. +*/ +struct SK_API SkPoint { + SkScalar fX; //!< x-axis value + SkScalar fY; //!< y-axis value + + /** Sets fX to x, fY to y. Used both to set SkPoint and vector. + + @param x SkScalar x-axis value of constructed SkPoint or vector + @param y SkScalar y-axis value of constructed SkPoint or vector + @return SkPoint (x, y) + */ + static constexpr SkPoint Make(SkScalar x, SkScalar y) { + return {x, y}; + } + + /** Returns x-axis value of SkPoint or vector. + + @return fX + */ + constexpr SkScalar x() const { return fX; } + + /** Returns y-axis value of SkPoint or vector. + + @return fY + */ + constexpr SkScalar y() const { return fY; } + + /** Returns true if fX and fY are both zero. + + @return true if fX is zero and fY is zero + */ + bool isZero() const { return (0 == fX) & (0 == fY); } + + /** Sets fX to x and fY to y. + + @param x new value for fX + @param y new value for fY + */ + void set(SkScalar x, SkScalar y) { + fX = x; + fY = y; + } + + /** Sets fX to x and fY to y, promoting integers to SkScalar values. + + Assigning a large integer value directly to fX or fY may cause a compiler + error, triggered by narrowing conversion of int to SkScalar. This safely + casts x and y to avoid the error. + + @param x new value for fX + @param y new value for fY + */ + void iset(int32_t x, int32_t y) { + fX = SkIntToScalar(x); + fY = SkIntToScalar(y); + } + + /** Sets fX to p.fX and fY to p.fY, promoting integers to SkScalar values. + + Assigning an SkIPoint containing a large integer value directly to fX or fY may + cause a compiler error, triggered by narrowing conversion of int to SkScalar. + This safely casts p.fX and p.fY to avoid the error. + + @param p SkIPoint members promoted to SkScalar + */ + void iset(const SkIPoint& p) { + fX = SkIntToScalar(p.fX); + fY = SkIntToScalar(p.fY); + } + + /** Sets fX to absolute value of pt.fX; and fY to absolute value of pt.fY. + + @param pt members providing magnitude for fX and fY + */ + void setAbs(const SkPoint& pt) { + fX = SkScalarAbs(pt.fX); + fY = SkScalarAbs(pt.fY); + } + + /** Adds offset to each SkPoint in points array with count entries. + + @param points SkPoint array + @param count entries in array + @param offset vector added to points + */ + static void Offset(SkPoint points[], int count, const SkVector& offset) { + Offset(points, count, offset.fX, offset.fY); + } + + /** Adds offset (dx, dy) to each SkPoint in points array of length count. + + @param points SkPoint array + @param count entries in array + @param dx added to fX in points + @param dy added to fY in points + */ + static void Offset(SkPoint points[], int count, SkScalar dx, SkScalar dy) { + for (int i = 0; i < count; ++i) { + points[i].offset(dx, dy); + } + } + + /** Adds offset (dx, dy) to SkPoint. + + @param dx added to fX + @param dy added to fY + */ + void offset(SkScalar dx, SkScalar dy) { + fX += dx; + fY += dy; + } + + /** Returns the Euclidean distance from origin, computed as: + + sqrt(fX * fX + fY * fY) + + . + + @return straight-line distance to origin + */ + SkScalar length() const { return SkPoint::Length(fX, fY); } + + /** Returns the Euclidean distance from origin, computed as: + + sqrt(fX * fX + fY * fY) + + . + + @return straight-line distance to origin + */ + SkScalar distanceToOrigin() const { return this->length(); } + + /** Scales (fX, fY) so that length() returns one, while preserving ratio of fX to fY, + if possible. If prior length is nearly zero, sets vector to (0, 0) and returns + false; otherwise returns true. + + @return true if former length is not zero or nearly zero + + example: https://fiddle.skia.org/c/@Point_normalize_2 + */ + bool normalize(); + + /** Sets vector to (x, y) scaled so length() returns one, and so that + (fX, fY) is proportional to (x, y). If (x, y) length is nearly zero, + sets vector to (0, 0) and returns false; otherwise returns true. + + @param x proportional value for fX + @param y proportional value for fY + @return true if (x, y) length is not zero or nearly zero + + example: https://fiddle.skia.org/c/@Point_setNormalize + */ + bool setNormalize(SkScalar x, SkScalar y); + + /** Scales vector so that distanceToOrigin() returns length, if possible. If former + length is nearly zero, sets vector to (0, 0) and return false; otherwise returns + true. + + @param length straight-line distance to origin + @return true if former length is not zero or nearly zero + + example: https://fiddle.skia.org/c/@Point_setLength + */ + bool setLength(SkScalar length); + + /** Sets vector to (x, y) scaled to length, if possible. If former + length is nearly zero, sets vector to (0, 0) and return false; otherwise returns + true. + + @param x proportional value for fX + @param y proportional value for fY + @param length straight-line distance to origin + @return true if (x, y) length is not zero or nearly zero + + example: https://fiddle.skia.org/c/@Point_setLength_2 + */ + bool setLength(SkScalar x, SkScalar y, SkScalar length); + + /** Sets dst to SkPoint times scale. dst may be SkPoint to modify SkPoint in place. + + @param scale factor to multiply SkPoint by + @param dst storage for scaled SkPoint + + example: https://fiddle.skia.org/c/@Point_scale + */ + void scale(SkScalar scale, SkPoint* dst) const; + + /** Scales SkPoint in place by scale. + + @param value factor to multiply SkPoint by + */ + void scale(SkScalar value) { this->scale(value, this); } + + /** Changes the sign of fX and fY. + */ + void negate() { + fX = -fX; + fY = -fY; + } + + /** Returns SkPoint changing the signs of fX and fY. + + @return SkPoint as (-fX, -fY) + */ + SkPoint operator-() const { + return {-fX, -fY}; + } + + /** Adds vector v to SkPoint. Sets SkPoint to: (fX + v.fX, fY + v.fY). + + @param v vector to add + */ + void operator+=(const SkVector& v) { + fX += v.fX; + fY += v.fY; + } + + /** Subtracts vector v from SkPoint. Sets SkPoint to: (fX - v.fX, fY - v.fY). + + @param v vector to subtract + */ + void operator-=(const SkVector& v) { + fX -= v.fX; + fY -= v.fY; + } + + /** Returns SkPoint multiplied by scale. + + @param scale scalar to multiply by + @return SkPoint as (fX * scale, fY * scale) + */ + SkPoint operator*(SkScalar scale) const { + return {fX * scale, fY * scale}; + } + + /** Multiplies SkPoint by scale. Sets SkPoint to: (fX * scale, fY * scale). + + @param scale scalar to multiply by + @return reference to SkPoint + */ + SkPoint& operator*=(SkScalar scale) { + fX *= scale; + fY *= scale; + return *this; + } + + /** Returns true if both fX and fY are measurable values. + + @return true for values other than infinities and NaN + */ + bool isFinite() const { + SkScalar accum = 0; + accum *= fX; + accum *= fY; + + // accum is either NaN or it is finite (zero). + SkASSERT(0 == accum || SkScalarIsNaN(accum)); + + // value==value will be true iff value is not NaN + // TODO: is it faster to say !accum or accum==accum? + return !SkScalarIsNaN(accum); + } + + /** Returns true if SkPoint is equivalent to SkPoint constructed from (x, y). + + @param x value compared with fX + @param y value compared with fY + @return true if SkPoint equals (x, y) + */ + bool equals(SkScalar x, SkScalar y) const { + return fX == x && fY == y; + } + + /** Returns true if a is equivalent to b. + + @param a SkPoint to compare + @param b SkPoint to compare + @return true if a.fX == b.fX and a.fY == b.fY + */ + friend bool operator==(const SkPoint& a, const SkPoint& b) { + return a.fX == b.fX && a.fY == b.fY; + } + + /** Returns true if a is not equivalent to b. + + @param a SkPoint to compare + @param b SkPoint to compare + @return true if a.fX != b.fX or a.fY != b.fY + */ + friend bool operator!=(const SkPoint& a, const SkPoint& b) { + return a.fX != b.fX || a.fY != b.fY; + } + + /** Returns vector from b to a, computed as (a.fX - b.fX, a.fY - b.fY). + + Can also be used to subtract vector from SkPoint, returning SkPoint. + Can also be used to subtract vector from vector, returning vector. + + @param a SkPoint to subtract from + @param b SkPoint to subtract + @return vector from b to a + */ + friend SkVector operator-(const SkPoint& a, const SkPoint& b) { + return {a.fX - b.fX, a.fY - b.fY}; + } + + /** Returns SkPoint resulting from SkPoint a offset by vector b, computed as: + (a.fX + b.fX, a.fY + b.fY). + + Can also be used to offset SkPoint b by vector a, returning SkPoint. + Can also be used to add vector to vector, returning vector. + + @param a SkPoint or vector to add to + @param b SkPoint or vector to add + @return SkPoint equal to a offset by b + */ + friend SkPoint operator+(const SkPoint& a, const SkVector& b) { + return {a.fX + b.fX, a.fY + b.fY}; + } + + /** Returns the Euclidean distance from origin, computed as: + + sqrt(x * x + y * y) + + . + + @param x component of length + @param y component of length + @return straight-line distance to origin + + example: https://fiddle.skia.org/c/@Point_Length + */ + static SkScalar Length(SkScalar x, SkScalar y); + + /** Scales (vec->fX, vec->fY) so that length() returns one, while preserving ratio of vec->fX + to vec->fY, if possible. If original length is nearly zero, sets vec to (0, 0) and returns + zero; otherwise, returns length of vec before vec is scaled. + + Returned prior length may be SK_ScalarInfinity if it can not be represented by SkScalar. + + Note that normalize() is faster if prior length is not required. + + @param vec normalized to unit length + @return original vec length + + example: https://fiddle.skia.org/c/@Point_Normalize + */ + static SkScalar Normalize(SkVector* vec); + + /** Returns the Euclidean distance between a and b. + + @param a line end point + @param b line end point + @return straight-line distance from a to b + */ + static SkScalar Distance(const SkPoint& a, const SkPoint& b) { + return Length(a.fX - b.fX, a.fY - b.fY); + } + + /** Returns the dot product of vector a and vector b. + + @param a left side of dot product + @param b right side of dot product + @return product of input magnitudes and cosine of the angle between them + */ + static SkScalar DotProduct(const SkVector& a, const SkVector& b) { + return a.fX * b.fX + a.fY * b.fY; + } + + /** Returns the cross product of vector a and vector b. + + a and b form three-dimensional vectors with z-axis value equal to zero. The + cross product is a three-dimensional vector with x-axis and y-axis values equal + to zero. The cross product z-axis component is returned. + + @param a left side of cross product + @param b right side of cross product + @return area spanned by vectors signed by angle direction + */ + static SkScalar CrossProduct(const SkVector& a, const SkVector& b) { + return a.fX * b.fY - a.fY * b.fX; + } + + /** Returns the cross product of vector and vec. + + Vector and vec form three-dimensional vectors with z-axis value equal to zero. + The cross product is a three-dimensional vector with x-axis and y-axis values + equal to zero. The cross product z-axis component is returned. + + @param vec right side of cross product + @return area spanned by vectors signed by angle direction + */ + SkScalar cross(const SkVector& vec) const { + return CrossProduct(*this, vec); + } + + /** Returns the dot product of vector and vector vec. + + @param vec right side of dot product + @return product of input magnitudes and cosine of the angle between them + */ + SkScalar dot(const SkVector& vec) const { + return DotProduct(*this, vec); + } + +}; + +#endif diff --git a/src/deps/skia/include/core/SkPoint3.h b/src/deps/skia/include/core/SkPoint3.h new file mode 100644 index 000000000..e372f8279 --- /dev/null +++ b/src/deps/skia/include/core/SkPoint3.h @@ -0,0 +1,157 @@ +/* + * Copyright 2015 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPoint3_DEFINED +#define SkPoint3_DEFINED + +#include "include/core/SkPoint.h" + +struct SK_API SkPoint3 { + SkScalar fX, fY, fZ; + + static SkPoint3 Make(SkScalar x, SkScalar y, SkScalar z) { + SkPoint3 pt; + pt.set(x, y, z); + return pt; + } + + SkScalar x() const { return fX; } + SkScalar y() const { return fY; } + SkScalar z() const { return fZ; } + + void set(SkScalar x, SkScalar y, SkScalar z) { fX = x; fY = y; fZ = z; } + + friend bool operator==(const SkPoint3& a, const SkPoint3& b) { + return a.fX == b.fX && a.fY == b.fY && a.fZ == b.fZ; + } + + friend bool operator!=(const SkPoint3& a, const SkPoint3& b) { + return !(a == b); + } + + /** Returns the Euclidian distance from (0,0,0) to (x,y,z) + */ + static SkScalar Length(SkScalar x, SkScalar y, SkScalar z); + + /** Return the Euclidian distance from (0,0,0) to the point + */ + SkScalar length() const { return SkPoint3::Length(fX, fY, fZ); } + + /** Set the point (vector) to be unit-length in the same direction as it + already points. If the point has a degenerate length (i.e., nearly 0) + then set it to (0,0,0) and return false; otherwise return true. + */ + bool normalize(); + + /** Return a new point whose X, Y and Z coordinates are scaled. + */ + SkPoint3 makeScale(SkScalar scale) const { + SkPoint3 p; + p.set(scale * fX, scale * fY, scale * fZ); + return p; + } + + /** Scale the point's coordinates by scale. + */ + void scale(SkScalar value) { + fX *= value; + fY *= value; + fZ *= value; + } + + /** Return a new point whose X, Y and Z coordinates are the negative of the + original point's + */ + SkPoint3 operator-() const { + SkPoint3 neg; + neg.fX = -fX; + neg.fY = -fY; + neg.fZ = -fZ; + return neg; + } + + /** Returns a new point whose coordinates are the difference between + a and b (i.e., a - b) + */ + friend SkPoint3 operator-(const SkPoint3& a, const SkPoint3& b) { + return { a.fX - b.fX, a.fY - b.fY, a.fZ - b.fZ }; + } + + /** Returns a new point whose coordinates are the sum of a and b (a + b) + */ + friend SkPoint3 operator+(const SkPoint3& a, const SkPoint3& b) { + return { a.fX + b.fX, a.fY + b.fY, a.fZ + b.fZ }; + } + + /** Add v's coordinates to the point's + */ + void operator+=(const SkPoint3& v) { + fX += v.fX; + fY += v.fY; + fZ += v.fZ; + } + + /** Subtract v's coordinates from the point's + */ + void operator-=(const SkPoint3& v) { + fX -= v.fX; + fY -= v.fY; + fZ -= v.fZ; + } + + friend SkPoint3 operator*(SkScalar t, SkPoint3 p) { + return { t * p.fX, t * p.fY, t * p.fZ }; + } + + /** Returns true if fX, fY, and fZ are measurable values. + + @return true for values other than infinities and NaN + */ + bool isFinite() const { + SkScalar accum = 0; + accum *= fX; + accum *= fY; + accum *= fZ; + + // accum is either NaN or it is finite (zero). + SkASSERT(0 == accum || SkScalarIsNaN(accum)); + + // value==value will be true iff value is not NaN + // TODO: is it faster to say !accum or accum==accum? + return !SkScalarIsNaN(accum); + } + + /** Returns the dot product of a and b, treating them as 3D vectors + */ + static SkScalar DotProduct(const SkPoint3& a, const SkPoint3& b) { + return a.fX * b.fX + a.fY * b.fY + a.fZ * b.fZ; + } + + SkScalar dot(const SkPoint3& vec) const { + return DotProduct(*this, vec); + } + + /** Returns the cross product of a and b, treating them as 3D vectors + */ + static SkPoint3 CrossProduct(const SkPoint3& a, const SkPoint3& b) { + SkPoint3 result; + result.fX = a.fY*b.fZ - a.fZ*b.fY; + result.fY = a.fZ*b.fX - a.fX*b.fZ; + result.fZ = a.fX*b.fY - a.fY*b.fX; + + return result; + } + + SkPoint3 cross(const SkPoint3& vec) const { + return CrossProduct(*this, vec); + } +}; + +typedef SkPoint3 SkVector3; +typedef SkPoint3 SkColor3f; + +#endif diff --git a/src/deps/skia/include/core/SkPromiseImageTexture.h b/src/deps/skia/include/core/SkPromiseImageTexture.h new file mode 100644 index 000000000..05434c094 --- /dev/null +++ b/src/deps/skia/include/core/SkPromiseImageTexture.h @@ -0,0 +1,46 @@ +/* + * Copyright 2017 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkPromiseImageTexture_DEFINED +#define SkPromiseImageTexture_DEFINED + +#include "include/core/SkTypes.h" + +#if SK_SUPPORT_GPU +#include "include/core/SkRefCnt.h" +#include "include/gpu/GrBackendSurface.h" +/** + * This type is used to fulfill textures for PromiseImages. Once an instance is returned from a + * PromiseImageTextureFulfillProc the GrBackendTexture it wraps must remain valid until the + * corresponding PromiseImageTextureReleaseProc is called. + */ +class SK_API SkPromiseImageTexture : public SkNVRefCnt<SkPromiseImageTexture> { +public: + SkPromiseImageTexture() = delete; + SkPromiseImageTexture(const SkPromiseImageTexture&) = delete; + SkPromiseImageTexture(SkPromiseImageTexture&&) = delete; + ~SkPromiseImageTexture(); + SkPromiseImageTexture& operator=(const SkPromiseImageTexture&) = delete; + SkPromiseImageTexture& operator=(SkPromiseImageTexture&&) = delete; + + static sk_sp<SkPromiseImageTexture> Make(const GrBackendTexture& backendTexture) { + if (!backendTexture.isValid()) { + return nullptr; + } + return sk_sp<SkPromiseImageTexture>(new SkPromiseImageTexture(backendTexture)); + } + + GrBackendTexture backendTexture() const { return fBackendTexture; } + +private: + explicit SkPromiseImageTexture(const GrBackendTexture& backendTexture); + + GrBackendTexture fBackendTexture; +}; +#endif // SK_SUPPORT_GPU + +#endif // SkPromiseImageTexture_DEFINED diff --git a/src/deps/skia/include/core/SkRRect.h b/src/deps/skia/include/core/SkRRect.h new file mode 100644 index 000000000..099385168 --- /dev/null +++ b/src/deps/skia/include/core/SkRRect.h @@ -0,0 +1,512 @@ +/* + * Copyright 2012 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkRRect_DEFINED +#define SkRRect_DEFINED + +#include "include/core/SkPoint.h" +#include "include/core/SkRect.h" + +class SkPath; +class SkMatrix; +class SkString; + +/** \class SkRRect + SkRRect describes a rounded rectangle with a bounds and a pair of radii for each corner. + The bounds and radii can be set so that SkRRect describes: a rectangle with sharp corners; + a circle; an oval; or a rectangle with one or more rounded corners. + + SkRRect allows implementing CSS properties that describe rounded corners. + SkRRect may have up to eight different radii, one for each axis on each of its four + corners. + + SkRRect may modify the provided parameters when initializing bounds and radii. + If either axis radii is zero or less: radii are stored as zero; corner is square. + If corner curves overlap, radii are proportionally reduced to fit within bounds. +*/ +class SK_API SkRRect { +public: + + /** Initializes bounds at (0, 0), the origin, with zero width and height. + Initializes corner radii to (0, 0), and sets type of kEmpty_Type. + + @return empty SkRRect + */ + SkRRect() = default; + + /** Initializes to copy of rrect bounds and corner radii. + + @param rrect bounds and corner to copy + @return copy of rrect + */ + SkRRect(const SkRRect& rrect) = default; + + /** Copies rrect bounds and corner radii. + + @param rrect bounds and corner to copy + @return copy of rrect + */ + SkRRect& operator=(const SkRRect& rrect) = default; + + /** \enum SkRRect::Type + Type describes possible specializations of SkRRect. Each Type is + exclusive; a SkRRect may only have one type. + + Type members become progressively less restrictive; larger values of + Type have more degrees of freedom than smaller values. + */ + enum Type { + kEmpty_Type, //!< zero width or height + kRect_Type, //!< non-zero width and height, and zeroed radii + kOval_Type, //!< non-zero width and height filled with radii + kSimple_Type, //!< non-zero width and height with equal radii + kNinePatch_Type, //!< non-zero width and height with axis-aligned radii + kComplex_Type, //!< non-zero width and height with arbitrary radii + kLastType = kComplex_Type, //!< largest Type value + }; + + Type getType() const { + SkASSERT(this->isValid()); + return static_cast<Type>(fType); + } + + Type type() const { return this->getType(); } + + inline bool isEmpty() const { return kEmpty_Type == this->getType(); } + inline bool isRect() const { return kRect_Type == this->getType(); } + inline bool isOval() const { return kOval_Type == this->getType(); } + inline bool isSimple() const { return kSimple_Type == this->getType(); } + inline bool isNinePatch() const { return kNinePatch_Type == this->getType(); } + inline bool isComplex() const { return kComplex_Type == this->getType(); } + + /** Returns span on the x-axis. This does not check if result fits in 32-bit float; + result may be infinity. + + @return rect().fRight minus rect().fLeft + */ + SkScalar width() const { return fRect.width(); } + + /** Returns span on the y-axis. This does not check if result fits in 32-bit float; + result may be infinity. + + @return rect().fBottom minus rect().fTop + */ + SkScalar height() const { return fRect.height(); } + + /** Returns top-left corner radii. If type() returns kEmpty_Type, kRect_Type, + kOval_Type, or kSimple_Type, returns a value representative of all corner radii. + If type() returns kNinePatch_Type or kComplex_Type, at least one of the + remaining three corners has a different value. + + @return corner radii for simple types + */ + SkVector getSimpleRadii() const { + return fRadii[0]; + } + + /** Sets bounds to zero width and height at (0, 0), the origin. Sets + corner radii to zero and sets type to kEmpty_Type. + */ + void setEmpty() { *this = SkRRect(); } + + /** Sets bounds to sorted rect, and sets corner radii to zero. + If set bounds has width and height, and sets type to kRect_Type; + otherwise, sets type to kEmpty_Type. + + @param rect bounds to set + */ + void setRect(const SkRect& rect) { + if (!this->initializeRect(rect)) { + return; + } + + memset(fRadii, 0, sizeof(fRadii)); + fType = kRect_Type; + + SkASSERT(this->isValid()); + } + + /** Initializes bounds at (0, 0), the origin, with zero width and height. + Initializes corner radii to (0, 0), and sets type of kEmpty_Type. + + @return empty SkRRect + */ + static SkRRect MakeEmpty() { return SkRRect(); } + + /** Initializes to copy of r bounds and zeroes corner radii. + + @param r bounds to copy + @return copy of r + */ + static SkRRect MakeRect(const SkRect& r) { + SkRRect rr; + rr.setRect(r); + return rr; + } + + /** Sets bounds to oval, x-axis radii to half oval.width(), and all y-axis radii + to half oval.height(). If oval bounds is empty, sets to kEmpty_Type. + Otherwise, sets to kOval_Type. + + @param oval bounds of oval + @return oval + */ + static SkRRect MakeOval(const SkRect& oval) { + SkRRect rr; + rr.setOval(oval); + return rr; + } + + /** Sets to rounded rectangle with the same radii for all four corners. + If rect is empty, sets to kEmpty_Type. + Otherwise, if xRad and yRad are zero, sets to kRect_Type. + Otherwise, if xRad is at least half rect.width() and yRad is at least half + rect.height(), sets to kOval_Type. + Otherwise, sets to kSimple_Type. + + @param rect bounds of rounded rectangle + @param xRad x-axis radius of corners + @param yRad y-axis radius of corners + @return rounded rectangle + */ + static SkRRect MakeRectXY(const SkRect& rect, SkScalar xRad, SkScalar yRad) { + SkRRect rr; + rr.setRectXY(rect, xRad, yRad); + return rr; + } + + /** Sets bounds to oval, x-axis radii to half oval.width(), and all y-axis radii + to half oval.height(). If oval bounds is empty, sets to kEmpty_Type. + Otherwise, sets to kOval_Type. + + @param oval bounds of oval + */ + void setOval(const SkRect& oval); + + /** Sets to rounded rectangle with the same radii for all four corners. + If rect is empty, sets to kEmpty_Type. + Otherwise, if xRad or yRad is zero, sets to kRect_Type. + Otherwise, if xRad is at least half rect.width() and yRad is at least half + rect.height(), sets to kOval_Type. + Otherwise, sets to kSimple_Type. + + @param rect bounds of rounded rectangle + @param xRad x-axis radius of corners + @param yRad y-axis radius of corners + + example: https://fiddle.skia.org/c/@RRect_setRectXY + */ + void setRectXY(const SkRect& rect, SkScalar xRad, SkScalar yRad); + + /** Sets bounds to rect. Sets radii to (leftRad, topRad), (rightRad, topRad), + (rightRad, bottomRad), (leftRad, bottomRad). + + If rect is empty, sets to kEmpty_Type. + Otherwise, if leftRad and rightRad are zero, sets to kRect_Type. + Otherwise, if topRad and bottomRad are zero, sets to kRect_Type. + Otherwise, if leftRad and rightRad are equal and at least half rect.width(), and + topRad and bottomRad are equal at least half rect.height(), sets to kOval_Type. + Otherwise, if leftRad and rightRad are equal, and topRad and bottomRad are equal, + sets to kSimple_Type. Otherwise, sets to kNinePatch_Type. + + Nine patch refers to the nine parts defined by the radii: one center rectangle, + four edge patches, and four corner patches. + + @param rect bounds of rounded rectangle + @param leftRad left-top and left-bottom x-axis radius + @param topRad left-top and right-top y-axis radius + @param rightRad right-top and right-bottom x-axis radius + @param bottomRad left-bottom and right-bottom y-axis radius + */ + void setNinePatch(const SkRect& rect, SkScalar leftRad, SkScalar topRad, + SkScalar rightRad, SkScalar bottomRad); + + /** Sets bounds to rect. Sets radii array for individual control of all for corners. + + If rect is empty, sets to kEmpty_Type. + Otherwise, if one of each corner radii are zero, sets to kRect_Type. + Otherwise, if all x-axis radii are equal and at least half rect.width(), and + all y-axis radii are equal at least half rect.height(), sets to kOval_Type. + Otherwise, if all x-axis radii are equal, and all y-axis radii are equal, + sets to kSimple_Type. Otherwise, sets to kNinePatch_Type. + + @param rect bounds of rounded rectangle + @param radii corner x-axis and y-axis radii + + example: https://fiddle.skia.org/c/@RRect_setRectRadii + */ + void setRectRadii(const SkRect& rect, const SkVector radii[4]); + + /** \enum SkRRect::Corner + The radii are stored: top-left, top-right, bottom-right, bottom-left. + */ + enum Corner { + kUpperLeft_Corner, //!< index of top-left corner radii + kUpperRight_Corner, //!< index of top-right corner radii + kLowerRight_Corner, //!< index of bottom-right corner radii + kLowerLeft_Corner, //!< index of bottom-left corner radii + }; + + /** Returns bounds. Bounds may have zero width or zero height. Bounds right is + greater than or equal to left; bounds bottom is greater than or equal to top. + Result is identical to getBounds(). + + @return bounding box + */ + const SkRect& rect() const { return fRect; } + + /** Returns scalar pair for radius of curve on x-axis and y-axis for one corner. + Both radii may be zero. If not zero, both are positive and finite. + + @return x-axis and y-axis radii for one corner + */ + SkVector radii(Corner corner) const { return fRadii[corner]; } + + /** Returns bounds. Bounds may have zero width or zero height. Bounds right is + greater than or equal to left; bounds bottom is greater than or equal to top. + Result is identical to rect(). + + @return bounding box + */ + const SkRect& getBounds() const { return fRect; } + + /** Returns true if bounds and radii in a are equal to bounds and radii in b. + + a and b are not equal if either contain NaN. a and b are equal if members + contain zeroes with different signs. + + @param a SkRect bounds and radii to compare + @param b SkRect bounds and radii to compare + @return true if members are equal + */ + friend bool operator==(const SkRRect& a, const SkRRect& b) { + return a.fRect == b.fRect && SkScalarsEqual(&a.fRadii[0].fX, &b.fRadii[0].fX, 8); + } + + /** Returns true if bounds and radii in a are not equal to bounds and radii in b. + + a and b are not equal if either contain NaN. a and b are equal if members + contain zeroes with different signs. + + @param a SkRect bounds and radii to compare + @param b SkRect bounds and radii to compare + @return true if members are not equal + */ + friend bool operator!=(const SkRRect& a, const SkRRect& b) { + return a.fRect != b.fRect || !SkScalarsEqual(&a.fRadii[0].fX, &b.fRadii[0].fX, 8); + } + + /** Copies SkRRect to dst, then insets dst bounds by dx and dy, and adjusts dst + radii by dx and dy. dx and dy may be positive, negative, or zero. dst may be + SkRRect. + + If either corner radius is zero, the corner has no curvature and is unchanged. + Otherwise, if adjusted radius becomes negative, pins radius to zero. + If dx exceeds half dst bounds width, dst bounds left and right are set to + bounds x-axis center. If dy exceeds half dst bounds height, dst bounds top and + bottom are set to bounds y-axis center. + + If dx or dy cause the bounds to become infinite, dst bounds is zeroed. + + @param dx added to rect().fLeft, and subtracted from rect().fRight + @param dy added to rect().fTop, and subtracted from rect().fBottom + @param dst insets bounds and radii + + example: https://fiddle.skia.org/c/@RRect_inset + */ + void inset(SkScalar dx, SkScalar dy, SkRRect* dst) const; + + /** Insets bounds by dx and dy, and adjusts radii by dx and dy. dx and dy may be + positive, negative, or zero. + + If either corner radius is zero, the corner has no curvature and is unchanged. + Otherwise, if adjusted radius becomes negative, pins radius to zero. + If dx exceeds half bounds width, bounds left and right are set to + bounds x-axis center. If dy exceeds half bounds height, bounds top and + bottom are set to bounds y-axis center. + + If dx or dy cause the bounds to become infinite, bounds is zeroed. + + @param dx added to rect().fLeft, and subtracted from rect().fRight + @param dy added to rect().fTop, and subtracted from rect().fBottom + */ + void inset(SkScalar dx, SkScalar dy) { + this->inset(dx, dy, this); + } + + /** Outsets dst bounds by dx and dy, and adjusts radii by dx and dy. dx and dy may be + positive, negative, or zero. + + If either corner radius is zero, the corner has no curvature and is unchanged. + Otherwise, if adjusted radius becomes negative, pins radius to zero. + If dx exceeds half dst bounds width, dst bounds left and right are set to + bounds x-axis center. If dy exceeds half dst bounds height, dst bounds top and + bottom are set to bounds y-axis center. + + If dx or dy cause the bounds to become infinite, dst bounds is zeroed. + + @param dx subtracted from rect().fLeft, and added to rect().fRight + @param dy subtracted from rect().fTop, and added to rect().fBottom + @param dst outset bounds and radii + */ + void outset(SkScalar dx, SkScalar dy, SkRRect* dst) const { + this->inset(-dx, -dy, dst); + } + + /** Outsets bounds by dx and dy, and adjusts radii by dx and dy. dx and dy may be + positive, negative, or zero. + + If either corner radius is zero, the corner has no curvature and is unchanged. + Otherwise, if adjusted radius becomes negative, pins radius to zero. + If dx exceeds half bounds width, bounds left and right are set to + bounds x-axis center. If dy exceeds half bounds height, bounds top and + bottom are set to bounds y-axis center. + + If dx or dy cause the bounds to become infinite, bounds is zeroed. + + @param dx subtracted from rect().fLeft, and added to rect().fRight + @param dy subtracted from rect().fTop, and added to rect().fBottom + */ + void outset(SkScalar dx, SkScalar dy) { + this->inset(-dx, -dy, this); + } + + /** Translates SkRRect by (dx, dy). + + @param dx offset added to rect().fLeft and rect().fRight + @param dy offset added to rect().fTop and rect().fBottom + */ + void offset(SkScalar dx, SkScalar dy) { + fRect.offset(dx, dy); + } + + /** Returns SkRRect translated by (dx, dy). + + @param dx offset added to rect().fLeft and rect().fRight + @param dy offset added to rect().fTop and rect().fBottom + @return SkRRect bounds offset by (dx, dy), with unchanged corner radii + */ + SkRRect SK_WARN_UNUSED_RESULT makeOffset(SkScalar dx, SkScalar dy) const { + return SkRRect(fRect.makeOffset(dx, dy), fRadii, fType); + } + + /** Returns true if rect is inside the bounds and corner radii, and if + SkRRect and rect are not empty. + + @param rect area tested for containment + @return true if SkRRect contains rect + + example: https://fiddle.skia.org/c/@RRect_contains + */ + bool contains(const SkRect& rect) const; + + /** Returns true if bounds and radii values are finite and describe a SkRRect + SkRRect::Type that matches getType(). All SkRRect methods construct valid types, + even if the input values are not valid. Invalid SkRRect data can only + be generated by corrupting memory. + + @return true if bounds and radii match type() + + example: https://fiddle.skia.org/c/@RRect_isValid + */ + bool isValid() const; + + static constexpr size_t kSizeInMemory = 12 * sizeof(SkScalar); + + /** Writes SkRRect to buffer. Writes kSizeInMemory bytes, and returns + kSizeInMemory, the number of bytes written. + + @param buffer storage for SkRRect + @return bytes written, kSizeInMemory + + example: https://fiddle.skia.org/c/@RRect_writeToMemory + */ + size_t writeToMemory(void* buffer) const; + + /** Reads SkRRect from buffer, reading kSizeInMemory bytes. + Returns kSizeInMemory, bytes read if length is at least kSizeInMemory. + Otherwise, returns zero. + + @param buffer memory to read from + @param length size of buffer + @return bytes read, or 0 if length is less than kSizeInMemory + + example: https://fiddle.skia.org/c/@RRect_readFromMemory + */ + size_t readFromMemory(const void* buffer, size_t length); + + /** Transforms by SkRRect by matrix, storing result in dst. + Returns true if SkRRect transformed can be represented by another SkRRect. + Returns false if matrix contains transformations that are not axis aligned. + + Asserts in debug builds if SkRRect equals dst. + + @param matrix SkMatrix specifying the transform + @param dst SkRRect to store the result + @return true if transformation succeeded. + + example: https://fiddle.skia.org/c/@RRect_transform + */ + bool transform(const SkMatrix& matrix, SkRRect* dst) const; + + /** Writes text representation of SkRRect to standard output. + Set asHex true to generate exact binary representations + of floating point numbers. + + @param asHex true if SkScalar values are written as hexadecimal + + example: https://fiddle.skia.org/c/@RRect_dump + */ + void dump(bool asHex) const; + SkString dumpToString(bool asHex) const; + + /** Writes text representation of SkRRect to standard output. The representation + may be directly compiled as C++ code. Floating point values are written + with limited precision; it may not be possible to reconstruct original + SkRRect from output. + */ + void dump() const { this->dump(false); } + + /** Writes text representation of SkRRect to standard output. The representation + may be directly compiled as C++ code. Floating point values are written + in hexadecimal to preserve their exact bit pattern. The output reconstructs the + original SkRRect. + */ + void dumpHex() const { this->dump(true); } + +private: + static bool AreRectAndRadiiValid(const SkRect&, const SkVector[4]); + + SkRRect(const SkRect& rect, const SkVector radii[4], int32_t type) + : fRect(rect) + , fRadii{radii[0], radii[1], radii[2], radii[3]} + , fType(type) {} + + /** + * Initializes fRect. If the passed in rect is not finite or empty the rrect will be fully + * initialized and false is returned. Otherwise, just fRect is initialized and true is returned. + */ + bool initializeRect(const SkRect&); + + void computeType(); + bool checkCornerContainment(SkScalar x, SkScalar y) const; + // Returns true if the radii had to be scaled to fit rect + bool scaleRadii(); + + SkRect fRect = SkRect::MakeEmpty(); + // Radii order is UL, UR, LR, LL. Use Corner enum to index into fRadii[] + SkVector fRadii[4] = {{0, 0}, {0, 0}, {0,0}, {0,0}}; + // use an explicitly sized type so we're sure the class is dense (no uninitialized bytes) + int32_t fType = kEmpty_Type; + // TODO: add padding so we can use memcpy for flattening and not copy uninitialized data + + // to access fRadii directly + friend class SkPath; + friend class SkRRectPriv; +}; + +#endif diff --git a/src/deps/skia/include/core/SkRSXform.h b/src/deps/skia/include/core/SkRSXform.h new file mode 100644 index 000000000..91653311d --- /dev/null +++ b/src/deps/skia/include/core/SkRSXform.h @@ -0,0 +1,69 @@ +/* + * Copyright 2015 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkRSXform_DEFINED +#define SkRSXform_DEFINED + +#include "include/core/SkPoint.h" +#include "include/core/SkSize.h" + +/** + * A compressed form of a rotation+scale matrix. + * + * [ fSCos -fSSin fTx ] + * [ fSSin fSCos fTy ] + * [ 0 0 1 ] + */ +struct SkRSXform { + static SkRSXform Make(SkScalar scos, SkScalar ssin, SkScalar tx, SkScalar ty) { + SkRSXform xform = { scos, ssin, tx, ty }; + return xform; + } + + /* + * Initialize a new xform based on the scale, rotation (in radians), final tx,ty location + * and anchor-point ax,ay within the src quad. + * + * Note: the anchor point is not normalized (e.g. 0...1) but is in pixels of the src image. + */ + static SkRSXform MakeFromRadians(SkScalar scale, SkScalar radians, SkScalar tx, SkScalar ty, + SkScalar ax, SkScalar ay) { + const SkScalar s = SkScalarSin(radians) * scale; + const SkScalar c = SkScalarCos(radians) * scale; + return Make(c, s, tx + -c * ax + s * ay, ty + -s * ax - c * ay); + } + + SkScalar fSCos; + SkScalar fSSin; + SkScalar fTx; + SkScalar fTy; + + bool rectStaysRect() const { + return 0 == fSCos || 0 == fSSin; + } + + void setIdentity() { + fSCos = 1; + fSSin = fTx = fTy = 0; + } + + void set(SkScalar scos, SkScalar ssin, SkScalar tx, SkScalar ty) { + fSCos = scos; + fSSin = ssin; + fTx = tx; + fTy = ty; + } + + void toQuad(SkScalar width, SkScalar height, SkPoint quad[4]) const; + void toQuad(const SkSize& size, SkPoint quad[4]) const { + this->toQuad(size.width(), size.height(), quad); + } + void toTriStrip(SkScalar width, SkScalar height, SkPoint strip[4]) const; +}; + +#endif + diff --git a/src/deps/skia/include/core/SkRasterHandleAllocator.h b/src/deps/skia/include/core/SkRasterHandleAllocator.h new file mode 100644 index 000000000..ad7c379ee --- /dev/null +++ b/src/deps/skia/include/core/SkRasterHandleAllocator.h @@ -0,0 +1,92 @@ +/* + * Copyright 2016 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkRasterHandleAllocator_DEFINED +#define SkRasterHandleAllocator_DEFINED + +#include "include/core/SkImageInfo.h" + +class SkBitmap; +class SkCanvas; +class SkMatrix; + +/** + * If a client wants to control the allocation of raster layers in a canvas, it should subclass + * SkRasterHandleAllocator. This allocator performs two tasks: + * 1. controls how the memory for the pixels is allocated + * 2. associates a "handle" to a private object that can track the matrix/clip of the SkCanvas + * + * This example allocates a canvas, and defers to the allocator to create the base layer. + * + * std::unique_ptr<SkCanvas> canvas = SkRasterHandleAllocator::MakeCanvas( + * SkImageInfo::Make(...), + * std::make_unique<MySubclassRasterHandleAllocator>(...), + * nullptr); + * + * If you have already allocated the base layer (and its handle, release-proc etc.) then you + * can pass those in using the last parameter to MakeCanvas(). + * + * Regardless of how the base layer is allocated, each time canvas->saveLayer() is called, + * your allocator's allocHandle() will be called. + */ +class SK_API SkRasterHandleAllocator { +public: + virtual ~SkRasterHandleAllocator() = default; + + // The value that is returned to clients of the canvas that has this allocator installed. + typedef void* Handle; + + struct Rec { + // When the allocation goes out of scope, this proc is called to free everything associated + // with it: the pixels, the "handle", etc. This is passed the pixel address and fReleaseCtx. + void (*fReleaseProc)(void* pixels, void* ctx); + void* fReleaseCtx; // context passed to fReleaseProc + void* fPixels; // pixels for this allocation + size_t fRowBytes; // rowbytes for these pixels + Handle fHandle; // public handle returned by SkCanvas::accessTopRasterHandle() + }; + + /** + * Given a requested info, allocate the corresponding pixels/rowbytes, and whatever handle + * is desired to give clients access to those pixels. The rec also contains a proc and context + * which will be called when this allocation goes out of scope. + * + * e.g. + * when canvas->saveLayer() is called, the allocator will be called to allocate the pixels + * for the layer. When canvas->restore() is called, the fReleaseProc will be called. + */ + virtual bool allocHandle(const SkImageInfo&, Rec*) = 0; + + /** + * Clients access the handle for a given layer by calling SkCanvas::accessTopRasterHandle(). + * To allow the handle to reflect the current matrix/clip in the canvs, updateHandle() is + * is called. The subclass is responsible to update the handle as it sees fit. + */ + virtual void updateHandle(Handle, const SkMatrix&, const SkIRect&) = 0; + + /** + * This creates a canvas which will use the allocator to manage pixel allocations, including + * all calls to saveLayer(). + * + * If rec is non-null, then it will be used as the base-layer of pixels/handle. + * If rec is null, then the allocator will be called for the base-layer as well. + */ + static std::unique_ptr<SkCanvas> MakeCanvas(std::unique_ptr<SkRasterHandleAllocator>, + const SkImageInfo&, const Rec* rec = nullptr); + +protected: + SkRasterHandleAllocator() = default; + SkRasterHandleAllocator(const SkRasterHandleAllocator&) = delete; + SkRasterHandleAllocator& operator=(const SkRasterHandleAllocator&) = delete; + +private: + friend class SkBitmapDevice; + + Handle allocBitmap(const SkImageInfo&, SkBitmap*); +}; + +#endif diff --git a/src/deps/skia/include/core/SkRect.h b/src/deps/skia/include/core/SkRect.h new file mode 100644 index 000000000..99efe70bc --- /dev/null +++ b/src/deps/skia/include/core/SkRect.h @@ -0,0 +1,1378 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkRect_DEFINED +#define SkRect_DEFINED + +#include "include/core/SkPoint.h" +#include "include/core/SkSize.h" +#include "include/private/SkSafe32.h" +#include "include/private/SkTFitsIn.h" + +#include <algorithm> +#include <utility> + +struct SkRect; + +/** \struct SkIRect + SkIRect holds four 32-bit integer coordinates describing the upper and + lower bounds of a rectangle. SkIRect may be created from outer bounds or + from position, width, and height. SkIRect describes an area; if its right + is less than or equal to its left, or if its bottom is less than or equal to + its top, it is considered empty. +*/ +struct SK_API SkIRect { + int32_t fLeft; //!< smaller x-axis bounds + int32_t fTop; //!< smaller y-axis bounds + int32_t fRight; //!< larger x-axis bounds + int32_t fBottom; //!< larger y-axis bounds + + /** Returns constructed SkIRect set to (0, 0, 0, 0). + Many other rectangles are empty; if left is equal to or greater than right, + or if top is equal to or greater than bottom. Setting all members to zero + is a convenience, but does not designate a special empty rectangle. + + @return bounds (0, 0, 0, 0) + */ + static constexpr SkIRect SK_WARN_UNUSED_RESULT MakeEmpty() { + return SkIRect{0, 0, 0, 0}; + } + + /** Returns constructed SkIRect set to (0, 0, w, h). Does not validate input; w or h + may be negative. + + @param w width of constructed SkIRect + @param h height of constructed SkIRect + @return bounds (0, 0, w, h) + */ + static constexpr SkIRect SK_WARN_UNUSED_RESULT MakeWH(int32_t w, int32_t h) { + return SkIRect{0, 0, w, h}; + } + + /** Returns constructed SkIRect set to (0, 0, size.width(), size.height()). + Does not validate input; size.width() or size.height() may be negative. + + @param size values for SkIRect width and height + @return bounds (0, 0, size.width(), size.height()) + */ + static constexpr SkIRect SK_WARN_UNUSED_RESULT MakeSize(const SkISize& size) { + return SkIRect{0, 0, size.fWidth, size.fHeight}; + } + + /** Returns constructed SkIRect set to (pt.x(), pt.y(), pt.x() + size.width(), + pt.y() + size.height()). Does not validate input; size.width() or size.height() may be + negative. + + @param pt values for SkIRect fLeft and fTop + @param size values for SkIRect width and height + @return bounds at pt with width and height of size + */ + static constexpr SkIRect SK_WARN_UNUSED_RESULT MakePtSize(SkIPoint pt, SkISize size) { + return MakeXYWH(pt.x(), pt.y(), size.width(), size.height()); + } + + /** Returns constructed SkIRect set to (l, t, r, b). Does not sort input; SkIRect may + result in fLeft greater than fRight, or fTop greater than fBottom. + + @param l integer stored in fLeft + @param t integer stored in fTop + @param r integer stored in fRight + @param b integer stored in fBottom + @return bounds (l, t, r, b) + */ + static constexpr SkIRect SK_WARN_UNUSED_RESULT MakeLTRB(int32_t l, int32_t t, + int32_t r, int32_t b) { + return SkIRect{l, t, r, b}; + } + + /** Returns constructed SkIRect set to: (x, y, x + w, y + h). + Does not validate input; w or h may be negative. + + @param x stored in fLeft + @param y stored in fTop + @param w added to x and stored in fRight + @param h added to y and stored in fBottom + @return bounds at (x, y) with width w and height h + */ + static constexpr SkIRect SK_WARN_UNUSED_RESULT MakeXYWH(int32_t x, int32_t y, + int32_t w, int32_t h) { + return { x, y, Sk32_sat_add(x, w), Sk32_sat_add(y, h) }; + } + + /** Returns left edge of SkIRect, if sorted. + Call sort() to reverse fLeft and fRight if needed. + + @return fLeft + */ + constexpr int32_t left() const { return fLeft; } + + /** Returns top edge of SkIRect, if sorted. Call isEmpty() to see if SkIRect may be invalid, + and sort() to reverse fTop and fBottom if needed. + + @return fTop + */ + constexpr int32_t top() const { return fTop; } + + /** Returns right edge of SkIRect, if sorted. + Call sort() to reverse fLeft and fRight if needed. + + @return fRight + */ + constexpr int32_t right() const { return fRight; } + + /** Returns bottom edge of SkIRect, if sorted. Call isEmpty() to see if SkIRect may be invalid, + and sort() to reverse fTop and fBottom if needed. + + @return fBottom + */ + constexpr int32_t bottom() const { return fBottom; } + + /** Returns left edge of SkIRect, if sorted. Call isEmpty() to see if SkIRect may be invalid, + and sort() to reverse fLeft and fRight if needed. + + @return fLeft + */ + constexpr int32_t x() const { return fLeft; } + + /** Returns top edge of SkIRect, if sorted. Call isEmpty() to see if SkIRect may be invalid, + and sort() to reverse fTop and fBottom if needed. + + @return fTop + */ + constexpr int32_t y() const { return fTop; } + + // Experimental + constexpr SkIPoint topLeft() const { return {fLeft, fTop}; } + + /** Returns span on the x-axis. This does not check if SkIRect is sorted, or if + result fits in 32-bit signed integer; result may be negative. + + @return fRight minus fLeft + */ + constexpr int32_t width() const { return Sk32_can_overflow_sub(fRight, fLeft); } + + /** Returns span on the y-axis. This does not check if SkIRect is sorted, or if + result fits in 32-bit signed integer; result may be negative. + + @return fBottom minus fTop + */ + constexpr int32_t height() const { return Sk32_can_overflow_sub(fBottom, fTop); } + + /** Returns spans on the x-axis and y-axis. This does not check if SkIRect is sorted, + or if result fits in 32-bit signed integer; result may be negative. + + @return SkISize (width, height) + */ + constexpr SkISize size() const { return SkISize::Make(this->width(), this->height()); } + + /** Returns span on the x-axis. This does not check if SkIRect is sorted, so the + result may be negative. This is safer than calling width() since width() might + overflow in its calculation. + + @return fRight minus fLeft cast to int64_t + */ + constexpr int64_t width64() const { return (int64_t)fRight - (int64_t)fLeft; } + + /** Returns span on the y-axis. This does not check if SkIRect is sorted, so the + result may be negative. This is safer than calling height() since height() might + overflow in its calculation. + + @return fBottom minus fTop cast to int64_t + */ + constexpr int64_t height64() const { return (int64_t)fBottom - (int64_t)fTop; } + + /** Returns true if fLeft is equal to or greater than fRight, or if fTop is equal + to or greater than fBottom. Call sort() to reverse rectangles with negative + width64() or height64(). + + @return true if width64() or height64() are zero or negative + */ + bool isEmpty64() const { return fRight <= fLeft || fBottom <= fTop; } + + /** Returns true if width() or height() are zero or negative. + + @return true if width() or height() are zero or negative + */ + bool isEmpty() const { + int64_t w = this->width64(); + int64_t h = this->height64(); + if (w <= 0 || h <= 0) { + return true; + } + // Return true if either exceeds int32_t + return !SkTFitsIn<int32_t>(w | h); + } + + /** Returns true if all members in a: fLeft, fTop, fRight, and fBottom; are + identical to corresponding members in b. + + @param a SkIRect to compare + @param b SkIRect to compare + @return true if members are equal + */ + friend bool operator==(const SkIRect& a, const SkIRect& b) { + return !memcmp(&a, &b, sizeof(a)); + } + + /** Returns true if any member in a: fLeft, fTop, fRight, and fBottom; is not + identical to the corresponding member in b. + + @param a SkIRect to compare + @param b SkIRect to compare + @return true if members are not equal + */ + friend bool operator!=(const SkIRect& a, const SkIRect& b) { + return !(a == b); + } + + /** Sets SkIRect to (0, 0, 0, 0). + + Many other rectangles are empty; if left is equal to or greater than right, + or if top is equal to or greater than bottom. Setting all members to zero + is a convenience, but does not designate a special empty rectangle. + */ + void setEmpty() { memset(this, 0, sizeof(*this)); } + + /** Sets SkIRect to (left, top, right, bottom). + left and right are not sorted; left is not necessarily less than right. + top and bottom are not sorted; top is not necessarily less than bottom. + + @param left stored in fLeft + @param top stored in fTop + @param right stored in fRight + @param bottom stored in fBottom + */ + void setLTRB(int32_t left, int32_t top, int32_t right, int32_t bottom) { + fLeft = left; + fTop = top; + fRight = right; + fBottom = bottom; + } + + /** Sets SkIRect to: (x, y, x + width, y + height). + Does not validate input; width or height may be negative. + + @param x stored in fLeft + @param y stored in fTop + @param width added to x and stored in fRight + @param height added to y and stored in fBottom + */ + void setXYWH(int32_t x, int32_t y, int32_t width, int32_t height) { + fLeft = x; + fTop = y; + fRight = Sk32_sat_add(x, width); + fBottom = Sk32_sat_add(y, height); + } + + void setWH(int32_t width, int32_t height) { + fLeft = 0; + fTop = 0; + fRight = width; + fBottom = height; + } + + void setSize(SkISize size) { + fLeft = 0; + fTop = 0; + fRight = size.width(); + fBottom = size.height(); + } + + /** Returns SkIRect offset by (dx, dy). + + If dx is negative, SkIRect returned is moved to the left. + If dx is positive, SkIRect returned is moved to the right. + If dy is negative, SkIRect returned is moved upward. + If dy is positive, SkIRect returned is moved downward. + + @param dx offset added to fLeft and fRight + @param dy offset added to fTop and fBottom + @return SkIRect offset by dx and dy, with original width and height + */ + constexpr SkIRect makeOffset(int32_t dx, int32_t dy) const { + return { + Sk32_sat_add(fLeft, dx), Sk32_sat_add(fTop, dy), + Sk32_sat_add(fRight, dx), Sk32_sat_add(fBottom, dy), + }; + } + + /** Returns SkIRect offset by (offset.x(), offset.y()). + + If offset.x() is negative, SkIRect returned is moved to the left. + If offset.x() is positive, SkIRect returned is moved to the right. + If offset.y() is negative, SkIRect returned is moved upward. + If offset.y() is positive, SkIRect returned is moved downward. + + @param offset translation vector + @return SkIRect translated by offset, with original width and height + */ + constexpr SkIRect makeOffset(SkIVector offset) const { + return this->makeOffset(offset.x(), offset.y()); + } + + /** Returns SkIRect, inset by (dx, dy). + + If dx is negative, SkIRect returned is wider. + If dx is positive, SkIRect returned is narrower. + If dy is negative, SkIRect returned is taller. + If dy is positive, SkIRect returned is shorter. + + @param dx offset added to fLeft and subtracted from fRight + @param dy offset added to fTop and subtracted from fBottom + @return SkIRect inset symmetrically left and right, top and bottom + */ + SkIRect makeInset(int32_t dx, int32_t dy) const { + return { + Sk32_sat_add(fLeft, dx), Sk32_sat_add(fTop, dy), + Sk32_sat_sub(fRight, dx), Sk32_sat_sub(fBottom, dy), + }; + } + + /** Returns SkIRect, outset by (dx, dy). + + If dx is negative, SkIRect returned is narrower. + If dx is positive, SkIRect returned is wider. + If dy is negative, SkIRect returned is shorter. + If dy is positive, SkIRect returned is taller. + + @param dx offset subtracted to fLeft and added from fRight + @param dy offset subtracted to fTop and added from fBottom + @return SkIRect outset symmetrically left and right, top and bottom + */ + SkIRect makeOutset(int32_t dx, int32_t dy) const { + return { + Sk32_sat_sub(fLeft, dx), Sk32_sat_sub(fTop, dy), + Sk32_sat_add(fRight, dx), Sk32_sat_add(fBottom, dy), + }; + } + + /** Offsets SkIRect by adding dx to fLeft, fRight; and by adding dy to fTop, fBottom. + + If dx is negative, moves SkIRect returned to the left. + If dx is positive, moves SkIRect returned to the right. + If dy is negative, moves SkIRect returned upward. + If dy is positive, moves SkIRect returned downward. + + @param dx offset added to fLeft and fRight + @param dy offset added to fTop and fBottom + */ + void offset(int32_t dx, int32_t dy) { + fLeft = Sk32_sat_add(fLeft, dx); + fTop = Sk32_sat_add(fTop, dy); + fRight = Sk32_sat_add(fRight, dx); + fBottom = Sk32_sat_add(fBottom, dy); + } + + /** Offsets SkIRect by adding delta.fX to fLeft, fRight; and by adding delta.fY to + fTop, fBottom. + + If delta.fX is negative, moves SkIRect returned to the left. + If delta.fX is positive, moves SkIRect returned to the right. + If delta.fY is negative, moves SkIRect returned upward. + If delta.fY is positive, moves SkIRect returned downward. + + @param delta offset added to SkIRect + */ + void offset(const SkIPoint& delta) { + this->offset(delta.fX, delta.fY); + } + + /** Offsets SkIRect so that fLeft equals newX, and fTop equals newY. width and height + are unchanged. + + @param newX stored in fLeft, preserving width() + @param newY stored in fTop, preserving height() + */ + void offsetTo(int32_t newX, int32_t newY) { + fRight = Sk64_pin_to_s32((int64_t)fRight + newX - fLeft); + fBottom = Sk64_pin_to_s32((int64_t)fBottom + newY - fTop); + fLeft = newX; + fTop = newY; + } + + /** Insets SkIRect by (dx,dy). + + If dx is positive, makes SkIRect narrower. + If dx is negative, makes SkIRect wider. + If dy is positive, makes SkIRect shorter. + If dy is negative, makes SkIRect taller. + + @param dx offset added to fLeft and subtracted from fRight + @param dy offset added to fTop and subtracted from fBottom + */ + void inset(int32_t dx, int32_t dy) { + fLeft = Sk32_sat_add(fLeft, dx); + fTop = Sk32_sat_add(fTop, dy); + fRight = Sk32_sat_sub(fRight, dx); + fBottom = Sk32_sat_sub(fBottom, dy); + } + + /** Outsets SkIRect by (dx, dy). + + If dx is positive, makes SkIRect wider. + If dx is negative, makes SkIRect narrower. + If dy is positive, makes SkIRect taller. + If dy is negative, makes SkIRect shorter. + + @param dx subtracted to fLeft and added from fRight + @param dy subtracted to fTop and added from fBottom + */ + void outset(int32_t dx, int32_t dy) { this->inset(-dx, -dy); } + + /** Adjusts SkIRect by adding dL to fLeft, dT to fTop, dR to fRight, and dB to fBottom. + + If dL is positive, narrows SkIRect on the left. If negative, widens it on the left. + If dT is positive, shrinks SkIRect on the top. If negative, lengthens it on the top. + If dR is positive, narrows SkIRect on the right. If negative, widens it on the right. + If dB is positive, shrinks SkIRect on the bottom. If negative, lengthens it on the bottom. + + The resulting SkIRect is not checked for validity. Thus, if the resulting SkIRect left is + greater than right, the SkIRect will be considered empty. Call sort() after this call + if that is not the desired behavior. + + @param dL offset added to fLeft + @param dT offset added to fTop + @param dR offset added to fRight + @param dB offset added to fBottom + */ + void adjust(int32_t dL, int32_t dT, int32_t dR, int32_t dB) { + fLeft = Sk32_sat_add(fLeft, dL); + fTop = Sk32_sat_add(fTop, dT); + fRight = Sk32_sat_add(fRight, dR); + fBottom = Sk32_sat_add(fBottom, dB); + } + + /** Returns true if: fLeft <= x < fRight && fTop <= y < fBottom. + Returns false if SkIRect is empty. + + Considers input to describe constructed SkIRect: (x, y, x + 1, y + 1) and + returns true if constructed area is completely enclosed by SkIRect area. + + @param x test SkIPoint x-coordinate + @param y test SkIPoint y-coordinate + @return true if (x, y) is inside SkIRect + */ + bool contains(int32_t x, int32_t y) const { + return x >= fLeft && x < fRight && y >= fTop && y < fBottom; + } + + /** Returns true if SkIRect contains r. + Returns false if SkIRect is empty or r is empty. + + SkIRect contains r when SkIRect area completely includes r area. + + @param r SkIRect contained + @return true if all sides of SkIRect are outside r + */ + bool contains(const SkIRect& r) const { + return !r.isEmpty() && !this->isEmpty() && // check for empties + fLeft <= r.fLeft && fTop <= r.fTop && + fRight >= r.fRight && fBottom >= r.fBottom; + } + + /** Returns true if SkIRect contains r. + Returns false if SkIRect is empty or r is empty. + + SkIRect contains r when SkIRect area completely includes r area. + + @param r SkRect contained + @return true if all sides of SkIRect are outside r + */ + inline bool contains(const SkRect& r) const; + + /** Returns true if SkIRect contains construction. + Asserts if SkIRect is empty or construction is empty, and if SK_DEBUG is defined. + + Return is undefined if SkIRect is empty or construction is empty. + + @param r SkIRect contained + @return true if all sides of SkIRect are outside r + */ + bool containsNoEmptyCheck(const SkIRect& r) const { + SkASSERT(fLeft < fRight && fTop < fBottom); + SkASSERT(r.fLeft < r.fRight && r.fTop < r.fBottom); + return fLeft <= r.fLeft && fTop <= r.fTop && fRight >= r.fRight && fBottom >= r.fBottom; + } + + /** Returns true if SkIRect intersects r, and sets SkIRect to intersection. + Returns false if SkIRect does not intersect r, and leaves SkIRect unchanged. + + Returns false if either r or SkIRect is empty, leaving SkIRect unchanged. + + @param r limit of result + @return true if r and SkIRect have area in common + */ + bool intersect(const SkIRect& r) { + return this->intersect(*this, r); + } + + /** Returns true if a intersects b, and sets SkIRect to intersection. + Returns false if a does not intersect b, and leaves SkIRect unchanged. + + Returns false if either a or b is empty, leaving SkIRect unchanged. + + @param a SkIRect to intersect + @param b SkIRect to intersect + @return true if a and b have area in common + */ + bool SK_WARN_UNUSED_RESULT intersect(const SkIRect& a, const SkIRect& b); + + /** Returns true if a intersects b. + Returns false if either a or b is empty, or do not intersect. + + @param a SkIRect to intersect + @param b SkIRect to intersect + @return true if a and b have area in common + */ + static bool Intersects(const SkIRect& a, const SkIRect& b) { + return SkIRect{}.intersect(a, b); + } + + /** Sets SkIRect to the union of itself and r. + + Has no effect if r is empty. Otherwise, if SkIRect is empty, sets SkIRect to r. + + @param r expansion SkIRect + + example: https://fiddle.skia.org/c/@IRect_join_2 + */ + void join(const SkIRect& r); + + /** Swaps fLeft and fRight if fLeft is greater than fRight; and swaps + fTop and fBottom if fTop is greater than fBottom. Result may be empty, + and width() and height() will be zero or positive. + */ + void sort() { + using std::swap; + if (fLeft > fRight) { + swap(fLeft, fRight); + } + if (fTop > fBottom) { + swap(fTop, fBottom); + } + } + + /** Returns SkIRect with fLeft and fRight swapped if fLeft is greater than fRight; and + with fTop and fBottom swapped if fTop is greater than fBottom. Result may be empty; + and width() and height() will be zero or positive. + + @return sorted SkIRect + */ + SkIRect makeSorted() const { + return MakeLTRB(std::min(fLeft, fRight), std::min(fTop, fBottom), + std::max(fLeft, fRight), std::max(fTop, fBottom)); + } +}; + +/** \struct SkRect + SkRect holds four SkScalar coordinates describing the upper and + lower bounds of a rectangle. SkRect may be created from outer bounds or + from position, width, and height. SkRect describes an area; if its right + is less than or equal to its left, or if its bottom is less than or equal to + its top, it is considered empty. +*/ +struct SK_API SkRect { + SkScalar fLeft; //!< smaller x-axis bounds + SkScalar fTop; //!< smaller y-axis bounds + SkScalar fRight; //!< larger x-axis bounds + SkScalar fBottom; //!< larger y-axis bounds + + /** Returns constructed SkRect set to (0, 0, 0, 0). + Many other rectangles are empty; if left is equal to or greater than right, + or if top is equal to or greater than bottom. Setting all members to zero + is a convenience, but does not designate a special empty rectangle. + + @return bounds (0, 0, 0, 0) + */ + static constexpr SkRect SK_WARN_UNUSED_RESULT MakeEmpty() { + return SkRect{0, 0, 0, 0}; + } + + /** Returns constructed SkRect set to SkScalar values (0, 0, w, h). Does not + validate input; w or h may be negative. + + Passing integer values may generate a compiler warning since SkRect cannot + represent 32-bit integers exactly. Use SkIRect for an exact integer rectangle. + + @param w SkScalar width of constructed SkRect + @param h SkScalar height of constructed SkRect + @return bounds (0, 0, w, h) + */ + static constexpr SkRect SK_WARN_UNUSED_RESULT MakeWH(SkScalar w, SkScalar h) { + return SkRect{0, 0, w, h}; + } + + /** Returns constructed SkRect set to integer values (0, 0, w, h). Does not validate + input; w or h may be negative. + + Use to avoid a compiler warning that input may lose precision when stored. + Use SkIRect for an exact integer rectangle. + + @param w integer width of constructed SkRect + @param h integer height of constructed SkRect + @return bounds (0, 0, w, h) + */ + static SkRect SK_WARN_UNUSED_RESULT MakeIWH(int w, int h) { + return {0, 0, SkIntToScalar(w), SkIntToScalar(h)}; + } + + /** Returns constructed SkRect set to (0, 0, size.width(), size.height()). Does not + validate input; size.width() or size.height() may be negative. + + @param size SkScalar values for SkRect width and height + @return bounds (0, 0, size.width(), size.height()) + */ + static constexpr SkRect SK_WARN_UNUSED_RESULT MakeSize(const SkSize& size) { + return SkRect{0, 0, size.fWidth, size.fHeight}; + } + + /** Returns constructed SkRect set to (l, t, r, b). Does not sort input; SkRect may + result in fLeft greater than fRight, or fTop greater than fBottom. + + @param l SkScalar stored in fLeft + @param t SkScalar stored in fTop + @param r SkScalar stored in fRight + @param b SkScalar stored in fBottom + @return bounds (l, t, r, b) + */ + static constexpr SkRect SK_WARN_UNUSED_RESULT MakeLTRB(SkScalar l, SkScalar t, SkScalar r, + SkScalar b) { + return SkRect {l, t, r, b}; + } + + /** Returns constructed SkRect set to (x, y, x + w, y + h). + Does not validate input; w or h may be negative. + + @param x stored in fLeft + @param y stored in fTop + @param w added to x and stored in fRight + @param h added to y and stored in fBottom + @return bounds at (x, y) with width w and height h + */ + static constexpr SkRect SK_WARN_UNUSED_RESULT MakeXYWH(SkScalar x, SkScalar y, SkScalar w, + SkScalar h) { + return SkRect {x, y, x + w, y + h}; + } + + /** Returns constructed SkIRect set to (0, 0, size.width(), size.height()). + Does not validate input; size.width() or size.height() may be negative. + + @param size integer values for SkRect width and height + @return bounds (0, 0, size.width(), size.height()) + */ + static SkRect Make(const SkISize& size) { + return MakeIWH(size.width(), size.height()); + } + + /** Returns constructed SkIRect set to irect, promoting integers to scalar. + Does not validate input; fLeft may be greater than fRight, fTop may be greater + than fBottom. + + @param irect integer unsorted bounds + @return irect members converted to SkScalar + */ + static SkRect SK_WARN_UNUSED_RESULT Make(const SkIRect& irect) { + return { + SkIntToScalar(irect.fLeft), SkIntToScalar(irect.fTop), + SkIntToScalar(irect.fRight), SkIntToScalar(irect.fBottom) + }; + } + + /** Returns true if fLeft is equal to or greater than fRight, or if fTop is equal + to or greater than fBottom. Call sort() to reverse rectangles with negative + width() or height(). + + @return true if width() or height() are zero or negative + */ + bool isEmpty() const { + // We write it as the NOT of a non-empty rect, so we will return true if any values + // are NaN. + return !(fLeft < fRight && fTop < fBottom); + } + + /** Returns true if fLeft is equal to or less than fRight, or if fTop is equal + to or less than fBottom. Call sort() to reverse rectangles with negative + width() or height(). + + @return true if width() or height() are zero or positive + */ + bool isSorted() const { return fLeft <= fRight && fTop <= fBottom; } + + /** Returns true if all values in the rectangle are finite: SK_ScalarMin or larger, + and SK_ScalarMax or smaller. + + @return true if no member is infinite or NaN + */ + bool isFinite() const { + float accum = 0; + accum *= fLeft; + accum *= fTop; + accum *= fRight; + accum *= fBottom; + + // accum is either NaN or it is finite (zero). + SkASSERT(0 == accum || SkScalarIsNaN(accum)); + + // value==value will be true iff value is not NaN + // TODO: is it faster to say !accum or accum==accum? + return !SkScalarIsNaN(accum); + } + + /** Returns left edge of SkRect, if sorted. Call isSorted() to see if SkRect is valid. + Call sort() to reverse fLeft and fRight if needed. + + @return fLeft + */ + constexpr SkScalar x() const { return fLeft; } + + /** Returns top edge of SkRect, if sorted. Call isEmpty() to see if SkRect may be invalid, + and sort() to reverse fTop and fBottom if needed. + + @return fTop + */ + constexpr SkScalar y() const { return fTop; } + + /** Returns left edge of SkRect, if sorted. Call isSorted() to see if SkRect is valid. + Call sort() to reverse fLeft and fRight if needed. + + @return fLeft + */ + constexpr SkScalar left() const { return fLeft; } + + /** Returns top edge of SkRect, if sorted. Call isEmpty() to see if SkRect may be invalid, + and sort() to reverse fTop and fBottom if needed. + + @return fTop + */ + constexpr SkScalar top() const { return fTop; } + + /** Returns right edge of SkRect, if sorted. Call isSorted() to see if SkRect is valid. + Call sort() to reverse fLeft and fRight if needed. + + @return fRight + */ + constexpr SkScalar right() const { return fRight; } + + /** Returns bottom edge of SkRect, if sorted. Call isEmpty() to see if SkRect may be invalid, + and sort() to reverse fTop and fBottom if needed. + + @return fBottom + */ + constexpr SkScalar bottom() const { return fBottom; } + + /** Returns span on the x-axis. This does not check if SkRect is sorted, or if + result fits in 32-bit float; result may be negative or infinity. + + @return fRight minus fLeft + */ + constexpr SkScalar width() const { return fRight - fLeft; } + + /** Returns span on the y-axis. This does not check if SkRect is sorted, or if + result fits in 32-bit float; result may be negative or infinity. + + @return fBottom minus fTop + */ + constexpr SkScalar height() const { return fBottom - fTop; } + + /** Returns average of left edge and right edge. Result does not change if SkRect + is sorted. Result may overflow to infinity if SkRect is far from the origin. + + @return midpoint on x-axis + */ + SkScalar centerX() const { + // don't use SkScalarHalf(fLeft + fBottom) as that might overflow before the 0.5 + return SkScalarHalf(fLeft) + SkScalarHalf(fRight); + } + + /** Returns average of top edge and bottom edge. Result does not change if SkRect + is sorted. + + @return midpoint on y-axis + */ + SkScalar centerY() const { + // don't use SkScalarHalf(fTop + fBottom) as that might overflow before the 0.5 + return SkScalarHalf(fTop) + SkScalarHalf(fBottom); + } + + /** Returns true if all members in a: fLeft, fTop, fRight, and fBottom; are + equal to the corresponding members in b. + + a and b are not equal if either contain NaN. a and b are equal if members + contain zeroes with different signs. + + @param a SkRect to compare + @param b SkRect to compare + @return true if members are equal + */ + friend bool operator==(const SkRect& a, const SkRect& b) { + return SkScalarsEqual((const SkScalar*)&a, (const SkScalar*)&b, 4); + } + + /** Returns true if any in a: fLeft, fTop, fRight, and fBottom; does not + equal the corresponding members in b. + + a and b are not equal if either contain NaN. a and b are equal if members + contain zeroes with different signs. + + @param a SkRect to compare + @param b SkRect to compare + @return true if members are not equal + */ + friend bool operator!=(const SkRect& a, const SkRect& b) { + return !SkScalarsEqual((const SkScalar*)&a, (const SkScalar*)&b, 4); + } + + /** Returns four points in quad that enclose SkRect ordered as: top-left, top-right, + bottom-right, bottom-left. + + TODO: Consider adding parameter to control whether quad is clockwise or counterclockwise. + + @param quad storage for corners of SkRect + + example: https://fiddle.skia.org/c/@Rect_toQuad + */ + void toQuad(SkPoint quad[4]) const; + + /** Sets SkRect to (0, 0, 0, 0). + + Many other rectangles are empty; if left is equal to or greater than right, + or if top is equal to or greater than bottom. Setting all members to zero + is a convenience, but does not designate a special empty rectangle. + */ + void setEmpty() { *this = MakeEmpty(); } + + /** Sets SkRect to src, promoting src members from integer to scalar. + Very large values in src may lose precision. + + @param src integer SkRect + */ + void set(const SkIRect& src) { + fLeft = SkIntToScalar(src.fLeft); + fTop = SkIntToScalar(src.fTop); + fRight = SkIntToScalar(src.fRight); + fBottom = SkIntToScalar(src.fBottom); + } + + /** Sets SkRect to (left, top, right, bottom). + left and right are not sorted; left is not necessarily less than right. + top and bottom are not sorted; top is not necessarily less than bottom. + + @param left stored in fLeft + @param top stored in fTop + @param right stored in fRight + @param bottom stored in fBottom + */ + void setLTRB(SkScalar left, SkScalar top, SkScalar right, SkScalar bottom) { + fLeft = left; + fTop = top; + fRight = right; + fBottom = bottom; + } + + /** Sets to bounds of SkPoint array with count entries. If count is zero or smaller, + or if SkPoint array contains an infinity or NaN, sets to (0, 0, 0, 0). + + Result is either empty or sorted: fLeft is less than or equal to fRight, and + fTop is less than or equal to fBottom. + + @param pts SkPoint array + @param count entries in array + */ + void setBounds(const SkPoint pts[], int count) { + (void)this->setBoundsCheck(pts, count); + } + + /** Sets to bounds of SkPoint array with count entries. Returns false if count is + zero or smaller, or if SkPoint array contains an infinity or NaN; in these cases + sets SkRect to (0, 0, 0, 0). + + Result is either empty or sorted: fLeft is less than or equal to fRight, and + fTop is less than or equal to fBottom. + + @param pts SkPoint array + @param count entries in array + @return true if all SkPoint values are finite + + example: https://fiddle.skia.org/c/@Rect_setBoundsCheck + */ + bool setBoundsCheck(const SkPoint pts[], int count); + + /** Sets to bounds of SkPoint pts array with count entries. If any SkPoint in pts + contains infinity or NaN, all SkRect dimensions are set to NaN. + + @param pts SkPoint array + @param count entries in array + + example: https://fiddle.skia.org/c/@Rect_setBoundsNoCheck + */ + void setBoundsNoCheck(const SkPoint pts[], int count); + + /** Sets bounds to the smallest SkRect enclosing SkPoint p0 and p1. The result is + sorted and may be empty. Does not check to see if values are finite. + + @param p0 corner to include + @param p1 corner to include + */ + void set(const SkPoint& p0, const SkPoint& p1) { + fLeft = std::min(p0.fX, p1.fX); + fRight = std::max(p0.fX, p1.fX); + fTop = std::min(p0.fY, p1.fY); + fBottom = std::max(p0.fY, p1.fY); + } + + /** Sets SkRect to (x, y, x + width, y + height). + Does not validate input; width or height may be negative. + + @param x stored in fLeft + @param y stored in fTop + @param width added to x and stored in fRight + @param height added to y and stored in fBottom + */ + void setXYWH(SkScalar x, SkScalar y, SkScalar width, SkScalar height) { + fLeft = x; + fTop = y; + fRight = x + width; + fBottom = y + height; + } + + /** Sets SkRect to (0, 0, width, height). Does not validate input; + width or height may be negative. + + @param width stored in fRight + @param height stored in fBottom + */ + void setWH(SkScalar width, SkScalar height) { + fLeft = 0; + fTop = 0; + fRight = width; + fBottom = height; + } + void setIWH(int32_t width, int32_t height) { + this->setWH(SkIntToScalar(width), SkIntToScalar(height)); + } + + /** Returns SkRect offset by (dx, dy). + + If dx is negative, SkRect returned is moved to the left. + If dx is positive, SkRect returned is moved to the right. + If dy is negative, SkRect returned is moved upward. + If dy is positive, SkRect returned is moved downward. + + @param dx added to fLeft and fRight + @param dy added to fTop and fBottom + @return SkRect offset on axes, with original width and height + */ + constexpr SkRect makeOffset(SkScalar dx, SkScalar dy) const { + return MakeLTRB(fLeft + dx, fTop + dy, fRight + dx, fBottom + dy); + } + + /** Returns SkRect offset by v. + + @param v added to rect + @return SkRect offset on axes, with original width and height + */ + constexpr SkRect makeOffset(SkVector v) const { return this->makeOffset(v.x(), v.y()); } + + /** Returns SkRect, inset by (dx, dy). + + If dx is negative, SkRect returned is wider. + If dx is positive, SkRect returned is narrower. + If dy is negative, SkRect returned is taller. + If dy is positive, SkRect returned is shorter. + + @param dx added to fLeft and subtracted from fRight + @param dy added to fTop and subtracted from fBottom + @return SkRect inset symmetrically left and right, top and bottom + */ + SkRect makeInset(SkScalar dx, SkScalar dy) const { + return MakeLTRB(fLeft + dx, fTop + dy, fRight - dx, fBottom - dy); + } + + /** Returns SkRect, outset by (dx, dy). + + If dx is negative, SkRect returned is narrower. + If dx is positive, SkRect returned is wider. + If dy is negative, SkRect returned is shorter. + If dy is positive, SkRect returned is taller. + + @param dx subtracted to fLeft and added from fRight + @param dy subtracted to fTop and added from fBottom + @return SkRect outset symmetrically left and right, top and bottom + */ + SkRect makeOutset(SkScalar dx, SkScalar dy) const { + return MakeLTRB(fLeft - dx, fTop - dy, fRight + dx, fBottom + dy); + } + + /** Offsets SkRect by adding dx to fLeft, fRight; and by adding dy to fTop, fBottom. + + If dx is negative, moves SkRect to the left. + If dx is positive, moves SkRect to the right. + If dy is negative, moves SkRect upward. + If dy is positive, moves SkRect downward. + + @param dx offset added to fLeft and fRight + @param dy offset added to fTop and fBottom + */ + void offset(SkScalar dx, SkScalar dy) { + fLeft += dx; + fTop += dy; + fRight += dx; + fBottom += dy; + } + + /** Offsets SkRect by adding delta.fX to fLeft, fRight; and by adding delta.fY to + fTop, fBottom. + + If delta.fX is negative, moves SkRect to the left. + If delta.fX is positive, moves SkRect to the right. + If delta.fY is negative, moves SkRect upward. + If delta.fY is positive, moves SkRect downward. + + @param delta added to SkRect + */ + void offset(const SkPoint& delta) { + this->offset(delta.fX, delta.fY); + } + + /** Offsets SkRect so that fLeft equals newX, and fTop equals newY. width and height + are unchanged. + + @param newX stored in fLeft, preserving width() + @param newY stored in fTop, preserving height() + */ + void offsetTo(SkScalar newX, SkScalar newY) { + fRight += newX - fLeft; + fBottom += newY - fTop; + fLeft = newX; + fTop = newY; + } + + /** Insets SkRect by (dx, dy). + + If dx is positive, makes SkRect narrower. + If dx is negative, makes SkRect wider. + If dy is positive, makes SkRect shorter. + If dy is negative, makes SkRect taller. + + @param dx added to fLeft and subtracted from fRight + @param dy added to fTop and subtracted from fBottom + */ + void inset(SkScalar dx, SkScalar dy) { + fLeft += dx; + fTop += dy; + fRight -= dx; + fBottom -= dy; + } + + /** Outsets SkRect by (dx, dy). + + If dx is positive, makes SkRect wider. + If dx is negative, makes SkRect narrower. + If dy is positive, makes SkRect taller. + If dy is negative, makes SkRect shorter. + + @param dx subtracted to fLeft and added from fRight + @param dy subtracted to fTop and added from fBottom + */ + void outset(SkScalar dx, SkScalar dy) { this->inset(-dx, -dy); } + + /** Returns true if SkRect intersects r, and sets SkRect to intersection. + Returns false if SkRect does not intersect r, and leaves SkRect unchanged. + + Returns false if either r or SkRect is empty, leaving SkRect unchanged. + + @param r limit of result + @return true if r and SkRect have area in common + + example: https://fiddle.skia.org/c/@Rect_intersect + */ + bool intersect(const SkRect& r); + + /** Returns true if a intersects b, and sets SkRect to intersection. + Returns false if a does not intersect b, and leaves SkRect unchanged. + + Returns false if either a or b is empty, leaving SkRect unchanged. + + @param a SkRect to intersect + @param b SkRect to intersect + @return true if a and b have area in common + */ + bool SK_WARN_UNUSED_RESULT intersect(const SkRect& a, const SkRect& b); + + +private: + static bool Intersects(SkScalar al, SkScalar at, SkScalar ar, SkScalar ab, + SkScalar bl, SkScalar bt, SkScalar br, SkScalar bb) { + SkScalar L = std::max(al, bl); + SkScalar R = std::min(ar, br); + SkScalar T = std::max(at, bt); + SkScalar B = std::min(ab, bb); + return L < R && T < B; + } + +public: + + /** Returns true if SkRect intersects r. + Returns false if either r or SkRect is empty, or do not intersect. + + @param r SkRect to intersect + @return true if r and SkRect have area in common + */ + bool intersects(const SkRect& r) const { + return Intersects(fLeft, fTop, fRight, fBottom, + r.fLeft, r.fTop, r.fRight, r.fBottom); + } + + /** Returns true if a intersects b. + Returns false if either a or b is empty, or do not intersect. + + @param a SkRect to intersect + @param b SkRect to intersect + @return true if a and b have area in common + */ + static bool Intersects(const SkRect& a, const SkRect& b) { + return Intersects(a.fLeft, a.fTop, a.fRight, a.fBottom, + b.fLeft, b.fTop, b.fRight, b.fBottom); + } + + /** Sets SkRect to the union of itself and r. + + Has no effect if r is empty. Otherwise, if SkRect is empty, sets + SkRect to r. + + @param r expansion SkRect + + example: https://fiddle.skia.org/c/@Rect_join_2 + */ + void join(const SkRect& r); + + /** Sets SkRect to the union of itself and r. + + Asserts if r is empty and SK_DEBUG is defined. + If SkRect is empty, sets SkRect to r. + + May produce incorrect results if r is empty. + + @param r expansion SkRect + */ + void joinNonEmptyArg(const SkRect& r) { + SkASSERT(!r.isEmpty()); + // if we are empty, just assign + if (fLeft >= fRight || fTop >= fBottom) { + *this = r; + } else { + this->joinPossiblyEmptyRect(r); + } + } + + /** Sets SkRect to the union of itself and the construction. + + May produce incorrect results if SkRect or r is empty. + + @param r expansion SkRect + */ + void joinPossiblyEmptyRect(const SkRect& r) { + fLeft = std::min(fLeft, r.left()); + fTop = std::min(fTop, r.top()); + fRight = std::max(fRight, r.right()); + fBottom = std::max(fBottom, r.bottom()); + } + + /** Returns true if: fLeft <= x < fRight && fTop <= y < fBottom. + Returns false if SkRect is empty. + + @param x test SkPoint x-coordinate + @param y test SkPoint y-coordinate + @return true if (x, y) is inside SkRect + */ + bool contains(SkScalar x, SkScalar y) const { + return x >= fLeft && x < fRight && y >= fTop && y < fBottom; + } + + /** Returns true if SkRect contains r. + Returns false if SkRect is empty or r is empty. + + SkRect contains r when SkRect area completely includes r area. + + @param r SkRect contained + @return true if all sides of SkRect are outside r + */ + bool contains(const SkRect& r) const { + // todo: can we eliminate the this->isEmpty check? + return !r.isEmpty() && !this->isEmpty() && + fLeft <= r.fLeft && fTop <= r.fTop && + fRight >= r.fRight && fBottom >= r.fBottom; + } + + /** Returns true if SkRect contains r. + Returns false if SkRect is empty or r is empty. + + SkRect contains r when SkRect area completely includes r area. + + @param r SkIRect contained + @return true if all sides of SkRect are outside r + */ + bool contains(const SkIRect& r) const { + // todo: can we eliminate the this->isEmpty check? + return !r.isEmpty() && !this->isEmpty() && + fLeft <= SkIntToScalar(r.fLeft) && fTop <= SkIntToScalar(r.fTop) && + fRight >= SkIntToScalar(r.fRight) && fBottom >= SkIntToScalar(r.fBottom); + } + + /** Sets SkIRect by adding 0.5 and discarding the fractional portion of SkRect + members, using (SkScalarRoundToInt(fLeft), SkScalarRoundToInt(fTop), + SkScalarRoundToInt(fRight), SkScalarRoundToInt(fBottom)). + + @param dst storage for SkIRect + */ + void round(SkIRect* dst) const { + SkASSERT(dst); + dst->setLTRB(SkScalarRoundToInt(fLeft), SkScalarRoundToInt(fTop), + SkScalarRoundToInt(fRight), SkScalarRoundToInt(fBottom)); + } + + /** Sets SkIRect by discarding the fractional portion of fLeft and fTop; and rounding + up fRight and fBottom, using + (SkScalarFloorToInt(fLeft), SkScalarFloorToInt(fTop), + SkScalarCeilToInt(fRight), SkScalarCeilToInt(fBottom)). + + @param dst storage for SkIRect + */ + void roundOut(SkIRect* dst) const { + SkASSERT(dst); + dst->setLTRB(SkScalarFloorToInt(fLeft), SkScalarFloorToInt(fTop), + SkScalarCeilToInt(fRight), SkScalarCeilToInt(fBottom)); + } + + /** Sets SkRect by discarding the fractional portion of fLeft and fTop; and rounding + up fRight and fBottom, using + (SkScalarFloorToInt(fLeft), SkScalarFloorToInt(fTop), + SkScalarCeilToInt(fRight), SkScalarCeilToInt(fBottom)). + + @param dst storage for SkRect + */ + void roundOut(SkRect* dst) const { + dst->setLTRB(SkScalarFloorToScalar(fLeft), SkScalarFloorToScalar(fTop), + SkScalarCeilToScalar(fRight), SkScalarCeilToScalar(fBottom)); + } + + /** Sets SkRect by rounding up fLeft and fTop; and discarding the fractional portion + of fRight and fBottom, using + (SkScalarCeilToInt(fLeft), SkScalarCeilToInt(fTop), + SkScalarFloorToInt(fRight), SkScalarFloorToInt(fBottom)). + + @param dst storage for SkIRect + */ + void roundIn(SkIRect* dst) const { + SkASSERT(dst); + dst->setLTRB(SkScalarCeilToInt(fLeft), SkScalarCeilToInt(fTop), + SkScalarFloorToInt(fRight), SkScalarFloorToInt(fBottom)); + } + + /** Returns SkIRect by adding 0.5 and discarding the fractional portion of SkRect + members, using (SkScalarRoundToInt(fLeft), SkScalarRoundToInt(fTop), + SkScalarRoundToInt(fRight), SkScalarRoundToInt(fBottom)). + + @return rounded SkIRect + */ + SkIRect round() const { + SkIRect ir; + this->round(&ir); + return ir; + } + + /** Sets SkIRect by discarding the fractional portion of fLeft and fTop; and rounding + up fRight and fBottom, using + (SkScalarFloorToInt(fLeft), SkScalarFloorToInt(fTop), + SkScalarCeilToInt(fRight), SkScalarCeilToInt(fBottom)). + + @return rounded SkIRect + */ + SkIRect roundOut() const { + SkIRect ir; + this->roundOut(&ir); + return ir; + } + /** Sets SkIRect by rounding up fLeft and fTop; and discarding the fractional portion + of fRight and fBottom, using + (SkScalarCeilToInt(fLeft), SkScalarCeilToInt(fTop), + SkScalarFloorToInt(fRight), SkScalarFloorToInt(fBottom)). + + @return rounded SkIRect + */ + SkIRect roundIn() const { + SkIRect ir; + this->roundIn(&ir); + return ir; + } + + /** Swaps fLeft and fRight if fLeft is greater than fRight; and swaps + fTop and fBottom if fTop is greater than fBottom. Result may be empty; + and width() and height() will be zero or positive. + */ + void sort() { + using std::swap; + if (fLeft > fRight) { + swap(fLeft, fRight); + } + + if (fTop > fBottom) { + swap(fTop, fBottom); + } + } + + /** Returns SkRect with fLeft and fRight swapped if fLeft is greater than fRight; and + with fTop and fBottom swapped if fTop is greater than fBottom. Result may be empty; + and width() and height() will be zero or positive. + + @return sorted SkRect + */ + SkRect makeSorted() const { + return MakeLTRB(std::min(fLeft, fRight), std::min(fTop, fBottom), + std::max(fLeft, fRight), std::max(fTop, fBottom)); + } + + /** Returns pointer to first scalar in SkRect, to treat it as an array with four + entries. + + @return pointer to fLeft + */ + const SkScalar* asScalars() const { return &fLeft; } + + /** Writes text representation of SkRect to standard output. Set asHex to true to + generate exact binary representations of floating point numbers. + + @param asHex true if SkScalar values are written as hexadecimal + + example: https://fiddle.skia.org/c/@Rect_dump + */ + void dump(bool asHex) const; + + /** Writes text representation of SkRect to standard output. The representation may be + directly compiled as C++ code. Floating point values are written + with limited precision; it may not be possible to reconstruct original SkRect + from output. + */ + void dump() const { this->dump(false); } + + /** Writes text representation of SkRect to standard output. The representation may be + directly compiled as C++ code. Floating point values are written + in hexadecimal to preserve their exact bit pattern. The output reconstructs the + original SkRect. + + Use instead of dump() when submitting + */ + void dumpHex() const { this->dump(true); } +}; + +inline bool SkIRect::contains(const SkRect& r) const { + return !r.isEmpty() && !this->isEmpty() && // check for empties + (SkScalar)fLeft <= r.fLeft && (SkScalar)fTop <= r.fTop && + (SkScalar)fRight >= r.fRight && (SkScalar)fBottom >= r.fBottom; +} + +#endif diff --git a/src/deps/skia/include/core/SkRefCnt.h b/src/deps/skia/include/core/SkRefCnt.h new file mode 100644 index 000000000..bcb75d769 --- /dev/null +++ b/src/deps/skia/include/core/SkRefCnt.h @@ -0,0 +1,382 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkRefCnt_DEFINED +#define SkRefCnt_DEFINED + +#include "include/core/SkTypes.h" + +#include <atomic> // std::atomic, std::memory_order_* +#include <cstddef> // std::nullptr_t +#include <iosfwd> // std::basic_ostream +#include <memory> // TODO: unused +#include <type_traits> // std::enable_if, std::is_convertible +#include <utility> // std::forward, std::swap + +/** \class SkRefCntBase + + SkRefCntBase is the base class for objects that may be shared by multiple + objects. When an existing owner wants to share a reference, it calls ref(). + When an owner wants to release its reference, it calls unref(). When the + shared object's reference count goes to zero as the result of an unref() + call, its (virtual) destructor is called. It is an error for the + destructor to be called explicitly (or via the object going out of scope on + the stack or calling delete) if getRefCnt() > 1. +*/ +class SK_API SkRefCntBase { +public: + /** Default construct, initializing the reference count to 1. + */ + SkRefCntBase() : fRefCnt(1) {} + + /** Destruct, asserting that the reference count is 1. + */ + virtual ~SkRefCntBase() { + #ifdef SK_DEBUG + SkASSERTF(this->getRefCnt() == 1, "fRefCnt was %d", this->getRefCnt()); + // illegal value, to catch us if we reuse after delete + fRefCnt.store(0, std::memory_order_relaxed); + #endif + } + + /** May return true if the caller is the only owner. + * Ensures that all previous owner's actions are complete. + */ + bool unique() const { + if (1 == fRefCnt.load(std::memory_order_acquire)) { + // The acquire barrier is only really needed if we return true. It + // prevents code conditioned on the result of unique() from running + // until previous owners are all totally done calling unref(). + return true; + } + return false; + } + + /** Increment the reference count. Must be balanced by a call to unref(). + */ + void ref() const { + SkASSERT(this->getRefCnt() > 0); + // No barrier required. + (void)fRefCnt.fetch_add(+1, std::memory_order_relaxed); + } + + /** Decrement the reference count. If the reference count is 1 before the + decrement, then delete the object. Note that if this is the case, then + the object needs to have been allocated via new, and not on the stack. + */ + void unref() const { + SkASSERT(this->getRefCnt() > 0); + // A release here acts in place of all releases we "should" have been doing in ref(). + if (1 == fRefCnt.fetch_add(-1, std::memory_order_acq_rel)) { + // Like unique(), the acquire is only needed on success, to make sure + // code in internal_dispose() doesn't happen before the decrement. + this->internal_dispose(); + } + } + +private: + +#ifdef SK_DEBUG + /** Return the reference count. Use only for debugging. */ + int32_t getRefCnt() const { + return fRefCnt.load(std::memory_order_relaxed); + } +#endif + + /** + * Called when the ref count goes to 0. + */ + virtual void internal_dispose() const { + #ifdef SK_DEBUG + SkASSERT(0 == this->getRefCnt()); + fRefCnt.store(1, std::memory_order_relaxed); + #endif + delete this; + } + + // The following friends are those which override internal_dispose() + // and conditionally call SkRefCnt::internal_dispose(). + friend class SkWeakRefCnt; + + mutable std::atomic<int32_t> fRefCnt; + + SkRefCntBase(SkRefCntBase&&) = delete; + SkRefCntBase(const SkRefCntBase&) = delete; + SkRefCntBase& operator=(SkRefCntBase&&) = delete; + SkRefCntBase& operator=(const SkRefCntBase&) = delete; +}; + +#ifdef SK_REF_CNT_MIXIN_INCLUDE +// It is the responsibility of the following include to define the type SkRefCnt. +// This SkRefCnt should normally derive from SkRefCntBase. +#include SK_REF_CNT_MIXIN_INCLUDE +#else +class SK_API SkRefCnt : public SkRefCntBase { + // "#include SK_REF_CNT_MIXIN_INCLUDE" doesn't work with this build system. + #if defined(SK_BUILD_FOR_GOOGLE3) + public: + void deref() const { this->unref(); } + #endif +}; +#endif + +/////////////////////////////////////////////////////////////////////////////// + +/** Call obj->ref() and return obj. The obj must not be nullptr. + */ +template <typename T> static inline T* SkRef(T* obj) { + SkASSERT(obj); + obj->ref(); + return obj; +} + +/** Check if the argument is non-null, and if so, call obj->ref() and return obj. + */ +template <typename T> static inline T* SkSafeRef(T* obj) { + if (obj) { + obj->ref(); + } + return obj; +} + +/** Check if the argument is non-null, and if so, call obj->unref() + */ +template <typename T> static inline void SkSafeUnref(T* obj) { + if (obj) { + obj->unref(); + } +} + +/////////////////////////////////////////////////////////////////////////////// + +// This is a variant of SkRefCnt that's Not Virtual, so weighs 4 bytes instead of 8 or 16. +// There's only benefit to using this if the deriving class does not otherwise need a vtable. +template <typename Derived> +class SkNVRefCnt { +public: + SkNVRefCnt() : fRefCnt(1) {} + ~SkNVRefCnt() { + #ifdef SK_DEBUG + int rc = fRefCnt.load(std::memory_order_relaxed); + SkASSERTF(rc == 1, "NVRefCnt was %d", rc); + #endif + } + + // Implementation is pretty much the same as SkRefCntBase. All required barriers are the same: + // - unique() needs acquire when it returns true, and no barrier if it returns false; + // - ref() doesn't need any barrier; + // - unref() needs a release barrier, and an acquire if it's going to call delete. + + bool unique() const { return 1 == fRefCnt.load(std::memory_order_acquire); } + void ref() const { (void)fRefCnt.fetch_add(+1, std::memory_order_relaxed); } + void unref() const { + if (1 == fRefCnt.fetch_add(-1, std::memory_order_acq_rel)) { + // restore the 1 for our destructor's assert + SkDEBUGCODE(fRefCnt.store(1, std::memory_order_relaxed)); + delete (const Derived*)this; + } + } + void deref() const { this->unref(); } + + // This must be used with caution. It is only valid to call this when 'threadIsolatedTestCnt' + // refs are known to be isolated to the current thread. That is, it is known that there are at + // least 'threadIsolatedTestCnt' refs for which no other thread may make a balancing unref() + // call. Assuming the contract is followed, if this returns false then no other thread has + // ownership of this. If it returns true then another thread *may* have ownership. + bool refCntGreaterThan(int32_t threadIsolatedTestCnt) const { + int cnt = fRefCnt.load(std::memory_order_acquire); + // If this fails then the above contract has been violated. + SkASSERT(cnt >= threadIsolatedTestCnt); + return cnt > threadIsolatedTestCnt; + } + +private: + mutable std::atomic<int32_t> fRefCnt; + + SkNVRefCnt(SkNVRefCnt&&) = delete; + SkNVRefCnt(const SkNVRefCnt&) = delete; + SkNVRefCnt& operator=(SkNVRefCnt&&) = delete; + SkNVRefCnt& operator=(const SkNVRefCnt&) = delete; +}; + +/////////////////////////////////////////////////////////////////////////////////////////////////// + +/** + * Shared pointer class to wrap classes that support a ref()/unref() interface. + * + * This can be used for classes inheriting from SkRefCnt, but it also works for other + * classes that match the interface, but have different internal choices: e.g. the hosted class + * may have its ref/unref be thread-safe, but that is not assumed/imposed by sk_sp. + */ +template <typename T> class sk_sp { +public: + using element_type = T; + + constexpr sk_sp() : fPtr(nullptr) {} + constexpr sk_sp(std::nullptr_t) : fPtr(nullptr) {} + + /** + * Shares the underlying object by calling ref(), so that both the argument and the newly + * created sk_sp both have a reference to it. + */ + sk_sp(const sk_sp<T>& that) : fPtr(SkSafeRef(that.get())) {} + template <typename U, + typename = typename std::enable_if<std::is_convertible<U*, T*>::value>::type> + sk_sp(const sk_sp<U>& that) : fPtr(SkSafeRef(that.get())) {} + + /** + * Move the underlying object from the argument to the newly created sk_sp. Afterwards only + * the new sk_sp will have a reference to the object, and the argument will point to null. + * No call to ref() or unref() will be made. + */ + sk_sp(sk_sp<T>&& that) : fPtr(that.release()) {} + template <typename U, + typename = typename std::enable_if<std::is_convertible<U*, T*>::value>::type> + sk_sp(sk_sp<U>&& that) : fPtr(that.release()) {} + + /** + * Adopt the bare pointer into the newly created sk_sp. + * No call to ref() or unref() will be made. + */ + explicit sk_sp(T* obj) : fPtr(obj) {} + + /** + * Calls unref() on the underlying object pointer. + */ + ~sk_sp() { + SkSafeUnref(fPtr); + SkDEBUGCODE(fPtr = nullptr); + } + + sk_sp<T>& operator=(std::nullptr_t) { this->reset(); return *this; } + + /** + * Shares the underlying object referenced by the argument by calling ref() on it. If this + * sk_sp previously had a reference to an object (i.e. not null) it will call unref() on that + * object. + */ + sk_sp<T>& operator=(const sk_sp<T>& that) { + if (this != &that) { + this->reset(SkSafeRef(that.get())); + } + return *this; + } + template <typename U, + typename = typename std::enable_if<std::is_convertible<U*, T*>::value>::type> + sk_sp<T>& operator=(const sk_sp<U>& that) { + this->reset(SkSafeRef(that.get())); + return *this; + } + + /** + * Move the underlying object from the argument to the sk_sp. If the sk_sp previously held + * a reference to another object, unref() will be called on that object. No call to ref() + * will be made. + */ + sk_sp<T>& operator=(sk_sp<T>&& that) { + this->reset(that.release()); + return *this; + } + template <typename U, + typename = typename std::enable_if<std::is_convertible<U*, T*>::value>::type> + sk_sp<T>& operator=(sk_sp<U>&& that) { + this->reset(that.release()); + return *this; + } + + T& operator*() const { + SkASSERT(this->get() != nullptr); + return *this->get(); + } + + explicit operator bool() const { return this->get() != nullptr; } + + T* get() const { return fPtr; } + T* operator->() const { return fPtr; } + + /** + * Adopt the new bare pointer, and call unref() on any previously held object (if not null). + * No call to ref() will be made. + */ + void reset(T* ptr = nullptr) { + // Calling fPtr->unref() may call this->~() or this->reset(T*). + // http://wg21.cmeerw.net/lwg/issue998 + // http://wg21.cmeerw.net/lwg/issue2262 + T* oldPtr = fPtr; + fPtr = ptr; + SkSafeUnref(oldPtr); + } + + /** + * Return the bare pointer, and set the internal object pointer to nullptr. + * The caller must assume ownership of the object, and manage its reference count directly. + * No call to unref() will be made. + */ + T* SK_WARN_UNUSED_RESULT release() { + T* ptr = fPtr; + fPtr = nullptr; + return ptr; + } + + void swap(sk_sp<T>& that) /*noexcept*/ { + using std::swap; + swap(fPtr, that.fPtr); + } + +private: + T* fPtr; +}; + +template <typename T> inline void swap(sk_sp<T>& a, sk_sp<T>& b) /*noexcept*/ { + a.swap(b); +} + +template <typename T, typename U> inline bool operator==(const sk_sp<T>& a, const sk_sp<U>& b) { + return a.get() == b.get(); +} +template <typename T> inline bool operator==(const sk_sp<T>& a, std::nullptr_t) /*noexcept*/ { + return !a; +} +template <typename T> inline bool operator==(std::nullptr_t, const sk_sp<T>& b) /*noexcept*/ { + return !b; +} + +template <typename T, typename U> inline bool operator!=(const sk_sp<T>& a, const sk_sp<U>& b) { + return a.get() != b.get(); +} +template <typename T> inline bool operator!=(const sk_sp<T>& a, std::nullptr_t) /*noexcept*/ { + return static_cast<bool>(a); +} +template <typename T> inline bool operator!=(std::nullptr_t, const sk_sp<T>& b) /*noexcept*/ { + return static_cast<bool>(b); +} + +template <typename C, typename CT, typename T> +auto operator<<(std::basic_ostream<C, CT>& os, const sk_sp<T>& sp) -> decltype(os << sp.get()) { + return os << sp.get(); +} + +template <typename T, typename... Args> +sk_sp<T> sk_make_sp(Args&&... args) { + return sk_sp<T>(new T(std::forward<Args>(args)...)); +} + +/* + * Returns a sk_sp wrapping the provided ptr AND calls ref on it (if not null). + * + * This is different than the semantics of the constructor for sk_sp, which just wraps the ptr, + * effectively "adopting" it. + */ +template <typename T> sk_sp<T> sk_ref_sp(T* obj) { + return sk_sp<T>(SkSafeRef(obj)); +} + +template <typename T> sk_sp<T> sk_ref_sp(const T* obj) { + return sk_sp<T>(const_cast<T*>(SkSafeRef(obj))); +} + +#endif diff --git a/src/deps/skia/include/core/SkRegion.h b/src/deps/skia/include/core/SkRegion.h new file mode 100644 index 000000000..ab326d98f --- /dev/null +++ b/src/deps/skia/include/core/SkRegion.h @@ -0,0 +1,672 @@ +/* + * Copyright 2005 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkRegion_DEFINED +#define SkRegion_DEFINED + +#include "include/core/SkRect.h" + +class SkPath; +class SkRgnBuilder; + +/** \class SkRegion + SkRegion describes the set of pixels used to clip SkCanvas. SkRegion is compact, + efficiently storing a single integer rectangle, or a run length encoded array + of rectangles. SkRegion may reduce the current SkCanvas clip, or may be drawn as + one or more integer rectangles. SkRegion iterator returns the scan lines or + rectangles contained by it, optionally intersecting a bounding rectangle. +*/ +class SK_API SkRegion { + typedef int32_t RunType; +public: + + /** Constructs an empty SkRegion. SkRegion is set to empty bounds + at (0, 0) with zero width and height. + + @return empty SkRegion + + example: https://fiddle.skia.org/c/@Region_empty_constructor + */ + SkRegion(); + + /** Constructs a copy of an existing region. + Copy constructor makes two regions identical by value. Internally, region and + the returned result share pointer values. The underlying SkRect array is + copied when modified. + + Creating a SkRegion copy is very efficient and never allocates memory. + SkRegion are always copied by value from the interface; the underlying shared + pointers are not exposed. + + @param region SkRegion to copy by value + @return copy of SkRegion + + example: https://fiddle.skia.org/c/@Region_copy_const_SkRegion + */ + SkRegion(const SkRegion& region); + + /** Constructs a rectangular SkRegion matching the bounds of rect. + + @param rect bounds of constructed SkRegion + @return rectangular SkRegion + + example: https://fiddle.skia.org/c/@Region_copy_const_SkIRect + */ + explicit SkRegion(const SkIRect& rect); + + /** Releases ownership of any shared data and deletes data if SkRegion is sole owner. + + example: https://fiddle.skia.org/c/@Region_destructor + */ + ~SkRegion(); + + /** Constructs a copy of an existing region. + Makes two regions identical by value. Internally, region and + the returned result share pointer values. The underlying SkRect array is + copied when modified. + + Creating a SkRegion copy is very efficient and never allocates memory. + SkRegion are always copied by value from the interface; the underlying shared + pointers are not exposed. + + @param region SkRegion to copy by value + @return SkRegion to copy by value + + example: https://fiddle.skia.org/c/@Region_copy_operator + */ + SkRegion& operator=(const SkRegion& region); + + /** Compares SkRegion and other; returns true if they enclose exactly + the same area. + + @param other SkRegion to compare + @return true if SkRegion pair are equivalent + + example: https://fiddle.skia.org/c/@Region_equal1_operator + */ + bool operator==(const SkRegion& other) const; + + /** Compares SkRegion and other; returns true if they do not enclose the same area. + + @param other SkRegion to compare + @return true if SkRegion pair are not equivalent + */ + bool operator!=(const SkRegion& other) const { + return !(*this == other); + } + + /** Sets SkRegion to src, and returns true if src bounds is not empty. + This makes SkRegion and src identical by value. Internally, + SkRegion and src share pointer values. The underlying SkRect array is + copied when modified. + + Creating a SkRegion copy is very efficient and never allocates memory. + SkRegion are always copied by value from the interface; the underlying shared + pointers are not exposed. + + @param src SkRegion to copy + @return copy of src + */ + bool set(const SkRegion& src) { + *this = src; + return !this->isEmpty(); + } + + /** Exchanges SkIRect array of SkRegion and other. swap() internally exchanges pointers, + so it is lightweight and does not allocate memory. + + swap() usage has largely been replaced by operator=(const SkRegion& region). + SkPath do not copy their content on assignment until they are written to, + making assignment as efficient as swap(). + + @param other operator=(const SkRegion& region) set + + example: https://fiddle.skia.org/c/@Region_swap + */ + void swap(SkRegion& other); + + /** Returns true if SkRegion is empty. + Empty SkRegion has bounds width or height less than or equal to zero. + SkRegion() constructs empty SkRegion; setEmpty() + and setRect() with dimensionless data make SkRegion empty. + + @return true if bounds has no width or height + */ + bool isEmpty() const { return fRunHead == emptyRunHeadPtr(); } + + /** Returns true if SkRegion is one SkIRect with positive dimensions. + + @return true if SkRegion contains one SkIRect + */ + bool isRect() const { return fRunHead == kRectRunHeadPtr; } + + /** Returns true if SkRegion is described by more than one rectangle. + + @return true if SkRegion contains more than one SkIRect + */ + bool isComplex() const { return !this->isEmpty() && !this->isRect(); } + + /** Returns minimum and maximum axes values of SkIRect array. + Returns (0, 0, 0, 0) if SkRegion is empty. + + @return combined bounds of all SkIRect elements + */ + const SkIRect& getBounds() const { return fBounds; } + + /** Returns a value that increases with the number of + elements in SkRegion. Returns zero if SkRegion is empty. + Returns one if SkRegion equals SkIRect; otherwise, returns + value greater than one indicating that SkRegion is complex. + + Call to compare SkRegion for relative complexity. + + @return relative complexity + + example: https://fiddle.skia.org/c/@Region_computeRegionComplexity + */ + int computeRegionComplexity() const; + + /** Appends outline of SkRegion to path. + Returns true if SkRegion is not empty; otherwise, returns false, and leaves path + unmodified. + + @param path SkPath to append to + @return true if path changed + + example: https://fiddle.skia.org/c/@Region_getBoundaryPath + */ + bool getBoundaryPath(SkPath* path) const; + + /** Constructs an empty SkRegion. SkRegion is set to empty bounds + at (0, 0) with zero width and height. Always returns false. + + @return false + + example: https://fiddle.skia.org/c/@Region_setEmpty + */ + bool setEmpty(); + + /** Constructs a rectangular SkRegion matching the bounds of rect. + If rect is empty, constructs empty and returns false. + + @param rect bounds of constructed SkRegion + @return true if rect is not empty + + example: https://fiddle.skia.org/c/@Region_setRect + */ + bool setRect(const SkIRect& rect); + + /** Constructs SkRegion as the union of SkIRect in rects array. If count is + zero, constructs empty SkRegion. Returns false if constructed SkRegion is empty. + + May be faster than repeated calls to op(). + + @param rects array of SkIRect + @param count array size + @return true if constructed SkRegion is not empty + + example: https://fiddle.skia.org/c/@Region_setRects + */ + bool setRects(const SkIRect rects[], int count); + + /** Constructs a copy of an existing region. + Makes two regions identical by value. Internally, region and + the returned result share pointer values. The underlying SkRect array is + copied when modified. + + Creating a SkRegion copy is very efficient and never allocates memory. + SkRegion are always copied by value from the interface; the underlying shared + pointers are not exposed. + + @param region SkRegion to copy by value + @return SkRegion to copy by value + + example: https://fiddle.skia.org/c/@Region_setRegion + */ + bool setRegion(const SkRegion& region); + + /** Constructs SkRegion to match outline of path within clip. + Returns false if constructed SkRegion is empty. + + Constructed SkRegion draws the same pixels as path through clip when + anti-aliasing is disabled. + + @param path SkPath providing outline + @param clip SkRegion containing path + @return true if constructed SkRegion is not empty + + example: https://fiddle.skia.org/c/@Region_setPath + */ + bool setPath(const SkPath& path, const SkRegion& clip); + + /** Returns true if SkRegion intersects rect. + Returns false if either rect or SkRegion is empty, or do not intersect. + + @param rect SkIRect to intersect + @return true if rect and SkRegion have area in common + + example: https://fiddle.skia.org/c/@Region_intersects + */ + bool intersects(const SkIRect& rect) const; + + /** Returns true if SkRegion intersects other. + Returns false if either other or SkRegion is empty, or do not intersect. + + @param other SkRegion to intersect + @return true if other and SkRegion have area in common + + example: https://fiddle.skia.org/c/@Region_intersects_2 + */ + bool intersects(const SkRegion& other) const; + + /** Returns true if SkIPoint (x, y) is inside SkRegion. + Returns false if SkRegion is empty. + + @param x test SkIPoint x-coordinate + @param y test SkIPoint y-coordinate + @return true if (x, y) is inside SkRegion + + example: https://fiddle.skia.org/c/@Region_contains + */ + bool contains(int32_t x, int32_t y) const; + + /** Returns true if other is completely inside SkRegion. + Returns false if SkRegion or other is empty. + + @param other SkIRect to contain + @return true if other is inside SkRegion + + example: https://fiddle.skia.org/c/@Region_contains_2 + */ + bool contains(const SkIRect& other) const; + + /** Returns true if other is completely inside SkRegion. + Returns false if SkRegion or other is empty. + + @param other SkRegion to contain + @return true if other is inside SkRegion + + example: https://fiddle.skia.org/c/@Region_contains_3 + */ + bool contains(const SkRegion& other) const; + + /** Returns true if SkRegion is a single rectangle and contains r. + May return false even though SkRegion contains r. + + @param r SkIRect to contain + @return true quickly if r points are equal or inside + */ + bool quickContains(const SkIRect& r) const { + SkASSERT(this->isEmpty() == fBounds.isEmpty()); // valid region + + return r.fLeft < r.fRight && r.fTop < r.fBottom && + fRunHead == kRectRunHeadPtr && // this->isRect() + /* fBounds.contains(left, top, right, bottom); */ + fBounds.fLeft <= r.fLeft && fBounds.fTop <= r.fTop && + fBounds.fRight >= r.fRight && fBounds.fBottom >= r.fBottom; + } + + /** Returns true if SkRegion does not intersect rect. + Returns true if rect is empty or SkRegion is empty. + May return false even though SkRegion does not intersect rect. + + @param rect SkIRect to intersect + @return true if rect does not intersect + */ + bool quickReject(const SkIRect& rect) const { + return this->isEmpty() || rect.isEmpty() || + !SkIRect::Intersects(fBounds, rect); + } + + /** Returns true if SkRegion does not intersect rgn. + Returns true if rgn is empty or SkRegion is empty. + May return false even though SkRegion does not intersect rgn. + + @param rgn SkRegion to intersect + @return true if rgn does not intersect + */ + bool quickReject(const SkRegion& rgn) const { + return this->isEmpty() || rgn.isEmpty() || + !SkIRect::Intersects(fBounds, rgn.fBounds); + } + + /** Offsets SkRegion by ivector (dx, dy). Has no effect if SkRegion is empty. + + @param dx x-axis offset + @param dy y-axis offset + */ + void translate(int dx, int dy) { this->translate(dx, dy, this); } + + /** Offsets SkRegion by ivector (dx, dy), writing result to dst. SkRegion may be passed + as dst parameter, translating SkRegion in place. Has no effect if dst is nullptr. + If SkRegion is empty, sets dst to empty. + + @param dx x-axis offset + @param dy y-axis offset + @param dst translated result + + example: https://fiddle.skia.org/c/@Region_translate_2 + */ + void translate(int dx, int dy, SkRegion* dst) const; + + /** \enum SkRegion::Op + The logical operations that can be performed when combining two SkRegion. + */ + enum Op { + kDifference_Op, //!< target minus operand + kIntersect_Op, //!< target intersected with operand + kUnion_Op, //!< target unioned with operand + kXOR_Op, //!< target exclusive or with operand + kReverseDifference_Op, //!< operand minus target + kReplace_Op, //!< replace target with operand + kLastOp = kReplace_Op, //!< last operator + }; + + static const int kOpCnt = kLastOp + 1; + + /** Replaces SkRegion with the result of SkRegion op rect. + Returns true if replaced SkRegion is not empty. + + @param rect SkIRect operand + @return false if result is empty + */ + bool op(const SkIRect& rect, Op op) { + if (this->isRect() && kIntersect_Op == op) { + if (!fBounds.intersect(rect)) { + return this->setEmpty(); + } + return true; + } + return this->op(*this, rect, op); + } + + /** Replaces SkRegion with the result of SkRegion op rgn. + Returns true if replaced SkRegion is not empty. + + @param rgn SkRegion operand + @return false if result is empty + */ + bool op(const SkRegion& rgn, Op op) { return this->op(*this, rgn, op); } + + /** Replaces SkRegion with the result of rect op rgn. + Returns true if replaced SkRegion is not empty. + + @param rect SkIRect operand + @param rgn SkRegion operand + @return false if result is empty + + example: https://fiddle.skia.org/c/@Region_op_4 + */ + bool op(const SkIRect& rect, const SkRegion& rgn, Op op); + + /** Replaces SkRegion with the result of rgn op rect. + Returns true if replaced SkRegion is not empty. + + @param rgn SkRegion operand + @param rect SkIRect operand + @return false if result is empty + + example: https://fiddle.skia.org/c/@Region_op_5 + */ + bool op(const SkRegion& rgn, const SkIRect& rect, Op op); + + /** Replaces SkRegion with the result of rgna op rgnb. + Returns true if replaced SkRegion is not empty. + + @param rgna SkRegion operand + @param rgnb SkRegion operand + @return false if result is empty + + example: https://fiddle.skia.org/c/@Region_op_6 + */ + bool op(const SkRegion& rgna, const SkRegion& rgnb, Op op); + +#ifdef SK_BUILD_FOR_ANDROID_FRAMEWORK + /** Private. Android framework only. + + @return string representation of SkRegion + */ + char* toString(); +#endif + + /** \class SkRegion::Iterator + Returns sequence of rectangles, sorted along y-axis, then x-axis, that make + up SkRegion. + */ + class SK_API Iterator { + public: + + /** Initializes SkRegion::Iterator with an empty SkRegion. done() on SkRegion::Iterator + returns true. + Call reset() to initialized SkRegion::Iterator at a later time. + + @return empty SkRegion iterator + */ + Iterator() : fRgn(nullptr), fDone(true) {} + + /** Sets SkRegion::Iterator to return elements of SkIRect array in region. + + @param region SkRegion to iterate + @return SkRegion iterator + + example: https://fiddle.skia.org/c/@Region_Iterator_copy_const_SkRegion + */ + Iterator(const SkRegion& region); + + /** SkPoint SkRegion::Iterator to start of SkRegion. + Returns true if SkRegion was set; otherwise, returns false. + + @return true if SkRegion was set + + example: https://fiddle.skia.org/c/@Region_Iterator_rewind + */ + bool rewind(); + + /** Resets iterator, using the new SkRegion. + + @param region SkRegion to iterate + + example: https://fiddle.skia.org/c/@Region_Iterator_reset + */ + void reset(const SkRegion& region); + + /** Returns true if SkRegion::Iterator is pointing to final SkIRect in SkRegion. + + @return true if data parsing is complete + */ + bool done() const { return fDone; } + + /** Advances SkRegion::Iterator to next SkIRect in SkRegion if it is not done. + + example: https://fiddle.skia.org/c/@Region_Iterator_next + */ + void next(); + + /** Returns SkIRect element in SkRegion. Does not return predictable results if SkRegion + is empty. + + @return part of SkRegion as SkIRect + */ + const SkIRect& rect() const { return fRect; } + + /** Returns SkRegion if set; otherwise, returns nullptr. + + @return iterated SkRegion + */ + const SkRegion* rgn() const { return fRgn; } + + private: + const SkRegion* fRgn; + const SkRegion::RunType* fRuns; + SkIRect fRect = {0, 0, 0, 0}; + bool fDone; + }; + + /** \class SkRegion::Cliperator + Returns the sequence of rectangles, sorted along y-axis, then x-axis, that make + up SkRegion intersected with the specified clip rectangle. + */ + class SK_API Cliperator { + public: + + /** Sets SkRegion::Cliperator to return elements of SkIRect array in SkRegion within clip. + + @param region SkRegion to iterate + @param clip bounds of iteration + @return SkRegion iterator + + example: https://fiddle.skia.org/c/@Region_Cliperator_const_SkRegion_const_SkIRect + */ + Cliperator(const SkRegion& region, const SkIRect& clip); + + /** Returns true if SkRegion::Cliperator is pointing to final SkIRect in SkRegion. + + @return true if data parsing is complete + */ + bool done() { return fDone; } + + /** Advances iterator to next SkIRect in SkRegion contained by clip. + + example: https://fiddle.skia.org/c/@Region_Cliperator_next + */ + void next(); + + /** Returns SkIRect element in SkRegion, intersected with clip passed to + SkRegion::Cliperator constructor. Does not return predictable results if SkRegion + is empty. + + @return part of SkRegion inside clip as SkIRect + */ + const SkIRect& rect() const { return fRect; } + + private: + Iterator fIter; + SkIRect fClip; + SkIRect fRect = {0, 0, 0, 0}; + bool fDone; + }; + + /** \class SkRegion::Spanerator + Returns the line segment ends within SkRegion that intersect a horizontal line. + */ + class Spanerator { + public: + + /** Sets SkRegion::Spanerator to return line segments in SkRegion on scan line. + + @param region SkRegion to iterate + @param y horizontal line to intersect + @param left bounds of iteration + @param right bounds of iteration + @return SkRegion iterator + + example: https://fiddle.skia.org/c/@Region_Spanerator_const_SkRegion_int_int_int + */ + Spanerator(const SkRegion& region, int y, int left, int right); + + /** Advances iterator to next span intersecting SkRegion within line segment provided + in constructor. Returns true if interval was found. + + @param left pointer to span start; may be nullptr + @param right pointer to span end; may be nullptr + @return true if interval was found + + example: https://fiddle.skia.org/c/@Region_Spanerator_next + */ + bool next(int* left, int* right); + + private: + const SkRegion::RunType* fRuns; + int fLeft, fRight; + bool fDone; + }; + + /** Writes SkRegion to buffer, and returns number of bytes written. + If buffer is nullptr, returns number number of bytes that would be written. + + @param buffer storage for binary data + @return size of SkRegion + + example: https://fiddle.skia.org/c/@Region_writeToMemory + */ + size_t writeToMemory(void* buffer) const; + + /** Constructs SkRegion from buffer of size length. Returns bytes read. + Returned value will be multiple of four or zero if length was too small. + + @param buffer storage for binary data + @param length size of buffer + @return bytes read + + example: https://fiddle.skia.org/c/@Region_readFromMemory + */ + size_t readFromMemory(const void* buffer, size_t length); + +private: + static constexpr int kOpCount = kReplace_Op + 1; + + // T + // [B N L R S] + // S + static constexpr int kRectRegionRuns = 7; + + struct RunHead; + + static RunHead* emptyRunHeadPtr() { return (SkRegion::RunHead*) -1; } + static constexpr RunHead* kRectRunHeadPtr = nullptr; + + // allocate space for count runs + void allocateRuns(int count); + void allocateRuns(int count, int ySpanCount, int intervalCount); + void allocateRuns(const RunHead& src); + + SkDEBUGCODE(void dump() const;) + + SkIRect fBounds; + RunHead* fRunHead; + + void freeRuns(); + + /** + * Return the runs from this region, consing up fake runs if the region + * is empty or a rect. In those 2 cases, we use tmpStorage to hold the + * run data. + */ + const RunType* getRuns(RunType tmpStorage[], int* intervals) const; + + // This is called with runs[] that do not yet have their interval-count + // field set on each scanline. That is computed as part of this call + // (inside ComputeRunBounds). + bool setRuns(RunType runs[], int count); + + int count_runtype_values(int* itop, int* ibot) const; + + bool isValid() const; + + static void BuildRectRuns(const SkIRect& bounds, + RunType runs[kRectRegionRuns]); + + // If the runs define a simple rect, return true and set bounds to that + // rect. If not, return false and ignore bounds. + static bool RunsAreARect(const SkRegion::RunType runs[], int count, + SkIRect* bounds); + + /** + * If the last arg is null, just return if the result is non-empty, + * else store the result in the last arg. + */ + static bool Oper(const SkRegion&, const SkRegion&, SkRegion::Op, SkRegion*); + + friend struct RunHead; + friend class Iterator; + friend class Spanerator; + friend class SkRegionPriv; + friend class SkRgnBuilder; + friend class SkFlatRegion; +}; + +#endif diff --git a/src/deps/skia/include/core/SkSamplingOptions.h b/src/deps/skia/include/core/SkSamplingOptions.h new file mode 100644 index 000000000..468cf5bef --- /dev/null +++ b/src/deps/skia/include/core/SkSamplingOptions.h @@ -0,0 +1,92 @@ +/* + * Copyright 2020 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkImageSampling_DEFINED +#define SkImageSampling_DEFINED + +#include "include/core/SkTypes.h" +#include <new> + +enum class SkFilterMode { + kNearest, // single sample point (nearest neighbor) + kLinear, // interporate between 2x2 sample points (bilinear interpolation) + + kLast = kLinear, +}; + +enum class SkMipmapMode { + kNone, // ignore mipmap levels, sample from the "base" + kNearest, // sample from the nearest level + kLinear, // interpolate between the two nearest levels + + kLast = kLinear, +}; + +/* + * Specify B and C (each between 0...1) to create a shader that applies the corresponding + * cubic reconstruction filter to the image. + * + * Example values: + * B = 1/3, C = 1/3 "Mitchell" filter + * B = 0, C = 1/2 "Catmull-Rom" filter + * + * See "Reconstruction Filters in Computer Graphics" + * Don P. Mitchell + * Arun N. Netravali + * 1988 + * https://www.cs.utexas.edu/~fussell/courses/cs384g-fall2013/lectures/mitchell/Mitchell.pdf + * + * Desmos worksheet https://www.desmos.com/calculator/aghdpicrvr + * Nice overview https://entropymine.com/imageworsener/bicubic/ + */ +struct SkCubicResampler { + float B, C; + + // Historic default for kHigh_SkFilterQuality + static constexpr SkCubicResampler Mitchell() { return {1/3.0f, 1/3.0f}; } + static constexpr SkCubicResampler CatmullRom() { return {0.0f, 1/2.0f}; } +}; + +struct SK_API SkSamplingOptions { + const bool useCubic = false; + const SkCubicResampler cubic = {0, 0}; + const SkFilterMode filter = SkFilterMode::kNearest; + const SkMipmapMode mipmap = SkMipmapMode::kNone; + + SkSamplingOptions() = default; + SkSamplingOptions(const SkSamplingOptions&) = default; + SkSamplingOptions& operator=(const SkSamplingOptions& that) { + this->~SkSamplingOptions(); // A pedantic no-op. + new (this) SkSamplingOptions(that); + return *this; + } + + SkSamplingOptions(SkFilterMode fm, SkMipmapMode mm) + : useCubic(false) + , filter(fm) + , mipmap(mm) {} + + explicit SkSamplingOptions(SkFilterMode fm) + : useCubic(false) + , filter(fm) + , mipmap(SkMipmapMode::kNone) {} + + explicit SkSamplingOptions(const SkCubicResampler& c) + : useCubic(true) + , cubic(c) {} + + bool operator==(const SkSamplingOptions& other) const { + return useCubic == other.useCubic + && cubic.B == other.cubic.B + && cubic.C == other.cubic.C + && filter == other.filter + && mipmap == other.mipmap; + } + bool operator!=(const SkSamplingOptions& other) const { return !(*this == other); } +}; + +#endif diff --git a/src/deps/skia/include/core/SkScalar.h b/src/deps/skia/include/core/SkScalar.h new file mode 100644 index 000000000..07d4ec73d --- /dev/null +++ b/src/deps/skia/include/core/SkScalar.h @@ -0,0 +1,194 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkScalar_DEFINED +#define SkScalar_DEFINED + +#include "include/private/SkFloatingPoint.h" + +#undef SK_SCALAR_IS_FLOAT +#define SK_SCALAR_IS_FLOAT 1 + +typedef float SkScalar; + +#define SK_Scalar1 1.0f +#define SK_ScalarHalf 0.5f +#define SK_ScalarSqrt2 SK_FloatSqrt2 +#define SK_ScalarPI SK_FloatPI +#define SK_ScalarTanPIOver8 0.414213562f +#define SK_ScalarRoot2Over2 0.707106781f +#define SK_ScalarMax 3.402823466e+38f +#define SK_ScalarInfinity SK_FloatInfinity +#define SK_ScalarNegativeInfinity SK_FloatNegativeInfinity +#define SK_ScalarNaN SK_FloatNaN + +#define SkScalarFloorToScalar(x) sk_float_floor(x) +#define SkScalarCeilToScalar(x) sk_float_ceil(x) +#define SkScalarRoundToScalar(x) sk_float_floor((x) + 0.5f) +#define SkScalarTruncToScalar(x) sk_float_trunc(x) + +#define SkScalarFloorToInt(x) sk_float_floor2int(x) +#define SkScalarCeilToInt(x) sk_float_ceil2int(x) +#define SkScalarRoundToInt(x) sk_float_round2int(x) + +#define SkScalarAbs(x) sk_float_abs(x) +#define SkScalarCopySign(x, y) sk_float_copysign(x, y) +#define SkScalarMod(x, y) sk_float_mod(x,y) +#define SkScalarSqrt(x) sk_float_sqrt(x) +#define SkScalarPow(b, e) sk_float_pow(b, e) + +#define SkScalarSin(radians) (float)sk_float_sin(radians) +#define SkScalarCos(radians) (float)sk_float_cos(radians) +#define SkScalarTan(radians) (float)sk_float_tan(radians) +#define SkScalarASin(val) (float)sk_float_asin(val) +#define SkScalarACos(val) (float)sk_float_acos(val) +#define SkScalarATan2(y, x) (float)sk_float_atan2(y,x) +#define SkScalarExp(x) (float)sk_float_exp(x) +#define SkScalarLog(x) (float)sk_float_log(x) +#define SkScalarLog2(x) (float)sk_float_log2(x) + +////////////////////////////////////////////////////////////////////////////////////////////////// + +#define SkIntToScalar(x) static_cast<SkScalar>(x) +#define SkIntToFloat(x) static_cast<float>(x) +#define SkScalarTruncToInt(x) sk_float_saturate2int(x) + +#define SkScalarToFloat(x) static_cast<float>(x) +#define SkFloatToScalar(x) static_cast<SkScalar>(x) +#define SkScalarToDouble(x) static_cast<double>(x) +#define SkDoubleToScalar(x) sk_double_to_float(x) + +#define SK_ScalarMin (-SK_ScalarMax) + +static inline bool SkScalarIsNaN(SkScalar x) { return x != x; } + +/** Returns true if x is not NaN and not infinite + */ +static inline bool SkScalarIsFinite(SkScalar x) { return sk_float_isfinite(x); } + +static inline bool SkScalarsAreFinite(SkScalar a, SkScalar b) { + return sk_floats_are_finite(a, b); +} + +static inline bool SkScalarsAreFinite(const SkScalar array[], int count) { + return sk_floats_are_finite(array, count); +} + +/** + * Variant of SkScalarRoundToInt, that performs the rounding step (adding 0.5) explicitly using + * double, to avoid possibly losing the low bit(s) of the answer before calling floor(). + * + * This routine will likely be slower than SkScalarRoundToInt(), and should only be used when the + * extra precision is known to be valuable. + * + * In particular, this catches the following case: + * SkScalar x = 0.49999997; + * int ix = SkScalarRoundToInt(x); + * SkASSERT(0 == ix); // <--- fails + * ix = SkDScalarRoundToInt(x); + * SkASSERT(0 == ix); // <--- succeeds + */ +static inline int SkDScalarRoundToInt(SkScalar x) { + double xx = x; + xx += 0.5; + return (int)floor(xx); +} + +/** Returns the fractional part of the scalar. */ +static inline SkScalar SkScalarFraction(SkScalar x) { + return x - SkScalarTruncToScalar(x); +} + +static inline SkScalar SkScalarSquare(SkScalar x) { return x * x; } + +#define SkScalarInvert(x) sk_ieee_float_divide_TODO_IS_DIVIDE_BY_ZERO_SAFE_HERE(SK_Scalar1, (x)) +#define SkScalarAve(a, b) (((a) + (b)) * SK_ScalarHalf) +#define SkScalarHalf(a) ((a) * SK_ScalarHalf) + +#define SkDegreesToRadians(degrees) ((degrees) * (SK_ScalarPI / 180)) +#define SkRadiansToDegrees(radians) ((radians) * (180 / SK_ScalarPI)) + +static inline bool SkScalarIsInt(SkScalar x) { + return x == SkScalarFloorToScalar(x); +} + +/** + * Returns -1 || 0 || 1 depending on the sign of value: + * -1 if x < 0 + * 0 if x == 0 + * 1 if x > 0 + */ +static inline int SkScalarSignAsInt(SkScalar x) { + return x < 0 ? -1 : (x > 0); +} + +// Scalar result version of above +static inline SkScalar SkScalarSignAsScalar(SkScalar x) { + return x < 0 ? -SK_Scalar1 : ((x > 0) ? SK_Scalar1 : 0); +} + +#define SK_ScalarNearlyZero (SK_Scalar1 / (1 << 12)) + +static inline bool SkScalarNearlyZero(SkScalar x, + SkScalar tolerance = SK_ScalarNearlyZero) { + SkASSERT(tolerance >= 0); + return SkScalarAbs(x) <= tolerance; +} + +static inline bool SkScalarNearlyEqual(SkScalar x, SkScalar y, + SkScalar tolerance = SK_ScalarNearlyZero) { + SkASSERT(tolerance >= 0); + return SkScalarAbs(x-y) <= tolerance; +} + +static inline float SkScalarSinSnapToZero(SkScalar radians) { + float v = SkScalarSin(radians); + return SkScalarNearlyZero(v) ? 0.0f : v; +} + +static inline float SkScalarCosSnapToZero(SkScalar radians) { + float v = SkScalarCos(radians); + return SkScalarNearlyZero(v) ? 0.0f : v; +} + +/** Linearly interpolate between A and B, based on t. + If t is 0, return A + If t is 1, return B + else interpolate. + t must be [0..SK_Scalar1] +*/ +static inline SkScalar SkScalarInterp(SkScalar A, SkScalar B, SkScalar t) { + SkASSERT(t >= 0 && t <= SK_Scalar1); + return A + (B - A) * t; +} + +/** Interpolate along the function described by (keys[length], values[length]) + for the passed searchKey. SearchKeys outside the range keys[0]-keys[Length] + clamp to the min or max value. This function assumes the number of pairs + (length) will be small and a linear search is used. + + Repeated keys are allowed for discontinuous functions (so long as keys is + monotonically increasing). If key is the value of a repeated scalar in + keys the first one will be used. +*/ +SkScalar SkScalarInterpFunc(SkScalar searchKey, const SkScalar keys[], + const SkScalar values[], int length); + +/* + * Helper to compare an array of scalars. + */ +static inline bool SkScalarsEqual(const SkScalar a[], const SkScalar b[], int n) { + SkASSERT(n >= 0); + for (int i = 0; i < n; ++i) { + if (a[i] != b[i]) { + return false; + } + } + return true; +} + +#endif diff --git a/src/deps/skia/include/core/SkSerialProcs.h b/src/deps/skia/include/core/SkSerialProcs.h new file mode 100644 index 000000000..87e10d847 --- /dev/null +++ b/src/deps/skia/include/core/SkSerialProcs.h @@ -0,0 +1,73 @@ +/* + * Copyright 2017 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkSerialProcs_DEFINED +#define SkSerialProcs_DEFINED + +#include "include/core/SkImage.h" +#include "include/core/SkPicture.h" +#include "include/core/SkTypeface.h" + +/** + * A serial-proc is asked to serialize the specified object (e.g. picture or image). + * If a data object is returned, it will be used (even if it is zero-length). + * If null is returned, then Skia will take its default action. + * + * The default action for pictures is to use Skia's internal format. + * The default action for images is to encode either in its native format or PNG. + * The default action for typefaces is to use Skia's internal format. + */ + +typedef sk_sp<SkData> (*SkSerialPictureProc)(SkPicture*, void* ctx); +typedef sk_sp<SkData> (*SkSerialImageProc)(SkImage*, void* ctx); +typedef sk_sp<SkData> (*SkSerialTypefaceProc)(SkTypeface*, void* ctx); + +/** + * Called with the encoded form of a picture (previously written with a custom + * SkSerialPictureProc proc). Return a picture object, or nullptr indicating failure. + */ +typedef sk_sp<SkPicture> (*SkDeserialPictureProc)(const void* data, size_t length, void* ctx); + +/** + * Called with the encoded from of an image. The proc can return an image object, or if it + * returns nullptr, then Skia will take its default action to try to create an image from the data. + * + * Note that unlike SkDeserialPictureProc and SkDeserialTypefaceProc, return nullptr from this + * does not indicate failure, but is a signal for Skia to take its default action. + */ +typedef sk_sp<SkImage> (*SkDeserialImageProc)(const void* data, size_t length, void* ctx); + +/** + * Called with the encoded form of a typeface (previously written with a custom + * SkSerialTypefaceProc proc). Return a typeface object, or nullptr indicating failure. + */ +typedef sk_sp<SkTypeface> (*SkDeserialTypefaceProc)(const void* data, size_t length, void* ctx); + +struct SK_API SkSerialProcs { + SkSerialPictureProc fPictureProc = nullptr; + void* fPictureCtx = nullptr; + + SkSerialImageProc fImageProc = nullptr; + void* fImageCtx = nullptr; + + SkSerialTypefaceProc fTypefaceProc = nullptr; + void* fTypefaceCtx = nullptr; +}; + +struct SK_API SkDeserialProcs { + SkDeserialPictureProc fPictureProc = nullptr; + void* fPictureCtx = nullptr; + + SkDeserialImageProc fImageProc = nullptr; + void* fImageCtx = nullptr; + + SkDeserialTypefaceProc fTypefaceProc = nullptr; + void* fTypefaceCtx = nullptr; +}; + +#endif + diff --git a/src/deps/skia/include/core/SkShader.h b/src/deps/skia/include/core/SkShader.h new file mode 100644 index 000000000..fba17f8ad --- /dev/null +++ b/src/deps/skia/include/core/SkShader.h @@ -0,0 +1,148 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkShader_DEFINED +#define SkShader_DEFINED + +#include "include/core/SkBlendMode.h" +#include "include/core/SkColor.h" +#include "include/core/SkFlattenable.h" +#include "include/core/SkImageInfo.h" +#include "include/core/SkMatrix.h" +#include "include/core/SkTileMode.h" + +class SkArenaAlloc; +class SkBitmap; +class SkBlender; +class SkColorFilter; +class SkColorSpace; +class SkImage; +class SkPath; +class SkPicture; +class SkRasterPipeline; +class GrFragmentProcessor; + +/** \class SkShader + * + * Shaders specify the source color(s) for what is being drawn. If a paint + * has no shader, then the paint's color is used. If the paint has a + * shader, then the shader's color(s) are use instead, but they are + * modulated by the paint's alpha. This makes it easy to create a shader + * once (e.g. bitmap tiling or gradient) and then change its transparency + * w/o having to modify the original shader... only the paint's alpha needs + * to be modified. + */ +class SK_API SkShader : public SkFlattenable { +public: + /** + * Returns true if the shader is guaranteed to produce only opaque + * colors, subject to the SkPaint using the shader to apply an opaque + * alpha value. Subclasses should override this to allow some + * optimizations. + */ + virtual bool isOpaque() const { return false; } + + /** + * Iff this shader is backed by a single SkImage, return its ptr (the caller must ref this + * if they want to keep it longer than the lifetime of the shader). If not, return nullptr. + */ + SkImage* isAImage(SkMatrix* localMatrix, SkTileMode xy[2]) const; + + bool isAImage() const { + return this->isAImage(nullptr, (SkTileMode*)nullptr) != nullptr; + } + + /** + * If the shader subclass can be represented as a gradient, asAGradient + * returns the matching GradientType enum (or kNone_GradientType if it + * cannot). Also, if info is not null, asAGradient populates info with + * the relevant (see below) parameters for the gradient. fColorCount + * is both an input and output parameter. On input, it indicates how + * many entries in fColors and fColorOffsets can be used, if they are + * non-NULL. After asAGradient has run, fColorCount indicates how + * many color-offset pairs there are in the gradient. If there is + * insufficient space to store all of the color-offset pairs, fColors + * and fColorOffsets will not be altered. fColorOffsets specifies + * where on the range of 0 to 1 to transition to the given color. + * The meaning of fPoint and fRadius is dependant on the type of gradient. + * + * None: + * info is ignored. + * Color: + * fColorOffsets[0] is meaningless. + * Linear: + * fPoint[0] and fPoint[1] are the end-points of the gradient + * Radial: + * fPoint[0] and fRadius[0] are the center and radius + * Conical: + * fPoint[0] and fRadius[0] are the center and radius of the 1st circle + * fPoint[1] and fRadius[1] are the center and radius of the 2nd circle + * Sweep: + * fPoint[0] is the center of the sweep. + */ + + enum GradientType { + kNone_GradientType, + kColor_GradientType, + kLinear_GradientType, + kRadial_GradientType, + kSweep_GradientType, + kConical_GradientType, + kLast_GradientType = kConical_GradientType, + }; + + struct GradientInfo { + int fColorCount; //!< In-out parameter, specifies passed size + // of fColors/fColorOffsets on input, and + // actual number of colors/offsets on + // output. + SkColor* fColors; //!< The colors in the gradient. + SkScalar* fColorOffsets; //!< The unit offset for color transitions. + SkPoint fPoint[2]; //!< Type specific, see above. + SkScalar fRadius[2]; //!< Type specific, see above. + SkTileMode fTileMode; + uint32_t fGradientFlags; //!< see SkGradientShader::Flags + }; + + // DEPRECATED. skbug.com/8941 + virtual GradientType asAGradient(GradientInfo* info) const; + + ////////////////////////////////////////////////////////////////////////// + // Methods to create combinations or variants of shaders + + /** + * Return a shader that will apply the specified localMatrix to this shader. + * The specified matrix will be applied before any matrix associated with this shader. + */ + sk_sp<SkShader> makeWithLocalMatrix(const SkMatrix&) const; + + /** + * Create a new shader that produces the same colors as invoking this shader and then applying + * the colorfilter. + */ + sk_sp<SkShader> makeWithColorFilter(sk_sp<SkColorFilter>) const; + +private: + SkShader() = default; + friend class SkShaderBase; + + using INHERITED = SkFlattenable; +}; + +class SK_API SkShaders { +public: + static sk_sp<SkShader> Empty(); + static sk_sp<SkShader> Color(SkColor); + static sk_sp<SkShader> Color(const SkColor4f&, sk_sp<SkColorSpace>); + static sk_sp<SkShader> Blend(SkBlendMode mode, sk_sp<SkShader> dst, sk_sp<SkShader> src); + static sk_sp<SkShader> Blend(sk_sp<SkBlender>, sk_sp<SkShader> dst, sk_sp<SkShader> src); + +private: + SkShaders() = delete; +}; + +#endif diff --git a/src/deps/skia/include/core/SkSize.h b/src/deps/skia/include/core/SkSize.h new file mode 100644 index 000000000..79d673775 --- /dev/null +++ b/src/deps/skia/include/core/SkSize.h @@ -0,0 +1,90 @@ +/* + * Copyright 2011 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkSize_DEFINED +#define SkSize_DEFINED + +#include "include/core/SkScalar.h" + +struct SkISize { + int32_t fWidth; + int32_t fHeight; + + static constexpr SkISize Make(int32_t w, int32_t h) { return {w, h}; } + + static constexpr SkISize MakeEmpty() { return {0, 0}; } + + void set(int32_t w, int32_t h) { *this = SkISize{w, h}; } + + /** Returns true iff fWidth == 0 && fHeight == 0 + */ + bool isZero() const { return 0 == fWidth && 0 == fHeight; } + + /** Returns true if either width or height are <= 0 */ + bool isEmpty() const { return fWidth <= 0 || fHeight <= 0; } + + /** Set the width and height to 0 */ + void setEmpty() { fWidth = fHeight = 0; } + + constexpr int32_t width() const { return fWidth; } + constexpr int32_t height() const { return fHeight; } + + constexpr int64_t area() const { return fWidth * fHeight; } + + bool equals(int32_t w, int32_t h) const { return fWidth == w && fHeight == h; } +}; + +static inline bool operator==(const SkISize& a, const SkISize& b) { + return a.fWidth == b.fWidth && a.fHeight == b.fHeight; +} + +static inline bool operator!=(const SkISize& a, const SkISize& b) { return !(a == b); } + +/////////////////////////////////////////////////////////////////////////////// + +struct SkSize { + SkScalar fWidth; + SkScalar fHeight; + + static SkSize Make(SkScalar w, SkScalar h) { return {w, h}; } + + static SkSize Make(const SkISize& src) { + return {SkIntToScalar(src.width()), SkIntToScalar(src.height())}; + } + + static SkSize MakeEmpty() { return {0, 0}; } + + void set(SkScalar w, SkScalar h) { *this = SkSize{w, h}; } + + /** Returns true iff fWidth == 0 && fHeight == 0 + */ + bool isZero() const { return 0 == fWidth && 0 == fHeight; } + + /** Returns true if either width or height are <= 0 */ + bool isEmpty() const { return fWidth <= 0 || fHeight <= 0; } + + /** Set the width and height to 0 */ + void setEmpty() { *this = SkSize{0, 0}; } + + SkScalar width() const { return fWidth; } + SkScalar height() const { return fHeight; } + + bool equals(SkScalar w, SkScalar h) const { return fWidth == w && fHeight == h; } + + SkISize toRound() const { return {SkScalarRoundToInt(fWidth), SkScalarRoundToInt(fHeight)}; } + + SkISize toCeil() const { return {SkScalarCeilToInt(fWidth), SkScalarCeilToInt(fHeight)}; } + + SkISize toFloor() const { return {SkScalarFloorToInt(fWidth), SkScalarFloorToInt(fHeight)}; } +}; + +static inline bool operator==(const SkSize& a, const SkSize& b) { + return a.fWidth == b.fWidth && a.fHeight == b.fHeight; +} + +static inline bool operator!=(const SkSize& a, const SkSize& b) { return !(a == b); } +#endif diff --git a/src/deps/skia/include/core/SkSpan.h b/src/deps/skia/include/core/SkSpan.h new file mode 100644 index 000000000..b09ec867a --- /dev/null +++ b/src/deps/skia/include/core/SkSpan.h @@ -0,0 +1,89 @@ +/* + * Copyright 2018 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkSpan_DEFINED +#define SkSpan_DEFINED + +#include <cstddef> +#include <iterator> +#include <type_traits> +#include <utility> +#include "include/private/SkTLogic.h" + +/** + * An SkSpan is a view of a contiguous collection of elements of type T. It can be directly + * constructed from a pointer and size. SkMakeSpan can be used to construct one from an array, + * or a container (like std::vector). + * + * With C++17, we could add template deduction guides that eliminate the need for SkMakeSpan: + * https://skia-review.googlesource.com/c/skia/+/320264 + */ +template <typename T> +class SkSpan { +public: + constexpr SkSpan() : fPtr{nullptr}, fSize{0} {} + constexpr SkSpan(T* ptr, size_t size) : fPtr{ptr}, fSize{size} { + SkASSERT(size < kMaxSize); + } + template <typename U, typename = typename std::enable_if<std::is_same<const U, T>::value>::type> + constexpr SkSpan(const SkSpan<U>& that) : fPtr(that.data()), fSize{that.size()} {} + constexpr SkSpan(const SkSpan& o) = default; + + constexpr SkSpan& operator=(const SkSpan& that) { + fPtr = that.fPtr; + fSize = that.fSize; + return *this; + } + constexpr T& operator [] (size_t i) const { + SkASSERT(i < this->size()); + return fPtr[i]; + } + constexpr T& front() const { return fPtr[0]; } + constexpr T& back() const { return fPtr[fSize - 1]; } + constexpr T* begin() const { return fPtr; } + constexpr T* end() const { return fPtr + fSize; } + constexpr auto rbegin() const { return std::make_reverse_iterator(this->end()); } + constexpr auto rend() const { return std::make_reverse_iterator(this->begin()); } + constexpr T* data() const { return this->begin(); } + constexpr size_t size() const { return fSize; } + constexpr bool empty() const { return fSize == 0; } + constexpr size_t size_bytes() const { return fSize * sizeof(T); } + constexpr SkSpan<T> first(size_t prefixLen) const { + SkASSERT(prefixLen <= this->size()); + return SkSpan{fPtr, prefixLen}; + } + constexpr SkSpan<T> last(size_t postfixLen) const { + SkASSERT(postfixLen <= this->size()); + return SkSpan{fPtr + (this->size() - postfixLen), postfixLen}; + } + constexpr SkSpan<T> subspan(size_t offset, size_t count) const { + SkASSERT(offset <= this->size()); + SkASSERT(count <= this->size() - offset); + return SkSpan{fPtr + offset, count}; + } + +private: + static constexpr size_t kMaxSize = std::numeric_limits<size_t>::max() / sizeof(T); + T* fPtr; + size_t fSize; +}; + +template <typename T, typename S> inline constexpr SkSpan<T> SkMakeSpan(T* p, S s) { + return SkSpan<T>{p, SkTo<size_t>(s)}; +} + +template <size_t N, typename T> inline constexpr SkSpan<T> SkMakeSpan(T (&a)[N]) { + return SkSpan<T>{a, N}; +} + +template <typename Container> +inline auto SkMakeSpan(Container& c) + -> SkSpan<typename std::remove_reference<decltype(*(c.data()))>::type> { + return {c.data(), c.size()}; +} + +#endif // SkSpan_DEFINED diff --git a/src/deps/skia/include/core/SkStream.h b/src/deps/skia/include/core/SkStream.h new file mode 100644 index 000000000..32dfff25b --- /dev/null +++ b/src/deps/skia/include/core/SkStream.h @@ -0,0 +1,524 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkStream_DEFINED +#define SkStream_DEFINED + +#include "include/core/SkData.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkScalar.h" +#include "include/private/SkTo.h" + +#include <memory.h> + +class SkStream; +class SkStreamRewindable; +class SkStreamSeekable; +class SkStreamAsset; +class SkStreamMemory; + +/** + * SkStream -- abstraction for a source of bytes. Subclasses can be backed by + * memory, or a file, or something else. + * + * NOTE: + * + * Classic "streams" APIs are sort of async, in that on a request for N + * bytes, they may return fewer than N bytes on a given call, in which case + * the caller can "try again" to get more bytes, eventually (modulo an error) + * receiving their total N bytes. + * + * Skia streams behave differently. They are effectively synchronous, and will + * always return all N bytes of the request if possible. If they return fewer + * (the read() call returns the number of bytes read) then that means there is + * no more data (at EOF or hit an error). The caller should *not* call again + * in hopes of fulfilling more of the request. + */ +class SK_API SkStream { +public: + virtual ~SkStream() {} + SkStream() {} + + /** + * Attempts to open the specified file as a stream, returns nullptr on failure. + */ + static std::unique_ptr<SkStreamAsset> MakeFromFile(const char path[]); + + /** Reads or skips size number of bytes. + * If buffer == NULL, skip size bytes, return how many were skipped. + * If buffer != NULL, copy size bytes into buffer, return how many were copied. + * @param buffer when NULL skip size bytes, otherwise copy size bytes into buffer + * @param size the number of bytes to skip or copy + * @return the number of bytes actually read. + */ + virtual size_t read(void* buffer, size_t size) = 0; + + /** Skip size number of bytes. + * @return the actual number bytes that could be skipped. + */ + size_t skip(size_t size) { + return this->read(nullptr, size); + } + + /** + * Attempt to peek at size bytes. + * If this stream supports peeking, copy min(size, peekable bytes) into + * buffer, and return the number of bytes copied. + * If the stream does not support peeking, or cannot peek any bytes, + * return 0 and leave buffer unchanged. + * The stream is guaranteed to be in the same visible state after this + * call, regardless of success or failure. + * @param buffer Must not be NULL, and must be at least size bytes. Destination + * to copy bytes. + * @param size Number of bytes to copy. + * @return The number of bytes peeked/copied. + */ + virtual size_t peek(void* /*buffer*/, size_t /*size*/) const { return 0; } + + /** Returns true when all the bytes in the stream have been read. + * This may return true early (when there are no more bytes to be read) + * or late (after the first unsuccessful read). + */ + virtual bool isAtEnd() const = 0; + + bool SK_WARN_UNUSED_RESULT readS8(int8_t*); + bool SK_WARN_UNUSED_RESULT readS16(int16_t*); + bool SK_WARN_UNUSED_RESULT readS32(int32_t*); + + bool SK_WARN_UNUSED_RESULT readU8(uint8_t* i) { return this->readS8((int8_t*)i); } + bool SK_WARN_UNUSED_RESULT readU16(uint16_t* i) { return this->readS16((int16_t*)i); } + bool SK_WARN_UNUSED_RESULT readU32(uint32_t* i) { return this->readS32((int32_t*)i); } + + bool SK_WARN_UNUSED_RESULT readBool(bool* b) { + uint8_t i; + if (!this->readU8(&i)) { return false; } + *b = (i != 0); + return true; + } + bool SK_WARN_UNUSED_RESULT readScalar(SkScalar*); + bool SK_WARN_UNUSED_RESULT readPackedUInt(size_t*); + +//SkStreamRewindable + /** Rewinds to the beginning of the stream. Returns true if the stream is known + * to be at the beginning after this call returns. + */ + virtual bool rewind() { return false; } + + /** Duplicates this stream. If this cannot be done, returns NULL. + * The returned stream will be positioned at the beginning of its data. + */ + std::unique_ptr<SkStream> duplicate() const { + return std::unique_ptr<SkStream>(this->onDuplicate()); + } + /** Duplicates this stream. If this cannot be done, returns NULL. + * The returned stream will be positioned the same as this stream. + */ + std::unique_ptr<SkStream> fork() const { + return std::unique_ptr<SkStream>(this->onFork()); + } + +//SkStreamSeekable + /** Returns true if this stream can report it's current position. */ + virtual bool hasPosition() const { return false; } + /** Returns the current position in the stream. If this cannot be done, returns 0. */ + virtual size_t getPosition() const { return 0; } + + /** Seeks to an absolute position in the stream. If this cannot be done, returns false. + * If an attempt is made to seek past the end of the stream, the position will be set + * to the end of the stream. + */ + virtual bool seek(size_t /*position*/) { return false; } + + /** Seeks to an relative offset in the stream. If this cannot be done, returns false. + * If an attempt is made to move to a position outside the stream, the position will be set + * to the closest point within the stream (beginning or end). + */ + virtual bool move(long /*offset*/) { return false; } + +//SkStreamAsset + /** Returns true if this stream can report it's total length. */ + virtual bool hasLength() const { return false; } + /** Returns the total length of the stream. If this cannot be done, returns 0. */ + virtual size_t getLength() const { return 0; } + +//SkStreamMemory + /** Returns the starting address for the data. If this cannot be done, returns NULL. */ + //TODO: replace with virtual const SkData* getData() + virtual const void* getMemoryBase() { return nullptr; } + +private: + virtual SkStream* onDuplicate() const { return nullptr; } + virtual SkStream* onFork() const { return nullptr; } + + SkStream(SkStream&&) = delete; + SkStream(const SkStream&) = delete; + SkStream& operator=(SkStream&&) = delete; + SkStream& operator=(const SkStream&) = delete; +}; + +/** SkStreamRewindable is a SkStream for which rewind and duplicate are required. */ +class SK_API SkStreamRewindable : public SkStream { +public: + bool rewind() override = 0; + std::unique_ptr<SkStreamRewindable> duplicate() const { + return std::unique_ptr<SkStreamRewindable>(this->onDuplicate()); + } +private: + SkStreamRewindable* onDuplicate() const override = 0; +}; + +/** SkStreamSeekable is a SkStreamRewindable for which position, seek, move, and fork are required. */ +class SK_API SkStreamSeekable : public SkStreamRewindable { +public: + std::unique_ptr<SkStreamSeekable> duplicate() const { + return std::unique_ptr<SkStreamSeekable>(this->onDuplicate()); + } + + bool hasPosition() const override { return true; } + size_t getPosition() const override = 0; + bool seek(size_t position) override = 0; + bool move(long offset) override = 0; + + std::unique_ptr<SkStreamSeekable> fork() const { + return std::unique_ptr<SkStreamSeekable>(this->onFork()); + } +private: + SkStreamSeekable* onDuplicate() const override = 0; + SkStreamSeekable* onFork() const override = 0; +}; + +/** SkStreamAsset is a SkStreamSeekable for which getLength is required. */ +class SK_API SkStreamAsset : public SkStreamSeekable { +public: + bool hasLength() const override { return true; } + size_t getLength() const override = 0; + + std::unique_ptr<SkStreamAsset> duplicate() const { + return std::unique_ptr<SkStreamAsset>(this->onDuplicate()); + } + std::unique_ptr<SkStreamAsset> fork() const { + return std::unique_ptr<SkStreamAsset>(this->onFork()); + } +private: + SkStreamAsset* onDuplicate() const override = 0; + SkStreamAsset* onFork() const override = 0; +}; + +/** SkStreamMemory is a SkStreamAsset for which getMemoryBase is required. */ +class SK_API SkStreamMemory : public SkStreamAsset { +public: + const void* getMemoryBase() override = 0; + + std::unique_ptr<SkStreamMemory> duplicate() const { + return std::unique_ptr<SkStreamMemory>(this->onDuplicate()); + } + std::unique_ptr<SkStreamMemory> fork() const { + return std::unique_ptr<SkStreamMemory>(this->onFork()); + } +private: + SkStreamMemory* onDuplicate() const override = 0; + SkStreamMemory* onFork() const override = 0; +}; + +class SK_API SkWStream { +public: + virtual ~SkWStream(); + SkWStream() {} + + /** Called to write bytes to a SkWStream. Returns true on success + @param buffer the address of at least size bytes to be written to the stream + @param size The number of bytes in buffer to write to the stream + @return true on success + */ + virtual bool write(const void* buffer, size_t size) = 0; + virtual void flush(); + + virtual size_t bytesWritten() const = 0; + + // helpers + + bool write8(U8CPU value) { + uint8_t v = SkToU8(value); + return this->write(&v, 1); + } + bool write16(U16CPU value) { + uint16_t v = SkToU16(value); + return this->write(&v, 2); + } + bool write32(uint32_t v) { + return this->write(&v, 4); + } + + bool writeText(const char text[]) { + SkASSERT(text); + return this->write(text, strlen(text)); + } + + bool newline() { return this->write("\n", strlen("\n")); } + + bool writeDecAsText(int32_t); + bool writeBigDecAsText(int64_t, int minDigits = 0); + bool writeHexAsText(uint32_t, int minDigits = 0); + bool writeScalarAsText(SkScalar); + + bool writeBool(bool v) { return this->write8(v); } + bool writeScalar(SkScalar); + bool writePackedUInt(size_t); + + bool writeStream(SkStream* input, size_t length); + + /** + * This returns the number of bytes in the stream required to store + * 'value'. + */ + static int SizeOfPackedUInt(size_t value); + +private: + SkWStream(const SkWStream&) = delete; + SkWStream& operator=(const SkWStream&) = delete; +}; + +class SK_API SkNullWStream : public SkWStream { +public: + SkNullWStream() : fBytesWritten(0) {} + + bool write(const void* , size_t n) override { fBytesWritten += n; return true; } + void flush() override {} + size_t bytesWritten() const override { return fBytesWritten; } + +private: + size_t fBytesWritten; +}; + +//////////////////////////////////////////////////////////////////////////////////////// + +#include <stdio.h> + +/** A stream that wraps a C FILE* file stream. */ +class SK_API SkFILEStream : public SkStreamAsset { +public: + /** Initialize the stream by calling sk_fopen on the specified path. + * This internal stream will be closed in the destructor. + */ + explicit SkFILEStream(const char path[] = nullptr); + + /** Initialize the stream with an existing C FILE stream. + * The current position of the C FILE stream will be considered the + * beginning of the SkFILEStream and the current seek end of the FILE will be the end. + * The C FILE stream will be closed in the destructor. + */ + explicit SkFILEStream(FILE* file); + + /** Initialize the stream with an existing C FILE stream. + * The current position of the C FILE stream will be considered the + * beginning of the SkFILEStream and size bytes later will be the end. + * The C FILE stream will be closed in the destructor. + */ + explicit SkFILEStream(FILE* file, size_t size); + + ~SkFILEStream() override; + + static std::unique_ptr<SkFILEStream> Make(const char path[]) { + std::unique_ptr<SkFILEStream> stream(new SkFILEStream(path)); + return stream->isValid() ? std::move(stream) : nullptr; + } + + /** Returns true if the current path could be opened. */ + bool isValid() const { return fFILE != nullptr; } + + /** Close this SkFILEStream. */ + void close(); + + size_t read(void* buffer, size_t size) override; + bool isAtEnd() const override; + + bool rewind() override; + std::unique_ptr<SkStreamAsset> duplicate() const { + return std::unique_ptr<SkStreamAsset>(this->onDuplicate()); + } + + size_t getPosition() const override; + bool seek(size_t position) override; + bool move(long offset) override; + + std::unique_ptr<SkStreamAsset> fork() const { + return std::unique_ptr<SkStreamAsset>(this->onFork()); + } + + size_t getLength() const override; + +private: + explicit SkFILEStream(FILE*, size_t size, size_t start); + explicit SkFILEStream(std::shared_ptr<FILE>, size_t end, size_t start); + explicit SkFILEStream(std::shared_ptr<FILE>, size_t end, size_t start, size_t current); + + SkStreamAsset* onDuplicate() const override; + SkStreamAsset* onFork() const override; + + std::shared_ptr<FILE> fFILE; + // My own council will I keep on sizes and offsets. + // These are seek positions in the underling FILE, not offsets into the stream. + size_t fEnd; + size_t fStart; + size_t fCurrent; + + using INHERITED = SkStreamAsset; +}; + +class SK_API SkMemoryStream : public SkStreamMemory { +public: + SkMemoryStream(); + + /** We allocate (and free) the memory. Write to it via getMemoryBase() */ + SkMemoryStream(size_t length); + + /** If copyData is true, the stream makes a private copy of the data. */ + SkMemoryStream(const void* data, size_t length, bool copyData = false); + + /** Creates the stream to read from the specified data */ + SkMemoryStream(sk_sp<SkData> data); + + /** Returns a stream with a copy of the input data. */ + static std::unique_ptr<SkMemoryStream> MakeCopy(const void* data, size_t length); + + /** Returns a stream with a bare pointer reference to the input data. */ + static std::unique_ptr<SkMemoryStream> MakeDirect(const void* data, size_t length); + + /** Returns a stream with a shared reference to the input data. */ + static std::unique_ptr<SkMemoryStream> Make(sk_sp<SkData> data); + + /** Resets the stream to the specified data and length, + just like the constructor. + if copyData is true, the stream makes a private copy of the data + */ + virtual void setMemory(const void* data, size_t length, + bool copyData = false); + /** Replace any memory buffer with the specified buffer. The caller + must have allocated data with sk_malloc or sk_realloc, since it + will be freed with sk_free. + */ + void setMemoryOwned(const void* data, size_t length); + + sk_sp<SkData> asData() const { return fData; } + void setData(sk_sp<SkData> data); + + void skipToAlign4(); + const void* getAtPos(); + + size_t read(void* buffer, size_t size) override; + bool isAtEnd() const override; + + size_t peek(void* buffer, size_t size) const override; + + bool rewind() override; + + std::unique_ptr<SkMemoryStream> duplicate() const { + return std::unique_ptr<SkMemoryStream>(this->onDuplicate()); + } + + size_t getPosition() const override; + bool seek(size_t position) override; + bool move(long offset) override; + + std::unique_ptr<SkMemoryStream> fork() const { + return std::unique_ptr<SkMemoryStream>(this->onFork()); + } + + size_t getLength() const override; + + const void* getMemoryBase() override; + +private: + SkMemoryStream* onDuplicate() const override; + SkMemoryStream* onFork() const override; + + sk_sp<SkData> fData; + size_t fOffset; + + using INHERITED = SkStreamMemory; +}; + +///////////////////////////////////////////////////////////////////////////////////////////// + +class SK_API SkFILEWStream : public SkWStream { +public: + SkFILEWStream(const char path[]); + ~SkFILEWStream() override; + + /** Returns true if the current path could be opened. + */ + bool isValid() const { return fFILE != nullptr; } + + bool write(const void* buffer, size_t size) override; + void flush() override; + void fsync(); + size_t bytesWritten() const override; + +private: + FILE* fFILE; + + using INHERITED = SkWStream; +}; + +class SK_API SkDynamicMemoryWStream : public SkWStream { +public: + SkDynamicMemoryWStream() = default; + SkDynamicMemoryWStream(SkDynamicMemoryWStream&&); + SkDynamicMemoryWStream& operator=(SkDynamicMemoryWStream&&); + ~SkDynamicMemoryWStream() override; + + bool write(const void* buffer, size_t size) override; + size_t bytesWritten() const override; + + bool read(void* buffer, size_t offset, size_t size); + + /** More efficient version of read(dst, 0, bytesWritten()). */ + void copyTo(void* dst) const; + bool writeToStream(SkWStream* dst) const; + + /** Equivalent to copyTo() followed by reset(), but may save memory use. */ + void copyToAndReset(void* dst); + + /** Equivalent to writeToStream() followed by reset(), but may save memory use. */ + bool writeToAndReset(SkWStream* dst); + + /** Equivalent to writeToStream() followed by reset(), but may save memory use. + When the dst is also a SkDynamicMemoryWStream, the implementation is constant time. */ + bool writeToAndReset(SkDynamicMemoryWStream* dst); + + /** Prepend this stream to dst, resetting this. */ + void prependToAndReset(SkDynamicMemoryWStream* dst); + + /** Return the contents as SkData, and then reset the stream. */ + sk_sp<SkData> detachAsData(); + + /** Reset, returning a reader stream with the current content. */ + std::unique_ptr<SkStreamAsset> detachAsStream(); + + /** Reset the stream to its original, empty, state. */ + void reset(); + void padToAlign4(); +private: + struct Block; + Block* fHead = nullptr; + Block* fTail = nullptr; + size_t fBytesWrittenBeforeTail = 0; + +#ifdef SK_DEBUG + void validate() const; +#else + void validate() const {} +#endif + + // For access to the Block type. + friend class SkBlockMemoryStream; + friend class SkBlockMemoryRefCnt; + + using INHERITED = SkWStream; +}; + +#endif diff --git a/src/deps/skia/include/core/SkString.h b/src/deps/skia/include/core/SkString.h new file mode 100644 index 000000000..5576e7422 --- /dev/null +++ b/src/deps/skia/include/core/SkString.h @@ -0,0 +1,302 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkString_DEFINED +#define SkString_DEFINED + +#include "include/core/SkRefCnt.h" +#include "include/core/SkScalar.h" +#include "include/core/SkTypes.h" +#include "include/private/SkMalloc.h" +#include "include/private/SkTArray.h" +#include "include/private/SkTo.h" + +#include <stdarg.h> +#include <string.h> +#include <atomic> +#include <string> + +namespace skstd { + class string_view; +} + +/* Some helper functions for C strings */ +static inline bool SkStrStartsWith(const char string[], const char prefixStr[]) { + SkASSERT(string); + SkASSERT(prefixStr); + return !strncmp(string, prefixStr, strlen(prefixStr)); +} +static inline bool SkStrStartsWith(const char string[], const char prefixChar) { + SkASSERT(string); + return (prefixChar == *string); +} + +bool SkStrEndsWith(const char string[], const char suffixStr[]); +bool SkStrEndsWith(const char string[], const char suffixChar); + +int SkStrStartsWithOneOf(const char string[], const char prefixes[]); + +static inline int SkStrFind(const char string[], const char substring[]) { + const char *first = strstr(string, substring); + if (nullptr == first) return -1; + return SkToInt(first - &string[0]); +} + +static inline int SkStrFindLastOf(const char string[], const char subchar) { + const char* last = strrchr(string, subchar); + if (nullptr == last) return -1; + return SkToInt(last - &string[0]); +} + +static inline bool SkStrContains(const char string[], const char substring[]) { + SkASSERT(string); + SkASSERT(substring); + return (-1 != SkStrFind(string, substring)); +} +static inline bool SkStrContains(const char string[], const char subchar) { + SkASSERT(string); + char tmp[2]; + tmp[0] = subchar; + tmp[1] = '\0'; + return (-1 != SkStrFind(string, tmp)); +} + +/* + * The SkStrAppend... methods will write into the provided buffer, assuming it is large enough. + * Each method has an associated const (e.g. kSkStrAppendU32_MaxSize) which will be the largest + * value needed for that method's buffer. + * + * char storage[kSkStrAppendU32_MaxSize]; + * SkStrAppendU32(storage, value); + * + * Note : none of the SkStrAppend... methods write a terminating 0 to their buffers. Instead, + * the methods return the ptr to the end of the written part of the buffer. This can be used + * to compute the length, and/or know where to write a 0 if that is desired. + * + * char storage[kSkStrAppendU32_MaxSize + 1]; + * char* stop = SkStrAppendU32(storage, value); + * size_t len = stop - storage; + * *stop = 0; // valid, since storage was 1 byte larger than the max. + */ + +static constexpr int kSkStrAppendU32_MaxSize = 10; +char* SkStrAppendU32(char buffer[], uint32_t); +static constexpr int kSkStrAppendU64_MaxSize = 20; +char* SkStrAppendU64(char buffer[], uint64_t, int minDigits); + +static constexpr int kSkStrAppendS32_MaxSize = kSkStrAppendU32_MaxSize + 1; +char* SkStrAppendS32(char buffer[], int32_t); +static constexpr int kSkStrAppendS64_MaxSize = kSkStrAppendU64_MaxSize + 1; +char* SkStrAppendS64(char buffer[], int64_t, int minDigits); + +/** + * Floats have at most 8 significant digits, so we limit our %g to that. + * However, the total string could be 15 characters: -1.2345678e-005 + * + * In theory we should only expect up to 2 digits for the exponent, but on + * some platforms we have seen 3 (as in the example above). + */ +static constexpr int kSkStrAppendScalar_MaxSize = 15; + +/** + * Write the scalar in decimal format into buffer, and return a pointer to + * the next char after the last one written. Note: a terminating 0 is not + * written into buffer, which must be at least kSkStrAppendScalar_MaxSize. + * Thus if the caller wants to add a 0 at the end, buffer must be at least + * kSkStrAppendScalar_MaxSize + 1 bytes large. + */ +char* SkStrAppendScalar(char buffer[], SkScalar); + +/** \class SkString + + Light weight class for managing strings. Uses reference + counting to make string assignments and copies very fast + with no extra RAM cost. Assumes UTF8 encoding. +*/ +class SK_API SkString { +public: + SkString(); + explicit SkString(size_t len); + explicit SkString(const char text[]); + SkString(const char text[], size_t len); + SkString(const SkString&); + SkString(SkString&&); + explicit SkString(const std::string&); + explicit SkString(skstd::string_view); + ~SkString(); + + bool isEmpty() const { return 0 == fRec->fLength; } + size_t size() const { return (size_t) fRec->fLength; } + const char* c_str() const { return fRec->data(); } + char operator[](size_t n) const { return this->c_str()[n]; } + + bool equals(const SkString&) const; + bool equals(const char text[]) const; + bool equals(const char text[], size_t len) const; + + bool startsWith(const char prefixStr[]) const { + return SkStrStartsWith(fRec->data(), prefixStr); + } + bool startsWith(const char prefixChar) const { + return SkStrStartsWith(fRec->data(), prefixChar); + } + bool endsWith(const char suffixStr[]) const { + return SkStrEndsWith(fRec->data(), suffixStr); + } + bool endsWith(const char suffixChar) const { + return SkStrEndsWith(fRec->data(), suffixChar); + } + bool contains(const char substring[]) const { + return SkStrContains(fRec->data(), substring); + } + bool contains(const char subchar) const { + return SkStrContains(fRec->data(), subchar); + } + int find(const char substring[]) const { + return SkStrFind(fRec->data(), substring); + } + int findLastOf(const char subchar) const { + return SkStrFindLastOf(fRec->data(), subchar); + } + + friend bool operator==(const SkString& a, const SkString& b) { + return a.equals(b); + } + friend bool operator!=(const SkString& a, const SkString& b) { + return !a.equals(b); + } + + // these methods edit the string + + SkString& operator=(const SkString&); + SkString& operator=(SkString&&); + SkString& operator=(const char text[]); + + char* writable_str(); + char& operator[](size_t n) { return this->writable_str()[n]; } + + void reset(); + /** String contents are preserved on resize. (For destructive resize, `set(nullptr, length)`.) + * `resize` automatically reserves an extra byte at the end of the buffer for a null terminator. + */ + void resize(size_t len); + void set(const SkString& src) { *this = src; } + void set(const char text[]); + void set(const char text[], size_t len); + + void insert(size_t offset, const SkString& src) { this->insert(offset, src.c_str(), src.size()); } + void insert(size_t offset, const char text[]); + void insert(size_t offset, const char text[], size_t len); + void insertUnichar(size_t offset, SkUnichar); + void insertS32(size_t offset, int32_t value); + void insertS64(size_t offset, int64_t value, int minDigits = 0); + void insertU32(size_t offset, uint32_t value); + void insertU64(size_t offset, uint64_t value, int minDigits = 0); + void insertHex(size_t offset, uint32_t value, int minDigits = 0); + void insertScalar(size_t offset, SkScalar); + + void append(const SkString& str) { this->insert((size_t)-1, str); } + void append(const char text[]) { this->insert((size_t)-1, text); } + void append(const char text[], size_t len) { this->insert((size_t)-1, text, len); } + void appendUnichar(SkUnichar uni) { this->insertUnichar((size_t)-1, uni); } + void appendS32(int32_t value) { this->insertS32((size_t)-1, value); } + void appendS64(int64_t value, int minDigits = 0) { this->insertS64((size_t)-1, value, minDigits); } + void appendU32(uint32_t value) { this->insertU32((size_t)-1, value); } + void appendU64(uint64_t value, int minDigits = 0) { this->insertU64((size_t)-1, value, minDigits); } + void appendHex(uint32_t value, int minDigits = 0) { this->insertHex((size_t)-1, value, minDigits); } + void appendScalar(SkScalar value) { this->insertScalar((size_t)-1, value); } + + void prepend(const SkString& str) { this->insert(0, str); } + void prepend(const char text[]) { this->insert(0, text); } + void prepend(const char text[], size_t len) { this->insert(0, text, len); } + void prependUnichar(SkUnichar uni) { this->insertUnichar(0, uni); } + void prependS32(int32_t value) { this->insertS32(0, value); } + void prependS64(int32_t value, int minDigits = 0) { this->insertS64(0, value, minDigits); } + void prependHex(uint32_t value, int minDigits = 0) { this->insertHex(0, value, minDigits); } + void prependScalar(SkScalar value) { this->insertScalar((size_t)-1, value); } + + void printf(const char format[], ...) SK_PRINTF_LIKE(2, 3); + void printVAList(const char format[], va_list); + void appendf(const char format[], ...) SK_PRINTF_LIKE(2, 3); + void appendVAList(const char format[], va_list); + void prependf(const char format[], ...) SK_PRINTF_LIKE(2, 3); + void prependVAList(const char format[], va_list); + + void remove(size_t offset, size_t length); + + SkString& operator+=(const SkString& s) { this->append(s); return *this; } + SkString& operator+=(const char text[]) { this->append(text); return *this; } + SkString& operator+=(const char c) { this->append(&c, 1); return *this; } + + /** + * Swap contents between this and other. This function is guaranteed + * to never fail or throw. + */ + void swap(SkString& other); + +private: + struct Rec { + public: + constexpr Rec(uint32_t len, int32_t refCnt) : fLength(len), fRefCnt(refCnt) {} + static sk_sp<Rec> Make(const char text[], size_t len); + char* data() { return fBeginningOfData; } + const char* data() const { return fBeginningOfData; } + void ref() const; + void unref() const; + bool unique() const; +#ifdef SK_DEBUG + int32_t getRefCnt() const; +#endif + uint32_t fLength; // logically size_t, but we want it to stay 32 bits + + private: + mutable std::atomic<int32_t> fRefCnt; + char fBeginningOfData[1] = {'\0'}; + + // Ensure the unsized delete is called. + void operator delete(void* p) { ::operator delete(p); } + }; + sk_sp<Rec> fRec; + +#ifdef SK_DEBUG + const SkString& validate() const; +#else + const SkString& validate() const { return *this; } +#endif + + static const Rec gEmptyRec; +}; + +/// Creates a new string and writes into it using a printf()-style format. +SkString SkStringPrintf(const char* format, ...) SK_PRINTF_LIKE(1, 2); +/// This makes it easier to write a caller as a VAR_ARGS function where the format string is +/// optional. +static inline SkString SkStringPrintf() { return SkString(); } + +static inline void swap(SkString& a, SkString& b) { + a.swap(b); +} + +enum SkStrSplitMode { + // Strictly return all results. If the input is ",," and the separator is ',' this will return + // an array of three empty strings. + kStrict_SkStrSplitMode, + + // Only nonempty results will be added to the results. Multiple separators will be + // coalesced. Separators at the beginning and end of the input will be ignored. If the input is + // ",," and the separator is ',', this will return an empty vector. + kCoalesce_SkStrSplitMode +}; + +// Split str on any characters in delimiters into out. (Think, strtok with a sane API.) +void SkStrSplit(const char* str, const char* delimiters, SkStrSplitMode splitMode, + SkTArray<SkString>* out); +inline void SkStrSplit(const char* str, const char* delimiters, SkTArray<SkString>* out) { + SkStrSplit(str, delimiters, kCoalesce_SkStrSplitMode, out); +} + +#endif diff --git a/src/deps/skia/include/core/SkStringView.h b/src/deps/skia/include/core/SkStringView.h new file mode 100644 index 000000000..184e681d2 --- /dev/null +++ b/src/deps/skia/include/core/SkStringView.h @@ -0,0 +1,185 @@ +/* + * Copyright 2021 Google LLC. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkStringView_DEFINED +#define SkStringView_DEFINED + +#include <algorithm> +#include <cstring> +#include <string> + +namespace skstd { + +class string_view { +public: + using value_type = char; + using traits_type = std::char_traits<value_type>; + using const_pointer = const value_type*; + using const_reference = const value_type&; + using iterator = const_pointer; + using const_iterator = iterator; + using size_type = size_t; + static constexpr size_type npos = size_type(-1); + + constexpr string_view() + : fData(nullptr) + , fLength(0) {} + + constexpr string_view(const string_view&) = default; + + constexpr string_view(const_pointer data, size_type length) + : fData(data) + , fLength(length) {} + + string_view(const_pointer data) + : string_view(data, strlen(data)) {} + + string_view(const std::string& str) + : string_view(str.data(), str.length()) {} + + constexpr string_view& operator=(const string_view&) = default; + + constexpr iterator begin() const { + return fData; + } + + constexpr iterator end() const { + return fData + fLength; + } + + constexpr const_reference operator[](size_type idx) const { + return fData[idx]; + } + + constexpr const_reference front() const { + return fData[0]; + } + + constexpr const_reference back() const { + return fData[fLength - 1]; + } + + constexpr const_pointer data() const { + return fData; + } + + constexpr size_type size() const { + return fLength; + } + + constexpr size_type length() const { + return fLength; + } + + constexpr bool empty() const { + return fLength == 0; + } + + constexpr bool starts_with(string_view s) const { + if (s.length() > fLength) { + return false; + } + return s.length() == 0 || !memcmp(fData, s.fData, s.length()); + } + + constexpr bool starts_with(value_type c) const { + return !this->empty() && this->front() == c; + } + + constexpr bool ends_with(string_view s) const { + if (s.length() > fLength) { + return false; + } + return s.length() == 0 || !memcmp(this->end() - s.length(), s.fData, s.length()); + } + + constexpr bool ends_with(value_type c) const { + return !this->empty() && this->back() == c; + } + + size_type find(string_view needle, size_type pos = 0) const { + if (needle.length() == 0) { + return 0; + } + if (this->length() < needle.length()) { + return npos; + } + const char* match = nullptr; + const char* start = this->data() + pos; + const char* end = start + this->length() - needle.length() + 1; + while ((match = (const char*)(memchr(start, needle[0], (size_t)(end - start))))) { + if (!memcmp(match, needle.data(), needle.length())) { + return (size_type)(match - this->data()); + } else { + start = match + 1; + } + } + return npos; + } + + bool contains(string_view needle) const { + return this->find(needle) != npos; + } + + constexpr string_view substr(size_type pos = 0, size_type count = npos) const { + if (pos > fLength) { + return {}; + } + return string_view{fData + pos, std::min(count, fLength - pos)}; + } + + constexpr void swap(string_view& other) { + const_pointer tempData = fData; + fData = other.fData; + other.fData = tempData; + + size_type tempLength = fLength; + fLength = other.fLength; + other.fLength = tempLength; + } + + constexpr void remove_prefix(size_type n) { + fData += n; + fLength -= n; + } + + constexpr void remove_suffix(size_type n) { + fLength -= n; + } + +private: + const_pointer fData; + size_type fLength; +}; + +bool operator==(string_view left, string_view right); + +bool operator!=(string_view left, string_view right); + +bool operator<(string_view left, string_view right); + +bool operator<=(string_view left, string_view right); + +bool operator>(string_view left, string_view right); + +bool operator>=(string_view left, string_view right); + +} // namespace skstd + +namespace std { + template<> struct hash<skstd::string_view> { + size_t operator()(const skstd::string_view& s) const { + size_t result = 0; + for (auto iter = s.begin(); iter != s.end(); ++iter) { + result = result * 101 + (size_t) *iter; + } + return result; + } + }; +} // namespace std + +#endif diff --git a/src/deps/skia/include/core/SkStrokeRec.h b/src/deps/skia/include/core/SkStrokeRec.h new file mode 100644 index 000000000..b4796fcbf --- /dev/null +++ b/src/deps/skia/include/core/SkStrokeRec.h @@ -0,0 +1,154 @@ +/* + * Copyright 2012 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkStrokeRec_DEFINED +#define SkStrokeRec_DEFINED + +#include "include/core/SkPaint.h" +#include "include/private/SkMacros.h" + +class SkPath; + +SK_BEGIN_REQUIRE_DENSE +class SK_API SkStrokeRec { +public: + enum InitStyle { + kHairline_InitStyle, + kFill_InitStyle + }; + SkStrokeRec(InitStyle style); + SkStrokeRec(const SkPaint&, SkPaint::Style, SkScalar resScale = 1); + explicit SkStrokeRec(const SkPaint&, SkScalar resScale = 1); + + enum Style { + kHairline_Style, + kFill_Style, + kStroke_Style, + kStrokeAndFill_Style + }; + + static constexpr int kStyleCount = kStrokeAndFill_Style + 1; + + Style getStyle() const; + SkScalar getWidth() const { return fWidth; } + SkScalar getMiter() const { return fMiterLimit; } + SkPaint::Cap getCap() const { return (SkPaint::Cap)fCap; } + SkPaint::Join getJoin() const { return (SkPaint::Join)fJoin; } + + bool isHairlineStyle() const { + return kHairline_Style == this->getStyle(); + } + + bool isFillStyle() const { + return kFill_Style == this->getStyle(); + } + + void setFillStyle(); + void setHairlineStyle(); + /** + * Specify the strokewidth, and optionally if you want stroke + fill. + * Note, if width==0, then this request is taken to mean: + * strokeAndFill==true -> new style will be Fill + * strokeAndFill==false -> new style will be Hairline + */ + void setStrokeStyle(SkScalar width, bool strokeAndFill = false); + + void setStrokeParams(SkPaint::Cap cap, SkPaint::Join join, SkScalar miterLimit) { + fCap = cap; + fJoin = join; + fMiterLimit = miterLimit; + } + + SkScalar getResScale() const { + return fResScale; + } + + void setResScale(SkScalar rs) { + SkASSERT(rs > 0 && SkScalarIsFinite(rs)); + fResScale = rs; + } + + /** + * Returns true if this specifes any thick stroking, i.e. applyToPath() + * will return true. + */ + bool needToApply() const { + Style style = this->getStyle(); + return (kStroke_Style == style) || (kStrokeAndFill_Style == style); + } + + /** + * Apply these stroke parameters to the src path, returning the result + * in dst. + * + * If there was no change (i.e. style == hairline or fill) this returns + * false and dst is unchanged. Otherwise returns true and the result is + * stored in dst. + * + * src and dst may be the same path. + */ + bool applyToPath(SkPath* dst, const SkPath& src) const; + + /** + * Apply these stroke parameters to a paint. + */ + void applyToPaint(SkPaint* paint) const; + + /** + * Gives a conservative value for the outset that should applied to a + * geometries bounds to account for any inflation due to applying this + * strokeRec to the geometry. + */ + SkScalar getInflationRadius() const; + + /** + * Equivalent to: + * SkStrokeRec rec(paint, style); + * rec.getInflationRadius(); + * This does not account for other effects on the paint (i.e. path + * effect). + */ + static SkScalar GetInflationRadius(const SkPaint&, SkPaint::Style); + + static SkScalar GetInflationRadius(SkPaint::Join, SkScalar miterLimit, SkPaint::Cap, + SkScalar strokeWidth); + + /** + * Compare if two SkStrokeRecs have an equal effect on a path. + * Equal SkStrokeRecs produce equal paths. Equality of produced + * paths does not take the ResScale parameter into account. + */ + bool hasEqualEffect(const SkStrokeRec& other) const { + if (!this->needToApply()) { + return this->getStyle() == other.getStyle(); + } + return fWidth == other.fWidth && + (fJoin != SkPaint::kMiter_Join || fMiterLimit == other.fMiterLimit) && + fCap == other.fCap && + fJoin == other.fJoin && + fStrokeAndFill == other.fStrokeAndFill; + } + +private: + void init(const SkPaint&, SkPaint::Style, SkScalar resScale); + + SkScalar fResScale; + SkScalar fWidth; + SkScalar fMiterLimit; + // The following three members are packed together into a single u32. + // This is to avoid unnecessary padding and ensure binary equality for + // hashing (because the padded areas might contain garbage values). + // + // fCap and fJoin are larger than needed to avoid having to initialize + // any pad values + uint32_t fCap : 16; // SkPaint::Cap + uint32_t fJoin : 15; // SkPaint::Join + uint32_t fStrokeAndFill : 1; // bool +}; +SK_END_REQUIRE_DENSE + +#endif diff --git a/src/deps/skia/include/core/SkSurface.h b/src/deps/skia/include/core/SkSurface.h new file mode 100644 index 000000000..3718aaaab --- /dev/null +++ b/src/deps/skia/include/core/SkSurface.h @@ -0,0 +1,1079 @@ +/* + * Copyright 2012 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkSurface_DEFINED +#define SkSurface_DEFINED + +#include "include/core/SkImage.h" +#include "include/core/SkPixmap.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkSurfaceProps.h" + +#if SK_SUPPORT_GPU +#include "include/gpu/GrTypes.h" +#endif + +#if defined(SK_BUILD_FOR_ANDROID) && __ANDROID_API__ >= 26 +#include <android/hardware_buffer.h> +#endif + +#ifdef SK_METAL +#include "include/gpu/mtl/GrMtlTypes.h" +#endif + +class SkCanvas; +class SkDeferredDisplayList; +class SkPaint; +class SkSurfaceCharacterization; +class GrBackendRenderTarget; +class GrBackendSemaphore; +class GrBackendSurfaceMutableState; +class GrBackendTexture; +class GrDirectContext; +class GrRecordingContext; +class GrRenderTarget; +enum GrSurfaceOrigin: int; + +/** \class SkSurface + SkSurface is responsible for managing the pixels that a canvas draws into. The pixels can be + allocated either in CPU memory (a raster surface) or on the GPU (a GrRenderTarget surface). + SkSurface takes care of allocating a SkCanvas that will draw into the surface. Call + surface->getCanvas() to use that canvas (but don't delete it, it is owned by the surface). + SkSurface always has non-zero dimensions. If there is a request for a new surface, and either + of the requested dimensions are zero, then nullptr will be returned. +*/ +class SK_API SkSurface : public SkRefCnt { +public: + + /** Allocates raster SkSurface. SkCanvas returned by SkSurface draws directly into pixels. + + SkSurface is returned if all parameters are valid. + Valid parameters include: + info dimensions are greater than zero; + info contains SkColorType and SkAlphaType supported by raster surface; + pixels is not nullptr; + rowBytes is large enough to contain info width pixels of SkColorType. + + Pixel buffer size should be info height times computed rowBytes. + Pixels are not initialized. + To access pixels after drawing, peekPixels() or readPixels(). + + @param imageInfo width, height, SkColorType, SkAlphaType, SkColorSpace, + of raster surface; width and height must be greater than zero + @param pixels pointer to destination pixels buffer + @param rowBytes interval from one SkSurface row to the next + @param surfaceProps LCD striping orientation and setting for device independent fonts; + may be nullptr + @return SkSurface if all parameters are valid; otherwise, nullptr + */ + static sk_sp<SkSurface> MakeRasterDirect(const SkImageInfo& imageInfo, void* pixels, + size_t rowBytes, + const SkSurfaceProps* surfaceProps = nullptr); + + static sk_sp<SkSurface> MakeRasterDirect(const SkPixmap& pm, + const SkSurfaceProps* props = nullptr) { + return MakeRasterDirect(pm.info(), pm.writable_addr(), pm.rowBytes(), props); + } + + /** Allocates raster SkSurface. SkCanvas returned by SkSurface draws directly into pixels. + releaseProc is called with pixels and context when SkSurface is deleted. + + SkSurface is returned if all parameters are valid. + Valid parameters include: + info dimensions are greater than zero; + info contains SkColorType and SkAlphaType supported by raster surface; + pixels is not nullptr; + rowBytes is large enough to contain info width pixels of SkColorType. + + Pixel buffer size should be info height times computed rowBytes. + Pixels are not initialized. + To access pixels after drawing, call flush() or peekPixels(). + + @param imageInfo width, height, SkColorType, SkAlphaType, SkColorSpace, + of raster surface; width and height must be greater than zero + @param pixels pointer to destination pixels buffer + @param rowBytes interval from one SkSurface row to the next + @param releaseProc called when SkSurface is deleted; may be nullptr + @param context passed to releaseProc; may be nullptr + @param surfaceProps LCD striping orientation and setting for device independent fonts; + may be nullptr + @return SkSurface if all parameters are valid; otherwise, nullptr + */ + static sk_sp<SkSurface> MakeRasterDirectReleaseProc(const SkImageInfo& imageInfo, void* pixels, + size_t rowBytes, + void (*releaseProc)(void* pixels, void* context), + void* context, const SkSurfaceProps* surfaceProps = nullptr); + + /** Allocates raster SkSurface. SkCanvas returned by SkSurface draws directly into pixels. + Allocates and zeroes pixel memory. Pixel memory size is imageInfo.height() times + rowBytes, or times imageInfo.minRowBytes() if rowBytes is zero. + Pixel memory is deleted when SkSurface is deleted. + + SkSurface is returned if all parameters are valid. + Valid parameters include: + info dimensions are greater than zero; + info contains SkColorType and SkAlphaType supported by raster surface; + rowBytes is large enough to contain info width pixels of SkColorType, or is zero. + + If rowBytes is zero, a suitable value will be chosen internally. + + @param imageInfo width, height, SkColorType, SkAlphaType, SkColorSpace, + of raster surface; width and height must be greater than zero + @param rowBytes interval from one SkSurface row to the next; may be zero + @param surfaceProps LCD striping orientation and setting for device independent fonts; + may be nullptr + @return SkSurface if all parameters are valid; otherwise, nullptr + */ + static sk_sp<SkSurface> MakeRaster(const SkImageInfo& imageInfo, size_t rowBytes, + const SkSurfaceProps* surfaceProps); + + /** Allocates raster SkSurface. SkCanvas returned by SkSurface draws directly into pixels. + Allocates and zeroes pixel memory. Pixel memory size is imageInfo.height() times + imageInfo.minRowBytes(). + Pixel memory is deleted when SkSurface is deleted. + + SkSurface is returned if all parameters are valid. + Valid parameters include: + info dimensions are greater than zero; + info contains SkColorType and SkAlphaType supported by raster surface. + + @param imageInfo width, height, SkColorType, SkAlphaType, SkColorSpace, + of raster surface; width and height must be greater than zero + @param props LCD striping orientation and setting for device independent fonts; + may be nullptr + @return SkSurface if all parameters are valid; otherwise, nullptr + */ + static sk_sp<SkSurface> MakeRaster(const SkImageInfo& imageInfo, + const SkSurfaceProps* props = nullptr) { + return MakeRaster(imageInfo, 0, props); + } + + /** Allocates raster SkSurface. SkCanvas returned by SkSurface draws directly into pixels. + Allocates and zeroes pixel memory. Pixel memory size is height times width times + four. Pixel memory is deleted when SkSurface is deleted. + + Internally, sets SkImageInfo to width, height, native color type, and + kPremul_SkAlphaType. + + SkSurface is returned if width and height are greater than zero. + + Use to create SkSurface that matches SkPMColor, the native pixel arrangement on + the platform. SkSurface drawn to output device skips converting its pixel format. + + @param width pixel column count; must be greater than zero + @param height pixel row count; must be greater than zero + @param surfaceProps LCD striping orientation and setting for device independent + fonts; may be nullptr + @return SkSurface if all parameters are valid; otherwise, nullptr + */ + static sk_sp<SkSurface> MakeRasterN32Premul(int width, int height, + const SkSurfaceProps* surfaceProps = nullptr); + + /** Caller data passed to RenderTarget/TextureReleaseProc; may be nullptr. */ + typedef void* ReleaseContext; + + /** User function called when supplied render target may be deleted. */ + typedef void (*RenderTargetReleaseProc)(ReleaseContext releaseContext); + + /** User function called when supplied texture may be deleted. */ + typedef void (*TextureReleaseProc)(ReleaseContext releaseContext); + + /** Wraps a GPU-backed texture into SkSurface. Caller must ensure the texture is + valid for the lifetime of returned SkSurface. If sampleCnt greater than zero, + creates an intermediate MSAA SkSurface which is used for drawing backendTexture. + + SkSurface is returned if all parameters are valid. backendTexture is valid if + its pixel configuration agrees with colorSpace and context; for instance, if + backendTexture has an sRGB configuration, then context must support sRGB, + and colorSpace must be present. Further, backendTexture width and height must + not exceed context capabilities, and the context must be able to support + back-end textures. + + Upon success textureReleaseProc is called when it is safe to delete the texture in the + backend API (accounting only for use of the texture by this surface). If SkSurface creation + fails textureReleaseProc is called before this function returns. + + If SK_SUPPORT_GPU is defined as zero, has no effect and returns nullptr. + + @param context GPU context + @param backendTexture texture residing on GPU + @param sampleCnt samples per pixel, or 0 to disable full scene anti-aliasing + @param colorSpace range of colors; may be nullptr + @param surfaceProps LCD striping orientation and setting for device independent + fonts; may be nullptr + @param textureReleaseProc function called when texture can be released + @param releaseContext state passed to textureReleaseProc + @return SkSurface if all parameters are valid; otherwise, nullptr + */ + static sk_sp<SkSurface> MakeFromBackendTexture(GrRecordingContext* context, + const GrBackendTexture& backendTexture, + GrSurfaceOrigin origin, int sampleCnt, + SkColorType colorType, + sk_sp<SkColorSpace> colorSpace, + const SkSurfaceProps* surfaceProps, + TextureReleaseProc textureReleaseProc = nullptr, + ReleaseContext releaseContext = nullptr); + + /** Wraps a GPU-backed buffer into SkSurface. Caller must ensure backendRenderTarget + is valid for the lifetime of returned SkSurface. + + SkSurface is returned if all parameters are valid. backendRenderTarget is valid if + its pixel configuration agrees with colorSpace and context; for instance, if + backendRenderTarget has an sRGB configuration, then context must support sRGB, + and colorSpace must be present. Further, backendRenderTarget width and height must + not exceed context capabilities, and the context must be able to support + back-end render targets. + + Upon success releaseProc is called when it is safe to delete the render target in the + backend API (accounting only for use of the render target by this surface). If SkSurface + creation fails releaseProc is called before this function returns. + + If SK_SUPPORT_GPU is defined as zero, has no effect and returns nullptr. + + @param context GPU context + @param backendRenderTarget GPU intermediate memory buffer + @param colorSpace range of colors + @param surfaceProps LCD striping orientation and setting for device independent + fonts; may be nullptr + @param releaseProc function called when backendRenderTarget can be released + @param releaseContext state passed to releaseProc + @return SkSurface if all parameters are valid; otherwise, nullptr + */ + static sk_sp<SkSurface> MakeFromBackendRenderTarget(GrRecordingContext* context, + const GrBackendRenderTarget& backendRenderTarget, + GrSurfaceOrigin origin, + SkColorType colorType, + sk_sp<SkColorSpace> colorSpace, + const SkSurfaceProps* surfaceProps, + RenderTargetReleaseProc releaseProc = nullptr, + ReleaseContext releaseContext = nullptr); + + /** Returns SkSurface on GPU indicated by context. Allocates memory for + pixels, based on the width, height, and SkColorType in SkImageInfo. budgeted + selects whether allocation for pixels is tracked by context. imageInfo + describes the pixel format in SkColorType, and transparency in + SkAlphaType, and color matching in SkColorSpace. + + sampleCount requests the number of samples per pixel. + Pass zero to disable multi-sample anti-aliasing. The request is rounded + up to the next supported count, or rounded down if it is larger than the + maximum supported count. + + surfaceOrigin pins either the top-left or the bottom-left corner to the origin. + + shouldCreateWithMips hints that SkImage returned by makeImageSnapshot() is mip map. + + If SK_SUPPORT_GPU is defined as zero, has no effect and returns nullptr. + + @param context GPU context + @param imageInfo width, height, SkColorType, SkAlphaType, SkColorSpace; + width, or height, or both, may be zero + @param sampleCount samples per pixel, or 0 to disable full scene anti-aliasing + @param surfaceProps LCD striping orientation and setting for device independent + fonts; may be nullptr + @param shouldCreateWithMips hint that SkSurface will host mip map images + @return SkSurface if all parameters are valid; otherwise, nullptr + */ + static sk_sp<SkSurface> MakeRenderTarget(GrRecordingContext* context, SkBudgeted budgeted, + const SkImageInfo& imageInfo, + int sampleCount, GrSurfaceOrigin surfaceOrigin, + const SkSurfaceProps* surfaceProps, + bool shouldCreateWithMips = false); + + /** Returns SkSurface on GPU indicated by context. Allocates memory for + pixels, based on the width, height, and SkColorType in SkImageInfo. budgeted + selects whether allocation for pixels is tracked by context. imageInfo + describes the pixel format in SkColorType, and transparency in + SkAlphaType, and color matching in SkColorSpace. + + sampleCount requests the number of samples per pixel. + Pass zero to disable multi-sample anti-aliasing. The request is rounded + up to the next supported count, or rounded down if it is larger than the + maximum supported count. + + SkSurface bottom-left corner is pinned to the origin. + + @param context GPU context + @param imageInfo width, height, SkColorType, SkAlphaType, SkColorSpace, + of raster surface; width, or height, or both, may be zero + @param sampleCount samples per pixel, or 0 to disable multi-sample anti-aliasing + @param surfaceProps LCD striping orientation and setting for device independent + fonts; may be nullptr + @return SkSurface if all parameters are valid; otherwise, nullptr + */ + static sk_sp<SkSurface> MakeRenderTarget(GrRecordingContext* context, SkBudgeted budgeted, + const SkImageInfo& imageInfo, int sampleCount, + const SkSurfaceProps* surfaceProps) { +#if SK_SUPPORT_GPU + return MakeRenderTarget(context, budgeted, imageInfo, sampleCount, + kBottomLeft_GrSurfaceOrigin, surfaceProps); +#else + // TODO(kjlubick, scroggo) Remove this once Android is updated. + return nullptr; +#endif + } + + /** Returns SkSurface on GPU indicated by context. Allocates memory for + pixels, based on the width, height, and SkColorType in SkImageInfo. budgeted + selects whether allocation for pixels is tracked by context. imageInfo + describes the pixel format in SkColorType, and transparency in + SkAlphaType, and color matching in SkColorSpace. + + SkSurface bottom-left corner is pinned to the origin. + + @param context GPU context + @param imageInfo width, height, SkColorType, SkAlphaType, SkColorSpace, + of raster surface; width, or height, or both, may be zero + @return SkSurface if all parameters are valid; otherwise, nullptr + */ + static sk_sp<SkSurface> MakeRenderTarget(GrRecordingContext* context, SkBudgeted budgeted, + const SkImageInfo& imageInfo) { +#if SK_SUPPORT_GPU + if (!imageInfo.width() || !imageInfo.height()) { + return nullptr; + } + return MakeRenderTarget(context, budgeted, imageInfo, 0, kBottomLeft_GrSurfaceOrigin, + nullptr); +#else + // TODO(kjlubick, scroggo) Remove this once Android is updated. + return nullptr; +#endif + } + + /** Returns SkSurface on GPU indicated by context that is compatible with the provided + characterization. budgeted selects whether allocation for pixels is tracked by context. + + @param context GPU context + @param characterization description of the desired SkSurface + @return SkSurface if all parameters are valid; otherwise, nullptr + */ + static sk_sp<SkSurface> MakeRenderTarget(GrRecordingContext* context, + const SkSurfaceCharacterization& characterization, + SkBudgeted budgeted); + + +#if defined(SK_BUILD_FOR_ANDROID) && __ANDROID_API__ >= 26 + /** Private. + Creates SkSurface from Android hardware buffer. + Returned SkSurface takes a reference on the buffer. The ref on the buffer will be released + when the SkSurface is destroyed and there is no pending work on the GPU involving the + buffer. + + Only available on Android, when __ANDROID_API__ is defined to be 26 or greater. + + Currently this is only supported for buffers that can be textured as well as rendered to. + In other words that must have both AHARDWAREBUFFER_USAGE_GPU_COLOR_OUTPUT and + AHARDWAREBUFFER_USAGE_GPU_SAMPLED_IMAGE usage bits. + + @param context GPU context + @param hardwareBuffer AHardwareBuffer Android hardware buffer + @param colorSpace range of colors; may be nullptr + @param surfaceProps LCD striping orientation and setting for device independent + fonts; may be nullptr + @param fromWindow Whether or not the AHardwareBuffer is part of an Android Window. + Currently only used with Vulkan backend. + @return created SkSurface, or nullptr + */ + static sk_sp<SkSurface> MakeFromAHardwareBuffer(GrDirectContext* context, + AHardwareBuffer* hardwareBuffer, + GrSurfaceOrigin origin, + sk_sp<SkColorSpace> colorSpace, + const SkSurfaceProps* surfaceProps +#ifdef SK_BUILD_FOR_ANDROID_FRAMEWORK + , bool fromWindow = false +#endif // SK_BUILD_FOR_ANDROID_FRAMEWORK + ); +#endif + +#ifdef SK_METAL + /** Creates SkSurface from CAMetalLayer. + Returned SkSurface takes a reference on the CAMetalLayer. The ref on the layer will be + released when the SkSurface is destroyed. + + Only available when Metal API is enabled. + + Will grab the current drawable from the layer and use its texture as a backendRT to + create a renderable surface. + + @param context GPU context + @param layer GrMTLHandle (expected to be a CAMetalLayer*) + @param sampleCnt samples per pixel, or 0 to disable full scene anti-aliasing + @param colorSpace range of colors; may be nullptr + @param surfaceProps LCD striping orientation and setting for device independent + fonts; may be nullptr + @param drawable Pointer to drawable to be filled in when this surface is + instantiated; may not be nullptr + @return created SkSurface, or nullptr + */ + static sk_sp<SkSurface> MakeFromCAMetalLayer(GrRecordingContext* context, + GrMTLHandle layer, + GrSurfaceOrigin origin, + int sampleCnt, + SkColorType colorType, + sk_sp<SkColorSpace> colorSpace, + const SkSurfaceProps* surfaceProps, + GrMTLHandle* drawable) + SK_API_AVAILABLE_CA_METAL_LAYER; + + /** Creates SkSurface from MTKView. + Returned SkSurface takes a reference on the MTKView. The ref on the layer will be + released when the SkSurface is destroyed. + + Only available when Metal API is enabled. + + Will grab the current drawable from the layer and use its texture as a backendRT to + create a renderable surface. + + @param context GPU context + @param layer GrMTLHandle (expected to be a MTKView*) + @param sampleCnt samples per pixel, or 0 to disable full scene anti-aliasing + @param colorSpace range of colors; may be nullptr + @param surfaceProps LCD striping orientation and setting for device independent + fonts; may be nullptr + @return created SkSurface, or nullptr + */ + static sk_sp<SkSurface> MakeFromMTKView(GrRecordingContext* context, + GrMTLHandle mtkView, + GrSurfaceOrigin origin, + int sampleCnt, + SkColorType colorType, + sk_sp<SkColorSpace> colorSpace, + const SkSurfaceProps* surfaceProps) + SK_API_AVAILABLE(macos(10.11), ios(9.0)); +#endif + + /** Is this surface compatible with the provided characterization? + + This method can be used to determine if an existing SkSurface is a viable destination + for an SkDeferredDisplayList. + + @param characterization The characterization for which a compatibility check is desired + @return true if this surface is compatible with the characterization; + false otherwise + */ + bool isCompatible(const SkSurfaceCharacterization& characterization) const; + + /** Returns SkSurface without backing pixels. Drawing to SkCanvas returned from SkSurface + has no effect. Calling makeImageSnapshot() on returned SkSurface returns nullptr. + + @param width one or greater + @param height one or greater + @return SkSurface if width and height are positive; otherwise, nullptr + + example: https://fiddle.skia.org/c/@Surface_MakeNull + */ + static sk_sp<SkSurface> MakeNull(int width, int height); + + /** Returns pixel count in each row; may be zero or greater. + + @return number of pixel columns + */ + int width() const { return fWidth; } + + /** Returns pixel row count; may be zero or greater. + + @return number of pixel rows + */ + int height() const { return fHeight; } + + /** Returns an ImageInfo describing the surface. + */ + SkImageInfo imageInfo(); + + /** Returns unique value identifying the content of SkSurface. Returned value changes + each time the content changes. Content is changed by drawing, or by calling + notifyContentWillChange(). + + @return unique content identifier + + example: https://fiddle.skia.org/c/@Surface_notifyContentWillChange + */ + uint32_t generationID(); + + /** \enum SkSurface::ContentChangeMode + ContentChangeMode members are parameters to notifyContentWillChange(). + */ + enum ContentChangeMode { + kDiscard_ContentChangeMode, //!< discards surface on change + kRetain_ContentChangeMode, //!< preserves surface on change + }; + + /** Notifies that SkSurface contents will be changed by code outside of Skia. + Subsequent calls to generationID() return a different value. + + TODO: Can kRetain_ContentChangeMode be deprecated? + + example: https://fiddle.skia.org/c/@Surface_notifyContentWillChange + */ + void notifyContentWillChange(ContentChangeMode mode); + + /** Returns the recording context being used by the SkSurface. + + @return the recording context, if available; nullptr otherwise + */ + GrRecordingContext* recordingContext(); + +#if SK_SUPPORT_GPU + enum BackendHandleAccess { + kFlushRead_BackendHandleAccess, //!< back-end object is readable + kFlushWrite_BackendHandleAccess, //!< back-end object is writable + kDiscardWrite_BackendHandleAccess, //!< back-end object must be overwritten + }; + + /** Deprecated. + */ + static const BackendHandleAccess kFlushRead_TextureHandleAccess = + kFlushRead_BackendHandleAccess; + + /** Deprecated. + */ + static const BackendHandleAccess kFlushWrite_TextureHandleAccess = + kFlushWrite_BackendHandleAccess; + + /** Deprecated. + */ + static const BackendHandleAccess kDiscardWrite_TextureHandleAccess = + kDiscardWrite_BackendHandleAccess; + + /** Retrieves the back-end texture. If SkSurface has no back-end texture, an invalid + object is returned. Call GrBackendTexture::isValid to determine if the result + is valid. + + The returned GrBackendTexture should be discarded if the SkSurface is drawn to or deleted. + + @return GPU texture reference; invalid on failure + */ + GrBackendTexture getBackendTexture(BackendHandleAccess backendHandleAccess); + + /** Retrieves the back-end render target. If SkSurface has no back-end render target, an invalid + object is returned. Call GrBackendRenderTarget::isValid to determine if the result + is valid. + + The returned GrBackendRenderTarget should be discarded if the SkSurface is drawn to + or deleted. + + @return GPU render target reference; invalid on failure + */ + GrBackendRenderTarget getBackendRenderTarget(BackendHandleAccess backendHandleAccess); + + /** If the surface was made via MakeFromBackendTexture then it's backing texture may be + substituted with a different texture. The contents of the previous backing texture are + copied into the new texture. SkCanvas state is preserved. The original sample count is + used. The GrBackendFormat and dimensions of replacement texture must match that of + the original. + + Upon success textureReleaseProc is called when it is safe to delete the texture in the + backend API (accounting only for use of the texture by this surface). If SkSurface creation + fails textureReleaseProc is called before this function returns. + + @param backendTexture the new backing texture for the surface + @param mode Retain or discard current Content + @param textureReleaseProc function called when texture can be released + @param releaseContext state passed to textureReleaseProc + */ + bool replaceBackendTexture(const GrBackendTexture& backendTexture, + GrSurfaceOrigin origin, + ContentChangeMode mode = kRetain_ContentChangeMode, + TextureReleaseProc textureReleaseProc = nullptr, + ReleaseContext releaseContext = nullptr); +#endif + + /** Returns SkCanvas that draws into SkSurface. Subsequent calls return the same SkCanvas. + SkCanvas returned is managed and owned by SkSurface, and is deleted when SkSurface + is deleted. + + @return drawing SkCanvas for SkSurface + + example: https://fiddle.skia.org/c/@Surface_getCanvas + */ + SkCanvas* getCanvas(); + + /** Returns a compatible SkSurface, or nullptr. Returned SkSurface contains + the same raster, GPU, or null properties as the original. Returned SkSurface + does not share the same pixels. + + Returns nullptr if imageInfo width or height are zero, or if imageInfo + is incompatible with SkSurface. + + @param imageInfo width, height, SkColorType, SkAlphaType, SkColorSpace, + of SkSurface; width and height must be greater than zero + @return compatible SkSurface or nullptr + + example: https://fiddle.skia.org/c/@Surface_makeSurface + */ + sk_sp<SkSurface> makeSurface(const SkImageInfo& imageInfo); + + /** Calls makeSurface(ImageInfo) with the same ImageInfo as this surface, but with the + * specified width and height. + */ + sk_sp<SkSurface> makeSurface(int width, int height); + + /** Returns SkImage capturing SkSurface contents. Subsequent drawing to SkSurface contents + are not captured. SkImage allocation is accounted for if SkSurface was created with + SkBudgeted::kYes. + + @return SkImage initialized with SkSurface contents + + example: https://fiddle.skia.org/c/@Surface_makeImageSnapshot + */ + sk_sp<SkImage> makeImageSnapshot(); + + /** + * Like the no-parameter version, this returns an image of the current surface contents. + * This variant takes a rectangle specifying the subset of the surface that is of interest. + * These bounds will be sanitized before being used. + * - If bounds extends beyond the surface, it will be trimmed to just the intersection of + * it and the surface. + * - If bounds does not intersect the surface, then this returns nullptr. + * - If bounds == the surface, then this is the same as calling the no-parameter variant. + + example: https://fiddle.skia.org/c/@Surface_makeImageSnapshot_2 + */ + sk_sp<SkImage> makeImageSnapshot(const SkIRect& bounds); + + /** Draws SkSurface contents to canvas, with its top-left corner at (x, y). + + If SkPaint paint is not nullptr, apply SkColorFilter, alpha, SkImageFilter, and SkBlendMode. + + @param canvas SkCanvas drawn into + @param x horizontal offset in SkCanvas + @param y vertical offset in SkCanvas + @param sampling what technique to use when sampling the surface pixels + @param paint SkPaint containing SkBlendMode, SkColorFilter, SkImageFilter, + and so on; or nullptr + + example: https://fiddle.skia.org/c/@Surface_draw + */ + void draw(SkCanvas* canvas, SkScalar x, SkScalar y, const SkSamplingOptions& sampling, + const SkPaint* paint); + + void draw(SkCanvas* canvas, SkScalar x, SkScalar y, const SkPaint* paint = nullptr) { + this->draw(canvas, x, y, SkSamplingOptions(), paint); + } + + /** Copies SkSurface pixel address, row bytes, and SkImageInfo to SkPixmap, if address + is available, and returns true. If pixel address is not available, return + false and leave SkPixmap unchanged. + + pixmap contents become invalid on any future change to SkSurface. + + @param pixmap storage for pixel state if pixels are readable; otherwise, ignored + @return true if SkSurface has direct access to pixels + + example: https://fiddle.skia.org/c/@Surface_peekPixels + */ + bool peekPixels(SkPixmap* pixmap); + + /** Copies SkRect of pixels to dst. + + Source SkRect corners are (srcX, srcY) and SkSurface (width(), height()). + Destination SkRect corners are (0, 0) and (dst.width(), dst.height()). + Copies each readable pixel intersecting both rectangles, without scaling, + converting to dst.colorType() and dst.alphaType() if required. + + Pixels are readable when SkSurface is raster, or backed by a GPU. + + The destination pixel storage must be allocated by the caller. + + Pixel values are converted only if SkColorType and SkAlphaType + do not match. Only pixels within both source and destination rectangles + are copied. dst contents outside SkRect intersection are unchanged. + + Pass negative values for srcX or srcY to offset pixels across or down destination. + + Does not copy, and returns false if: + - Source and destination rectangles do not intersect. + - SkPixmap pixels could not be allocated. + - dst.rowBytes() is too small to contain one row of pixels. + + @param dst storage for pixels copied from SkSurface + @param srcX offset into readable pixels on x-axis; may be negative + @param srcY offset into readable pixels on y-axis; may be negative + @return true if pixels were copied + + example: https://fiddle.skia.org/c/@Surface_readPixels + */ + bool readPixels(const SkPixmap& dst, int srcX, int srcY); + + /** Copies SkRect of pixels from SkCanvas into dstPixels. + + Source SkRect corners are (srcX, srcY) and SkSurface (width(), height()). + Destination SkRect corners are (0, 0) and (dstInfo.width(), dstInfo.height()). + Copies each readable pixel intersecting both rectangles, without scaling, + converting to dstInfo.colorType() and dstInfo.alphaType() if required. + + Pixels are readable when SkSurface is raster, or backed by a GPU. + + The destination pixel storage must be allocated by the caller. + + Pixel values are converted only if SkColorType and SkAlphaType + do not match. Only pixels within both source and destination rectangles + are copied. dstPixels contents outside SkRect intersection are unchanged. + + Pass negative values for srcX or srcY to offset pixels across or down destination. + + Does not copy, and returns false if: + - Source and destination rectangles do not intersect. + - SkSurface pixels could not be converted to dstInfo.colorType() or dstInfo.alphaType(). + - dstRowBytes is too small to contain one row of pixels. + + @param dstInfo width, height, SkColorType, and SkAlphaType of dstPixels + @param dstPixels storage for pixels; dstInfo.height() times dstRowBytes, or larger + @param dstRowBytes size of one destination row; dstInfo.width() times pixel size, or larger + @param srcX offset into readable pixels on x-axis; may be negative + @param srcY offset into readable pixels on y-axis; may be negative + @return true if pixels were copied + */ + bool readPixels(const SkImageInfo& dstInfo, void* dstPixels, size_t dstRowBytes, + int srcX, int srcY); + + /** Copies SkRect of pixels from SkSurface into bitmap. + + Source SkRect corners are (srcX, srcY) and SkSurface (width(), height()). + Destination SkRect corners are (0, 0) and (bitmap.width(), bitmap.height()). + Copies each readable pixel intersecting both rectangles, without scaling, + converting to bitmap.colorType() and bitmap.alphaType() if required. + + Pixels are readable when SkSurface is raster, or backed by a GPU. + + The destination pixel storage must be allocated by the caller. + + Pixel values are converted only if SkColorType and SkAlphaType + do not match. Only pixels within both source and destination rectangles + are copied. dst contents outside SkRect intersection are unchanged. + + Pass negative values for srcX or srcY to offset pixels across or down destination. + + Does not copy, and returns false if: + - Source and destination rectangles do not intersect. + - SkSurface pixels could not be converted to dst.colorType() or dst.alphaType(). + - dst pixels could not be allocated. + - dst.rowBytes() is too small to contain one row of pixels. + + @param dst storage for pixels copied from SkSurface + @param srcX offset into readable pixels on x-axis; may be negative + @param srcY offset into readable pixels on y-axis; may be negative + @return true if pixels were copied + + example: https://fiddle.skia.org/c/@Surface_readPixels_3 + */ + bool readPixels(const SkBitmap& dst, int srcX, int srcY); + + using AsyncReadResult = SkImage::AsyncReadResult; + + /** Client-provided context that is passed to client-provided ReadPixelsContext. */ + using ReadPixelsContext = void*; + + /** Client-provided callback to asyncRescaleAndReadPixels() or + asyncRescaleAndReadPixelsYUV420() that is called when read result is ready or on failure. + */ + using ReadPixelsCallback = void(ReadPixelsContext, std::unique_ptr<const AsyncReadResult>); + + /** Controls the gamma that rescaling occurs in for asyncRescaleAndReadPixels() and + asyncRescaleAndReadPixelsYUV420(). + */ + using RescaleGamma = SkImage::RescaleGamma; + using RescaleMode = SkImage::RescaleMode; + + /** Makes surface pixel data available to caller, possibly asynchronously. It can also rescale + the surface pixels. + + Currently asynchronous reads are only supported on the GPU backend and only when the + underlying 3D API supports transfer buffers and CPU/GPU synchronization primitives. In all + other cases this operates synchronously. + + Data is read from the source sub-rectangle, is optionally converted to a linear gamma, is + rescaled to the size indicated by 'info', is then converted to the color space, color type, + and alpha type of 'info'. A 'srcRect' that is not contained by the bounds of the surface + causes failure. + + When the pixel data is ready the caller's ReadPixelsCallback is called with a + AsyncReadResult containing pixel data in the requested color type, alpha type, and color + space. The AsyncReadResult will have count() == 1. Upon failure the callback is called + with nullptr for AsyncReadResult. For a GPU surface this flushes work but a submit must + occur to guarantee a finite time before the callback is called. + + The data is valid for the lifetime of AsyncReadResult with the exception that if the + SkSurface is GPU-backed the data is immediately invalidated if the context is abandoned + or destroyed. + + @param info info of the requested pixels + @param srcRect subrectangle of surface to read + @param rescaleGamma controls whether rescaling is done in the surface's gamma or whether + the source data is transformed to a linear gamma before rescaling. + @param rescaleMode controls the technique of the rescaling + @param callback function to call with result of the read + @param context passed to callback + */ + void asyncRescaleAndReadPixels(const SkImageInfo& info, + const SkIRect& srcRect, + RescaleGamma rescaleGamma, + RescaleMode rescaleMode, + ReadPixelsCallback callback, + ReadPixelsContext context); + + /** + Similar to asyncRescaleAndReadPixels but performs an additional conversion to YUV. The + RGB->YUV conversion is controlled by 'yuvColorSpace'. The YUV data is returned as three + planes ordered y, u, v. The u and v planes are half the width and height of the resized + rectangle. The y, u, and v values are single bytes. Currently this fails if 'dstSize' + width and height are not even. A 'srcRect' that is not contained by the bounds of the + surface causes failure. + + When the pixel data is ready the caller's ReadPixelsCallback is called with a + AsyncReadResult containing the planar data. The AsyncReadResult will have count() == 3. + Upon failure the callback is called with nullptr for AsyncReadResult. For a GPU surface this + flushes work but a submit must occur to guarantee a finite time before the callback is + called. + + The data is valid for the lifetime of AsyncReadResult with the exception that if the + SkSurface is GPU-backed the data is immediately invalidated if the context is abandoned + or destroyed. + + @param yuvColorSpace The transformation from RGB to YUV. Applied to the resized image + after it is converted to dstColorSpace. + @param dstColorSpace The color space to convert the resized image to, after rescaling. + @param srcRect The portion of the surface to rescale and convert to YUV planes. + @param dstSize The size to rescale srcRect to + @param rescaleGamma controls whether rescaling is done in the surface's gamma or whether + the source data is transformed to a linear gamma before rescaling. + @param rescaleMode controls the sampling technique of the rescaling + @param callback function to call with the planar read result + @param context passed to callback + */ + void asyncRescaleAndReadPixelsYUV420(SkYUVColorSpace yuvColorSpace, + sk_sp<SkColorSpace> dstColorSpace, + const SkIRect& srcRect, + const SkISize& dstSize, + RescaleGamma rescaleGamma, + RescaleMode rescaleMode, + ReadPixelsCallback callback, + ReadPixelsContext context); + + /** Copies SkRect of pixels from the src SkPixmap to the SkSurface. + + Source SkRect corners are (0, 0) and (src.width(), src.height()). + Destination SkRect corners are (dstX, dstY) and + (dstX + Surface width(), dstY + Surface height()). + + Copies each readable pixel intersecting both rectangles, without scaling, + converting to SkSurface colorType() and SkSurface alphaType() if required. + + @param src storage for pixels to copy to SkSurface + @param dstX x-axis position relative to SkSurface to begin copy; may be negative + @param dstY y-axis position relative to SkSurface to begin copy; may be negative + + example: https://fiddle.skia.org/c/@Surface_writePixels + */ + void writePixels(const SkPixmap& src, int dstX, int dstY); + + /** Copies SkRect of pixels from the src SkBitmap to the SkSurface. + + Source SkRect corners are (0, 0) and (src.width(), src.height()). + Destination SkRect corners are (dstX, dstY) and + (dstX + Surface width(), dstY + Surface height()). + + Copies each readable pixel intersecting both rectangles, without scaling, + converting to SkSurface colorType() and SkSurface alphaType() if required. + + @param src storage for pixels to copy to SkSurface + @param dstX x-axis position relative to SkSurface to begin copy; may be negative + @param dstY y-axis position relative to SkSurface to begin copy; may be negative + + example: https://fiddle.skia.org/c/@Surface_writePixels_2 + */ + void writePixels(const SkBitmap& src, int dstX, int dstY); + + /** Returns SkSurfaceProps for surface. + + @return LCD striping orientation and setting for device independent fonts + */ + const SkSurfaceProps& props() const { return fProps; } + + /** Call to ensure all reads/writes of the surface have been issued to the underlying 3D API. + Skia will correctly order its own draws and pixel operations. This must to be used to ensure + correct ordering when the surface backing store is accessed outside Skia (e.g. direct use of + the 3D API or a windowing system). GrDirectContext has additional flush and submit methods + that apply to all surfaces and images created from a GrDirectContext. This is equivalent to + calling SkSurface::flush with a default GrFlushInfo followed by + GrDirectContext::submit(syncCpu). + */ + void flushAndSubmit(bool syncCpu = false); + + enum class BackendSurfaceAccess { + kNoAccess, //!< back-end object will not be used by client + kPresent, //!< back-end surface will be used for presenting to screen + }; + +#if SK_SUPPORT_GPU + /** Issues pending SkSurface commands to the GPU-backed API objects and resolves any SkSurface + MSAA. A call to GrDirectContext::submit is always required to ensure work is actually sent + to the gpu. Some specific API details: + GL: Commands are actually sent to the driver, but glFlush is never called. Thus some + sync objects from the flush will not be valid until a submission occurs. + + Vulkan/Metal/D3D/Dawn: Commands are recorded to the backend APIs corresponding command + buffer or encoder objects. However, these objects are not sent to the gpu until a + submission occurs. + + The work that is submitted to the GPU will be dependent on the BackendSurfaceAccess that is + passed in. + + If BackendSurfaceAccess::kNoAccess is passed in all commands will be issued to the GPU. + + If BackendSurfaceAccess::kPresent is passed in and the backend API is not Vulkan, it is + treated the same as kNoAccess. If the backend API is Vulkan, the VkImage that backs the + SkSurface will be transferred back to its original queue. If the SkSurface was created by + wrapping a VkImage, the queue will be set to the queue which was originally passed in on + the GrVkImageInfo. Additionally, if the original queue was not external or foreign the + layout of the VkImage will be set to VK_IMAGE_LAYOUT_PRESENT_SRC_KHR. + + The GrFlushInfo describes additional options to flush. Please see documentation at + GrFlushInfo for more info. + + If the return is GrSemaphoresSubmitted::kYes, only initialized GrBackendSemaphores will be + submitted to the gpu during the next submit call (it is possible Skia failed to create a + subset of the semaphores). The client should not wait on these semaphores until after submit + has been called, but must keep them alive until then. If a submit flag was passed in with + the flush these valid semaphores can we waited on immediately. If this call returns + GrSemaphoresSubmitted::kNo, the GPU backend will not submit any semaphores to be signaled on + the GPU. Thus the client should not have the GPU wait on any of the semaphores passed in + with the GrFlushInfo. Regardless of whether semaphores were submitted to the GPU or not, the + client is still responsible for deleting any initialized semaphores. + Regardless of semaphore submission the context will still be flushed. It should be + emphasized that a return value of GrSemaphoresSubmitted::kNo does not mean the flush did not + happen. It simply means there were no semaphores submitted to the GPU. A caller should only + take this as a failure if they passed in semaphores to be submitted. + + Pending surface commands are flushed regardless of the return result. + + @param access type of access the call will do on the backend object after flush + @param info flush options + */ + GrSemaphoresSubmitted flush(BackendSurfaceAccess access, const GrFlushInfo& info); + + /** Issues pending SkSurface commands to the GPU-backed API objects and resolves any SkSurface + MSAA. A call to GrDirectContext::submit is always required to ensure work is actually sent + to the gpu. Some specific API details: + GL: Commands are actually sent to the driver, but glFlush is never called. Thus some + sync objects from the flush will not be valid until a submission occurs. + + Vulkan/Metal/D3D/Dawn: Commands are recorded to the backend APIs corresponding command + buffer or encoder objects. However, these objects are not sent to the gpu until a + submission occurs. + + The GrFlushInfo describes additional options to flush. Please see documentation at + GrFlushInfo for more info. + + If a GrBackendSurfaceMutableState is passed in, at the end of the flush we will transition + the surface to be in the state requested by the GrBackendSurfaceMutableState. If the surface + (or SkImage or GrBackendSurface wrapping the same backend object) is used again after this + flush the state may be changed and no longer match what is requested here. This is often + used if the surface will be used for presenting or external use and the client wants backend + object to be prepped for that use. A finishedProc or semaphore on the GrFlushInfo will also + include the work for any requested state change. + + If the backend API is Vulkan, the caller can set the GrBackendSurfaceMutableState's + VkImageLayout to VK_IMAGE_LAYOUT_UNDEFINED or queueFamilyIndex to VK_QUEUE_FAMILY_IGNORED to + tell Skia to not change those respective states. + + If the return is GrSemaphoresSubmitted::kYes, only initialized GrBackendSemaphores will be + submitted to the gpu during the next submit call (it is possible Skia failed to create a + subset of the semaphores). The client should not wait on these semaphores until after submit + has been called, but must keep them alive until then. If a submit flag was passed in with + the flush these valid semaphores can we waited on immediately. If this call returns + GrSemaphoresSubmitted::kNo, the GPU backend will not submit any semaphores to be signaled on + the GPU. Thus the client should not have the GPU wait on any of the semaphores passed in + with the GrFlushInfo. Regardless of whether semaphores were submitted to the GPU or not, the + client is still responsible for deleting any initialized semaphores. + Regardleess of semaphore submission the context will still be flushed. It should be + emphasized that a return value of GrSemaphoresSubmitted::kNo does not mean the flush did not + happen. It simply means there were no semaphores submitted to the GPU. A caller should only + take this as a failure if they passed in semaphores to be submitted. + + Pending surface commands are flushed regardless of the return result. + + @param info flush options + @param access optional state change request after flush + */ + GrSemaphoresSubmitted flush(const GrFlushInfo& info, + const GrBackendSurfaceMutableState* newState = nullptr); +#endif // SK_SUPPORT_GPU + + void flush(); + + /** Inserts a list of GPU semaphores that the current GPU-backed API must wait on before + executing any more commands on the GPU for this surface. If this call returns false, then + the GPU back-end will not wait on any passed in semaphores, and the client will still own + the semaphores, regardless of the value of deleteSemaphoresAfterWait. + + If deleteSemaphoresAfterWait is false then Skia will not delete the semaphores. In this case + it is the client's responsibility to not destroy or attempt to reuse the semaphores until it + knows that Skia has finished waiting on them. This can be done by using finishedProcs + on flush calls. + + @param numSemaphores size of waitSemaphores array + @param waitSemaphores array of semaphore containers + @paramm deleteSemaphoresAfterWait who owns and should delete the semaphores + @return true if GPU is waiting on semaphores + */ + bool wait(int numSemaphores, const GrBackendSemaphore* waitSemaphores, + bool deleteSemaphoresAfterWait = true); + + /** Initializes SkSurfaceCharacterization that can be used to perform GPU back-end + processing in a separate thread. Typically this is used to divide drawing + into multiple tiles. SkDeferredDisplayListRecorder records the drawing commands + for each tile. + + Return true if SkSurface supports characterization. raster surface returns false. + + @param characterization properties for parallel drawing + @return true if supported + + example: https://fiddle.skia.org/c/@Surface_characterize + */ + bool characterize(SkSurfaceCharacterization* characterization) const; + + /** Draws the deferred display list created via a SkDeferredDisplayListRecorder. + If the deferred display list is not compatible with this SkSurface, the draw is skipped + and false is return. + + The xOffset and yOffset parameters are experimental and, if not both zero, will cause + the draw to be ignored. + When implemented, if xOffset or yOffset are non-zero, the DDL will be drawn offset by that + amount into the surface. + + @param deferredDisplayList drawing commands + @param xOffset x-offset at which to draw the DDL + @param yOffset y-offset at which to draw the DDL + @return false if deferredDisplayList is not compatible + + example: https://fiddle.skia.org/c/@Surface_draw_2 + */ + bool draw(sk_sp<const SkDeferredDisplayList> deferredDisplayList, + int xOffset = 0, + int yOffset = 0); + +protected: + SkSurface(int width, int height, const SkSurfaceProps* surfaceProps); + SkSurface(const SkImageInfo& imageInfo, const SkSurfaceProps* surfaceProps); + + // called by subclass if their contents have changed + void dirtyGenerationID() { + fGenerationID = 0; + } + +private: + const SkSurfaceProps fProps; + const int fWidth; + const int fHeight; + uint32_t fGenerationID; + + using INHERITED = SkRefCnt; +}; + +#endif diff --git a/src/deps/skia/include/core/SkSurfaceCharacterization.h b/src/deps/skia/include/core/SkSurfaceCharacterization.h new file mode 100644 index 000000000..91b10e87b --- /dev/null +++ b/src/deps/skia/include/core/SkSurfaceCharacterization.h @@ -0,0 +1,263 @@ +/* + * Copyright 2017 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkSurfaceCharacterization_DEFINED +#define SkSurfaceCharacterization_DEFINED + + +#include "include/core/SkColorSpace.h" +#include "include/core/SkImageInfo.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkSurfaceProps.h" + +class SkColorSpace; + + +#if SK_SUPPORT_GPU +#include "include/gpu/GrBackendSurface.h" +#include "include/gpu/GrContextThreadSafeProxy.h" +#include "include/gpu/GrTypes.h" + +/** \class SkSurfaceCharacterization + A surface characterization contains all the information Ganesh requires to makes its internal + rendering decisions. When passed into a SkDeferredDisplayListRecorder it will copy the + data and pass it on to the SkDeferredDisplayList if/when it is created. Note that both of + those objects (the Recorder and the DisplayList) will take a ref on the + GrContextThreadSafeProxy and SkColorSpace objects. +*/ +class SK_API SkSurfaceCharacterization { +public: + enum class Textureable : bool { kNo = false, kYes = true }; + enum class MipMapped : bool { kNo = false, kYes = true }; + enum class UsesGLFBO0 : bool { kNo = false, kYes = true }; + // This flag indicates that the backing VkImage for this Vulkan surface will have the + // VK_IMAGE_USAGE_INPUT_ATTACHMENT_BIT set. This bit allows skia to handle advanced blends + // more optimally in a shader by being able to directly read the dst values. + enum class VkRTSupportsInputAttachment : bool { kNo = false, kYes = true }; + // This flag indicates if the surface is wrapping a raw Vulkan secondary command buffer. + enum class VulkanSecondaryCBCompatible : bool { kNo = false, kYes = true }; + + SkSurfaceCharacterization() + : fCacheMaxResourceBytes(0) + , fOrigin(kBottomLeft_GrSurfaceOrigin) + , fSampleCnt(0) + , fIsTextureable(Textureable::kYes) + , fIsMipMapped(MipMapped::kYes) + , fUsesGLFBO0(UsesGLFBO0::kNo) + , fVulkanSecondaryCBCompatible(VulkanSecondaryCBCompatible::kNo) + , fIsProtected(GrProtected::kNo) + , fSurfaceProps(0, kUnknown_SkPixelGeometry) { + } + + SkSurfaceCharacterization(SkSurfaceCharacterization&&) = default; + SkSurfaceCharacterization& operator=(SkSurfaceCharacterization&&) = default; + + SkSurfaceCharacterization(const SkSurfaceCharacterization&) = default; + SkSurfaceCharacterization& operator=(const SkSurfaceCharacterization& other) = default; + bool operator==(const SkSurfaceCharacterization& other) const; + bool operator!=(const SkSurfaceCharacterization& other) const { + return !(*this == other); + } + + /* + * Return a new surface characterization with the only difference being a different width + * and height + */ + SkSurfaceCharacterization createResized(int width, int height) const; + + /* + * Return a new surface characterization with only a replaced color space + */ + SkSurfaceCharacterization createColorSpace(sk_sp<SkColorSpace>) const; + + /* + * Return a new surface characterization with the backend format replaced. A colorType + * must also be supplied to indicate the interpretation of the new format. + */ + SkSurfaceCharacterization createBackendFormat(SkColorType colorType, + const GrBackendFormat& backendFormat) const; + + /* + * Return a new surface characterization with just a different use of FBO0 (in GL) + */ + SkSurfaceCharacterization createFBO0(bool usesGLFBO0) const; + + GrContextThreadSafeProxy* contextInfo() const { return fContextInfo.get(); } + sk_sp<GrContextThreadSafeProxy> refContextInfo() const { return fContextInfo; } + size_t cacheMaxResourceBytes() const { return fCacheMaxResourceBytes; } + + bool isValid() const { return kUnknown_SkColorType != fImageInfo.colorType(); } + + const SkImageInfo& imageInfo() const { return fImageInfo; } + const GrBackendFormat& backendFormat() const { return fBackendFormat; } + GrSurfaceOrigin origin() const { return fOrigin; } + SkISize dimensions() const { return fImageInfo.dimensions(); } + int width() const { return fImageInfo.width(); } + int height() const { return fImageInfo.height(); } + SkColorType colorType() const { return fImageInfo.colorType(); } + int sampleCount() const { return fSampleCnt; } + bool isTextureable() const { return Textureable::kYes == fIsTextureable; } + bool isMipMapped() const { return MipMapped::kYes == fIsMipMapped; } + bool usesGLFBO0() const { return UsesGLFBO0::kYes == fUsesGLFBO0; } + bool vkRTSupportsInputAttachment() const { + return VkRTSupportsInputAttachment::kYes == fVkRTSupportsInputAttachment; + } + bool vulkanSecondaryCBCompatible() const { + return VulkanSecondaryCBCompatible::kYes == fVulkanSecondaryCBCompatible; + } + GrProtected isProtected() const { return fIsProtected; } + SkColorSpace* colorSpace() const { return fImageInfo.colorSpace(); } + sk_sp<SkColorSpace> refColorSpace() const { return fImageInfo.refColorSpace(); } + const SkSurfaceProps& surfaceProps()const { return fSurfaceProps; } + + // Is the provided backend texture compatible with this surface characterization? + bool isCompatible(const GrBackendTexture&) const; + +private: + friend class SkSurface_Gpu; // for 'set' & 'config' + friend class GrVkSecondaryCBDrawContext; // for 'set' & 'config' + friend class GrContextThreadSafeProxy; // for private ctor + friend class SkDeferredDisplayListRecorder; // for 'config' + friend class SkSurface; // for 'config' + + SkDEBUGCODE(void validate() const;) + + SkSurfaceCharacterization(sk_sp<GrContextThreadSafeProxy> contextInfo, + size_t cacheMaxResourceBytes, + const SkImageInfo& ii, + const GrBackendFormat& backendFormat, + GrSurfaceOrigin origin, + int sampleCnt, + Textureable isTextureable, + MipMapped isMipMapped, + UsesGLFBO0 usesGLFBO0, + VkRTSupportsInputAttachment vkRTSupportsInputAttachment, + VulkanSecondaryCBCompatible vulkanSecondaryCBCompatible, + GrProtected isProtected, + const SkSurfaceProps& surfaceProps) + : fContextInfo(std::move(contextInfo)) + , fCacheMaxResourceBytes(cacheMaxResourceBytes) + , fImageInfo(ii) + , fBackendFormat(backendFormat) + , fOrigin(origin) + , fSampleCnt(sampleCnt) + , fIsTextureable(isTextureable) + , fIsMipMapped(isMipMapped) + , fUsesGLFBO0(usesGLFBO0) + , fVkRTSupportsInputAttachment(vkRTSupportsInputAttachment) + , fVulkanSecondaryCBCompatible(vulkanSecondaryCBCompatible) + , fIsProtected(isProtected) + , fSurfaceProps(surfaceProps) { + if (fSurfaceProps.flags() & SkSurfaceProps::kDynamicMSAA_Flag) { + // Dynamic MSAA is not currently supported with DDL. + *this = {}; + } + SkDEBUGCODE(this->validate()); + } + + void set(sk_sp<GrContextThreadSafeProxy> contextInfo, + size_t cacheMaxResourceBytes, + const SkImageInfo& ii, + const GrBackendFormat& backendFormat, + GrSurfaceOrigin origin, + int sampleCnt, + Textureable isTextureable, + MipMapped isMipMapped, + UsesGLFBO0 usesGLFBO0, + VkRTSupportsInputAttachment vkRTSupportsInputAttachment, + VulkanSecondaryCBCompatible vulkanSecondaryCBCompatible, + GrProtected isProtected, + const SkSurfaceProps& surfaceProps) { + if (surfaceProps.flags() & SkSurfaceProps::kDynamicMSAA_Flag) { + // Dynamic MSAA is not currently supported with DDL. + *this = {}; + } else { + fContextInfo = contextInfo; + fCacheMaxResourceBytes = cacheMaxResourceBytes; + + fImageInfo = ii; + fBackendFormat = backendFormat; + fOrigin = origin; + fSampleCnt = sampleCnt; + fIsTextureable = isTextureable; + fIsMipMapped = isMipMapped; + fUsesGLFBO0 = usesGLFBO0; + fVkRTSupportsInputAttachment = vkRTSupportsInputAttachment; + fVulkanSecondaryCBCompatible = vulkanSecondaryCBCompatible; + fIsProtected = isProtected; + fSurfaceProps = surfaceProps; + } + SkDEBUGCODE(this->validate()); + } + + sk_sp<GrContextThreadSafeProxy> fContextInfo; + size_t fCacheMaxResourceBytes; + + SkImageInfo fImageInfo; + GrBackendFormat fBackendFormat; + GrSurfaceOrigin fOrigin; + int fSampleCnt; + Textureable fIsTextureable; + MipMapped fIsMipMapped; + UsesGLFBO0 fUsesGLFBO0; + VkRTSupportsInputAttachment fVkRTSupportsInputAttachment; + VulkanSecondaryCBCompatible fVulkanSecondaryCBCompatible; + GrProtected fIsProtected; + SkSurfaceProps fSurfaceProps; +}; + +#else// !SK_SUPPORT_GPU +class GrBackendFormat; + +class SK_API SkSurfaceCharacterization { +public: + SkSurfaceCharacterization() : fSurfaceProps(0, kUnknown_SkPixelGeometry) { } + + SkSurfaceCharacterization createResized(int width, int height) const { + return *this; + } + + SkSurfaceCharacterization createColorSpace(sk_sp<SkColorSpace>) const { + return *this; + } + + SkSurfaceCharacterization createBackendFormat(SkColorType, const GrBackendFormat&) const { + return *this; + } + + SkSurfaceCharacterization createFBO0(bool usesGLFBO0) const { + return *this; + } + + bool operator==(const SkSurfaceCharacterization& other) const { return false; } + bool operator!=(const SkSurfaceCharacterization& other) const { + return !(*this == other); + } + + size_t cacheMaxResourceBytes() const { return 0; } + + bool isValid() const { return false; } + + int width() const { return 0; } + int height() const { return 0; } + int stencilCount() const { return 0; } + bool isTextureable() const { return false; } + bool isMipMapped() const { return false; } + bool usesGLFBO0() const { return false; } + bool vkRTSupportsAttachmentInput() const { return false; } + bool vulkanSecondaryCBCompatible() const { return false; } + SkColorSpace* colorSpace() const { return nullptr; } + sk_sp<SkColorSpace> refColorSpace() const { return nullptr; } + const SkSurfaceProps& surfaceProps()const { return fSurfaceProps; } + +private: + SkSurfaceProps fSurfaceProps; +}; + +#endif + +#endif diff --git a/src/deps/skia/include/core/SkSurfaceProps.h b/src/deps/skia/include/core/SkSurfaceProps.h new file mode 100644 index 000000000..7b07554e5 --- /dev/null +++ b/src/deps/skia/include/core/SkSurfaceProps.h @@ -0,0 +1,92 @@ +/* + * Copyright 2014 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkSurfaceProps_DEFINED +#define SkSurfaceProps_DEFINED + +#include "include/core/SkTypes.h" + +/** + * Description of how the LCD strips are arranged for each pixel. If this is unknown, or the + * pixels are meant to be "portable" and/or transformed before showing (e.g. rotated, scaled) + * then use kUnknown_SkPixelGeometry. + */ +enum SkPixelGeometry { + kUnknown_SkPixelGeometry, + kRGB_H_SkPixelGeometry, + kBGR_H_SkPixelGeometry, + kRGB_V_SkPixelGeometry, + kBGR_V_SkPixelGeometry, +}; + +// Returns true iff geo is a known geometry and is RGB. +static inline bool SkPixelGeometryIsRGB(SkPixelGeometry geo) { + return kRGB_H_SkPixelGeometry == geo || kRGB_V_SkPixelGeometry == geo; +} + +// Returns true iff geo is a known geometry and is BGR. +static inline bool SkPixelGeometryIsBGR(SkPixelGeometry geo) { + return kBGR_H_SkPixelGeometry == geo || kBGR_V_SkPixelGeometry == geo; +} + +// Returns true iff geo is a known geometry and is horizontal. +static inline bool SkPixelGeometryIsH(SkPixelGeometry geo) { + return kRGB_H_SkPixelGeometry == geo || kBGR_H_SkPixelGeometry == geo; +} + +// Returns true iff geo is a known geometry and is vertical. +static inline bool SkPixelGeometryIsV(SkPixelGeometry geo) { + return kRGB_V_SkPixelGeometry == geo || kBGR_V_SkPixelGeometry == geo; +} + +/** + * Describes properties and constraints of a given SkSurface. The rendering engine can parse these + * during drawing, and can sometimes optimize its performance (e.g. disabling an expensive + * feature). + */ +class SK_API SkSurfaceProps { +public: + enum Flags { + kUseDeviceIndependentFonts_Flag = 1 << 0, + // Use internal MSAA to render to non-MSAA GPU surfaces. + kDynamicMSAA_Flag = 1 << 1 + }; + /** Deprecated alias used by Chromium. Will be removed. */ + static const Flags kUseDistanceFieldFonts_Flag = kUseDeviceIndependentFonts_Flag; + + /** No flags, unknown pixel geometry. */ + SkSurfaceProps(); + SkSurfaceProps(uint32_t flags, SkPixelGeometry); + + SkSurfaceProps(const SkSurfaceProps&); + SkSurfaceProps& operator=(const SkSurfaceProps&); + + SkSurfaceProps cloneWithPixelGeometry(SkPixelGeometry newPixelGeometry) const { + return SkSurfaceProps(fFlags, newPixelGeometry); + } + + uint32_t flags() const { return fFlags; } + SkPixelGeometry pixelGeometry() const { return fPixelGeometry; } + + bool isUseDeviceIndependentFonts() const { + return SkToBool(fFlags & kUseDeviceIndependentFonts_Flag); + } + + bool operator==(const SkSurfaceProps& that) const { + return fFlags == that.fFlags && fPixelGeometry == that.fPixelGeometry; + } + + bool operator!=(const SkSurfaceProps& that) const { + return !(*this == that); + } + +private: + uint32_t fFlags; + SkPixelGeometry fPixelGeometry; +}; + +#endif diff --git a/src/deps/skia/include/core/SkSwizzle.h b/src/deps/skia/include/core/SkSwizzle.h new file mode 100644 index 000000000..61e93b2da --- /dev/null +++ b/src/deps/skia/include/core/SkSwizzle.h @@ -0,0 +1,19 @@ +/* + * Copyright 2016 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkSwizzle_DEFINED +#define SkSwizzle_DEFINED + +#include "include/core/SkTypes.h" + +/** + Swizzles byte order of |count| 32-bit pixels, swapping R and B. + (RGBA <-> BGRA) +*/ +SK_API void SkSwapRB(uint32_t* dest, const uint32_t* src, int count); + +#endif diff --git a/src/deps/skia/include/core/SkTextBlob.h b/src/deps/skia/include/core/SkTextBlob.h new file mode 100644 index 000000000..d6cda3b27 --- /dev/null +++ b/src/deps/skia/include/core/SkTextBlob.h @@ -0,0 +1,503 @@ +/* + * Copyright 2014 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkTextBlob_DEFINED +#define SkTextBlob_DEFINED + +#include "include/core/SkFont.h" +#include "include/core/SkPaint.h" +#include "include/core/SkRefCnt.h" +#include "include/core/SkString.h" +#include "include/private/SkTemplates.h" + +#include <atomic> + +struct SkRSXform; +struct SkSerialProcs; +struct SkDeserialProcs; + +/** \class SkTextBlob + SkTextBlob combines multiple text runs into an immutable container. Each text + run consists of glyphs, SkPaint, and position. Only parts of SkPaint related to + fonts and text rendering are used by run. +*/ +class SK_API SkTextBlob final : public SkNVRefCnt<SkTextBlob> { +private: + class RunRecord; + +public: + + /** Returns conservative bounding box. Uses SkPaint associated with each glyph to + determine glyph bounds, and unions all bounds. Returned bounds may be + larger than the bounds of all glyphs in runs. + + @return conservative bounding box + */ + const SkRect& bounds() const { return fBounds; } + + /** Returns a non-zero value unique among all text blobs. + + @return identifier for SkTextBlob + */ + uint32_t uniqueID() const { return fUniqueID; } + + /** Returns the number of intervals that intersect bounds. + bounds describes a pair of lines parallel to the text advance. + The return count is zero or a multiple of two, and is at most twice the number of glyphs in + the the blob. + + Pass nullptr for intervals to determine the size of the interval array. + + Runs within the blob that contain SkRSXform are ignored when computing intercepts. + + @param bounds lower and upper line parallel to the advance + @param intervals returned intersections; may be nullptr + @param paint specifies stroking, SkPathEffect that affects the result; may be nullptr + @return number of intersections; may be zero + */ + int getIntercepts(const SkScalar bounds[2], SkScalar intervals[], + const SkPaint* paint = nullptr) const; + + /** Creates SkTextBlob with a single run. + + font contains attributes used to define the run text. + + When encoding is SkTextEncoding::kUTF8, SkTextEncoding::kUTF16, or + SkTextEncoding::kUTF32, this function uses the default + character-to-glyph mapping from the SkTypeface in font. It does not + perform typeface fallback for characters not found in the SkTypeface. + It does not perform kerning or other complex shaping; glyphs are + positioned based on their default advances. + + @param text character code points or glyphs drawn + @param byteLength byte length of text array + @param font text size, typeface, text scale, and so on, used to draw + @param encoding text encoding used in the text array + @return SkTextBlob constructed from one run + */ + static sk_sp<SkTextBlob> MakeFromText(const void* text, size_t byteLength, const SkFont& font, + SkTextEncoding encoding = SkTextEncoding::kUTF8); + + /** Creates SkTextBlob with a single run. string meaning depends on SkTextEncoding; + by default, string is encoded as UTF-8. + + font contains attributes used to define the run text. + + When encoding is SkTextEncoding::kUTF8, SkTextEncoding::kUTF16, or + SkTextEncoding::kUTF32, this function uses the default + character-to-glyph mapping from the SkTypeface in font. It does not + perform typeface fallback for characters not found in the SkTypeface. + It does not perform kerning or other complex shaping; glyphs are + positioned based on their default advances. + + @param string character code points or glyphs drawn + @param font text size, typeface, text scale, and so on, used to draw + @param encoding text encoding used in the text array + @return SkTextBlob constructed from one run + */ + static sk_sp<SkTextBlob> MakeFromString(const char* string, const SkFont& font, + SkTextEncoding encoding = SkTextEncoding::kUTF8) { + if (!string) { + return nullptr; + } + return MakeFromText(string, strlen(string), font, encoding); + } + + /** Returns a textblob built from a single run of text with x-positions and a single y value. + This is equivalent to using SkTextBlobBuilder and calling allocRunPosH(). + Returns nullptr if byteLength is zero. + + @param text character code points or glyphs drawn (based on encoding) + @param byteLength byte length of text array + @param xpos array of x-positions, must contain values for all of the character points. + @param constY shared y-position for each character point, to be paired with each xpos. + @param font SkFont used for this run + @param encoding specifies the encoding of the text array. + @return new textblob or nullptr + */ + static sk_sp<SkTextBlob> MakeFromPosTextH(const void* text, size_t byteLength, + const SkScalar xpos[], SkScalar constY, const SkFont& font, + SkTextEncoding encoding = SkTextEncoding::kUTF8); + + /** Returns a textblob built from a single run of text with positions. + This is equivalent to using SkTextBlobBuilder and calling allocRunPos(). + Returns nullptr if byteLength is zero. + + @param text character code points or glyphs drawn (based on encoding) + @param byteLength byte length of text array + @param pos array of positions, must contain values for all of the character points. + @param font SkFont used for this run + @param encoding specifies the encoding of the text array. + @return new textblob or nullptr + */ + static sk_sp<SkTextBlob> MakeFromPosText(const void* text, size_t byteLength, + const SkPoint pos[], const SkFont& font, + SkTextEncoding encoding = SkTextEncoding::kUTF8); + + static sk_sp<SkTextBlob> MakeFromRSXform(const void* text, size_t byteLength, + const SkRSXform xform[], const SkFont& font, + SkTextEncoding encoding = SkTextEncoding::kUTF8); + + /** Writes data to allow later reconstruction of SkTextBlob. memory points to storage + to receive the encoded data, and memory_size describes the size of storage. + Returns bytes used if provided storage is large enough to hold all data; + otherwise, returns zero. + + procs.fTypefaceProc permits supplying a custom function to encode SkTypeface. + If procs.fTypefaceProc is nullptr, default encoding is used. procs.fTypefaceCtx + may be used to provide user context to procs.fTypefaceProc; procs.fTypefaceProc + is called with a pointer to SkTypeface and user context. + + @param procs custom serial data encoders; may be nullptr + @param memory storage for data + @param memory_size size of storage + @return bytes written, or zero if required storage is larger than memory_size + + example: https://fiddle.skia.org/c/@TextBlob_serialize + */ + size_t serialize(const SkSerialProcs& procs, void* memory, size_t memory_size) const; + + /** Returns storage containing SkData describing SkTextBlob, using optional custom + encoders. + + procs.fTypefaceProc permits supplying a custom function to encode SkTypeface. + If procs.fTypefaceProc is nullptr, default encoding is used. procs.fTypefaceCtx + may be used to provide user context to procs.fTypefaceProc; procs.fTypefaceProc + is called with a pointer to SkTypeface and user context. + + @param procs custom serial data encoders; may be nullptr + @return storage containing serialized SkTextBlob + + example: https://fiddle.skia.org/c/@TextBlob_serialize_2 + */ + sk_sp<SkData> serialize(const SkSerialProcs& procs) const; + + /** Recreates SkTextBlob that was serialized into data. Returns constructed SkTextBlob + if successful; otherwise, returns nullptr. Fails if size is smaller than + required data length, or if data does not permit constructing valid SkTextBlob. + + procs.fTypefaceProc permits supplying a custom function to decode SkTypeface. + If procs.fTypefaceProc is nullptr, default decoding is used. procs.fTypefaceCtx + may be used to provide user context to procs.fTypefaceProc; procs.fTypefaceProc + is called with a pointer to SkTypeface data, data byte length, and user context. + + @param data pointer for serial data + @param size size of data + @param procs custom serial data decoders; may be nullptr + @return SkTextBlob constructed from data in memory + */ + static sk_sp<SkTextBlob> Deserialize(const void* data, size_t size, + const SkDeserialProcs& procs); + + class SK_API Iter { + public: + struct Run { + SkTypeface* fTypeface; + int fGlyphCount; + const uint16_t* fGlyphIndices; +#ifdef SK_UNTIL_CRBUG_1187654_IS_FIXED + const uint32_t* fClusterIndex_forTest; + int fUtf8Size_forTest; + const char* fUtf8_forTest; +#endif + }; + + Iter(const SkTextBlob&); + + /** + * Returns true for each "run" inside the textblob, setting the Run fields (if not null). + * If this returns false, there are no more runs, and the Run parameter will be ignored. + */ + bool next(Run*); + + // Experimental, DO NO USE, will change/go-away + struct ExperimentalRun { + SkFont font; + int count; + const uint16_t* glyphs; + const SkPoint* positions; + }; + bool experimentalNext(ExperimentalRun*); + + private: + const RunRecord* fRunRecord; + }; + +private: + friend class SkNVRefCnt<SkTextBlob>; + + enum GlyphPositioning : uint8_t; + + explicit SkTextBlob(const SkRect& bounds); + + ~SkTextBlob(); + + // Memory for objects of this class is created with sk_malloc rather than operator new and must + // be freed with sk_free. + void operator delete(void* p); + void* operator new(size_t); + void* operator new(size_t, void* p); + + static unsigned ScalarsPerGlyph(GlyphPositioning pos); + + // Call when this blob is part of the key to a cache entry. This allows the cache + // to know automatically those entries can be purged when this SkTextBlob is deleted. + void notifyAddedToCache(uint32_t cacheID) const { + fCacheID.store(cacheID); + } + + friend class SkGlyphRunList; + friend class GrTextBlobCache; + friend class SkTextBlobBuilder; + friend class SkTextBlobPriv; + friend class SkTextBlobRunIterator; + + const SkRect fBounds; + const uint32_t fUniqueID; + mutable std::atomic<uint32_t> fCacheID; + + SkDEBUGCODE(size_t fStorageSize;) + + // The actual payload resides in externally-managed storage, following the object. + // (see the .cpp for more details) + + using INHERITED = SkRefCnt; +}; + +/** \class SkTextBlobBuilder + Helper class for constructing SkTextBlob. +*/ +class SK_API SkTextBlobBuilder { +public: + + /** Constructs empty SkTextBlobBuilder. By default, SkTextBlobBuilder has no runs. + + @return empty SkTextBlobBuilder + + example: https://fiddle.skia.org/c/@TextBlobBuilder_empty_constructor + */ + SkTextBlobBuilder(); + + /** Deletes data allocated internally by SkTextBlobBuilder. + */ + ~SkTextBlobBuilder(); + + /** Returns SkTextBlob built from runs of glyphs added by builder. Returned + SkTextBlob is immutable; it may be copied, but its contents may not be altered. + Returns nullptr if no runs of glyphs were added by builder. + + Resets SkTextBlobBuilder to its initial empty state, allowing it to be + reused to build a new set of runs. + + @return SkTextBlob or nullptr + + example: https://fiddle.skia.org/c/@TextBlobBuilder_make + */ + sk_sp<SkTextBlob> make(); + + /** \struct SkTextBlobBuilder::RunBuffer + RunBuffer supplies storage for glyphs and positions within a run. + + A run is a sequence of glyphs sharing font metrics and positioning. + Each run may position its glyphs in one of three ways: + by specifying where the first glyph is drawn, and allowing font metrics to + determine the advance to subsequent glyphs; by specifying a baseline, and + the position on that baseline for each glyph in run; or by providing SkPoint + array, one per glyph. + */ + struct RunBuffer { + SkGlyphID* glyphs; //!< storage for glyph indexes in run + SkScalar* pos; //!< storage for glyph positions in run + char* utf8text; //!< storage for text UTF-8 code units in run + uint32_t* clusters; //!< storage for glyph clusters (index of UTF-8 code unit) + + // Helpers, since the "pos" field can be different types (always some number of floats). + SkPoint* points() const { return reinterpret_cast<SkPoint*>(pos); } + SkRSXform* xforms() const { return reinterpret_cast<SkRSXform*>(pos); } + }; + + /** Returns run with storage for glyphs. Caller must write count glyphs to + RunBuffer::glyphs before next call to SkTextBlobBuilder. + + RunBuffer::pos, RunBuffer::utf8text, and RunBuffer::clusters should be ignored. + + Glyphs share metrics in font. + + Glyphs are positioned on a baseline at (x, y), using font metrics to + determine their relative placement. + + bounds defines an optional bounding box, used to suppress drawing when SkTextBlob + bounds does not intersect SkSurface bounds. If bounds is nullptr, SkTextBlob bounds + is computed from (x, y) and RunBuffer::glyphs metrics. + + @param font SkFont used for this run + @param count number of glyphs + @param x horizontal offset within the blob + @param y vertical offset within the blob + @param bounds optional run bounding box + @return writable glyph buffer + */ + const RunBuffer& allocRun(const SkFont& font, int count, SkScalar x, SkScalar y, + const SkRect* bounds = nullptr); + + /** Returns run with storage for glyphs and positions along baseline. Caller must + write count glyphs to RunBuffer::glyphs and count scalars to RunBuffer::pos + before next call to SkTextBlobBuilder. + + RunBuffer::utf8text and RunBuffer::clusters should be ignored. + + Glyphs share metrics in font. + + Glyphs are positioned on a baseline at y, using x-axis positions written by + caller to RunBuffer::pos. + + bounds defines an optional bounding box, used to suppress drawing when SkTextBlob + bounds does not intersect SkSurface bounds. If bounds is nullptr, SkTextBlob bounds + is computed from y, RunBuffer::pos, and RunBuffer::glyphs metrics. + + @param font SkFont used for this run + @param count number of glyphs + @param y vertical offset within the blob + @param bounds optional run bounding box + @return writable glyph buffer and x-axis position buffer + */ + const RunBuffer& allocRunPosH(const SkFont& font, int count, SkScalar y, + const SkRect* bounds = nullptr); + + /** Returns run with storage for glyphs and SkPoint positions. Caller must + write count glyphs to RunBuffer::glyphs and count SkPoint to RunBuffer::pos + before next call to SkTextBlobBuilder. + + RunBuffer::utf8text and RunBuffer::clusters should be ignored. + + Glyphs share metrics in font. + + Glyphs are positioned using SkPoint written by caller to RunBuffer::pos, using + two scalar values for each SkPoint. + + bounds defines an optional bounding box, used to suppress drawing when SkTextBlob + bounds does not intersect SkSurface bounds. If bounds is nullptr, SkTextBlob bounds + is computed from RunBuffer::pos, and RunBuffer::glyphs metrics. + + @param font SkFont used for this run + @param count number of glyphs + @param bounds optional run bounding box + @return writable glyph buffer and SkPoint buffer + */ + const RunBuffer& allocRunPos(const SkFont& font, int count, + const SkRect* bounds = nullptr); + + // RunBuffer.pos points to SkRSXform array + const RunBuffer& allocRunRSXform(const SkFont& font, int count); + + /** Returns run with storage for glyphs, text, and clusters. Caller must + write count glyphs to RunBuffer::glyphs, textByteCount UTF-8 code units + into RunBuffer::utf8text, and count monotonic indexes into utf8text + into RunBuffer::clusters before next call to SkTextBlobBuilder. + + RunBuffer::pos should be ignored. + + Glyphs share metrics in font. + + Glyphs are positioned on a baseline at (x, y), using font metrics to + determine their relative placement. + + bounds defines an optional bounding box, used to suppress drawing when SkTextBlob + bounds does not intersect SkSurface bounds. If bounds is nullptr, SkTextBlob bounds + is computed from (x, y) and RunBuffer::glyphs metrics. + + @param font SkFont used for this run + @param count number of glyphs + @param x horizontal offset within the blob + @param y vertical offset within the blob + @param textByteCount number of UTF-8 code units + @param bounds optional run bounding box + @return writable glyph buffer, text buffer, and cluster buffer + */ + const RunBuffer& allocRunText(const SkFont& font, int count, SkScalar x, SkScalar y, + int textByteCount, const SkRect* bounds = nullptr); + + /** Returns run with storage for glyphs, positions along baseline, text, + and clusters. Caller must write count glyphs to RunBuffer::glyphs, + count scalars to RunBuffer::pos, textByteCount UTF-8 code units into + RunBuffer::utf8text, and count monotonic indexes into utf8text into + RunBuffer::clusters before next call to SkTextBlobBuilder. + + Glyphs share metrics in font. + + Glyphs are positioned on a baseline at y, using x-axis positions written by + caller to RunBuffer::pos. + + bounds defines an optional bounding box, used to suppress drawing when SkTextBlob + bounds does not intersect SkSurface bounds. If bounds is nullptr, SkTextBlob bounds + is computed from y, RunBuffer::pos, and RunBuffer::glyphs metrics. + + @param font SkFont used for this run + @param count number of glyphs + @param y vertical offset within the blob + @param textByteCount number of UTF-8 code units + @param bounds optional run bounding box + @return writable glyph buffer, x-axis position buffer, text buffer, and cluster buffer + */ + const RunBuffer& allocRunTextPosH(const SkFont& font, int count, SkScalar y, int textByteCount, + const SkRect* bounds = nullptr); + + /** Returns run with storage for glyphs, SkPoint positions, text, and + clusters. Caller must write count glyphs to RunBuffer::glyphs, count + SkPoint to RunBuffer::pos, textByteCount UTF-8 code units into + RunBuffer::utf8text, and count monotonic indexes into utf8text into + RunBuffer::clusters before next call to SkTextBlobBuilder. + + Glyphs share metrics in font. + + Glyphs are positioned using SkPoint written by caller to RunBuffer::pos, using + two scalar values for each SkPoint. + + bounds defines an optional bounding box, used to suppress drawing when SkTextBlob + bounds does not intersect SkSurface bounds. If bounds is nullptr, SkTextBlob bounds + is computed from RunBuffer::pos, and RunBuffer::glyphs metrics. + + @param font SkFont used for this run + @param count number of glyphs + @param textByteCount number of UTF-8 code units + @param bounds optional run bounding box + @return writable glyph buffer, SkPoint buffer, text buffer, and cluster buffer + */ + const RunBuffer& allocRunTextPos(const SkFont& font, int count, int textByteCount, + const SkRect* bounds = nullptr); + + // RunBuffer.pos points to SkRSXform array + const RunBuffer& allocRunTextRSXform(const SkFont& font, int count, int textByteCount, + const SkRect* bounds = nullptr); + +private: + void reserve(size_t size); + void allocInternal(const SkFont& font, SkTextBlob::GlyphPositioning positioning, + int count, int textBytes, SkPoint offset, const SkRect* bounds); + bool mergeRun(const SkFont& font, SkTextBlob::GlyphPositioning positioning, + uint32_t count, SkPoint offset); + void updateDeferredBounds(); + + static SkRect ConservativeRunBounds(const SkTextBlob::RunRecord&); + static SkRect TightRunBounds(const SkTextBlob::RunRecord&); + + friend class SkTextBlobPriv; + friend class SkTextBlobBuilderPriv; + + SkAutoTMalloc<uint8_t> fStorage; + size_t fStorageSize; + size_t fStorageUsed; + + SkRect fBounds; + int fRunCount; + bool fDeferredBounds; + size_t fLastRun; // index into fStorage + + RunBuffer fCurrentRunBuffer; +}; + +#endif // SkTextBlob_DEFINED diff --git a/src/deps/skia/include/core/SkTileMode.h b/src/deps/skia/include/core/SkTileMode.h new file mode 100644 index 000000000..8a9d02095 --- /dev/null +++ b/src/deps/skia/include/core/SkTileMode.h @@ -0,0 +1,41 @@ +/* + * Copyright 2019 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkTileModes_DEFINED +#define SkTileModes_DEFINED + +#include "include/core/SkTypes.h" + +enum class SkTileMode { + /** + * Replicate the edge color if the shader draws outside of its + * original bounds. + */ + kClamp, + + /** + * Repeat the shader's image horizontally and vertically. + */ + kRepeat, + + /** + * Repeat the shader's image horizontally and vertically, alternating + * mirror images so that adjacent images always seam. + */ + kMirror, + + /** + * Only draw within the original domain, return transparent-black everywhere else. + */ + kDecal, + + kLastTileMode = kDecal, +}; + +static constexpr int kSkTileModeCount = static_cast<int>(SkTileMode::kLastTileMode) + 1; + +#endif diff --git a/src/deps/skia/include/core/SkTime.h b/src/deps/skia/include/core/SkTime.h new file mode 100644 index 000000000..3da2c8c77 --- /dev/null +++ b/src/deps/skia/include/core/SkTime.h @@ -0,0 +1,63 @@ + +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + + +#ifndef SkTime_DEFINED +#define SkTime_DEFINED + +#include "include/core/SkTypes.h" +#include "include/private/SkMacros.h" + +#include <cinttypes> + +class SkString; + +/** \class SkTime + Platform-implemented utilities to return time of day, and millisecond counter. +*/ +class SK_API SkTime { +public: + struct DateTime { + int16_t fTimeZoneMinutes; // The number of minutes that GetDateTime() + // is ahead of or behind UTC. + uint16_t fYear; //!< e.g. 2005 + uint8_t fMonth; //!< 1..12 + uint8_t fDayOfWeek; //!< 0..6, 0==Sunday + uint8_t fDay; //!< 1..31 + uint8_t fHour; //!< 0..23 + uint8_t fMinute; //!< 0..59 + uint8_t fSecond; //!< 0..59 + + void toISO8601(SkString* dst) const; + }; + static void GetDateTime(DateTime*); + + static double GetSecs() { return GetNSecs() * 1e-9; } + static double GetMSecs() { return GetNSecs() * 1e-6; } + static double GetNSecs(); +}; + +/////////////////////////////////////////////////////////////////////////////// + +class SkAutoTime { +public: + // The label is not deep-copied, so its address must remain valid for the + // lifetime of this object + SkAutoTime(const char* label = nullptr) + : fLabel(label) + , fNow(SkTime::GetMSecs()) {} + ~SkAutoTime() { + uint64_t dur = static_cast<uint64_t>(SkTime::GetMSecs() - fNow); + SkDebugf("%s %" PRIu64 "\n", fLabel ? fLabel : "", dur); + } +private: + const char* fLabel; + double fNow; +}; + +#endif diff --git a/src/deps/skia/include/core/SkTraceMemoryDump.h b/src/deps/skia/include/core/SkTraceMemoryDump.h new file mode 100644 index 000000000..7837bfbd8 --- /dev/null +++ b/src/deps/skia/include/core/SkTraceMemoryDump.h @@ -0,0 +1,99 @@ +/* + * Copyright 2015 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkTraceMemoryDump_DEFINED +#define SkTraceMemoryDump_DEFINED + +#include "include/core/SkTypes.h" + +class SkDiscardableMemory; + +/** + * Interface for memory tracing. + * This interface is meant to be passed as argument to the memory dump methods of Skia objects. + * The implementation of this interface is provided by the embedder. + */ +class SK_API SkTraceMemoryDump { +public: + /** + * Enum to specify the level of the requested details for the dump from the Skia objects. + */ + enum LevelOfDetail { + // Dump only the minimal details to get the total memory usage (Usually just the totals). + kLight_LevelOfDetail, + + // Dump the detailed breakdown of the objects in the caches. + kObjectsBreakdowns_LevelOfDetail + }; + + /** + * Appends a new memory dump (i.e. a row) to the trace memory infrastructure. + * If dumpName does not exist yet, a new one is created. Otherwise, a new column is appended to + * the previously created dump. + * Arguments: + * dumpName: an absolute, slash-separated, name for the item being dumped + * e.g., "skia/CacheX/EntryY". + * valueName: a string indicating the name of the column. + * e.g., "size", "active_size", "number_of_objects". + * This string is supposed to be long lived and is NOT copied. + * units: a string indicating the units for the value. + * e.g., "bytes", "objects". + * This string is supposed to be long lived and is NOT copied. + * value: the actual value being dumped. + */ + virtual void dumpNumericValue(const char* dumpName, + const char* valueName, + const char* units, + uint64_t value) = 0; + + virtual void dumpStringValue(const char* /*dumpName*/, + const char* /*valueName*/, + const char* /*value*/) { } + + /** + * Sets the memory backing for an existing dump. + * backingType and backingObjectId are used by the embedder to associate the memory dumped via + * dumpNumericValue with the corresponding dump that backs the memory. + */ + virtual void setMemoryBacking(const char* dumpName, + const char* backingType, + const char* backingObjectId) = 0; + + /** + * Specialization for memory backed by discardable memory. + */ + virtual void setDiscardableMemoryBacking( + const char* dumpName, + const SkDiscardableMemory& discardableMemoryObject) = 0; + + /** + * Returns the type of details requested in the dump. The granularity of the dump is supposed to + * match the LevelOfDetail argument. The level of detail must not affect the total size + * reported, but only granularity of the child entries. + */ + virtual LevelOfDetail getRequestedDetails() const = 0; + + /** + * Returns true if we should dump wrapped objects. Wrapped objects come from outside Skia, and + * may be independently tracked there. + */ + virtual bool shouldDumpWrappedObjects() const { return true; } + + /** + * If shouldDumpWrappedObjects() returns true then this function will be called to populate + * the output with information on whether the item being dumped is a wrapped object. + */ + virtual void dumpWrappedState(const char* /*dumpName*/, bool /*isWrappedObject*/) {} + +protected: + virtual ~SkTraceMemoryDump() = default; + SkTraceMemoryDump() = default; + SkTraceMemoryDump(const SkTraceMemoryDump&) = delete; + SkTraceMemoryDump& operator=(const SkTraceMemoryDump&) = delete; +}; + +#endif diff --git a/src/deps/skia/include/core/SkTypeface.h b/src/deps/skia/include/core/SkTypeface.h new file mode 100644 index 000000000..ad49a544b --- /dev/null +++ b/src/deps/skia/include/core/SkTypeface.h @@ -0,0 +1,454 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkTypeface_DEFINED +#define SkTypeface_DEFINED + +#include "include/core/SkFontArguments.h" +#include "include/core/SkFontParameters.h" +#include "include/core/SkFontStyle.h" +#include "include/core/SkFontTypes.h" +#include "include/core/SkRect.h" +#include "include/core/SkString.h" +#include "include/private/SkOnce.h" +#include "include/private/SkWeakRefCnt.h" + +class SkData; +class SkDescriptor; +class SkFontData; +class SkFontDescriptor; +class SkScalerContext; +class SkStream; +class SkStreamAsset; +class SkWStream; +struct SkAdvancedTypefaceMetrics; +struct SkScalerContextEffects; +struct SkScalerContextRec; + +typedef uint32_t SkFontID; +/** Machine endian. */ +typedef uint32_t SkFontTableTag; + +/** \class SkTypeface + + The SkTypeface class specifies the typeface and intrinsic style of a font. + This is used in the paint, along with optionally algorithmic settings like + textSize, textSkewX, textScaleX, kFakeBoldText_Mask, to specify + how text appears when drawn (and measured). + + Typeface objects are immutable, and so they can be shared between threads. +*/ +class SK_API SkTypeface : public SkWeakRefCnt { +public: + /** Returns the typeface's intrinsic style attributes. */ + SkFontStyle fontStyle() const { + return fStyle; + } + + /** Returns true if style() has the kBold bit set. */ + bool isBold() const { return fStyle.weight() >= SkFontStyle::kSemiBold_Weight; } + + /** Returns true if style() has the kItalic bit set. */ + bool isItalic() const { return fStyle.slant() != SkFontStyle::kUpright_Slant; } + + /** Returns true if the typeface claims to be fixed-pitch. + * This is a style bit, advance widths may vary even if this returns true. + */ + bool isFixedPitch() const { return fIsFixedPitch; } + + /** Copy into 'coordinates' (allocated by the caller) the design variation coordinates. + * + * @param coordinates the buffer into which to write the design variation coordinates. + * @param coordinateCount the number of entries available through 'coordinates'. + * + * @return The number of axes, or -1 if there is an error. + * If 'coordinates != nullptr' and 'coordinateCount >= numAxes' then 'coordinates' will be + * filled with the variation coordinates describing the position of this typeface in design + * variation space. It is possible the number of axes can be retrieved but actual position + * cannot. + */ + int getVariationDesignPosition(SkFontArguments::VariationPosition::Coordinate coordinates[], + int coordinateCount) const; + + /** Copy into 'parameters' (allocated by the caller) the design variation parameters. + * + * @param parameters the buffer into which to write the design variation parameters. + * @param coordinateCount the number of entries available through 'parameters'. + * + * @return The number of axes, or -1 if there is an error. + * If 'parameters != nullptr' and 'parameterCount >= numAxes' then 'parameters' will be + * filled with the variation parameters describing the position of this typeface in design + * variation space. It is possible the number of axes can be retrieved but actual parameters + * cannot. + */ + int getVariationDesignParameters(SkFontParameters::Variation::Axis parameters[], + int parameterCount) const; + + /** Return a 32bit value for this typeface, unique for the underlying font + data. Will never return 0. + */ + SkFontID uniqueID() const { return fUniqueID; } + + /** Return the uniqueID for the specified typeface. If the face is null, + resolve it to the default font and return its uniqueID. Will never + return 0. + */ + static SkFontID UniqueID(const SkTypeface* face); + + /** Returns true if the two typefaces reference the same underlying font, + handling either being null (treating null as the default font) + */ + static bool Equal(const SkTypeface* facea, const SkTypeface* faceb); + + /** Returns the default normal typeface, which is never nullptr. */ + static sk_sp<SkTypeface> MakeDefault(); + + /** Creates a new reference to the typeface that most closely matches the + requested familyName and fontStyle. This method allows extended font + face specifiers as in the SkFontStyle type. Will never return null. + + @param familyName May be NULL. The name of the font family. + @param fontStyle The style of the typeface. + @return reference to the closest-matching typeface. Call must call + unref() when they are done. + */ + static sk_sp<SkTypeface> MakeFromName(const char familyName[], SkFontStyle fontStyle); + + /** Return a new typeface given a file. If the file does not exist, or is + not a valid font file, returns nullptr. + */ + static sk_sp<SkTypeface> MakeFromFile(const char path[], int index = 0); + + /** Return a new typeface given a stream. If the stream is + not a valid font file, returns nullptr. Ownership of the stream is + transferred, so the caller must not reference it again. + */ + static sk_sp<SkTypeface> MakeFromStream(std::unique_ptr<SkStreamAsset> stream, int index = 0); + + /** Return a new typeface given a SkData. If the data is null, or is not a valid font file, + * returns nullptr. + */ + static sk_sp<SkTypeface> MakeFromData(sk_sp<SkData>, int index = 0); + + /** Return a new typeface based on this typeface but parameterized as specified in the + SkFontArguments. If the SkFontArguments does not supply an argument for a parameter + in the font then the value from this typeface will be used as the value for that + argument. If the cloned typeface would be exaclty the same as this typeface then + this typeface may be ref'ed and returned. May return nullptr on failure. + */ + sk_sp<SkTypeface> makeClone(const SkFontArguments&) const; + + /** + * A typeface can serialize just a descriptor (names, etc.), or it can also include the + * actual font data (which can be large). This enum controls how serialize() decides what + * to serialize. + */ + enum class SerializeBehavior { + kDoIncludeData, + kDontIncludeData, + kIncludeDataIfLocal, + }; + + /** Write a unique signature to a stream, sufficient to reconstruct a + typeface referencing the same font when Deserialize is called. + */ + void serialize(SkWStream*, SerializeBehavior = SerializeBehavior::kIncludeDataIfLocal) const; + + /** + * Same as serialize(SkWStream*, ...) but returns the serialized data in SkData, instead of + * writing it to a stream. + */ + sk_sp<SkData> serialize(SerializeBehavior = SerializeBehavior::kIncludeDataIfLocal) const; + + /** Given the data previously written by serialize(), return a new instance + of a typeface referring to the same font. If that font is not available, + return nullptr. + Does not affect ownership of SkStream. + */ + static sk_sp<SkTypeface> MakeDeserialize(SkStream*); + + /** + * Given an array of UTF32 character codes, return their corresponding glyph IDs. + * + * @param chars pointer to the array of UTF32 chars + * @param number of chars and glyphs + * @param glyphs returns the corresponding glyph IDs for each character. + */ + void unicharsToGlyphs(const SkUnichar uni[], int count, SkGlyphID glyphs[]) const; + + int textToGlyphs(const void* text, size_t byteLength, SkTextEncoding encoding, + SkGlyphID glyphs[], int maxGlyphCount) const; + + /** + * Return the glyphID that corresponds to the specified unicode code-point + * (in UTF32 encoding). If the unichar is not supported, returns 0. + * + * This is a short-cut for calling unicharsToGlyphs(). + */ + SkGlyphID unicharToGlyph(SkUnichar unichar) const; + + /** + * Return the number of glyphs in the typeface. + */ + int countGlyphs() const; + + // Table getters -- may fail if the underlying font format is not organized + // as 4-byte tables. + + /** Return the number of tables in the font. */ + int countTables() const; + + /** Copy into tags[] (allocated by the caller) the list of table tags in + * the font, and return the number. This will be the same as CountTables() + * or 0 if an error occured. If tags == NULL, this only returns the count + * (the same as calling countTables()). + */ + int getTableTags(SkFontTableTag tags[]) const; + + /** Given a table tag, return the size of its contents, or 0 if not present + */ + size_t getTableSize(SkFontTableTag) const; + + /** Copy the contents of a table into data (allocated by the caller). Note + * that the contents of the table will be in their native endian order + * (which for most truetype tables is big endian). If the table tag is + * not found, or there is an error copying the data, then 0 is returned. + * If this happens, it is possible that some or all of the memory pointed + * to by data may have been written to, even though an error has occured. + * + * @param tag The table tag whose contents are to be copied + * @param offset The offset in bytes into the table's contents where the + * copy should start from. + * @param length The number of bytes, starting at offset, of table data + * to copy. + * @param data storage address where the table contents are copied to + * @return the number of bytes actually copied into data. If offset+length + * exceeds the table's size, then only the bytes up to the table's + * size are actually copied, and this is the value returned. If + * offset > the table's size, or tag is not a valid table, + * then 0 is returned. + */ + size_t getTableData(SkFontTableTag tag, size_t offset, size_t length, + void* data) const; + + /** + * Return an immutable copy of the requested font table, or nullptr if that table was + * not found. This can sometimes be faster than calling getTableData() twice: once to find + * the length, and then again to copy the data. + * + * @param tag The table tag whose contents are to be copied + * @return an immutable copy of the table's data, or nullptr. + */ + sk_sp<SkData> copyTableData(SkFontTableTag tag) const; + + /** + * Return the units-per-em value for this typeface, or zero if there is an + * error. + */ + int getUnitsPerEm() const; + + /** + * Given a run of glyphs, return the associated horizontal adjustments. + * Adjustments are in "design units", which are integers relative to the + * typeface's units per em (see getUnitsPerEm). + * + * Some typefaces are known to never support kerning. Calling this method + * with all zeros (e.g. getKerningPairAdustments(NULL, 0, NULL)) returns + * a boolean indicating if the typeface might support kerning. If it + * returns false, then it will always return false (no kerning) for all + * possible glyph runs. If it returns true, then it *may* return true for + * somne glyph runs. + * + * If count is non-zero, then the glyphs parameter must point to at least + * [count] valid glyph IDs, and the adjustments parameter must be + * sized to at least [count - 1] entries. If the method returns true, then + * [count-1] entries in the adjustments array will be set. If the method + * returns false, then no kerning should be applied, and the adjustments + * array will be in an undefined state (possibly some values may have been + * written, but none of them should be interpreted as valid values). + */ + bool getKerningPairAdjustments(const SkGlyphID glyphs[], int count, + int32_t adjustments[]) const; + + struct LocalizedString { + SkString fString; + SkString fLanguage; + }; + class LocalizedStrings { + public: + LocalizedStrings() = default; + virtual ~LocalizedStrings() { } + virtual bool next(LocalizedString* localizedString) = 0; + void unref() { delete this; } + + private: + LocalizedStrings(const LocalizedStrings&) = delete; + LocalizedStrings& operator=(const LocalizedStrings&) = delete; + }; + /** + * Returns an iterator which will attempt to enumerate all of the + * family names specified by the font. + * It is the caller's responsibility to unref() the returned pointer. + */ + LocalizedStrings* createFamilyNameIterator() const; + + /** + * Return the family name for this typeface. It will always be returned + * encoded as UTF8, but the language of the name is whatever the host + * platform chooses. + */ + void getFamilyName(SkString* name) const; + + /** + * Return the PostScript name for this typeface. + * Value may change based on variation parameters. + * Returns false if no PostScript name is available. + */ + bool getPostScriptName(SkString* name) const; + + /** + * Return a stream for the contents of the font data, or NULL on failure. + * If ttcIndex is not null, it is set to the TrueTypeCollection index + * of this typeface within the stream, or 0 if the stream is not a + * collection. + * The caller is responsible for deleting the stream. + */ + std::unique_ptr<SkStreamAsset> openStream(int* ttcIndex) const; + + /** + * Return a scalercontext for the given descriptor. It may return a + * stub scalercontext that will not crash, but will draw nothing. + */ + std::unique_ptr<SkScalerContext> createScalerContext(const SkScalerContextEffects&, + const SkDescriptor*) const; + + /** + * Return a rectangle (scaled to 1-pt) that represents the union of the bounds of all + * of the glyphs, but each one positioned at (0,). This may be conservatively large, and + * will not take into account any hinting or other size-specific adjustments. + */ + SkRect getBounds() const; + + // PRIVATE / EXPERIMENTAL -- do not call + void filterRec(SkScalerContextRec* rec) const { + this->onFilterRec(rec); + } + // PRIVATE / EXPERIMENTAL -- do not call + void getFontDescriptor(SkFontDescriptor* desc, bool* isLocal) const { + this->onGetFontDescriptor(desc, isLocal); + } + // PRIVATE / EXPERIMENTAL -- do not call + void* internal_private_getCTFontRef() const { + return this->onGetCTFontRef(); + } + +protected: + explicit SkTypeface(const SkFontStyle& style, bool isFixedPitch = false); + ~SkTypeface() override; + + virtual sk_sp<SkTypeface> onMakeClone(const SkFontArguments&) const = 0; + + /** Sets the fixedPitch bit. If used, must be called in the constructor. */ + void setIsFixedPitch(bool isFixedPitch) { fIsFixedPitch = isFixedPitch; } + /** Sets the font style. If used, must be called in the constructor. */ + void setFontStyle(SkFontStyle style) { fStyle = style; } + + // Must return a valid scaler context. It can not return nullptr. + virtual std::unique_ptr<SkScalerContext> onCreateScalerContext(const SkScalerContextEffects&, + const SkDescriptor*) const = 0; + virtual void onFilterRec(SkScalerContextRec*) const = 0; + friend class SkScalerContext; // onFilterRec + + // Subclasses *must* override this method to work with the PDF backend. + virtual std::unique_ptr<SkAdvancedTypefaceMetrics> onGetAdvancedMetrics() const = 0; + // For type1 postscript fonts only, set the glyph names for each glyph. + // destination array is non-null, and points to an array of size this->countGlyphs(). + // Backends that do not suport type1 fonts should not override. + virtual void getPostScriptGlyphNames(SkString*) const = 0; + + // The mapping from glyph to Unicode; array indices are glyph ids. + // For each glyph, give the default Unicode value, if it exists. + // dstArray is non-null, and points to an array of size this->countGlyphs(). + virtual void getGlyphToUnicodeMap(SkUnichar* dstArray) const = 0; + + virtual std::unique_ptr<SkStreamAsset> onOpenStream(int* ttcIndex) const = 0; + + virtual bool onGlyphMaskNeedsCurrentColor() const = 0; + + virtual int onGetVariationDesignPosition( + SkFontArguments::VariationPosition::Coordinate coordinates[], + int coordinateCount) const = 0; + + virtual int onGetVariationDesignParameters( + SkFontParameters::Variation::Axis parameters[], int parameterCount) const = 0; + + virtual void onGetFontDescriptor(SkFontDescriptor*, bool* isLocal) const = 0; + + virtual void onCharsToGlyphs(const SkUnichar* chars, int count, SkGlyphID glyphs[]) const = 0; + virtual int onCountGlyphs() const = 0; + + virtual int onGetUPEM() const = 0; + virtual bool onGetKerningPairAdjustments(const SkGlyphID glyphs[], int count, + int32_t adjustments[]) const; + + /** Returns the family name of the typeface as known by its font manager. + * This name may or may not be produced by the family name iterator. + */ + virtual void onGetFamilyName(SkString* familyName) const = 0; + virtual bool onGetPostScriptName(SkString*) const = 0; + + /** Returns an iterator over the family names in the font. */ + virtual LocalizedStrings* onCreateFamilyNameIterator() const = 0; + + virtual int onGetTableTags(SkFontTableTag tags[]) const = 0; + virtual size_t onGetTableData(SkFontTableTag, size_t offset, + size_t length, void* data) const = 0; + virtual sk_sp<SkData> onCopyTableData(SkFontTableTag) const; + + virtual bool onComputeBounds(SkRect*) const; + + virtual void* onGetCTFontRef() const { return nullptr; } + +private: + /** Returns true if the typeface's glyph masks may refer to the foreground + * paint foreground color. This is needed to determine caching requirements. Usually true for + * typefaces that contain a COLR table. + */ + bool glyphMaskNeedsCurrentColor() const; + friend class SkStrikeServerImpl; // glyphMaskNeedsCurrentColor + + /** Retrieve detailed typeface metrics. Used by the PDF backend. */ + std::unique_ptr<SkAdvancedTypefaceMetrics> getAdvancedMetrics() const; + friend class SkRandomTypeface; // getAdvancedMetrics + friend class SkPDFFont; // getAdvancedMetrics + + /** Style specifies the intrinsic style attributes of a given typeface */ + enum Style { + kNormal = 0, + kBold = 0x01, + kItalic = 0x02, + + // helpers + kBoldItalic = 0x03 + }; + static SkFontStyle FromOldStyle(Style oldStyle); + static SkTypeface* GetDefaultTypeface(Style style = SkTypeface::kNormal); + + friend class SkFontPriv; // GetDefaultTypeface + friend class SkPaintPriv; // GetDefaultTypeface + friend class SkFont; // getGlyphToUnicodeMap + +private: + SkFontID fUniqueID; + SkFontStyle fStyle; + mutable SkRect fBounds; + mutable SkOnce fBoundsOnce; + bool fIsFixedPitch; + + using INHERITED = SkWeakRefCnt; +}; +#endif diff --git a/src/deps/skia/include/core/SkTypes.h b/src/deps/skia/include/core/SkTypes.h new file mode 100644 index 000000000..1d94990d6 --- /dev/null +++ b/src/deps/skia/include/core/SkTypes.h @@ -0,0 +1,621 @@ +/* + * Copyright 2006 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkTypes_DEFINED +#define SkTypes_DEFINED + +/** \file SkTypes.h +*/ + +// Pre-SkUserConfig.h setup. + +// Allows embedders that want to disable macros that take arguments to just +// define that symbol to be one of these +#define SK_NOTHING_ARG1(arg1) +#define SK_NOTHING_ARG2(arg1, arg2) +#define SK_NOTHING_ARG3(arg1, arg2, arg3) + +#if !defined(SK_BUILD_FOR_ANDROID) && !defined(SK_BUILD_FOR_IOS) && !defined(SK_BUILD_FOR_WIN) && \ + !defined(SK_BUILD_FOR_UNIX) && !defined(SK_BUILD_FOR_MAC) + + #ifdef __APPLE__ + #include <TargetConditionals.h> + #endif + + #if defined(_WIN32) || defined(__SYMBIAN32__) + #define SK_BUILD_FOR_WIN + #elif defined(ANDROID) || defined(__ANDROID__) + #define SK_BUILD_FOR_ANDROID + #elif defined(linux) || defined(__linux) || defined(__FreeBSD__) || \ + defined(__OpenBSD__) || defined(__sun) || defined(__NetBSD__) || \ + defined(__DragonFly__) || defined(__Fuchsia__) || \ + defined(__GLIBC__) || defined(__GNU__) || defined(__unix__) + #define SK_BUILD_FOR_UNIX + #elif TARGET_OS_IPHONE || TARGET_IPHONE_SIMULATOR + #define SK_BUILD_FOR_IOS + #else + #define SK_BUILD_FOR_MAC + #endif + +#endif + +#if defined(SK_BUILD_FOR_WIN) && !defined(__clang__) + #if !defined(SK_RESTRICT) + #define SK_RESTRICT __restrict + #endif + #if !defined(SK_WARN_UNUSED_RESULT) + #define SK_WARN_UNUSED_RESULT + #endif +#endif + +#if !defined(SK_RESTRICT) + #define SK_RESTRICT __restrict__ +#endif + +#if !defined(SK_WARN_UNUSED_RESULT) + #define SK_WARN_UNUSED_RESULT __attribute__((warn_unused_result)) +#endif + +#if !defined(SK_CPU_BENDIAN) && !defined(SK_CPU_LENDIAN) + #if defined(__BYTE_ORDER__) && (__BYTE_ORDER__ == __ORDER_BIG_ENDIAN__) + #define SK_CPU_BENDIAN + #elif defined(__BYTE_ORDER__) && (__BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__) + #define SK_CPU_LENDIAN + #elif defined(__sparc) || defined(__sparc__) || \ + defined(_POWER) || defined(__powerpc__) || \ + defined(__ppc__) || defined(__hppa) || \ + defined(__PPC__) || defined(__PPC64__) || \ + defined(_MIPSEB) || defined(__ARMEB__) || \ + defined(__s390__) || \ + (defined(__sh__) && defined(__BIG_ENDIAN__)) || \ + (defined(__ia64) && defined(__BIG_ENDIAN__)) + #define SK_CPU_BENDIAN + #else + #define SK_CPU_LENDIAN + #endif +#endif + +#if defined(__i386) || defined(_M_IX86) || defined(__x86_64__) || defined(_M_X64) + #define SK_CPU_X86 1 +#endif + +/** + * SK_CPU_SSE_LEVEL + * + * If defined, SK_CPU_SSE_LEVEL should be set to the highest supported level. + * On non-intel CPU this should be undefined. + */ +#define SK_CPU_SSE_LEVEL_SSE1 10 +#define SK_CPU_SSE_LEVEL_SSE2 20 +#define SK_CPU_SSE_LEVEL_SSE3 30 +#define SK_CPU_SSE_LEVEL_SSSE3 31 +#define SK_CPU_SSE_LEVEL_SSE41 41 +#define SK_CPU_SSE_LEVEL_SSE42 42 +#define SK_CPU_SSE_LEVEL_AVX 51 +#define SK_CPU_SSE_LEVEL_AVX2 52 +#define SK_CPU_SSE_LEVEL_SKX 60 + +// Are we in GCC/Clang? +#ifndef SK_CPU_SSE_LEVEL + // These checks must be done in descending order to ensure we set the highest + // available SSE level. + #if defined(__AVX512F__) && defined(__AVX512DQ__) && defined(__AVX512CD__) && \ + defined(__AVX512BW__) && defined(__AVX512VL__) + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_SKX + #elif defined(__AVX2__) + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_AVX2 + #elif defined(__AVX__) + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_AVX + #elif defined(__SSE4_2__) + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_SSE42 + #elif defined(__SSE4_1__) + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_SSE41 + #elif defined(__SSSE3__) + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_SSSE3 + #elif defined(__SSE3__) + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_SSE3 + #elif defined(__SSE2__) + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_SSE2 + #endif +#endif + +// Are we in VisualStudio? +#ifndef SK_CPU_SSE_LEVEL + // These checks must be done in descending order to ensure we set the highest + // available SSE level. 64-bit intel guarantees at least SSE2 support. + #if defined(__AVX512F__) && defined(__AVX512DQ__) && defined(__AVX512CD__) && \ + defined(__AVX512BW__) && defined(__AVX512VL__) + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_SKX + #elif defined(__AVX2__) + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_AVX2 + #elif defined(__AVX__) + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_AVX + #elif defined(_M_X64) || defined(_M_AMD64) + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_SSE2 + #elif defined(_M_IX86_FP) + #if _M_IX86_FP >= 2 + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_SSE2 + #elif _M_IX86_FP == 1 + #define SK_CPU_SSE_LEVEL SK_CPU_SSE_LEVEL_SSE1 + #endif + #endif +#endif + +// ARM defines +#if defined(__arm__) && (!defined(__APPLE__) || !TARGET_IPHONE_SIMULATOR) + #define SK_CPU_ARM32 +#elif defined(__aarch64__) + #define SK_CPU_ARM64 +#endif + +// All 64-bit ARM chips have NEON. Many 32-bit ARM chips do too. +#if !defined(SK_ARM_HAS_NEON) && defined(__ARM_NEON) + #define SK_ARM_HAS_NEON +#endif + +#if defined(__ARM_FEATURE_CRC32) + #define SK_ARM_HAS_CRC32 +#endif + + +// DLL/.so exports. +#if !defined(SKIA_IMPLEMENTATION) + #define SKIA_IMPLEMENTATION 0 +#endif +#if !defined(SK_API) + #if defined(SKIA_DLL) + #if defined(_MSC_VER) + #if SKIA_IMPLEMENTATION + #define SK_API __declspec(dllexport) + #else + #define SK_API __declspec(dllimport) + #endif + #else + #define SK_API __attribute__((visibility("default"))) + #endif + #else + #define SK_API + #endif +#endif + +// SK_SPI is functionally identical to SK_API, but used within src to clarify that it's less stable +#if !defined(SK_SPI) + #define SK_SPI SK_API +#endif + +// IWYU pragma: begin_exports +#if defined (SK_USER_CONFIG_HEADER) + #include SK_USER_CONFIG_HEADER +#else + #include "include/config/SkUserConfig.h" +#endif +#include <stddef.h> +#include <stdint.h> +// IWYU pragma: end_exports + +// Post SkUserConfig.h checks and such. +#if !defined(SK_DEBUG) && !defined(SK_RELEASE) + #ifdef NDEBUG + #define SK_RELEASE + #else + #define SK_DEBUG + #endif +#endif + +#if defined(SK_DEBUG) && defined(SK_RELEASE) +# error "cannot define both SK_DEBUG and SK_RELEASE" +#elif !defined(SK_DEBUG) && !defined(SK_RELEASE) +# error "must define either SK_DEBUG or SK_RELEASE" +#endif + +#if defined(SK_CPU_LENDIAN) && defined(SK_CPU_BENDIAN) +# error "cannot define both SK_CPU_LENDIAN and SK_CPU_BENDIAN" +#elif !defined(SK_CPU_LENDIAN) && !defined(SK_CPU_BENDIAN) +# error "must define either SK_CPU_LENDIAN or SK_CPU_BENDIAN" +#endif + +#if defined(SK_CPU_BENDIAN) && !defined(I_ACKNOWLEDGE_SKIA_DOES_NOT_SUPPORT_BIG_ENDIAN) + #error "The Skia team is not endian-savvy enough to support big-endian CPUs." + #error "If you still want to use Skia," + #error "please define I_ACKNOWLEDGE_SKIA_DOES_NOT_SUPPORT_BIG_ENDIAN." +#endif + +#if !defined(SK_ATTRIBUTE) +# if defined(__clang__) || defined(__GNUC__) +# define SK_ATTRIBUTE(attr) __attribute__((attr)) +# else +# define SK_ATTRIBUTE(attr) +# endif +#endif + +#if !defined(SK_SUPPORT_GPU) +# define SK_SUPPORT_GPU 1 +#endif + +#if SK_SUPPORT_GPU || SK_GRAPHITE_ENABLED +# if !defined(SK_ENABLE_SKSL) +# define SK_ENABLE_SKSL +# endif +#else +# undef SK_GL +# undef SK_VULKAN +# undef SK_METAL +# undef SK_DAWN +# undef SK_DIRECT3D +#endif + +#if !defined(SkUNREACHABLE) +# if defined(_MSC_VER) && !defined(__clang__) +# include <intrin.h> +# define FAST_FAIL_INVALID_ARG 5 +// See https://developercommunity.visualstudio.com/content/problem/1128631/code-flow-doesnt-see-noreturn-with-extern-c.html +// for why this is wrapped. Hopefully removable after msvc++ 19.27 is no longer supported. +[[noreturn]] static inline void sk_fast_fail() { __fastfail(FAST_FAIL_INVALID_ARG); } +# define SkUNREACHABLE sk_fast_fail() +# else +# define SkUNREACHABLE __builtin_trap() +# endif +#endif + +#if defined(SK_BUILD_FOR_GOOGLE3) + void SkDebugfForDumpStackTrace(const char* data, void* unused); + void DumpStackTrace(int skip_count, void w(const char*, void*), void* arg); +# define SK_DUMP_GOOGLE3_STACK() DumpStackTrace(0, SkDebugfForDumpStackTrace, nullptr) +#else +# define SK_DUMP_GOOGLE3_STACK() +#endif + +#ifndef SK_ABORT +# ifdef SK_BUILD_FOR_WIN + // This style lets Visual Studio follow errors back to the source file. +# define SK_DUMP_LINE_FORMAT "%s(%d)" +# else +# define SK_DUMP_LINE_FORMAT "%s:%d" +# endif +# define SK_ABORT(message, ...) \ + do { \ + SkDebugf(SK_DUMP_LINE_FORMAT ": fatal error: \"" message "\"\n", \ + __FILE__, __LINE__, ##__VA_ARGS__); \ + SK_DUMP_GOOGLE3_STACK(); \ + sk_abort_no_print(); \ + } while (false) +#endif + +// If SK_R32_SHIFT is set, we'll use that to choose RGBA or BGRA. +// If not, we'll default to RGBA everywhere except BGRA on Windows. +#if defined(SK_R32_SHIFT) + static_assert(SK_R32_SHIFT == 0 || SK_R32_SHIFT == 16, ""); +#elif defined(SK_BUILD_FOR_WIN) + #define SK_R32_SHIFT 16 +#else + #define SK_R32_SHIFT 0 +#endif + +#if defined(SK_B32_SHIFT) + static_assert(SK_B32_SHIFT == (16-SK_R32_SHIFT), ""); +#else + #define SK_B32_SHIFT (16-SK_R32_SHIFT) +#endif + +#define SK_G32_SHIFT 8 +#define SK_A32_SHIFT 24 + + +/** + * SK_PMCOLOR_BYTE_ORDER can be used to query the byte order of SkPMColor at compile time. + */ +#ifdef SK_CPU_BENDIAN +# define SK_PMCOLOR_BYTE_ORDER(C0, C1, C2, C3) \ + (SK_ ## C3 ## 32_SHIFT == 0 && \ + SK_ ## C2 ## 32_SHIFT == 8 && \ + SK_ ## C1 ## 32_SHIFT == 16 && \ + SK_ ## C0 ## 32_SHIFT == 24) +#else +# define SK_PMCOLOR_BYTE_ORDER(C0, C1, C2, C3) \ + (SK_ ## C0 ## 32_SHIFT == 0 && \ + SK_ ## C1 ## 32_SHIFT == 8 && \ + SK_ ## C2 ## 32_SHIFT == 16 && \ + SK_ ## C3 ## 32_SHIFT == 24) +#endif + +#if defined SK_DEBUG && defined SK_BUILD_FOR_WIN + #ifdef free + #undef free + #endif + #include <crtdbg.h> + #undef free +#endif + +#if !defined(SK_UNUSED) +# if !defined(__clang__) && defined(_MSC_VER) +# define SK_UNUSED __pragma(warning(suppress:4189)) +# else +# define SK_UNUSED SK_ATTRIBUTE(unused) +# endif +#endif + +#if !defined(SK_MAYBE_UNUSED) +# if defined(__clang__) || defined(__GNUC__) +# define SK_MAYBE_UNUSED [[maybe_unused]] +# else +# define SK_MAYBE_UNUSED +# endif +#endif + +/** + * If your judgment is better than the compiler's (i.e. you've profiled it), + * you can use SK_ALWAYS_INLINE to force inlining. E.g. + * inline void someMethod() { ... } // may not be inlined + * SK_ALWAYS_INLINE void someMethod() { ... } // should always be inlined + */ +#if !defined(SK_ALWAYS_INLINE) +# if defined(SK_BUILD_FOR_WIN) +# define SK_ALWAYS_INLINE __forceinline +# else +# define SK_ALWAYS_INLINE SK_ATTRIBUTE(always_inline) inline +# endif +#endif + +/** + * If your judgment is better than the compiler's (i.e. you've profiled it), + * you can use SK_NEVER_INLINE to prevent inlining. + */ +#if !defined(SK_NEVER_INLINE) +# if defined(SK_BUILD_FOR_WIN) +# define SK_NEVER_INLINE __declspec(noinline) +# else +# define SK_NEVER_INLINE SK_ATTRIBUTE(noinline) +# endif +#endif + +#ifndef SK_PRINTF_LIKE +# if defined(__clang__) || defined(__GNUC__) +# define SK_PRINTF_LIKE(A, B) __attribute__((format(printf, (A), (B)))) +# else +# define SK_PRINTF_LIKE(A, B) +# endif +#endif + +#ifndef SK_ALLOW_STATIC_GLOBAL_INITIALIZERS + #define SK_ALLOW_STATIC_GLOBAL_INITIALIZERS 0 +#endif + +#if !defined(SK_GAMMA_EXPONENT) + #define SK_GAMMA_EXPONENT (0.0f) // SRGB +#endif + +#ifndef GR_TEST_UTILS +# define GR_TEST_UTILS 0 +#endif + +#ifndef SK_GPU_V1 +# define SK_GPU_V1 1 +#endif + +#if defined(SK_HISTOGRAM_ENUMERATION) || \ + defined(SK_HISTOGRAM_BOOLEAN) || \ + defined(SK_HISTOGRAM_EXACT_LINEAR) || \ + defined(SK_HISTOGRAM_MEMORY_KB) +# define SK_HISTOGRAMS_ENABLED 1 +#else +# define SK_HISTOGRAMS_ENABLED 0 +#endif + +#ifndef SK_HISTOGRAM_BOOLEAN +# define SK_HISTOGRAM_BOOLEAN(name, sample) +#endif + +#ifndef SK_HISTOGRAM_ENUMERATION +# define SK_HISTOGRAM_ENUMERATION(name, sample, enum_size) +#endif + +#ifndef SK_HISTOGRAM_EXACT_LINEAR +# define SK_HISTOGRAM_EXACT_LINEAR(name, sample, value_max) +#endif + +#ifndef SK_HISTOGRAM_MEMORY_KB +# define SK_HISTOGRAM_MEMORY_KB(name, sample) +#endif + +#define SK_HISTOGRAM_PERCENTAGE(name, percent_as_int) \ + SK_HISTOGRAM_EXACT_LINEAR(name, percent_as_int, 101) + +#ifndef SK_DISABLE_LEGACY_SHADERCONTEXT +#define SK_ENABLE_LEGACY_SHADERCONTEXT +#endif + +#ifdef SK_ENABLE_API_AVAILABLE +#define SK_API_AVAILABLE API_AVAILABLE +#else +#define SK_API_AVAILABLE(...) +#endif + +#if defined(SK_BUILD_FOR_LIBFUZZER) || defined(SK_BUILD_FOR_AFL_FUZZ) + #define SK_BUILD_FOR_FUZZER +#endif + +/** Called internally if we hit an unrecoverable error. + The platform implementation must not return, but should either throw + an exception or otherwise exit. +*/ +[[noreturn]] SK_API extern void sk_abort_no_print(void); + +#ifndef SkDebugf + SK_API void SkDebugf(const char format[], ...) SK_PRINTF_LIKE(1, 2); +#endif + +// SkASSERT, SkASSERTF and SkASSERT_RELEASE can be used as stand alone assertion expressions, e.g. +// uint32_t foo(int x) { +// SkASSERT(x > 4); +// return x - 4; +// } +// and are also written to be compatible with constexpr functions: +// constexpr uint32_t foo(int x) { +// return SkASSERT(x > 4), +// x - 4; +// } +#define SkASSERT_RELEASE(cond) \ + static_cast<void>( (cond) ? (void)0 : []{ SK_ABORT("assert(%s)", #cond); }() ) + +#ifdef SK_DEBUG + #define SkASSERT(cond) SkASSERT_RELEASE(cond) + #define SkASSERTF(cond, fmt, ...) static_cast<void>( (cond) ? (void)0 : [&]{ \ + SkDebugf(fmt"\n", ##__VA_ARGS__); \ + SK_ABORT("assert(%s)", #cond); \ + }() ) + #define SkDEBUGFAIL(message) SK_ABORT("%s", message) + #define SkDEBUGFAILF(fmt, ...) SK_ABORT(fmt, ##__VA_ARGS__) + #define SkDEBUGCODE(...) __VA_ARGS__ + #define SkDEBUGF(...) SkDebugf(__VA_ARGS__) + #define SkAssertResult(cond) SkASSERT(cond) +#else + #define SkASSERT(cond) static_cast<void>(0) + #define SkASSERTF(cond, fmt, ...) static_cast<void>(0) + #define SkDEBUGFAIL(message) + #define SkDEBUGFAILF(fmt, ...) + #define SkDEBUGCODE(...) + #define SkDEBUGF(...) + + // unlike SkASSERT, this macro executes its condition in the non-debug build. + // The if is present so that this can be used with functions marked SK_WARN_UNUSED_RESULT. + #define SkAssertResult(cond) if (cond) {} do {} while(false) +#endif + +//////////////////////////////////////////////////////////////////////////////// + +/** Fast type for unsigned 8 bits. Use for parameter passing and local + variables, not for storage +*/ +typedef unsigned U8CPU; + +/** Fast type for unsigned 16 bits. Use for parameter passing and local + variables, not for storage +*/ +typedef unsigned U16CPU; + +/** @return false or true based on the condition +*/ +template <typename T> static constexpr bool SkToBool(const T& x) { + return 0 != x; // NOLINT(modernize-use-nullptr) +} + +static constexpr int16_t SK_MaxS16 = INT16_MAX; +static constexpr int16_t SK_MinS16 = -SK_MaxS16; + +static constexpr int32_t SK_MaxS32 = INT32_MAX; +static constexpr int32_t SK_MinS32 = -SK_MaxS32; +static constexpr int32_t SK_NaN32 = INT32_MIN; + +static constexpr int64_t SK_MaxS64 = INT64_MAX; +static constexpr int64_t SK_MinS64 = -SK_MaxS64; + +static inline constexpr int32_t SkLeftShift(int32_t value, int32_t shift) { + return (int32_t) ((uint32_t) value << shift); +} + +static inline constexpr int64_t SkLeftShift(int64_t value, int32_t shift) { + return (int64_t) ((uint64_t) value << shift); +} + +//////////////////////////////////////////////////////////////////////////////// + +/** @return the number of entries in an array (not a pointer) +*/ +template <typename T, size_t N> char (&SkArrayCountHelper(T (&array)[N]))[N]; +#define SK_ARRAY_COUNT(array) (sizeof(SkArrayCountHelper(array))) + +//////////////////////////////////////////////////////////////////////////////// + +template <typename T> static constexpr T SkAlign2(T x) { return (x + 1) >> 1 << 1; } +template <typename T> static constexpr T SkAlign4(T x) { return (x + 3) >> 2 << 2; } +template <typename T> static constexpr T SkAlign8(T x) { return (x + 7) >> 3 << 3; } + +template <typename T> static constexpr bool SkIsAlign2(T x) { return 0 == (x & 1); } +template <typename T> static constexpr bool SkIsAlign4(T x) { return 0 == (x & 3); } +template <typename T> static constexpr bool SkIsAlign8(T x) { return 0 == (x & 7); } + +template <typename T> static constexpr T SkAlignPtr(T x) { + return sizeof(void*) == 8 ? SkAlign8(x) : SkAlign4(x); +} +template <typename T> static constexpr bool SkIsAlignPtr(T x) { + return sizeof(void*) == 8 ? SkIsAlign8(x) : SkIsAlign4(x); +} + +/** + * align up to a power of 2 + */ +static inline constexpr size_t SkAlignTo(size_t x, size_t alignment) { + // The same as alignment && SkIsPow2(value), w/o a dependency cycle. + SkASSERT(alignment && (alignment & (alignment - 1)) == 0); + return (x + alignment - 1) & ~(alignment - 1); +} + +typedef uint32_t SkFourByteTag; +static inline constexpr SkFourByteTag SkSetFourByteTag(char a, char b, char c, char d) { + return (((uint32_t)a << 24) | ((uint32_t)b << 16) | ((uint32_t)c << 8) | (uint32_t)d); +} + +//////////////////////////////////////////////////////////////////////////////// + +/** 32 bit integer to hold a unicode value +*/ +typedef int32_t SkUnichar; + +/** 16 bit unsigned integer to hold a glyph index +*/ +typedef uint16_t SkGlyphID; + +/** 32 bit value to hold a millisecond duration + Note that SK_MSecMax is about 25 days. +*/ +typedef uint32_t SkMSec; + +/** Maximum representable milliseconds; 24d 20h 31m 23.647s. +*/ +static constexpr SkMSec SK_MSecMax = INT32_MAX; + +/** The generation IDs in Skia reserve 0 has an invalid marker. +*/ +static constexpr uint32_t SK_InvalidGenID = 0; + +/** The unique IDs in Skia reserve 0 has an invalid marker. +*/ +static constexpr uint32_t SK_InvalidUniqueID = 0; + +static inline int32_t SkAbs32(int32_t value) { + SkASSERT(value != SK_NaN32); // The most negative int32_t can't be negated. + if (value < 0) { + value = -value; + } + return value; +} + +template <typename T> static inline T SkTAbs(T value) { + if (value < 0) { + value = -value; + } + return value; +} + +//////////////////////////////////////////////////////////////////////////////// + +/** Indicates whether an allocation should count against a cache budget. +*/ +enum class SkBudgeted : bool { + kNo = false, + kYes = true +}; + +/** Indicates whether a backing store needs to be an exact match or can be + larger than is strictly necessary +*/ +enum class SkBackingFit { + kApprox, + kExact +}; + +#endif diff --git a/src/deps/skia/include/core/SkUnPreMultiply.h b/src/deps/skia/include/core/SkUnPreMultiply.h new file mode 100644 index 000000000..b492619d0 --- /dev/null +++ b/src/deps/skia/include/core/SkUnPreMultiply.h @@ -0,0 +1,56 @@ + +/* + * Copyright 2008 The Android Open Source Project + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + + + + + +#ifndef SkUnPreMultiply_DEFINED +#define SkUnPreMultiply_DEFINED + +#include "include/core/SkColor.h" + +class SK_API SkUnPreMultiply { +public: + typedef uint32_t Scale; + + // index this table with alpha [0..255] + static const Scale* GetScaleTable() { + return gTable; + } + + static Scale GetScale(U8CPU alpha) { + SkASSERT(alpha <= 255); + return gTable[alpha]; + } + + /** Usage: + + const Scale* table = SkUnPreMultiply::GetScaleTable(); + + for (...) { + unsigned a = ... + SkUnPreMultiply::Scale scale = table[a]; + + red = SkUnPreMultiply::ApplyScale(scale, red); + ... + // now red is unpremultiplied + } + */ + static U8CPU ApplyScale(Scale scale, U8CPU component) { + SkASSERT(component <= 255); + return (scale * component + (1 << 23)) >> 24; + } + + static SkColor PMColorToColor(SkPMColor c); + +private: + static const uint32_t gTable[256]; +}; + +#endif diff --git a/src/deps/skia/include/core/SkVertices.h b/src/deps/skia/include/core/SkVertices.h new file mode 100644 index 000000000..fc53e9d01 --- /dev/null +++ b/src/deps/skia/include/core/SkVertices.h @@ -0,0 +1,132 @@ +/* + * Copyright 2017 Google Inc. + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkVertices_DEFINED +#define SkVertices_DEFINED + +#include "include/core/SkColor.h" +#include "include/core/SkRect.h" +#include "include/core/SkRefCnt.h" + +class SkData; +struct SkPoint; +class SkVerticesPriv; + +/** + * An immutable set of vertex data that can be used with SkCanvas::drawVertices. + */ +class SK_API SkVertices : public SkNVRefCnt<SkVertices> { + struct Desc; + struct Sizes; +public: + enum VertexMode { + kTriangles_VertexMode, + kTriangleStrip_VertexMode, + kTriangleFan_VertexMode, + + kLast_VertexMode = kTriangleFan_VertexMode, + }; + + /** + * Create a vertices by copying the specified arrays. texs, colors may be nullptr, + * and indices is ignored if indexCount == 0. + */ + static sk_sp<SkVertices> MakeCopy(VertexMode mode, int vertexCount, + const SkPoint positions[], + const SkPoint texs[], + const SkColor colors[], + int indexCount, + const uint16_t indices[]); + + static sk_sp<SkVertices> MakeCopy(VertexMode mode, int vertexCount, + const SkPoint positions[], + const SkPoint texs[], + const SkColor colors[]) { + return MakeCopy(mode, + vertexCount, + positions, + texs, + colors, + 0, + nullptr); + } + + enum BuilderFlags { + kHasTexCoords_BuilderFlag = 1 << 0, + kHasColors_BuilderFlag = 1 << 1, + }; + class Builder { + public: + Builder(VertexMode mode, int vertexCount, int indexCount, uint32_t flags); + + bool isValid() const { return fVertices != nullptr; } + + SkPoint* positions(); + uint16_t* indices(); // returns null if there are no indices + + // If we have custom attributes, these will always be null + SkPoint* texCoords(); // returns null if there are no texCoords + SkColor* colors(); // returns null if there are no colors + + // Detach the built vertices object. After the first call, this will always return null. + sk_sp<SkVertices> detach(); + + private: + Builder(const Desc&); + + void init(const Desc&); + + // holds a partially complete object. only completed in detach() + sk_sp<SkVertices> fVertices; + // Extra storage for intermediate vertices in the case where the client specifies indexed + // triangle fans. These get converted to indexed triangles when the Builder is finalized. + std::unique_ptr<uint8_t[]> fIntermediateFanIndices; + + friend class SkVertices; + friend class SkVerticesPriv; + }; + + uint32_t uniqueID() const { return fUniqueID; } + const SkRect& bounds() const { return fBounds; } + + // returns approximate byte size of the vertices object + size_t approximateSize() const; + + // Provides access to functions that aren't part of the public API. + SkVerticesPriv priv(); + const SkVerticesPriv priv() const; // NOLINT(readability-const-return-type) + +private: + SkVertices() {} + + friend class SkVerticesPriv; + + // these are needed since we've manually sized our allocation (see Builder::init) + friend class SkNVRefCnt<SkVertices>; + void operator delete(void* p); + + Sizes getSizes() const; + + // we store this first, to pair with the refcnt in our base-class, so we don't have an + // unnecessary pad between it and the (possibly 8-byte aligned) ptrs. + uint32_t fUniqueID; + + // these point inside our allocation, so none of these can be "freed" + SkPoint* fPositions; // [vertexCount] + uint16_t* fIndices; // [indexCount] or null + SkPoint* fTexs; // [vertexCount] or null + SkColor* fColors; // [vertexCount] or null + + SkRect fBounds; // computed to be the union of the fPositions[] + int fVertexCount; + int fIndexCount; + + VertexMode fMode; + // below here is where the actual array data is stored. +}; + +#endif diff --git a/src/deps/skia/include/core/SkYUVAInfo.h b/src/deps/skia/include/core/SkYUVAInfo.h new file mode 100644 index 000000000..a3cf210f3 --- /dev/null +++ b/src/deps/skia/include/core/SkYUVAInfo.h @@ -0,0 +1,304 @@ +/* + * Copyright 2020 Google LLC + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkYUVAInfo_DEFINED +#define SkYUVAInfo_DEFINED + +#include "include/codec/SkEncodedOrigin.h" +#include "include/core/SkImageInfo.h" +#include "include/core/SkSize.h" + +#include <array> +#include <tuple> + +/** + * Specifies the structure of planes for a YUV image with optional alpha. The actual planar data + * is not part of this structure and depending on usage is in external textures or pixmaps. + */ +class SK_API SkYUVAInfo { +public: + enum YUVAChannels { kY, kU, kV, kA, kLast = kA }; + static constexpr int kYUVAChannelCount = static_cast<int>(YUVAChannels::kLast + 1); + + struct YUVALocation; // For internal use. + using YUVALocations = std::array<YUVALocation, kYUVAChannelCount>; + + /** + * Specifies how YUV (and optionally A) are divided among planes. Planes are separated by + * underscores in the enum value names. Within each plane the pixmap/texture channels are + * mapped to the YUVA channels in the order specified, e.g. for kY_UV Y is in channel 0 of plane + * 0, U is in channel 0 of plane 1, and V is in channel 1 of plane 1. Channel ordering + * within a pixmap/texture given the channels it contains: + * A: 0:A + * Luminance/Gray: 0:Gray + * Luminance/Gray + Alpha: 0:Gray, 1:A + * RG 0:R, 1:G + * RGB 0:R, 1:G, 2:B + * RGBA 0:R, 1:G, 2:B, 3:A + */ + enum class PlaneConfig { + kUnknown, + + kY_U_V, ///< Plane 0: Y, Plane 1: U, Plane 2: V + kY_V_U, ///< Plane 0: Y, Plane 1: V, Plane 2: U + kY_UV, ///< Plane 0: Y, Plane 1: UV + kY_VU, ///< Plane 0: Y, Plane 1: VU + kYUV, ///< Plane 0: YUV + kUYV, ///< Plane 0: UYV + + kY_U_V_A, ///< Plane 0: Y, Plane 1: U, Plane 2: V, Plane 3: A + kY_V_U_A, ///< Plane 0: Y, Plane 1: V, Plane 2: U, Plane 3: A + kY_UV_A, ///< Plane 0: Y, Plane 1: UV, Plane 2: A + kY_VU_A, ///< Plane 0: Y, Plane 1: VU, Plane 2: A + kYUVA, ///< Plane 0: YUVA + kUYVA, ///< Plane 0: UYVA + + kLast = kUYVA + }; + + /** + * UV subsampling is also specified in the enum value names using J:a:b notation (e.g. 4:2:0 is + * 1/2 horizontal and 1/2 vertical resolution for U and V). If alpha is present it is not sub- + * sampled. Note that Subsampling values other than k444 are only valid with PlaneConfig values + * that have U and V in different planes than Y (and A, if present). + */ + enum class Subsampling { + kUnknown, + + k444, ///< No subsampling. UV values for each Y. + k422, ///< 1 set of UV values for each 2x1 block of Y values. + k420, ///< 1 set of UV values for each 2x2 block of Y values. + k440, ///< 1 set of UV values for each 1x2 block of Y values. + k411, ///< 1 set of UV values for each 4x1 block of Y values. + k410, ///< 1 set of UV values for each 4x2 block of Y values. + + kLast = k410 + }; + + /** + * Describes how subsampled chroma values are sited relative to luma values. + * + * Currently only centered siting is supported but will expand to support additional sitings. + */ + enum class Siting { + /** + * Subsampled chroma value is sited at the center of the block of corresponding luma values. + */ + kCentered, + }; + + static constexpr int kMaxPlanes = 4; + + /** ratio of Y/A values to U/V values in x and y. */ + static std::tuple<int, int> SubsamplingFactors(Subsampling); + + /** + * SubsamplingFactors(Subsampling) if planedIdx refers to a U/V plane and otherwise {1, 1} if + * inputs are valid. Invalid inputs consist of incompatible PlaneConfig/Subsampling/planeIdx + * combinations. {0, 0} is returned for invalid inputs. + */ + static std::tuple<int, int> PlaneSubsamplingFactors(PlaneConfig, Subsampling, int planeIdx); + + /** + * Given image dimensions, a planer configuration, subsampling, and origin, determine the + * expected size of each plane. Returns the number of expected planes. planeDimensions[0] + * through planeDimensions[<ret>] are written. The input image dimensions are as displayed + * (after the planes have been transformed to the intended display orientation). The plane + * dimensions are output as the planes are stored in memory (may be rotated from image + * dimensions). + */ + static int PlaneDimensions(SkISize imageDimensions, + PlaneConfig, + Subsampling, + SkEncodedOrigin, + SkISize planeDimensions[kMaxPlanes]); + + /** Number of planes for a given PlaneConfig. */ + static constexpr int NumPlanes(PlaneConfig); + + /** + * Number of Y, U, V, A channels in the ith plane for a given PlaneConfig (or 0 if i is + * invalid). + */ + static constexpr int NumChannelsInPlane(PlaneConfig, int i); + + /** + * Given a PlaneConfig and a set of channel flags for each plane, convert to YUVALocations + * representation. Fails if channel flags aren't valid for the PlaneConfig (i.e. don't have + * enough channels in a plane) by returning an invalid set of locations (plane indices are -1). + */ + static YUVALocations GetYUVALocations(PlaneConfig, const uint32_t* planeChannelFlags); + + /** Does the PlaneConfig have alpha values? */ + static bool HasAlpha(PlaneConfig); + + SkYUVAInfo() = default; + SkYUVAInfo(const SkYUVAInfo&) = default; + + /** + * 'dimensions' should specify the size of the full resolution image (after planes have been + * oriented to how the image is displayed as indicated by 'origin'). + */ + SkYUVAInfo(SkISize dimensions, + PlaneConfig, + Subsampling, + SkYUVColorSpace, + SkEncodedOrigin origin = kTopLeft_SkEncodedOrigin, + Siting sitingX = Siting::kCentered, + Siting sitingY = Siting::kCentered); + + SkYUVAInfo& operator=(const SkYUVAInfo& that) = default; + + PlaneConfig planeConfig() const { return fPlaneConfig; } + Subsampling subsampling() const { return fSubsampling; } + + std::tuple<int, int> planeSubsamplingFactors(int planeIdx) const { + return PlaneSubsamplingFactors(fPlaneConfig, fSubsampling, planeIdx); + } + + /** + * Dimensions of the full resolution image (after planes have been oriented to how the image + * is displayed as indicated by fOrigin). + */ + SkISize dimensions() const { return fDimensions; } + int width() const { return fDimensions.width(); } + int height() const { return fDimensions.height(); } + + SkYUVColorSpace yuvColorSpace() const { return fYUVColorSpace; } + Siting sitingX() const { return fSitingX; } + Siting sitingY() const { return fSitingY; } + + SkEncodedOrigin origin() const { return fOrigin; } + + SkMatrix originMatrix() const { + return SkEncodedOriginToMatrix(fOrigin, this->width(), this->height()); + } + + bool hasAlpha() const { return HasAlpha(fPlaneConfig); } + + /** + * Returns the number of planes and initializes planeDimensions[0]..planeDimensions[<ret>] to + * the expected dimensions for each plane. Dimensions are as stored in memory, before + * transformation to image display space as indicated by origin(). + */ + int planeDimensions(SkISize planeDimensions[kMaxPlanes]) const { + return PlaneDimensions(fDimensions, fPlaneConfig, fSubsampling, fOrigin, planeDimensions); + } + + /** + * Given a per-plane row bytes, determine size to allocate for all planes. Optionally retrieves + * the per-plane byte sizes in planeSizes if not null. If total size overflows will return + * SIZE_MAX and set all planeSizes to SIZE_MAX. + */ + size_t computeTotalBytes(const size_t rowBytes[kMaxPlanes], + size_t planeSizes[kMaxPlanes] = nullptr) const; + + int numPlanes() const { return NumPlanes(fPlaneConfig); } + + int numChannelsInPlane(int i) const { return NumChannelsInPlane(fPlaneConfig, i); } + + /** + * Given a set of channel flags for each plane, converts this->planeConfig() to YUVALocations + * representation. Fails if the channel flags aren't valid for the PlaneConfig (i.e. don't have + * enough channels in a plane) by returning default initialized locations (all plane indices are + * -1). + */ + YUVALocations toYUVALocations(const uint32_t* channelFlags) const; + + /** + * Makes a SkYUVAInfo that is identical to this one but with the passed Subsampling. If the + * passed Subsampling is not k444 and this info's PlaneConfig is not compatible with chroma + * subsampling (because Y is in the same plane as UV) then the result will be an invalid + * SkYUVAInfo. + */ + SkYUVAInfo makeSubsampling(SkYUVAInfo::Subsampling) const; + + /** + * Makes a SkYUVAInfo that is identical to this one but with the passed dimensions. If the + * passed dimensions is empty then the result will be an invalid SkYUVAInfo. + */ + SkYUVAInfo makeDimensions(SkISize) const; + + bool operator==(const SkYUVAInfo& that) const; + bool operator!=(const SkYUVAInfo& that) const { return !(*this == that); } + + bool isValid() const { return fPlaneConfig != PlaneConfig::kUnknown; } + +private: + SkISize fDimensions = {0, 0}; + + PlaneConfig fPlaneConfig = PlaneConfig::kUnknown; + Subsampling fSubsampling = Subsampling::kUnknown; + + SkYUVColorSpace fYUVColorSpace = SkYUVColorSpace::kIdentity_SkYUVColorSpace; + + /** + * YUVA data often comes from formats like JPEG that support EXIF orientation. + * Code that operates on the raw YUV data often needs to know that orientation. + */ + SkEncodedOrigin fOrigin = kTopLeft_SkEncodedOrigin; + + Siting fSitingX = Siting::kCentered; + Siting fSitingY = Siting::kCentered; +}; + +constexpr int SkYUVAInfo::NumPlanes(PlaneConfig planeConfig) { + switch (planeConfig) { + case PlaneConfig::kUnknown: return 0; + case PlaneConfig::kY_U_V: return 3; + case PlaneConfig::kY_V_U: return 3; + case PlaneConfig::kY_UV: return 2; + case PlaneConfig::kY_VU: return 2; + case PlaneConfig::kYUV: return 1; + case PlaneConfig::kUYV: return 1; + case PlaneConfig::kY_U_V_A: return 4; + case PlaneConfig::kY_V_U_A: return 4; + case PlaneConfig::kY_UV_A: return 3; + case PlaneConfig::kY_VU_A: return 3; + case PlaneConfig::kYUVA: return 1; + case PlaneConfig::kUYVA: return 1; + } + SkUNREACHABLE; +} + +constexpr int SkYUVAInfo::NumChannelsInPlane(PlaneConfig config, int i) { + switch (config) { + case PlaneConfig::kUnknown: + return 0; + + case SkYUVAInfo::PlaneConfig::kY_U_V: + case SkYUVAInfo::PlaneConfig::kY_V_U: + return i >= 0 && i < 3 ? 1 : 0; + case SkYUVAInfo::PlaneConfig::kY_UV: + case SkYUVAInfo::PlaneConfig::kY_VU: + switch (i) { + case 0: return 1; + case 1: return 2; + default: return 0; + } + case SkYUVAInfo::PlaneConfig::kYUV: + case SkYUVAInfo::PlaneConfig::kUYV: + return i == 0 ? 3 : 0; + case SkYUVAInfo::PlaneConfig::kY_U_V_A: + case SkYUVAInfo::PlaneConfig::kY_V_U_A: + return i >= 0 && i < 4 ? 1 : 0; + case SkYUVAInfo::PlaneConfig::kY_UV_A: + case SkYUVAInfo::PlaneConfig::kY_VU_A: + switch (i) { + case 0: return 1; + case 1: return 2; + case 2: return 1; + default: return 0; + } + case SkYUVAInfo::PlaneConfig::kYUVA: + case SkYUVAInfo::PlaneConfig::kUYVA: + return i == 0 ? 4 : 0; + } + return 0; +} + +#endif diff --git a/src/deps/skia/include/core/SkYUVAPixmaps.h b/src/deps/skia/include/core/SkYUVAPixmaps.h new file mode 100644 index 000000000..de04ab14d --- /dev/null +++ b/src/deps/skia/include/core/SkYUVAPixmaps.h @@ -0,0 +1,336 @@ +/* + * Copyright 2020 Google LLC + * + * Use of this source code is governed by a BSD-style license that can be + * found in the LICENSE file. + */ + +#ifndef SkYUVAPixmaps_DEFINED +#define SkYUVAPixmaps_DEFINED + +#include "include/core/SkData.h" +#include "include/core/SkImageInfo.h" +#include "include/core/SkPixmap.h" +#include "include/core/SkYUVAInfo.h" +#include "include/private/SkTo.h" + +#include <array> +#include <bitset> + +class GrImageContext; + +/** + * SkYUVAInfo combined with per-plane SkColorTypes and row bytes. Fully specifies the SkPixmaps + * for a YUVA image without the actual pixel memory and data. + */ +class SK_API SkYUVAPixmapInfo { +public: + static constexpr auto kMaxPlanes = SkYUVAInfo::kMaxPlanes; + + using PlaneConfig = SkYUVAInfo::PlaneConfig; + using Subsampling = SkYUVAInfo::Subsampling; + + /** + * Data type for Y, U, V, and possibly A channels independent of how values are packed into + * planes. + **/ + enum class DataType { + kUnorm8, ///< 8 bit unsigned normalized + kUnorm16, ///< 16 bit unsigned normalized + kFloat16, ///< 16 bit (half) floating point + kUnorm10_Unorm2, ///< 10 bit unorm for Y, U, and V. 2 bit unorm for alpha (if present). + + kLast = kUnorm10_Unorm2 + }; + static constexpr int kDataTypeCnt = static_cast<int>(DataType::kLast) + 1; + + class SK_API SupportedDataTypes { + public: + /** Defaults to nothing supported. */ + constexpr SupportedDataTypes() = default; + + /** Init based on texture formats supported by the context. */ + SupportedDataTypes(const GrImageContext&); + + /** All legal combinations of PlaneConfig and DataType are supported. */ + static constexpr SupportedDataTypes All(); + + /** + * Checks whether there is a supported combination of color types for planes structured + * as indicated by PlaneConfig with channel data types as indicated by DataType. + */ + constexpr bool supported(PlaneConfig, DataType) const; + + /** + * Update to add support for pixmaps with numChannel channels where each channel is + * represented as DataType. + */ + void enableDataType(DataType, int numChannels); + + private: + // The bit for DataType dt with n channels is at index kDataTypeCnt*(n-1) + dt. + std::bitset<kDataTypeCnt*4> fDataTypeSupport = {}; + }; + + /** + * Gets the default SkColorType to use with numChannels channels, each represented as DataType. + * Returns kUnknown_SkColorType if no such color type. + */ + static constexpr SkColorType DefaultColorTypeForDataType(DataType dataType, int numChannels); + + /** + * If the SkColorType is supported for YUVA pixmaps this will return the number of YUVA channels + * that can be stored in a plane of this color type and what the DataType is of those channels. + * If the SkColorType is not supported as a YUVA plane the number of channels is reported as 0 + * and the DataType returned should be ignored. + */ + static std::tuple<int, DataType> NumChannelsAndDataType(SkColorType); + + /** Default SkYUVAPixmapInfo is invalid. */ + SkYUVAPixmapInfo() = default; + + /** + * Initializes the SkYUVAPixmapInfo from a SkYUVAInfo with per-plane color types and row bytes. + * This will be invalid if the colorTypes aren't compatible with the SkYUVAInfo or if a + * rowBytes entry is not valid for the plane dimensions and color type. Color type and + * row byte values beyond the number of planes in SkYUVAInfo are ignored. All SkColorTypes + * must have the same DataType or this will be invalid. + * + * If rowBytes is nullptr then bpp*width is assumed for each plane. + */ + SkYUVAPixmapInfo(const SkYUVAInfo&, + const SkColorType[kMaxPlanes], + const size_t rowBytes[kMaxPlanes]); + /** + * Like above but uses DefaultColorTypeForDataType to determine each plane's SkColorType. If + * rowBytes is nullptr then bpp*width is assumed for each plane. + */ + SkYUVAPixmapInfo(const SkYUVAInfo&, DataType, const size_t rowBytes[kMaxPlanes]); + + SkYUVAPixmapInfo(const SkYUVAPixmapInfo&) = default; + + SkYUVAPixmapInfo& operator=(const SkYUVAPixmapInfo&) = default; + + bool operator==(const SkYUVAPixmapInfo&) const; + bool operator!=(const SkYUVAPixmapInfo& that) const { return !(*this == that); } + + const SkYUVAInfo& yuvaInfo() const { return fYUVAInfo; } + + SkYUVColorSpace yuvColorSpace() const { return fYUVAInfo.yuvColorSpace(); } + + /** The number of SkPixmap planes, 0 if this SkYUVAPixmapInfo is invalid. */ + int numPlanes() const { return fYUVAInfo.numPlanes(); } + + /** The per-YUV[A] channel data type. */ + DataType dataType() const { return fDataType; } + + /** + * Row bytes for the ith plane. Returns zero if i >= numPlanes() or this SkYUVAPixmapInfo is + * invalid. + */ + size_t rowBytes(int i) const { return fRowBytes[static_cast<size_t>(i)]; } + + /** Image info for the ith plane, or default SkImageInfo if i >= numPlanes() */ + const SkImageInfo& planeInfo(int i) const { return fPlaneInfos[static_cast<size_t>(i)]; } + + /** + * Determine size to allocate for all planes. Optionally retrieves the per-plane sizes in + * planeSizes if not null. If total size overflows will return SIZE_MAX and set all planeSizes + * to SIZE_MAX. Returns 0 and fills planesSizes with 0 if this SkYUVAPixmapInfo is not valid. + */ + size_t computeTotalBytes(size_t planeSizes[kMaxPlanes] = nullptr) const; + + /** + * Takes an allocation that is assumed to be at least computeTotalBytes() in size and configures + * the first numPlanes() entries in pixmaps array to point into that memory. The remaining + * entries of pixmaps are default initialized. Fails if this SkYUVAPixmapInfo not valid. + */ + bool initPixmapsFromSingleAllocation(void* memory, SkPixmap pixmaps[kMaxPlanes]) const; + + /** + * Returns true if this has been configured with a non-empty dimensioned SkYUVAInfo with + * compatible color types and row bytes. + */ + bool isValid() const { return fYUVAInfo.isValid(); } + + /** Is this valid and does it use color types allowed by the passed SupportedDataTypes? */ + bool isSupported(const SupportedDataTypes&) const; + +private: + SkYUVAInfo fYUVAInfo; + std::array<SkImageInfo, kMaxPlanes> fPlaneInfos = {}; + std::array<size_t, kMaxPlanes> fRowBytes = {}; + DataType fDataType = DataType::kUnorm8; + static_assert(kUnknown_SkColorType == 0, "default init isn't kUnknown"); +}; + +/** + * Helper to store SkPixmap planes as described by a SkYUVAPixmapInfo. Can be responsible for + * allocating/freeing memory for pixmaps or use external memory. + */ +class SK_API SkYUVAPixmaps { +public: + using DataType = SkYUVAPixmapInfo::DataType; + static constexpr auto kMaxPlanes = SkYUVAPixmapInfo::kMaxPlanes; + + static SkColorType RecommendedRGBAColorType(DataType); + + /** Allocate space for pixmaps' pixels in the SkYUVAPixmaps. */ + static SkYUVAPixmaps Allocate(const SkYUVAPixmapInfo& yuvaPixmapInfo); + + /** + * Use storage in SkData as backing store for pixmaps' pixels. SkData is retained by the + * SkYUVAPixmaps. + */ + static SkYUVAPixmaps FromData(const SkYUVAPixmapInfo&, sk_sp<SkData>); + + /** + * Makes a deep copy of the src SkYUVAPixmaps. The returned SkYUVAPixmaps owns its planes' + * backing stores. + */ + static SkYUVAPixmaps MakeCopy(const SkYUVAPixmaps& src); + + /** + * Use passed in memory as backing store for pixmaps' pixels. Caller must ensure memory remains + * allocated while pixmaps are in use. There must be at least + * SkYUVAPixmapInfo::computeTotalBytes() allocated starting at memory. + */ + static SkYUVAPixmaps FromExternalMemory(const SkYUVAPixmapInfo&, void* memory); + + /** + * Wraps existing SkPixmaps. The SkYUVAPixmaps will have no ownership of the SkPixmaps' pixel + * memory so the caller must ensure it remains valid. Will return an invalid SkYUVAPixmaps if + * the SkYUVAInfo isn't compatible with the SkPixmap array (number of planes, plane dimensions, + * sufficient color channels in planes, ...). + */ + static SkYUVAPixmaps FromExternalPixmaps(const SkYUVAInfo&, const SkPixmap[kMaxPlanes]); + + /** Default SkYUVAPixmaps is invalid. */ + SkYUVAPixmaps() = default; + ~SkYUVAPixmaps() = default; + + SkYUVAPixmaps(SkYUVAPixmaps&& that) = default; + SkYUVAPixmaps& operator=(SkYUVAPixmaps&& that) = default; + SkYUVAPixmaps(const SkYUVAPixmaps&) = default; + SkYUVAPixmaps& operator=(const SkYUVAPixmaps& that) = default; + + /** Does have initialized pixmaps compatible with its SkYUVAInfo. */ + bool isValid() const { return !fYUVAInfo.dimensions().isEmpty(); } + + const SkYUVAInfo& yuvaInfo() const { return fYUVAInfo; } + + DataType dataType() const { return fDataType; } + + SkYUVAPixmapInfo pixmapsInfo() const; + + /** Number of pixmap planes or 0 if this SkYUVAPixmaps is invalid. */ + int numPlanes() const { return this->isValid() ? fYUVAInfo.numPlanes() : 0; } + + /** + * Access the SkPixmap planes. They are default initialized if this is not a valid + * SkYUVAPixmaps. + */ + const std::array<SkPixmap, kMaxPlanes>& planes() const { return fPlanes; } + + /** + * Get the ith SkPixmap plane. SkPixmap will be default initialized if i >= numPlanes or this + * SkYUVAPixmaps is invalid. + */ + const SkPixmap& plane(int i) const { return fPlanes[SkToSizeT(i)]; } + + /** + * Computes a YUVALocations representation of the planar layout. The result is guaranteed to be + * valid if this->isValid(). + */ + SkYUVAInfo::YUVALocations toYUVALocations() const; + + /** Does this SkPixmaps own the backing store of the planes? */ + bool ownsStorage() const { return SkToBool(fData); } + +private: + SkYUVAPixmaps(const SkYUVAPixmapInfo&, sk_sp<SkData>); + SkYUVAPixmaps(const SkYUVAInfo&, DataType, const SkPixmap[kMaxPlanes]); + + std::array<SkPixmap, kMaxPlanes> fPlanes = {}; + sk_sp<SkData> fData; + SkYUVAInfo fYUVAInfo; + DataType fDataType; +}; + +////////////////////////////////////////////////////////////////////////////// + +constexpr SkYUVAPixmapInfo::SupportedDataTypes SkYUVAPixmapInfo::SupportedDataTypes::All() { + using ULL = unsigned long long; // bitset cons. takes this. + ULL bits = 0; + for (ULL c = 1; c <= 4; ++c) { + for (ULL dt = 0; dt <= ULL(kDataTypeCnt); ++dt) { + if (DefaultColorTypeForDataType(static_cast<DataType>(dt), + static_cast<int>(c)) != kUnknown_SkColorType) { + bits |= ULL(1) << (dt + static_cast<ULL>(kDataTypeCnt)*(c - 1)); + } + } + } + SupportedDataTypes combinations; + combinations.fDataTypeSupport = bits; + return combinations; +} + +constexpr bool SkYUVAPixmapInfo::SupportedDataTypes::supported(PlaneConfig config, + DataType type) const { + int n = SkYUVAInfo::NumPlanes(config); + for (int i = 0; i < n; ++i) { + auto c = static_cast<size_t>(SkYUVAInfo::NumChannelsInPlane(config, i)); + SkASSERT(c >= 1 && c <= 4); + if (!fDataTypeSupport[static_cast<size_t>(type) + + (c - 1)*static_cast<size_t>(kDataTypeCnt)]) { + return false; + } + } + return true; +} + +constexpr SkColorType SkYUVAPixmapInfo::DefaultColorTypeForDataType(DataType dataType, + int numChannels) { + switch (numChannels) { + case 1: + switch (dataType) { + case DataType::kUnorm8: return kGray_8_SkColorType; + case DataType::kUnorm16: return kA16_unorm_SkColorType; + case DataType::kFloat16: return kA16_float_SkColorType; + case DataType::kUnorm10_Unorm2: return kUnknown_SkColorType; + } + break; + case 2: + switch (dataType) { + case DataType::kUnorm8: return kR8G8_unorm_SkColorType; + case DataType::kUnorm16: return kR16G16_unorm_SkColorType; + case DataType::kFloat16: return kR16G16_float_SkColorType; + case DataType::kUnorm10_Unorm2: return kUnknown_SkColorType; + } + break; + case 3: + // None of these are tightly packed. The intended use case is for interleaved YUVA + // planes where we're forcing opaqueness by ignoring the alpha values. + // There are "x" rather than "A" variants for Unorm8 and Unorm10_Unorm2 but we don't + // choose them because 1) there is no inherent advantage and 2) there is better support + // in the GPU backend for the "A" versions. + switch (dataType) { + case DataType::kUnorm8: return kRGBA_8888_SkColorType; + case DataType::kUnorm16: return kR16G16B16A16_unorm_SkColorType; + case DataType::kFloat16: return kRGBA_F16_SkColorType; + case DataType::kUnorm10_Unorm2: return kRGBA_1010102_SkColorType; + } + break; + case 4: + switch (dataType) { + case DataType::kUnorm8: return kRGBA_8888_SkColorType; + case DataType::kUnorm16: return kR16G16B16A16_unorm_SkColorType; + case DataType::kFloat16: return kRGBA_F16_SkColorType; + case DataType::kUnorm10_Unorm2: return kRGBA_1010102_SkColorType; + } + break; + } + return kUnknown_SkColorType; +} + +#endif |